HU171207B - Sposob poluchenija proizvodnykh cef-3-em-4-karbonovojj kisloty - Google Patents
Sposob poluchenija proizvodnykh cef-3-em-4-karbonovojj kislotyInfo
- Publication number
- HU171207B HU171207B HU75AA00000838A HUAA000838A HU171207B HU 171207 B HU171207 B HU 171207B HU 75AA00000838 A HU75AA00000838 A HU 75AA00000838A HU AA000838 A HUAA000838 A HU AA000838A HU 171207 B HU171207 B HU 171207B
- Authority
- HU
- Hungary
- Prior art keywords
- ceph
- eme
- producing
- carboxylic acid
- acid derivatives
- Prior art date
Links
- IKWLIQXIPRUIDU-ZCFIWIBFSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical class OC(=O)C1=CCS[C@@H]2CC(=O)N12 IKWLIQXIPRUIDU-ZCFIWIBFSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/30—Hetero atoms other than halogen
- C07D333/34—Sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP14918074A JPS5180886A (ja) | 1974-12-28 | 1974-12-28 | Ganiosefuarosuhorinnoseiho |
| JP6958975A JPS51146492A (en) | 1975-06-11 | 1975-06-11 | Process for preparing phenylsulfinylacetamidocephalosporins |
| JP8576375A JPS5210289A (en) | 1975-07-15 | 1975-07-15 | Process for preparing penicillins and cephalosporins having thionylsul finyl group |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU171207B true HU171207B (hu) | 1977-12-28 |
Family
ID=27300085
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU75AA00000838A HU171207B (hu) | 1974-12-28 | 1975-12-23 | Sposob poluchenija proizvodnykh cef-3-em-4-karbonovojj kisloty |
Country Status (10)
| Country | Link |
|---|---|
| US (2) | US4172197A (enExample) |
| CA (1) | CA1072080A (enExample) |
| CH (1) | CH622799A5 (enExample) |
| DE (1) | DE2558869C2 (enExample) |
| DK (1) | DK586175A (enExample) |
| FR (1) | FR2295752A1 (enExample) |
| GB (1) | GB1527109A (enExample) |
| HU (1) | HU171207B (enExample) |
| NL (1) | NL7515085A (enExample) |
| SE (1) | SE7514646L (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1527109A (en) * | 1974-12-28 | 1978-10-04 | Asahi Chemical Ind | Cephalosporin derivatives and process for preparing same |
| US4229573A (en) | 1977-06-21 | 1980-10-21 | Asahi Kasei Kogyo Kabushiki Kaisha | 7α-Methoxycephalosporin derivatives |
| US4314059A (en) * | 1978-03-09 | 1982-02-02 | Chisei Shibuya | Process for preparing cephalosporin compounds |
| US4968815A (en) * | 1990-04-16 | 1990-11-06 | Merck & Co., Inc. | Synthesis of (S)-3-(thien-2-ylthio)butyric acid analogs |
| US4968814A (en) * | 1990-04-18 | 1990-11-06 | Merck & Co., Inc. | (S)-Alkyl 3-(thien-2-ylthio)butyrate and analogs and synthesis thereof |
| US5567698A (en) * | 1995-02-15 | 1996-10-22 | Bristol-Myers Squibb Company | Pyridinium thiomethyl substituted chepholosporin derivatives |
| KR20060109871A (ko) * | 2003-11-14 | 2006-10-23 | 템플 유니버시티-오브 더 커먼웰쓰 시스템 오브 하이어 에듀케이션 | 증식성 질병 치료용 알파, 베타-불포화 설폭시드 |
| US8198434B2 (en) * | 2008-05-07 | 2012-06-12 | Idexx Laboratories, Inc. | Process for preparing cefsulodin sodium |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2581626A (en) * | 1948-10-06 | 1952-01-08 | Socony Vacuum Oil Co Inc | Thienylthio carboxylic acids and thienylthio carboxylic acid esters in lubricating compositions |
| US3288859A (en) * | 1965-03-30 | 1966-11-29 | Procter & Gamble | Reactions of alkali metal salts of sulfinyl carbanions and alkanesulfenates with epoxy compounds and novel compounds derived therefrom |
| US3382238A (en) * | 1967-04-27 | 1968-05-07 | Squibb & Sons Inc | Penicillin and cephalosporin derivatives |
| US3865819A (en) * | 1972-05-03 | 1975-02-11 | Smithkline Corp | Substituted sulfonylacetamido cephalosporins |
| US3828037A (en) * | 1972-07-20 | 1974-08-06 | Smithkline Corp | Trifluoromethylmercaptoacetamidocephalosporins |
| US3904606A (en) * | 1973-01-12 | 1975-09-09 | Upjohn Co | Process for preparing optically active 6-(' -amino-acetamido)penicillanic acids and 7-(' -aminoacetamido) cephalosporanic acids |
| US3912726A (en) * | 1973-02-16 | 1975-10-14 | Squibb & Sons Inc | Process for the preparation of 7-(D-2-amino-2-(1,4-cyclo-hexadienyl) acetamido) desacetoxycephalosporanic acid and 7-(D-2-amino-2-(1,4-cyclohexadienyl) acetamido) cephalosporanic acid |
| US3880848A (en) * | 1973-06-18 | 1975-04-29 | Smithkline Corp | 7-Trifluorome thylsulfinylacetamido cephalosporins |
| DE2424740C3 (de) * | 1974-05-21 | 1981-02-19 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Thiophenderivate, Verfahren zu |
| GB1527109A (en) * | 1974-12-28 | 1978-10-04 | Asahi Chemical Ind | Cephalosporin derivatives and process for preparing same |
| US4093723A (en) * | 1976-05-19 | 1978-06-06 | Smithkline Corporation | 7-Acyl-3-(sulfonic acid and sulfamoyl substituted tetrazolyl thiomethyl) cephalosporins |
| US4045438A (en) * | 1975-10-24 | 1977-08-30 | Yeda Research And Development Co. Ltd. | Cephalosporin antibiotics |
| US4118491A (en) * | 1976-03-11 | 1978-10-03 | Smithkline Corporation | 7-Acyl-3-(sulfaminoalkyl substituted tetrazolylthiomethyl)cephalosporins, antibacterial compositions containing them and methods of treating bacterial infections with them |
| US4025626A (en) * | 1975-12-09 | 1977-05-24 | Smithkline Corporation | 7-Acyl-3-(ureidoalkyl substituted tetrazolylthiomethyl)-cephalosporins |
-
1975
- 1975-12-22 GB GB52467/75A patent/GB1527109A/en not_active Expired
- 1975-12-22 DK DK586175A patent/DK586175A/da unknown
- 1975-12-23 HU HU75AA00000838A patent/HU171207B/hu unknown
- 1975-12-23 SE SE7514646A patent/SE7514646L/xx not_active Application Discontinuation
- 1975-12-24 NL NL7515085A patent/NL7515085A/xx not_active Application Discontinuation
- 1975-12-24 US US05/644,241 patent/US4172197A/en not_active Expired - Lifetime
- 1975-12-26 FR FR7539873A patent/FR2295752A1/fr active Granted
- 1975-12-27 DE DE2558869A patent/DE2558869C2/de not_active Expired
- 1975-12-29 CA CA242,568A patent/CA1072080A/en not_active Expired
- 1975-12-29 CH CH1685075A patent/CH622799A5/de not_active IP Right Cessation
-
1979
- 1979-09-27 US US06/079,256 patent/US4245107A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| NL7515085A (nl) | 1976-06-30 |
| GB1527109A (en) | 1978-10-04 |
| CH622799A5 (enExample) | 1981-04-30 |
| US4245107A (en) | 1981-01-13 |
| DE2558869A1 (de) | 1976-07-01 |
| SE7514646L (sv) | 1976-06-29 |
| CA1072080A (en) | 1980-02-19 |
| DK586175A (da) | 1976-06-29 |
| US4172197A (en) | 1979-10-23 |
| FR2295752A1 (fr) | 1976-07-23 |
| FR2295752B1 (enExample) | 1981-07-31 |
| DE2558869C2 (de) | 1982-09-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU174973B (hu) | Sposob poluchenija proizvodnykh 16-alkil-16-gidroksi-prostanovykh kislot | |
| HU174077B (hu) | Sposob poluchenija proizvodnykh dekapeptidamidakh | |
| HU173052B (hu) | Sposob poluchenija proizvodnykh tienil-karbamida | |
| HU172448B (hu) | Sposob poluchenija proizvodnykh cef-3-em-4-karbonovojj kisloty | |
| HU174153B (hu) | Sposob poluchenija proizvodnykh 2,4,6-triiodo-bis-2,4,6-triiodo-3,5-bis-skobka-karbamoil-skobka zakryta-fenil-karbamoil-metil-amino-acetamido-5-benzojjnojj kisloty | |
| HU172039B (hu) | Sposob poluchenija proizvodnykh 2-fenil-indola | |
| HU174378B (hu) | Sposob poluchenija proizvodnykh 7-beta-acilamino-7-al'fa-alkoksi-cefem-4-karbonovojj kisloty ili 6-beta-acilamino-6-al'fa-alkoksi-penam-3-karbonovojj kisloty | |
| HU170897B (hu) | Sposob poluchenija proizvodnykh 7-skobka-n-acilamino-al'fa-aril acetamido-3-cefem-4-karbonovyki kislot | |
| HU172906B (hu) | Sposob poluchenija proizvodnykh alkil-amino-glikopiranozida | |
| HU172103B (hu) | Sposob poluchenija proizvodnykh 2-skobka-zamehhennykh-skobka zakryta-3-cianamino-3-skobka-zamehhennykh amino-skobka zakryta-propionitrilov | |
| YU40266B (en) | Process for producing thienothiazepine derivatives | |
| HU174005B (hu) | Sposob poluchenija proizvodnykh analogov prostaglandina | |
| HU173386B (hu) | Sposob poluchenija makromolekuljarnykh proizvodnykh 4-skobka-nikotinamid-adenin-dinukleotid-n-6 vverkh-skobka zakryta-3-gidroksimasljanojj kisloty | |
| HU171512B (hu) | Sposob polucsenija proizvodnykh nikotinamid-adenin-dinukleotidov | |
| HU173609B (hu) | Sposob poluchenija novykh proizvodnykh salicilanilida | |
| HU172045B (hu) | Sposob poluchenija proizvodnykh 7-acilamido-3-skobka-1,2-dvojjno zamehhennykh-1,3,4-triazol-5-il-tiometil-skobka zakryta-3-cefem-4-karbonovykh kislot | |
| HU170859B (hu) | Sposob poluchenija novykh proizvodnykh 6-skobka-al'fa-ureido-fenilacetilamido-skobka zakryta-penam-3-karbonovojj kisloty | |
| HU171513B (hu) | Sposob poluchenija proizvodnykh 7-beta-acilamino-7al'fa-alkok-icef-3-em-4-karbonovojj kisloty | |
| HU171207B (hu) | Sposob poluchenija proizvodnykh cef-3-em-4-karbonovojj kisloty | |
| HU172891B (hu) | Sposob poluchenija proizvodnykh 7-amino-cef-3-em-4-karbonovojj kisloty | |
| YU165781A (en) | Process for producing penzopyran derivatives | |
| HU171357B (hu) | Sposob poluchenija proizvodnykh cef-3-em-4-karbonovojj kisloty | |
| HU173651B (hu) | Sposob poluchenija proizvodnykh beta-amino-7-al'fa-metoksi-cef-3-em-4-karbonovojj kisloty | |
| YU37170B (en) | Process for obtaining penicillnic acid derivatives | |
| HU172892B (hu) | Sposob poluchenija proizvodnykh cef-3-em-4-karbonovojj kisloty |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 |