DE2602382C2 - Reihen-Parallel-Analog-Digital-Umsetzereinrichtung - Google Patents
Reihen-Parallel-Analog-Digital-UmsetzereinrichtungInfo
- Publication number
- DE2602382C2 DE2602382C2 DE2602382A DE2602382A DE2602382C2 DE 2602382 C2 DE2602382 C2 DE 2602382C2 DE 2602382 A DE2602382 A DE 2602382A DE 2602382 A DE2602382 A DE 2602382A DE 2602382 C2 DE2602382 C2 DE 2602382C2
- Authority
- DE
- Germany
- Prior art keywords
- signal
- converter
- analog
- digital
- level
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000005540 biological transmission Effects 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 11
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 238000010586 diagram Methods 0.000 description 6
- 238000010276 construction Methods 0.000 description 3
- 101150087426 Gnal gene Proteins 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- NPOJQCVWMSKXDN-UHFFFAOYSA-N Dacthal Chemical compound COC(=O)C1=C(Cl)C(Cl)=C(C(=O)OC)C(Cl)=C1Cl NPOJQCVWMSKXDN-UHFFFAOYSA-N 0.000 description 1
- 101100400378 Mus musculus Marveld2 gene Proteins 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 230000036316 preload Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03M—CODING; DECODING; CODE CONVERSION IN GENERAL
- H03M1/00—Analogue/digital conversion; Digital/analogue conversion
- H03M1/06—Continuously compensating for, or preventing, undesired influence of physical parameters
- H03M1/0602—Continuously compensating for, or preventing, undesired influence of physical parameters of deviations from the desired transfer characteristic
- H03M1/0604—Continuously compensating for, or preventing, undesired influence of physical parameters of deviations from the desired transfer characteristic at one point, i.e. by adjusting a single reference value, e.g. bias or gain error
- H03M1/0607—Offset or drift compensation
Landscapes
- Engineering & Computer Science (AREA)
- Theoretical Computer Science (AREA)
- Analogue/Digital Conversion (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP923875A JPS558052B2 (index.php) | 1975-01-23 | 1975-01-23 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2602382A1 DE2602382A1 (de) | 1976-07-29 |
| DE2602382C2 true DE2602382C2 (de) | 1983-01-20 |
Family
ID=11714811
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2602382A Expired DE2602382C2 (de) | 1975-01-23 | 1976-01-22 | Reihen-Parallel-Analog-Digital-Umsetzereinrichtung |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4122439A (index.php) |
| JP (1) | JPS558052B2 (index.php) |
| DE (1) | DE2602382C2 (index.php) |
| FR (1) | FR2298906A1 (index.php) |
| GB (1) | GB1536024A (index.php) |
| NL (1) | NL176729C (index.php) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS51128255A (en) * | 1975-05-01 | 1976-11-09 | Sony Corp | Analog-digital converter |
| JPS5784000U (index.php) * | 1980-11-11 | 1982-05-24 | ||
| JPS5871726A (ja) * | 1981-10-26 | 1983-04-28 | Nec Corp | アナログ−デジタル変換器 |
| JPS5875920A (ja) * | 1981-10-30 | 1983-05-07 | Sony Corp | A/dコンバ−タ回路 |
| DE3337041C1 (de) * | 1983-10-12 | 1985-04-18 | Krautkrämer GmbH, 5000 Köln | Schaltungsvorrichtung zur Logarithmierung und Digitalisierung analoger Signale |
| US4639715A (en) * | 1984-02-13 | 1987-01-27 | Intersil, Inc. | Flash analog to digital converter |
| GB2190556B (en) * | 1986-05-16 | 1989-12-13 | Plessey Co Plc | Analogue to digital converters |
| US4794794A (en) * | 1986-10-30 | 1989-01-03 | Djorup Robert Sonny | Thermal anemometer |
| JPS63198418A (ja) * | 1987-02-13 | 1988-08-17 | Sony Corp | 並列型a/dコンバ−タ |
| GB8705923D0 (en) * | 1987-03-12 | 1987-04-15 | Gen Electric Co Plc | Analogue to digital converter |
| US4749984A (en) * | 1987-06-29 | 1988-06-07 | Rca Corporation | Subranging A/D converter with converging digitally controlled voltages |
| DE3883673T2 (de) * | 1987-09-25 | 1994-03-03 | Japan Broadcasting Corp | Dekodierender Entzerrer. |
| JPH0775320B2 (ja) * | 1988-01-25 | 1995-08-09 | ソニー株式会社 | Ad変換回路 |
| JPH0744105Y2 (ja) * | 1988-11-25 | 1995-10-09 | ソニー株式会社 | Ad変換回路 |
| GB2226726B (en) * | 1988-12-28 | 1992-05-20 | Marconi Instruments Ltd | Sample and hold circuit |
| KR101062724B1 (ko) | 2004-03-25 | 2011-09-06 | 주식회사 하이닉스반도체 | 아날로그/디지털 변환기 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3311910A (en) * | 1962-02-05 | 1967-03-28 | James H Doyle | Electronic quantizer |
