DE2558869C2 - Cephalosporine - Google Patents
CephalosporineInfo
- Publication number
- DE2558869C2 DE2558869C2 DE2558869A DE2558869A DE2558869C2 DE 2558869 C2 DE2558869 C2 DE 2558869C2 DE 2558869 A DE2558869 A DE 2558869A DE 2558869 A DE2558869 A DE 2558869A DE 2558869 C2 DE2558869 C2 DE 2558869C2
- Authority
- DE
- Germany
- Prior art keywords
- cephem
- acid
- carboxylic acid
- methyl
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229930186147 Cephalosporin Natural products 0.000 title claims description 13
- 229940124587 cephalosporin Drugs 0.000 title claims description 13
- 150000001780 cephalosporins Chemical class 0.000 title claims description 12
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 48
- -1 thenyl Chemical group 0.000 description 38
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 32
- 239000000243 solution Substances 0.000 description 28
- 239000000203 mixture Substances 0.000 description 26
- SYTBZMRGLBWNTM-SNVBAGLBSA-N (R)-flurbiprofen Chemical compound FC1=CC([C@H](C(O)=O)C)=CC=C1C1=CC=CC=C1 SYTBZMRGLBWNTM-SNVBAGLBSA-N 0.000 description 25
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 24
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- 150000001875 compounds Chemical class 0.000 description 20
- 239000000047 product Substances 0.000 description 19
- 150000003462 sulfoxides Chemical class 0.000 description 18
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 159000000000 sodium salts Chemical class 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- PPAUMJSTRVZNNE-UHFFFAOYSA-N 2-(benzenesulfinyl)acetic acid Chemical compound OC(=O)CS(=O)C1=CC=CC=C1 PPAUMJSTRVZNNE-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 241000894006 Bacteria Species 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 238000000921 elemental analysis Methods 0.000 description 8
- 230000002401 inhibitory effect Effects 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 description 7
- 239000013078 crystal Substances 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 241000191967 Staphylococcus aureus Species 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- 241000588724 Escherichia coli Species 0.000 description 5
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 5
- 201000010099 disease Diseases 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- KWUCXUIDQMYNFR-UHFFFAOYSA-N 2-thiophen-2-ylsulfinylacetic acid Chemical compound OC(=O)CS(=O)C1=CC=CS1 KWUCXUIDQMYNFR-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 230000000845 anti-microbial effect Effects 0.000 description 4
- HGXLJRWXCXSEJO-GMSGAONNSA-N cefazaflur Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CSC(F)(F)F)[C@H]2SC1 HGXLJRWXCXSEJO-GMSGAONNSA-N 0.000 description 4
- 229950004359 cefazaflur Drugs 0.000 description 4
- 238000002329 infrared spectrum Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 3
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 3
- 241000607760 Shigella sonnei Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 3
- 239000003456 ion exchange resin Substances 0.000 description 3
- 229920003303 ion-exchange polymer Polymers 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 229940115939 shigella sonnei Drugs 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- WOEWMGJSTHBCRB-HWZXHQHMSA-N (6R)-7-amino-3-(azidomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC1[C@@H]2N(C(=C(CS2)CN=[N+]=[N-])C(=O)O)C1=O WOEWMGJSTHBCRB-HWZXHQHMSA-N 0.000 description 2
- DLRUVOPHQGXQFC-UHFFFAOYSA-N 2-pyridin-2-ylsulfinylacetic acid Chemical compound OC(=O)CS(=O)C1=CC=CC=N1 DLRUVOPHQGXQFC-UHFFFAOYSA-N 0.000 description 2
- DOJYVEULZCDFAR-UHFFFAOYSA-N 2-pyridin-4-ylsulfinylacetic acid Chemical compound OC(=O)CS(=O)C1=CC=NC=C1 DOJYVEULZCDFAR-UHFFFAOYSA-N 0.000 description 2
- KXWYPHNQESQOBK-UHFFFAOYSA-N 2-thiophen-3-ylsulfinylacetic acid Chemical compound OC(=O)CS(=O)C=1C=CSC=1 KXWYPHNQESQOBK-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241000588747 Klebsiella pneumoniae Species 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ATTZFSUZZUNHBP-UHFFFAOYSA-N Piperonyl sulfoxide Chemical compound CCCCCCCCS(=O)C(C)CC1=CC=C2OCOC2=C1 ATTZFSUZZUNHBP-UHFFFAOYSA-N 0.000 description 2
- 241000588767 Proteus vulgaris Species 0.000 description 2
- 241000588777 Providencia rettgeri Species 0.000 description 2
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 2
- 241001354013 Salmonella enterica subsp. enterica serovar Enteritidis Species 0.000 description 2
- 206010040047 Sepsis Diseases 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- RTEXIPZMMDUXMR-UHFFFAOYSA-N benzene;ethyl acetate Chemical compound CCOC(C)=O.C1=CC=CC=C1 RTEXIPZMMDUXMR-UHFFFAOYSA-N 0.000 description 2
- MDHYEMXUFSJLGV-UHFFFAOYSA-N beta-phenethyl acetate Natural products CC(=O)OCCC1=CC=CC=C1 MDHYEMXUFSJLGV-UHFFFAOYSA-N 0.000 description 2
- 229920001429 chelating resin Polymers 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- QEWYKACRFQMRMB-UHFFFAOYSA-N fluoroacetic acid Chemical compound OC(=O)CF QEWYKACRFQMRMB-UHFFFAOYSA-N 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 2
- 229940116357 potassium thiocyanate Drugs 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 229940007042 proteus vulgaris Drugs 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 208000013223 septicemia Diseases 0.000 description 2
- 238000010183 spectrum analysis Methods 0.000 description 2
- MHZGFDAXQYZEAB-VAGMKELTSA-N (6R)-3-(azidomethyl)-8-oxo-7-[(2-thiophen-3-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C=C(C=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CN=[N+]=[N-])C(=O)O)C1=O MHZGFDAXQYZEAB-VAGMKELTSA-N 0.000 description 1
- JWDBQDMWUIFRIQ-ZMUJUALCSA-N (6R)-3-[[1-(carboxymethyl)tetrazol-5-yl]sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2CC(=O)O)C(=O)O)C1=O JWDBQDMWUIFRIQ-ZMUJUALCSA-N 0.000 description 1
- PXVDZCRNTWWEKI-XCGJVMPOSA-N (6R)-4-[[1-(carboxymethyl)tetrazol-5-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)(O)CN1N=NN=C1SCC1S[C@H]2N(C(=C1)C(=O)O)C(C2)=O PXVDZCRNTWWEKI-XCGJVMPOSA-N 0.000 description 1
- FZEVMBJWXHDLDB-ZCFIWIBFSA-N (6r)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical compound S1CC=CN2C(=O)C[C@H]21 FZEVMBJWXHDLDB-ZCFIWIBFSA-N 0.000 description 1
- ZJIANJKJAAXAOC-HWZXHQHMSA-N (6r)-7-amino-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(N)=O)=C(C(O)=O)N2C(=O)C(N)[C@H]21 ZJIANJKJAAXAOC-HWZXHQHMSA-N 0.000 description 1
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Substances C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 1
- LMHISHQERUTXBB-UHFFFAOYSA-N 2-(furan-2-ylsulfinyl)acetic acid Chemical compound OC(=O)CS(=O)C1=CC=CO1 LMHISHQERUTXBB-UHFFFAOYSA-N 0.000 description 1
- IFAORVUVUJCKHZ-UHFFFAOYSA-N 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfinyl]acetic acid Chemical compound CC1=NN=C(S(=O)CC(O)=O)S1 IFAORVUVUJCKHZ-UHFFFAOYSA-N 0.000 description 1
- WFWHMPLURQHHER-UHFFFAOYSA-N 2-thiophen-2-ylethanethioic s-acid Chemical compound SC(=O)CC1=CC=CS1 WFWHMPLURQHHER-UHFFFAOYSA-N 0.000 description 1
- OXHKCZRAHXKQEK-UHFFFAOYSA-N 2-thiophen-2-ylsulfonylacetic acid Chemical compound OC(=O)CS(=O)(=O)C1=CC=CS1 OXHKCZRAHXKQEK-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- RPPMKBSDZZNXLQ-ZIIYNIHOSA-N CN1C(=NN=N1)SCC2=C(N3[C@@H](C(C3=O)NC(=O)CS(=O)C4=CC=CC=C4)SC2)C(=O)O Chemical compound CN1C(=NN=N1)SCC2=C(N3[C@@H](C(C3=O)NC(=O)CS(=O)C4=CC=CC=C4)SC2)C(=O)O RPPMKBSDZZNXLQ-ZIIYNIHOSA-N 0.000 description 1
- HHMYYIJMNGUSPR-DNHYOODVSA-N CN1C(=NN=N1)SCC2=C(N3[C@@H](C(C3=O)NC(=O)CS(=O)C4=CC=CS4)SC2)C(=O)O Chemical compound CN1C(=NN=N1)SCC2=C(N3[C@@H](C(C3=O)NC(=O)CS(=O)C4=CC=CS4)SC2)C(=O)O HHMYYIJMNGUSPR-DNHYOODVSA-N 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical compound OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 206010034038 Parotitis Diseases 0.000 description 1
- 206010035664 Pneumonia Diseases 0.000 description 1
- 206010037596 Pyelonephritis Diseases 0.000 description 1
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 1
- 241000607142 Salmonella Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- SWEDAZLCYJDAGW-UHFFFAOYSA-N Thiophene-2-thiol Chemical compound SC1=CC=CS1 SWEDAZLCYJDAGW-UHFFFAOYSA-N 0.000 description 1
- 210000001015 abdomen Anatomy 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 206010006451 bronchitis Diseases 0.000 description 1
- RRKTZKIUPZVBMF-IBTVXLQLSA-N brucine Chemical compound O([C@@H]1[C@H]([C@H]2C3)[C@@H]4N(C(C1)=O)C=1C=C(C(=CC=11)OC)OC)CC=C2CN2[C@@H]3[C@]41CC2 RRKTZKIUPZVBMF-IBTVXLQLSA-N 0.000 description 1
- RRKTZKIUPZVBMF-UHFFFAOYSA-N brucine Natural products C1=2C=C(OC)C(OC)=CC=2N(C(C2)=O)C3C(C4C5)C2OCC=C4CN2C5C31CC2 RRKTZKIUPZVBMF-UHFFFAOYSA-N 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 229960000603 cefalotin Drugs 0.000 description 1
- MLYYVTUWGNIJIB-BXKDBHETSA-N cefazolin Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CN3N=NN=C3)[C@H]2SC1 MLYYVTUWGNIJIB-BXKDBHETSA-N 0.000 description 1
- 229960001139 cefazolin Drugs 0.000 description 1
- VUFGUVLLDPOSBC-XRZFDKQNSA-M cephalothin sodium Chemical compound [Na+].N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C([O-])=O)C(=O)CC1=CC=CS1 VUFGUVLLDPOSBC-XRZFDKQNSA-M 0.000 description 1
- 201000001352 cholecystitis Diseases 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 201000003146 cystitis Diseases 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000008151 electrolyte solution Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 210000000232 gallbladder Anatomy 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- XELZGAJCZANUQH-UHFFFAOYSA-N methyl 1-acetylthieno[3,2-c]pyrazole-5-carboxylate Chemical compound CC(=O)N1N=CC2=C1C=C(C(=O)OC)S2 XELZGAJCZANUQH-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 201000008383 nephritis Diseases 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 206010034674 peritonitis Diseases 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 208000008423 pleurisy Diseases 0.000 description 1
- ZRAVGQVQWFNAQN-UBIIEXFASA-M potassium (6R)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2SC(=NN=2)C)C(=O)[O-])C1=O.[K+] ZRAVGQVQWFNAQN-UBIIEXFASA-M 0.000 description 1
- ZUFQCVZBBNZMKD-UHFFFAOYSA-M potassium 2-ethylhexanoate Chemical compound [K+].CCCCC(CC)C([O-])=O ZUFQCVZBBNZMKD-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- 201000004537 pyelitis Diseases 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 208000023504 respiratory system disease Diseases 0.000 description 1
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 1
- VYPDUQYOLCLEGS-UHFFFAOYSA-M sodium;2-ethylhexanoate Chemical compound [Na+].CCCCC(CC)C([O-])=O VYPDUQYOLCLEGS-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- ZHBAHLGOXUKPGD-QHDYGNBISA-N tert-butyl (6r)-7-amino-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound CN1N=NN=C1SCC1=C(C(=O)OC(C)(C)C)N2C(=O)C(N)[C@H]2SC1 ZHBAHLGOXUKPGD-QHDYGNBISA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 208000025301 tympanitis Diseases 0.000 description 1
- 210000001635 urinary tract Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/30—Hetero atoms other than halogen
- C07D333/34—Sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP14918074A JPS5180886A (ja) | 1974-12-28 | 1974-12-28 | Ganiosefuarosuhorinnoseiho |
| JP6958975A JPS51146492A (en) | 1975-06-11 | 1975-06-11 | Process for preparing phenylsulfinylacetamidocephalosporins |
| JP8576375A JPS5210289A (en) | 1975-07-15 | 1975-07-15 | Process for preparing penicillins and cephalosporins having thionylsul finyl group |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2558869A1 DE2558869A1 (de) | 1976-07-01 |
| DE2558869C2 true DE2558869C2 (de) | 1982-09-23 |
Family
ID=27300085
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2558869A Expired DE2558869C2 (de) | 1974-12-28 | 1975-12-27 | Cephalosporine |
Country Status (10)
| Country | Link |
|---|---|
| US (2) | US4172197A (enExample) |
| CA (1) | CA1072080A (enExample) |
| CH (1) | CH622799A5 (enExample) |
| DE (1) | DE2558869C2 (enExample) |
| DK (1) | DK586175A (enExample) |
| FR (1) | FR2295752A1 (enExample) |
| GB (1) | GB1527109A (enExample) |
| HU (1) | HU171207B (enExample) |
| NL (1) | NL7515085A (enExample) |
| SE (1) | SE7514646L (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1527109A (en) * | 1974-12-28 | 1978-10-04 | Asahi Chemical Ind | Cephalosporin derivatives and process for preparing same |
| US4229573A (en) | 1977-06-21 | 1980-10-21 | Asahi Kasei Kogyo Kabushiki Kaisha | 7α-Methoxycephalosporin derivatives |
| US4314059A (en) * | 1978-03-09 | 1982-02-02 | Chisei Shibuya | Process for preparing cephalosporin compounds |
| US4968815A (en) * | 1990-04-16 | 1990-11-06 | Merck & Co., Inc. | Synthesis of (S)-3-(thien-2-ylthio)butyric acid analogs |
| US4968814A (en) * | 1990-04-18 | 1990-11-06 | Merck & Co., Inc. | (S)-Alkyl 3-(thien-2-ylthio)butyrate and analogs and synthesis thereof |
| US5567698A (en) * | 1995-02-15 | 1996-10-22 | Bristol-Myers Squibb Company | Pyridinium thiomethyl substituted chepholosporin derivatives |
| KR20060109871A (ko) * | 2003-11-14 | 2006-10-23 | 템플 유니버시티-오브 더 커먼웰쓰 시스템 오브 하이어 에듀케이션 | 증식성 질병 치료용 알파, 베타-불포화 설폭시드 |
| US8198434B2 (en) * | 2008-05-07 | 2012-06-12 | Idexx Laboratories, Inc. | Process for preparing cefsulodin sodium |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2581626A (en) * | 1948-10-06 | 1952-01-08 | Socony Vacuum Oil Co Inc | Thienylthio carboxylic acids and thienylthio carboxylic acid esters in lubricating compositions |
| US3288859A (en) * | 1965-03-30 | 1966-11-29 | Procter & Gamble | Reactions of alkali metal salts of sulfinyl carbanions and alkanesulfenates with epoxy compounds and novel compounds derived therefrom |
| US3382238A (en) * | 1967-04-27 | 1968-05-07 | Squibb & Sons Inc | Penicillin and cephalosporin derivatives |
| US3865819A (en) * | 1972-05-03 | 1975-02-11 | Smithkline Corp | Substituted sulfonylacetamido cephalosporins |
| US3828037A (en) * | 1972-07-20 | 1974-08-06 | Smithkline Corp | Trifluoromethylmercaptoacetamidocephalosporins |
| US3904606A (en) * | 1973-01-12 | 1975-09-09 | Upjohn Co | Process for preparing optically active 6-(' -amino-acetamido)penicillanic acids and 7-(' -aminoacetamido) cephalosporanic acids |
| US3912726A (en) * | 1973-02-16 | 1975-10-14 | Squibb & Sons Inc | Process for the preparation of 7-(D-2-amino-2-(1,4-cyclo-hexadienyl) acetamido) desacetoxycephalosporanic acid and 7-(D-2-amino-2-(1,4-cyclohexadienyl) acetamido) cephalosporanic acid |
| US3880848A (en) * | 1973-06-18 | 1975-04-29 | Smithkline Corp | 7-Trifluorome thylsulfinylacetamido cephalosporins |
| DE2424740C3 (de) * | 1974-05-21 | 1981-02-19 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Thiophenderivate, Verfahren zu |
| GB1527109A (en) * | 1974-12-28 | 1978-10-04 | Asahi Chemical Ind | Cephalosporin derivatives and process for preparing same |
| US4093723A (en) * | 1976-05-19 | 1978-06-06 | Smithkline Corporation | 7-Acyl-3-(sulfonic acid and sulfamoyl substituted tetrazolyl thiomethyl) cephalosporins |
| US4045438A (en) * | 1975-10-24 | 1977-08-30 | Yeda Research And Development Co. Ltd. | Cephalosporin antibiotics |
| US4118491A (en) * | 1976-03-11 | 1978-10-03 | Smithkline Corporation | 7-Acyl-3-(sulfaminoalkyl substituted tetrazolylthiomethyl)cephalosporins, antibacterial compositions containing them and methods of treating bacterial infections with them |
| US4025626A (en) * | 1975-12-09 | 1977-05-24 | Smithkline Corporation | 7-Acyl-3-(ureidoalkyl substituted tetrazolylthiomethyl)-cephalosporins |
-
1975
- 1975-12-22 GB GB52467/75A patent/GB1527109A/en not_active Expired
- 1975-12-22 DK DK586175A patent/DK586175A/da unknown
- 1975-12-23 HU HU75AA00000838A patent/HU171207B/hu unknown
- 1975-12-23 SE SE7514646A patent/SE7514646L/xx not_active Application Discontinuation
- 1975-12-24 NL NL7515085A patent/NL7515085A/xx not_active Application Discontinuation
- 1975-12-24 US US05/644,241 patent/US4172197A/en not_active Expired - Lifetime
- 1975-12-26 FR FR7539873A patent/FR2295752A1/fr active Granted
- 1975-12-27 DE DE2558869A patent/DE2558869C2/de not_active Expired
- 1975-12-29 CA CA242,568A patent/CA1072080A/en not_active Expired
- 1975-12-29 CH CH1685075A patent/CH622799A5/de not_active IP Right Cessation
-
1979
- 1979-09-27 US US06/079,256 patent/US4245107A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| NL7515085A (nl) | 1976-06-30 |
| GB1527109A (en) | 1978-10-04 |
| CH622799A5 (enExample) | 1981-04-30 |
| US4245107A (en) | 1981-01-13 |
| DE2558869A1 (de) | 1976-07-01 |
| SE7514646L (sv) | 1976-06-29 |
| CA1072080A (en) | 1980-02-19 |
| DK586175A (da) | 1976-06-29 |
| US4172197A (en) | 1979-10-23 |
| FR2295752A1 (fr) | 1976-07-23 |
| HU171207B (hu) | 1977-12-28 |
| FR2295752B1 (enExample) | 1981-07-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2461478C2 (de) | Cephalosporinderivate und Verfahren zu deren Herstellung | |
| DE1795838B2 (de) | Cephalosporinderivate | |
| CH628058A5 (de) | Verfahren zur herstellung von cephemverbindungen. | |
| DE2736471C2 (enExample) | ||
| DE2558869C2 (de) | Cephalosporine | |
| DE2538804C2 (de) | Cephalosporinderivate, Verfahren zu ihrer Herstellung und sie enthaltende Mittel | |
| DE2217563A1 (de) | Verfahren zur Herstellung von Acylaminoverbindungen | |
| EP0000392B1 (de) | Cephalosporin und Penicillin-derivate, Verfahren zu deren Herstellung, und deren pharmazeutische Präparate | |
| DE2715038A1 (de) | Neue antibakterielle verbindungen | |
| CH666037A5 (de) | Verfahren zur herstellung von cephalosporin-syn-isomeren. | |
| DE2325065A1 (de) | Neue dithiocarbonylaminoacetylcephalosporine | |
| DE2356704A1 (de) | 3-(heterocyclische-thiomethyl)-cephalosporinverbindungen und ihre pharmakologisch vertraeglichen salze, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate | |
| DE2539214C2 (de) | 7-Methoxythienyl-ureido-cephalosporin und dieses enthaltendes Arzneimittel | |
| DE2559932C2 (de) | Cephalosporine, Verfahren zur Herstellung derselben und Mittel mit einem Gehalt derselben | |
| DE2236422C2 (de) | Cephalosporinverbindungen und Verfahren zu deren Herstellung | |
| DE2632051A1 (de) | 7- eckige klammer auf alpha-amino- omega-(2,3-methylendioxyphenyl)acylamido eckige klammer zu cephalosporansaeure-derivate und verfahren zu deren herstellung | |
| DE2540804A1 (de) | 3-heterothio-7-ureidocephalosporine | |
| DE2442302C2 (de) | Cephalosporine, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Mittel | |
| DE2727977C3 (de) | 7α -Methoxycephalosporinderivate und sie enthaltende Arzneimittel | |
| DE3224866A1 (de) | Ss-lactamantibiotika, verfahren zu deren herstellung sowie sie enthaltende mittel | |
| AT368513B (de) | Verfahren zum herstellen von neuen heterocyclischen derivaten von oxyiminosubstituierten cephalosporinen, ihren salzen und ihren isomeren | |
| DE2722666C2 (de) | 7-Acylamino-3-pyrazinylthiomethyl- 3-cephem-4-carbonsäure-Verbindungen und ihre Verwendung/Bekämpfung bakterieller Infektionen | |
| AT344325B (de) | Verfahren zur herstellung von neuen 6-subst.- aminopenicillansaeure- und 7-subst.-aminocephalosporansaeure-derivaten | |
| DE2548247A1 (de) | Cephalosporine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2222200A1 (de) | O-Acyl-7-acylaminocephalosporadensaeuren,Verfahren zu ihrer Herstellung und Arzneimittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D2 | Grant after examination | ||
| 8339 | Ceased/non-payment of the annual fee |