DE2625257A1 - Verfahren zur vernetzung von proteinen und nach dem verfahren hergestellte produkte - Google Patents
Verfahren zur vernetzung von proteinen und nach dem verfahren hergestellte produkteInfo
- Publication number
- DE2625257A1 DE2625257A1 DE19762625257 DE2625257A DE2625257A1 DE 2625257 A1 DE2625257 A1 DE 2625257A1 DE 19762625257 DE19762625257 DE 19762625257 DE 2625257 A DE2625257 A DE 2625257A DE 2625257 A1 DE2625257 A1 DE 2625257A1
- Authority
- DE
- Germany
- Prior art keywords
- poly
- radical
- ethylene oxide
- acid
- crosslinking agent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 238000000034 method Methods 0.000 title claims description 50
- 102000004169 proteins and genes Human genes 0.000 title claims description 33
- 108090000623 proteins and genes Proteins 0.000 title claims description 33
- 230000008569 process Effects 0.000 title claims description 13
- 230000006855 networking Effects 0.000 title description 3
- 239000012528 membrane Substances 0.000 claims description 52
- 229920003171 Poly (ethylene oxide) Polymers 0.000 claims description 49
- -1 isocyanato, isothiocyanato Chemical group 0.000 claims description 45
- 102000004190 Enzymes Human genes 0.000 claims description 43
- 108090000790 Enzymes Proteins 0.000 claims description 42
- 239000003431 cross linking reagent Substances 0.000 claims description 39
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 35
- 150000002148 esters Chemical class 0.000 claims description 27
- 238000004132 cross linking Methods 0.000 claims description 22
- 239000002245 particle Substances 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 16
- 229910052736 halogen Inorganic materials 0.000 claims description 13
- 150000002367 halogens Chemical class 0.000 claims description 13
- QEVGZEDELICMKH-UHFFFAOYSA-L 2-(carboxylatomethoxy)acetate Chemical compound [O-]C(=O)COCC([O-])=O QEVGZEDELICMKH-UHFFFAOYSA-L 0.000 claims description 12
- 125000003118 aryl group Chemical group 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical class C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 9
- 239000011148 porous material Substances 0.000 claims description 9
- 150000003254 radicals Chemical class 0.000 claims description 8
- 125000001989 1,3-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([H])C([*:2])=C1[H] 0.000 claims description 7
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 claims description 7
- 239000005725 8-Hydroxyquinoline Substances 0.000 claims description 7
- 229960003540 oxyquinoline Drugs 0.000 claims description 7
- WHMDPDGBKYUEMW-UHFFFAOYSA-N pyridine-2-thiol Chemical compound SC1=CC=CC=N1 WHMDPDGBKYUEMW-UHFFFAOYSA-N 0.000 claims description 7
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 claims description 6
- FHTDDANQIMVWKZ-UHFFFAOYSA-N 1h-pyridine-4-thione Chemical compound SC1=CC=NC=C1 FHTDDANQIMVWKZ-UHFFFAOYSA-N 0.000 claims description 6
- 150000007513 acids Chemical class 0.000 claims description 6
- 150000001298 alcohols Chemical class 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 108010010803 Gelatin Proteins 0.000 claims description 5
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 claims description 5
- 230000002378 acidificating effect Effects 0.000 claims description 5
- 229920000159 gelatin Polymers 0.000 claims description 5
- 239000008273 gelatin Substances 0.000 claims description 5
- 235000019322 gelatine Nutrition 0.000 claims description 5
- 235000011852 gelatine desserts Nutrition 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- IPHDQSNAYMVQCP-UHFFFAOYSA-N 2,6-dichloro-1h-triazine Chemical compound ClN1NC(Cl)=CC=N1 IPHDQSNAYMVQCP-UHFFFAOYSA-N 0.000 claims description 4
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 claims description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 4
- 150000001266 acyl halides Chemical class 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 4
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 claims description 3
- 102000004157 Hydrolases Human genes 0.000 claims description 3
- 108090000604 Hydrolases Proteins 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 3
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 claims description 2
- DAHDXYYBZVAEMV-UHFFFAOYSA-N 2,2,3-trimethoxypentanedioic acid Chemical compound OC(=O)CC(OC)C(OC)(OC)C(O)=O DAHDXYYBZVAEMV-UHFFFAOYSA-N 0.000 claims description 2
- UFBJCMHMOXMLKC-UHFFFAOYSA-N 2,4-dinitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O UFBJCMHMOXMLKC-UHFFFAOYSA-N 0.000 claims description 2
- IQUPABOKLQSFBK-UHFFFAOYSA-N 2-nitrophenol Chemical compound OC1=CC=CC=C1[N+]([O-])=O IQUPABOKLQSFBK-UHFFFAOYSA-N 0.000 claims description 2
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 claims description 2
- 108090000769 Isomerases Proteins 0.000 claims description 2
- 102000004195 Isomerases Human genes 0.000 claims description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical class OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 2
- 102000004316 Oxidoreductases Human genes 0.000 claims description 2
- 108090000854 Oxidoreductases Proteins 0.000 claims description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 claims description 2
- 125000003158 alcohol group Chemical group 0.000 claims description 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims description 2
- 239000012876 carrier material Substances 0.000 claims description 2
- 235000015165 citric acid Nutrition 0.000 claims description 2
- 229960001270 d- tartaric acid Drugs 0.000 claims description 2
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 2
- OHCXVBBPKJAIBJ-UHFFFAOYSA-N hydroxysulfonothioyl hydrogen carbonate Chemical compound OC(=O)OS(O)(=O)=S OHCXVBBPKJAIBJ-UHFFFAOYSA-N 0.000 claims description 2
- 239000001630 malic acid Substances 0.000 claims description 2
- 235000011090 malic acid Nutrition 0.000 claims description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 2
- ORTFAQDWJHRMNX-UHFFFAOYSA-M oxidooxomethyl Chemical compound [O-][C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-M 0.000 claims description 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 2
- 239000011975 tartaric acid Substances 0.000 claims description 2
- 229960001367 tartaric acid Drugs 0.000 claims description 2
- 235000002906 tartaric acid Nutrition 0.000 claims description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 claims 2
- IHDBZCJYSHDCKF-UHFFFAOYSA-N 4,6-dichlorotriazine Chemical compound ClC1=CC(Cl)=NN=N1 IHDBZCJYSHDCKF-UHFFFAOYSA-N 0.000 claims 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims 1
- KPOYAEAEGZSOAJ-UHFFFAOYSA-N [O-][N+](S(=O)=S(O)(OC(O)=O)=O)=O Chemical compound [O-][N+](S(=O)=S(O)(OC(O)=O)=O)=O KPOYAEAEGZSOAJ-UHFFFAOYSA-N 0.000 claims 1
- 125000005907 alkyl ester group Chemical group 0.000 claims 1
- HZVOZRGWRWCICA-UHFFFAOYSA-N methanediyl Chemical compound [CH2] HZVOZRGWRWCICA-UHFFFAOYSA-N 0.000 claims 1
- 238000012856 packing Methods 0.000 claims 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims 1
- 229960002317 succinimide Drugs 0.000 claims 1
- 125000004149 thio group Chemical group *S* 0.000 claims 1
- 239000000243 solution Substances 0.000 description 51
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 45
- 229940088598 enzyme Drugs 0.000 description 38
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 28
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 27
- 150000001875 compounds Chemical class 0.000 description 25
- 239000000047 product Substances 0.000 description 22
- 235000018102 proteins Nutrition 0.000 description 20
- 230000002255 enzymatic effect Effects 0.000 description 15
- 239000008363 phosphate buffer Substances 0.000 description 13
- 239000000203 mixture Substances 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 10
- 108090000317 Chymotrypsin Proteins 0.000 description 9
- 239000000872 buffer Substances 0.000 description 9
- 239000003153 chemical reaction reagent Substances 0.000 description 9
- 229960002376 chymotrypsin Drugs 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- 239000000758 substrate Substances 0.000 description 8
- 238000005406 washing Methods 0.000 description 8
- SXRSQZLOMIGNAQ-UHFFFAOYSA-N Glutaraldehyde Chemical compound O=CCCCC=O SXRSQZLOMIGNAQ-UHFFFAOYSA-N 0.000 description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- 108010024976 Asparaginase Proteins 0.000 description 5
- 102000015790 Asparaginase Human genes 0.000 description 5
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 5
- 229960003272 asparaginase Drugs 0.000 description 5
- DCXYFEDJOCDNAF-UHFFFAOYSA-M asparaginate Chemical compound [O-]C(=O)C(N)CC(N)=O DCXYFEDJOCDNAF-UHFFFAOYSA-M 0.000 description 5
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- CXMXRPHRNRROMY-UHFFFAOYSA-L sebacate(2-) Chemical compound [O-]C(=O)CCCCCCCCC([O-])=O CXMXRPHRNRROMY-UHFFFAOYSA-L 0.000 description 5
- 108010088751 Albumins Proteins 0.000 description 4
- 102000009027 Albumins Human genes 0.000 description 4
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 108090000631 Trypsin Proteins 0.000 description 4
- 102000004142 Trypsin Human genes 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 230000008901 benefit Effects 0.000 description 4
- 150000001735 carboxylic acids Chemical class 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- 239000012588 trypsin Substances 0.000 description 4
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 3
- 108010093096 Immobilized Enzymes Proteins 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 108010046334 Urease Proteins 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000006911 enzymatic reaction Methods 0.000 description 3
- 230000002779 inactivation Effects 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 2
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 2
- XMIIGOLPHOKFCH-UHFFFAOYSA-N 3-phenylpropionic acid Chemical compound OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- DCXYFEDJOCDNAF-UHFFFAOYSA-N Asparagine Natural products OC(=O)C(N)CC(N)=O DCXYFEDJOCDNAF-UHFFFAOYSA-N 0.000 description 2
- 102000016938 Catalase Human genes 0.000 description 2
- 108010053835 Catalase Proteins 0.000 description 2
- DCXYFEDJOCDNAF-REOHCLBHSA-N L-asparagine Chemical compound OC(=O)[C@@H](N)CC(N)=O DCXYFEDJOCDNAF-REOHCLBHSA-N 0.000 description 2
- 229920002684 Sepharose Polymers 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000001412 amines Chemical group 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 235000009582 asparagine Nutrition 0.000 description 2
- 229960001230 asparagine Drugs 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 229940125532 enzyme inhibitor Drugs 0.000 description 2
- 239000002532 enzyme inhibitor Substances 0.000 description 2
- SRLROPAFMUDDRC-INIZCTEOSA-N ethyl N-benzoyl-L-tyrosinate Chemical compound C([C@@H](C(=O)OCC)NC(=O)C=1C=CC=CC=1)C1=CC=C(O)C=C1 SRLROPAFMUDDRC-INIZCTEOSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000012286 potassium permanganate Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 238000000108 ultra-filtration Methods 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- FMCAFXHLMUOIGG-IWFBPKFRSA-N (2s)-2-[[(2s)-2-[[(2s)-2-[[(2r)-2-formamido-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxy-2,5-dimethylphenyl)propanoyl]amino]-4-methylsulfanylbutanoic acid Chemical compound O=CN[C@@H](CS)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(O)=O)CC1=CC(C)=C(O)C=C1C FMCAFXHLMUOIGG-IWFBPKFRSA-N 0.000 description 1
- MZFQOHXANVOIFU-UHFFFAOYSA-N (5-isocyanato-2-methylphenyl) carbamate Chemical compound C(N)(OC1=C(C=CC(=C1)N=C=O)C)=O MZFQOHXANVOIFU-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- ULOIAOPTGWSNHU-UHFFFAOYSA-N 2-butyl radical Chemical compound C[CH]CC ULOIAOPTGWSNHU-UHFFFAOYSA-N 0.000 description 1
- RZRAKAPVDKRJKW-UHFFFAOYSA-N 2-isothiocyanatobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1N=C=S RZRAKAPVDKRJKW-UHFFFAOYSA-N 0.000 description 1
- GTWJUDXIBMRDNK-UHFFFAOYSA-N 2-methoxybutanedioic acid Chemical compound COC(C(O)=O)CC(O)=O GTWJUDXIBMRDNK-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical group NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 102000003670 Carboxypeptidase B Human genes 0.000 description 1
- 108090000087 Carboxypeptidase B Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 108010073178 Glucan 1,4-alpha-Glucosidase Proteins 0.000 description 1
- 102100022624 Glucoamylase Human genes 0.000 description 1
- 239000004366 Glucose oxidase Substances 0.000 description 1
- 108010015776 Glucose oxidase Proteins 0.000 description 1
- 108010058683 Immobilized Proteins Proteins 0.000 description 1
- 102000003960 Ligases Human genes 0.000 description 1
- 108090000364 Ligases Proteins 0.000 description 1
- 102000004317 Lyases Human genes 0.000 description 1
- 108090000856 Lyases Proteins 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 102000004357 Transferases Human genes 0.000 description 1
- 108090000992 Transferases Proteins 0.000 description 1
- 108700040099 Xylose isomerases Proteins 0.000 description 1
- OCBFFGCSTGGPSQ-UHFFFAOYSA-N [CH2]CC Chemical compound [CH2]CC OCBFFGCSTGGPSQ-UHFFFAOYSA-N 0.000 description 1
- 150000001371 alpha-amino acids Chemical class 0.000 description 1
- 235000008206 alpha-amino acids Nutrition 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000005915 ammonolysis reaction Methods 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- 238000004925 denaturation Methods 0.000 description 1
- 230000036425 denaturation Effects 0.000 description 1
- FHIVAFMUCKRCQO-UHFFFAOYSA-N diazinon Chemical compound CCOP(=S)(OCC)OC1=CC(C)=NC(C(C)C)=N1 FHIVAFMUCKRCQO-UHFFFAOYSA-N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 125000005442 diisocyanate group Chemical group 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 229940116332 glucose oxidase Drugs 0.000 description 1
- 235000019420 glucose oxidase Nutrition 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000012982 microporous membrane Substances 0.000 description 1
- GFFRQCYOONZQMW-UCGGBYDDSA-N n-[(2s)-1-[[(5s)-5-[(3-amino-4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-naphthalen-1-yl-1-oxopropan-2-yl]morpholine-4-carboxamide Chemical compound N([C@@H](CC=1C2=CC=CC=C2C=CC=1)C(=O)NCCCC[C@@H](CO)N(CC(C)C)S(=O)(=O)C=1C=C(N)C(F)=CC=1)C(=O)N1CCOCC1 GFFRQCYOONZQMW-UCGGBYDDSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000001209 o-nitrophenyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])[N+]([O-])=O 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000004043 oxo group Chemical group O=* 0.000 description 1
- 239000011049 pearl Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 239000008237 rinsing water Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229940116351 sebacate Drugs 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- FDRCDNZGSXJAFP-UHFFFAOYSA-M sodium chloroacetate Chemical compound [Na+].[O-]C(=O)CCl FDRCDNZGSXJAFP-UHFFFAOYSA-M 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- DIORMHZUUKOISG-UHFFFAOYSA-N sulfoformic acid Chemical compound OC(=O)S(O)(=O)=O DIORMHZUUKOISG-UHFFFAOYSA-N 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08H—DERIVATIVES OF NATURAL MACROMOLECULAR COMPOUNDS
- C08H1/00—Macromolecular products derived from proteins
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S530/00—Chemistry: natural resins or derivatives; peptides or proteins; lignins or reaction products thereof
- Y10S530/81—Carrier - bound or immobilized peptides or proteins and the preparation thereof, e.g. biological cell or cell fragment as carrier
- Y10S530/812—Peptides or proteins is immobilized on, or in, an organic carrier
- Y10S530/815—Carrier is a synthetic polymer
- Y10S530/816—Attached to the carrier via a bridging agent
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Biochemistry (AREA)
- Materials Engineering (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyethers (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IL47468A IL47468A (en) | 1975-06-12 | 1975-06-12 | Process for the cross-linking of proteins using water soluble cross-linking agents |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2625257A1 true DE2625257A1 (de) | 1976-12-30 |
Family
ID=11048277
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762625257 Ceased DE2625257A1 (de) | 1975-06-12 | 1976-06-04 | Verfahren zur vernetzung von proteinen und nach dem verfahren hergestellte produkte |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4101380A (enExample) |
| CH (1) | CH601388A5 (enExample) |
| DE (1) | DE2625257A1 (enExample) |
| IL (1) | IL47468A (enExample) |
Families Citing this family (91)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1107772B (it) * | 1977-08-22 | 1985-11-25 | Cancer Res Inst Royal | Procedimento per la produzione di complessi macromolecolari prodotto ottenuto e composizioni farmaceutiche che lo contengono come ingrediente attivo |
| EP0082798B2 (de) * | 1981-12-21 | 1991-11-27 | Ciba-Geigy Ag | Verfahren zur Desinfektion und Reinigung von Kontaktlinsen |
| US4839345A (en) * | 1985-03-09 | 1989-06-13 | Nippon Oil And Fats Co., Ltd. | Hydrated adhesive gel and method for preparing the same |
| US5268307A (en) * | 1986-05-15 | 1993-12-07 | E. I. Du Pont De Nemours And Company | Preparation of liquid affinity supports for bioaffinity an ion exchange separations |
| US5306615A (en) * | 1986-05-15 | 1994-04-26 | E. I. Du Pont De Nemours And Company | Immunoassays and nucleic acid assays with liquid exchange supports |
| US5268456A (en) * | 1986-05-15 | 1993-12-07 | E. I. Du Pont De Nemours And Company | Bioaffinity and ion exchange separations with liquid exchange supports |
| US4810638A (en) * | 1986-07-24 | 1989-03-07 | Miles Inc. | Enzyme-labeled antibody reagent with polyalkyleneglycol linking group |
| US6007817A (en) | 1988-10-11 | 1999-12-28 | University Of Southern California | Vasopermeability enhancing immunoconjugates |
| US5238831A (en) * | 1989-04-28 | 1993-08-24 | Gist-Brocades | Stabilization of carboxyl esterase |
| KR100204837B1 (ko) * | 1989-04-28 | 1999-06-15 | 기스트 브로카데스 나암로제 베노오트하프 | 카르복실 에스테라제의 안정화 |
| US5240747A (en) * | 1989-05-11 | 1993-08-31 | Kanegafuchi Kagaku Kogyo Kabushiki Kaisha | Process for modifying surfaces of materials |
| US5252714A (en) * | 1990-11-28 | 1993-10-12 | The University Of Alabama In Huntsville | Preparation and use of polyethylene glycol propionaldehyde |
| US5416191A (en) * | 1991-04-01 | 1995-05-16 | Cortech, Inc. | Bradykinin antagonists |
| EP0586613A4 (en) * | 1991-04-01 | 1994-08-24 | Cortech Inc | Bradykinin antagonists |
| US5547981A (en) * | 1993-03-09 | 1996-08-20 | Enzon, Inc. | Taxol-7-carbazates |
| DE69423522T2 (de) * | 1993-04-27 | 2000-09-21 | Cytotherapeutics, Inc. | Membran aus einem acrylnitrilpolymer |
| WO1995000162A1 (en) * | 1993-06-21 | 1995-01-05 | Enzon, Inc. | Site specific synthesis of conjugated peptides |
| US5622986A (en) * | 1993-10-20 | 1997-04-22 | Enzon, Inc. | 2'-and/or 7-substituted taxanes |
| US5965566A (en) * | 1993-10-20 | 1999-10-12 | Enzon, Inc. | High molecular weight polymer-based prodrugs |
| US5880131A (en) * | 1993-10-20 | 1999-03-09 | Enzon, Inc. | High molecular weight polymer-based prodrugs |
| US5605976A (en) * | 1995-05-15 | 1997-02-25 | Enzon, Inc. | Method of preparing polyalkylene oxide carboxylic acids |
| US5643575A (en) * | 1993-10-27 | 1997-07-01 | Enzon, Inc. | Non-antigenic branched polymer conjugates |
| US5919455A (en) * | 1993-10-27 | 1999-07-06 | Enzon, Inc. | Non-antigenic branched polymer conjugates |
| US5446090A (en) * | 1993-11-12 | 1995-08-29 | Shearwater Polymers, Inc. | Isolatable, water soluble, and hydrolytically stable active sulfones of poly(ethylene glycol) and related polymers for modification of surfaces and molecules |
| EP0705298B1 (en) * | 1993-12-01 | 2002-03-27 | Bioartificial Gel Technologies Inc. | Albumin based hydrogel |
| US5730990A (en) * | 1994-06-24 | 1998-03-24 | Enzon, Inc. | Non-antigenic amine derived polymers and polymer conjugates |
| US5583114A (en) | 1994-07-27 | 1996-12-10 | Minnesota Mining And Manufacturing Company | Adhesive sealant composition |
| USRE38827E1 (en) | 1994-07-27 | 2005-10-11 | 3M Innovative Properties Company | Adhesive sealant composition |
| US5863984A (en) * | 1995-12-01 | 1999-01-26 | Universite Laval, Cite Universitaire | Biostable porous material comprising composite biopolymers |
| US6833408B2 (en) * | 1995-12-18 | 2004-12-21 | Cohesion Technologies, Inc. | Methods for tissue repair using adhesive materials |
| US7883693B2 (en) * | 1995-12-18 | 2011-02-08 | Angiodevice International Gmbh | Compositions and systems for forming crosslinked biomaterials and methods of preparation of use |
| US6458889B1 (en) | 1995-12-18 | 2002-10-01 | Cohesion Technologies, Inc. | Compositions and systems for forming crosslinked biomaterials and associated methods of preparation and use |
| EP1704878B1 (en) * | 1995-12-18 | 2013-04-10 | AngioDevice International GmbH | Crosslinked polymer compositions and methods for their use |
| US8003705B2 (en) * | 1996-09-23 | 2011-08-23 | Incept Llc | Biocompatible hydrogels made with small molecule precursors |
| WO1998012274A1 (en) * | 1996-09-23 | 1998-03-26 | Chandrashekar Pathak | Methods and devices for preparing protein concentrates |
| US20090324721A1 (en) * | 1996-09-23 | 2009-12-31 | Jack Kennedy | Hydrogels Suitable For Use In Polyp Removal |
| US6743248B2 (en) | 1996-12-18 | 2004-06-01 | Neomend, Inc. | Pretreatment method for enhancing tissue adhesion |
| US20040176801A1 (en) * | 1997-03-12 | 2004-09-09 | Neomend, Inc. | Pretreatment method for enhancing tissue adhesion |
| US6371975B2 (en) | 1998-11-06 | 2002-04-16 | Neomend, Inc. | Compositions, systems, and methods for creating in situ, chemically cross-linked, mechanical barriers |
| US20030191496A1 (en) * | 1997-03-12 | 2003-10-09 | Neomend, Inc. | Vascular sealing device with microwave antenna |
| US6514534B1 (en) * | 1998-08-14 | 2003-02-04 | Incept Llc | Methods for forming regional tissue adherent barriers and drug delivery systems |
| US6632457B1 (en) | 1998-08-14 | 2003-10-14 | Incept Llc | Composite hydrogel drug delivery systems |
| US6818018B1 (en) | 1998-08-14 | 2004-11-16 | Incept Llc | In situ polymerizable hydrogels |
| US6500571B2 (en) | 1998-08-19 | 2002-12-31 | Powerzyme, Inc. | Enzymatic fuel cell |
| US6994686B2 (en) | 1998-08-26 | 2006-02-07 | Neomend, Inc. | Systems for applying cross-linked mechanical barriers |
| US6458147B1 (en) | 1998-11-06 | 2002-10-01 | Neomend, Inc. | Compositions, systems, and methods for arresting or controlling bleeding or fluid leakage in body tissue |
| AU762616B2 (en) | 1998-10-16 | 2003-07-03 | Biogen Ma Inc. | Polymer conjugates of interferon beta-1a and uses |
| US6949114B2 (en) | 1998-11-06 | 2005-09-27 | Neomend, Inc. | Systems, methods, and compositions for achieving closure of vascular puncture sites |
| US6830756B2 (en) * | 1998-11-06 | 2004-12-14 | Neomend, Inc. | Systems, methods, and compositions for achieving closure of vascular puncture sites |
| US6899889B1 (en) | 1998-11-06 | 2005-05-31 | Neomend, Inc. | Biocompatible material composition adaptable to diverse therapeutic indications |
| US7279001B2 (en) * | 1998-11-06 | 2007-10-09 | Neomend, Inc. | Systems, methods, and compositions for achieving closure of vascular puncture sites |
| US20080114092A1 (en) * | 1998-12-04 | 2008-05-15 | Incept Llc | Adhesion barriers applicable by minimally invasive surgery and methods of use thereof |
| AU2707500A (en) | 1998-12-04 | 2000-06-26 | Incept Llc | Biocompatible crosslinked polymers |
| DE60043308D1 (de) | 1999-12-16 | 2009-12-24 | Biogen Idec Inc | Verfahren zur behandlung der schädigung des zentralnervensystems durch ischämie oder durch hämorrhagie mit antagonisten von alpha4 integrin |
| EP1257257B1 (en) | 2000-02-17 | 2018-10-31 | Neomend, Inc. | Method for producing delivery systems using preformed biodegradable polymer compositions |
| ES2270998T3 (es) * | 2000-04-04 | 2007-04-16 | Bioartificial Gel Technologies Inc. | Procedimiento para la preparacion de hidrogeles a base de proteinas. |
| JP2003535165A (ja) * | 2000-05-30 | 2003-11-25 | ビリディス バイオテック インコーポレイテッド | ポリユビキチン系ヒドロゲルとその用途 |
| US7037895B2 (en) * | 2001-03-27 | 2006-05-02 | Medical College Of Ohio | Albumin-based colloid composition and method of use in treating hypovolemia and multiorgan dysfunction |
| US7605130B2 (en) * | 2002-03-26 | 2009-10-20 | Medical College Of Ohio | Albumin-based colloid composition and method of use in treating hypovolemia and multiorgan dysfunction |
| EP1419191B1 (en) | 2001-08-22 | 2007-10-17 | Bioartificial Gel Technologies Inc. | Process for the preparation of activated polyethylene glycols |
| US20030138975A1 (en) * | 2001-12-20 | 2003-07-24 | Kimberly-Clark Worldwide, Inc. | Diagnostic signal amplification with proteinoid microspheres |
| US7056535B2 (en) * | 2001-12-20 | 2006-06-06 | Kimberly-Clark Worldwide, Inc. | Triggered release from proteinoid microspheres |
| AU2003216379A1 (en) * | 2002-02-22 | 2003-09-09 | Control Delivery Systems, Inc. | Method for treating otic disorders |
| US7884068B2 (en) * | 2002-03-26 | 2011-02-08 | Assaly Ragheb A | Albumin-based colloid composition having at least one protected thiol region, methods of making, and methods of use |
| US7345150B2 (en) * | 2002-03-26 | 2008-03-18 | Medical University Of Toledo | Albumin-based colloid composition having at least one protected thiol region, methods of making, and methods of use |
| JP5156890B2 (ja) * | 2002-09-11 | 2013-03-06 | 独立行政法人物質・材料研究機構 | 高分子架橋体及びその製造方法 |
| CA2511521C (en) | 2002-12-30 | 2012-02-07 | Angiotech International Ag | Drug delivery from rapid gelling polymer composition |
| CA2511486A1 (en) * | 2002-12-30 | 2004-07-22 | Angiotech International Ag | Tissue reactive compounds and compositions and uses thereof |
| US7351787B2 (en) * | 2004-03-05 | 2008-04-01 | Bioartificial Gel Technologies, Inc. | Process for the preparation of activated polyethylene glycols |
| US8067031B2 (en) | 2004-04-28 | 2011-11-29 | Angiodevice International Gmbh | Compositions and systems for forming crosslinked biomaterials and associated methods of preparation and use |
| JPWO2006016600A1 (ja) * | 2004-08-10 | 2008-07-31 | 独立行政法人物質・材料研究機構 | 酒石酸誘導体及び該誘導体により合成された高分子架橋体 |
| WO2006034128A2 (en) | 2004-09-17 | 2006-03-30 | Angiotech Biomaterials Corporation | Multifunctional compounds for forming crosslinked biomaterials and methods of preparation and use |
| EP1846505B1 (en) * | 2005-02-09 | 2015-11-11 | Covidien LP | Synthetic sealants |
| US20060246524A1 (en) * | 2005-04-28 | 2006-11-02 | Christina Bauer | Nanoparticle conjugates |
| AU2006239315B2 (en) | 2005-04-28 | 2012-03-01 | Ventana Medical Systems, Inc. | Enzymes conjugated to antiobodies via a PEG heterobifuctional linker |
| EP3095467B1 (en) * | 2005-11-23 | 2020-05-06 | Ventana Medical Systems, Inc. | Antibody-enzyme conjugate |
| US20090227981A1 (en) * | 2007-03-05 | 2009-09-10 | Bennett Steven L | Low-Swelling Biocompatible Hydrogels |
| US20090227689A1 (en) * | 2007-03-05 | 2009-09-10 | Bennett Steven L | Low-Swelling Biocompatible Hydrogels |
| US20080287633A1 (en) * | 2007-05-18 | 2008-11-20 | Drumheller Paul D | Hydrogel Materials |
| US8067028B2 (en) * | 2007-08-13 | 2011-11-29 | Confluent Surgical Inc. | Drug delivery device |
| US20100119605A1 (en) * | 2008-11-12 | 2010-05-13 | Isenburg Jason C | Compositions for tissue stabilization |
| EP2396070B1 (en) | 2009-02-12 | 2024-12-04 | Incept Llc | Drug delivery through hydrogel plugs |
| US20100256671A1 (en) * | 2009-04-07 | 2010-10-07 | Biomedica Management Corporation | Tissue sealant for use in noncompressible hemorrhage |
| EP2485687A1 (en) * | 2009-10-09 | 2012-08-15 | Vatrix Medical, Inc. | In vivo chemical stabilization of vulnerable plaque |
| US10226417B2 (en) | 2011-09-16 | 2019-03-12 | Peter Jarrett | Drug delivery systems and applications |
| KR20140130705A (ko) | 2012-02-29 | 2014-11-11 | 도레이 카부시키가이샤 | 체강액 저류 억제제 |
| AU2020308865A1 (en) | 2019-06-26 | 2022-02-17 | Davol Inc. | Reactive dry powdered hemostatic materials comprising a nucleophile and a multifunctional modified polyethylene glycol based crosslinking agent |
| EP4121131A1 (en) | 2020-03-20 | 2023-01-25 | Bard Peripheral Vascular, Inc. | Reactive hydrogel forming formulations and related methods |
| US11739166B2 (en) | 2020-07-02 | 2023-08-29 | Davol Inc. | Reactive polysaccharide-based hemostatic agent |
| US12161777B2 (en) | 2020-07-02 | 2024-12-10 | Davol Inc. | Flowable hemostatic suspension |
| CN116744984A (zh) | 2020-12-28 | 2023-09-12 | 达沃有限公司 | 包含蛋白质和多官能化改性的基于聚乙二醇的交联剂的反应性干粉状止血材料 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3796634A (en) * | 1970-03-19 | 1974-03-12 | Us Health Education & Welfare | Insolubilized biologically active enzymes |
| US4009267A (en) * | 1975-09-09 | 1977-02-22 | Diagnostic Data, Inc. | Cross-linked orgotein |
-
1975
- 1975-06-12 IL IL47468A patent/IL47468A/xx unknown
-
1976
- 1976-06-04 DE DE19762625257 patent/DE2625257A1/de not_active Ceased
- 1976-06-11 US US05/695,030 patent/US4101380A/en not_active Expired - Lifetime
- 1976-06-11 CH CH742976A patent/CH601388A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IL47468A0 (en) | 1975-08-31 |
| IL47468A (en) | 1979-05-31 |
| CH601388A5 (enExample) | 1978-07-14 |
| US4101380A (en) | 1978-07-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2625257A1 (de) | Verfahren zur vernetzung von proteinen und nach dem verfahren hergestellte produkte | |
| DE1815332C3 (de) | Verfahren zur Bindung von Proteinen, Polypeptiden, Peptiden oder Derivaten derselben an in Wasser unlösliche Polymere mit einer oder mehreren Hydroxyl- oder primären oder sekundären Aminogruppen | |
| DE2905671C2 (de) | Immobilisiertes Enzympräparat und Verfahren zu seiner Herstellung | |
| WO1995009194A1 (de) | Pyrrolidongruppenhaltige polyester und polyamide | |
| DE69425356T2 (de) | Pro-Prodrugs, ihre Herstellung und Anwendung | |
| DE2624002A1 (de) | Vrfahren zur verwendung eines enzyms zur umwandlung einer organischen substanz in mindestens eine andere organische substanz durch enzymatische reaktion | |
| EP0330106A1 (de) | Modifizierte Cellulose für biocompatible Dialysemembranen II und Verfahren zu deren Herstellung | |
| EP0330134A1 (de) | Modifizierte Cellulose für biocompatible Dialysemembranen IV und Verfahren zu deren Herstellung | |
| DE2910998A1 (de) | Verfahren zur herstellung von gebundenes enzym enthaltenden produkten und deren verwendung | |
| DE2322116A1 (de) | Substrat mit hoher empfindlichkeit fuer proteolytische enzyme vom typ der peptidpeptidohydrolasen | |
| DE2427948A1 (de) | Substituierte polyamide und verfahren zu deren herstellung | |
| DE19627302A1 (de) | Azlacton-derivatisierte Polyamide | |
| DE1792773C3 (de) | Rohrförmiger Formkörper aus einem unlöslichen Träger, der durchlässig oder undurchlässig ist, mit einem an den Träger über einen überbrückenden Rest chemisch gebundenem Enzym | |
| CH654016A5 (de) | Verfahren zur fixierung von biologisch aktivem protein oder von substrat von biologisch aktivem protein an polyamid. | |
| EP0339200A1 (de) | Modifizierte Cellulose für biocompatible Dialysemembranen III und Verfahren zu deren Herstellung | |
| DE1948273A1 (de) | Verfahren zur enzymatischen Verarbeitung eines Substrates mittels einer Enzym-Polymer-Verbindung | |
| DE2625255A1 (de) | Traegersubstanz fuer biologisch aktives material, verfahren zu deren herstellung und daraus hergestellte biologisch aktive matrix | |
| DE4429018C2 (de) | Verfahren zur Herstellung eines Enzyme immobilisierenden Trägers, Träger aus regeneriertem porösen Chitosan in Teilchenform und Verwendung des Trägers | |
| DE1642596A1 (de) | Feste Traegermaterialien mit darauf fixierten Enzymen und Verfahren zu ihrer Herstellung | |
| DE102013005184A1 (de) | Verfahren zur Funktionalisierung einer Oberfläche | |
| DE2930319A1 (de) | Diagnostische zusammensetzung, verfahren zu ihrer herstellung und ihre verwendung | |
| DD279486A1 (de) | Verfahren zur aktivierung von hydroxylgruppenhaltigen polymeren verbindungen | |
| CH618466A5 (enExample) | ||
| DE2833902A1 (de) | Isocyanoderivate von polymeren und verfahren zu ihrer herstellung | |
| DE2417265A1 (de) | Traegergebundene enzyme |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8131 | Rejection |