| DE1190982B (de) * | 1963-10-25 | 1965-04-15 | Siemens Ag | Einrichtung zur Umwandlung eines Analogsignals in ein Signal von Digitalform, insbesondere zur Informationsuebertragung mittels Puls-Code-Modulation |
| US3541315A (en) * | 1967-04-13 | 1970-11-17 | Singer General Precision | Analog-to-digital cyclic forward feed conversion equipment |
| US3581304A (en) * | 1967-05-16 | 1971-05-25 | Singer General Precision | Analog-to-digital cyclic forward feed successive approximation conversion equipment |
| US3646586A (en) * | 1969-04-28 | 1972-02-29 | Tennelec | Analogue-to-digital converter system |
| GB1318775A (en) * | 1970-08-24 | 1973-05-31 | Plessey Telcommunications Rese | Encoders |
| IE38230B1 (en) * | 1972-09-15 | 1978-01-18 | Ind Des Telecommunications Com | Improvements in digital coders |
| US3860952B2 (en) * | 1973-07-23 | 1996-05-07 | Harris Corp | Video time base corrector |
| JPS5081715A (index.php) * | 1973-11-23 | 1975-07-02 | ||
| US3967269A (en) * | 1974-04-29 | 1976-06-29 | British Broadcasting Corporation | Analogue to digital converters |
-
1975
- 1975-01-23 JP JP923875A patent/JPS558052B2/ja not_active Expired
-
1976
- 1976-01-16 US US05/649,731 patent/US4122439A/en not_active Expired - Lifetime
- 1976-01-21 GB GB2403/76A patent/GB1536024A/en not_active Expired
- 1976-01-22 FR FR7601732A patent/FR2298906A1/fr active Granted
- 1976-01-22 DE DE2602382A patent/DE2602382C2/de not_active Expired
- 1976-01-23 NL NLAANVRAGE7600734,A patent/NL176729C/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| GB1536024A (en) | 1978-12-13 |
| FR2298906B1 (index.php) | 1980-05-09 |
| NL7600734A (nl) | 1976-07-27 |
| DE2602382A1 (de) | 1976-07-29 |
| NL176729B (nl) | 1984-12-17 |
| JPS5185362A (index.php) | 1976-07-26 |
| NL176729C (nl) | 1985-05-17 |
| FR2298906A1 (fr) | 1976-08-20 |
| US4122439A (en) | 1978-10-24 |
| JPS558052B2 (index.php) | 1980-03-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2602382C2 (de) | Reihen-Parallel-Analog-Digital-Umsetzereinrichtung | |
| DE3902313C3 (de) | Analog /Digitalwandler | |
| DE3586187T2 (de) | Analog-digital-wandler. | |
| DE4208702A1 (de) | 2-schrittiger unterbereichs-analog/digital-wandler | |
| DE3202789C2 (index.php) | ||
| EP0054079B1 (de) | MOS-Parallel-A/D-Wandler | |
| DE4003758A1 (de) | Verfahren und vorrichtung zum umformen von analog/digital-nichtlinearitaeten in statisches rauschen | |
| DE3136784A1 (de) | Digital-analog-umsetzer | |
| DE19732840A1 (de) | Pipeline-Analog-Digital-Wandler | |
| DE2059933C3 (de) | Digital-Analog-Umsetzer | |
| DE19958049A1 (de) | Im Analog-Strommodus arbeitender D/A-Wandler | |
| DE2216349C3 (de) | Analog-Digital-Umsetzer für bipolare Eingangssignale | |
| DE3855117T2 (de) | Analog-Digital-Umsetzer mit schrittweiser Annäherung | |
| DE3788270T2 (de) | Analog-Digital-Wandler. | |
| DE3718937C2 (de) | Bipolarer A/D-Wandler mit automatischer Offsetkompensation | |
| EP0421395B2 (de) | Anordnung zur Umwandlung einer elektrischen Eingangsgrösse in ein dazu proportionales elektrisches Gleichsignal | |
| DE68927655T2 (de) | Analog-Digital-Wandler | |
| DE1276736B (de) | Schaltung zur Verstaerkungssteuerung | |
| DE3221483A1 (de) | Analog/digital-wandler mit einer selbstvorspannungsschaltung | |
| DE2129383B2 (de) | Pulscodemodulator mit knickkennlinien-amplitudenwandler | |
| DE2838310B1 (de) | Schaltungsanordnung zur Umsetzung von Digital-Signalen,insbesondere PCM-Signalen,in diesen entsprechende Analog-Signale,mit einem R-2R-Kettennetzwerk | |
| DE2619314C2 (index.php) | ||
| EP0046574B1 (de) | Verfahren zum Nullpunktabgleich des durch einen Operationsverstärker realisierten Analogwertvergleichers eines unter Verwendung eines Digital-Analog-Wandlers nach dem Iterativprinzip arbeitenden Analog-Digital-Wandlers, insbesondere bei dessen Zugehörigkeit zu einer Einrichtung zur Analog-Digital-Wandlung und umgekehrt zur Digital-Analog-Wandlung (Codec) | |
| DE1290180B (de) | Einrichtung zum Umsetzen von Analogwerten in Zahlenwerte nach dem Vergleichsverfahren | |
| DE1272352B (de) | Analog-Digital-Umsetzer mit den Stellenwerten zugeordneten Differenzverstaerkern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |