CH622799A5 - - Google Patents
Download PDFInfo
- Publication number
- CH622799A5 CH622799A5 CH1685075A CH1685075A CH622799A5 CH 622799 A5 CH622799 A5 CH 622799A5 CH 1685075 A CH1685075 A CH 1685075A CH 1685075 A CH1685075 A CH 1685075A CH 622799 A5 CH622799 A5 CH 622799A5
- Authority
- CH
- Switzerland
- Prior art keywords
- group
- carboxylic acid
- cephem
- methyl
- acid
- Prior art date
Links
- -1 carbamoyloxy group Chemical group 0.000 claims description 94
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 68
- 150000001875 compounds Chemical class 0.000 claims description 30
- 238000000034 method Methods 0.000 claims description 28
- 125000000217 alkyl group Chemical group 0.000 claims description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 19
- 125000003118 aryl group Chemical group 0.000 claims description 18
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 16
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 13
- 229930186147 Cephalosporin Natural products 0.000 claims description 11
- 229940124587 cephalosporin Drugs 0.000 claims description 11
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 10
- 150000001780 cephalosporins Chemical class 0.000 claims description 10
- 125000000623 heterocyclic group Chemical group 0.000 claims description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 10
- 125000004423 acyloxy group Chemical group 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 8
- 125000004414 alkyl thio group Chemical group 0.000 claims description 7
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 7
- 125000004076 pyridyl group Chemical group 0.000 claims description 7
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 6
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims description 5
- 125000002883 imidazolyl group Chemical group 0.000 claims description 5
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 5
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 5
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 4
- 125000000129 anionic group Chemical group 0.000 claims description 4
- 125000005333 aroyloxy group Chemical group 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 4
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 4
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 4
- 125000001544 thienyl group Chemical group 0.000 claims description 4
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 150000001768 cations Chemical class 0.000 claims description 3
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 3
- 231100000252 nontoxic Toxicity 0.000 claims description 3
- 230000003000 nontoxic effect Effects 0.000 claims description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 3
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 claims description 3
- 125000001425 triazolyl group Chemical group 0.000 claims description 3
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 claims description 2
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 125000004622 benzoxazinyl group Chemical group O1NC(=CC2=C1C=CC=C2)* 0.000 claims description 2
- 125000002541 furyl group Chemical group 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 claims description 2
- 125000002971 oxazolyl group Chemical group 0.000 claims description 2
- 125000003944 tolyl group Chemical group 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims 2
- 229910052736 halogen Inorganic materials 0.000 claims 2
- 150000002367 halogens Chemical class 0.000 claims 2
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 claims 1
- 125000000686 lactone group Chemical group 0.000 claims 1
- 125000000335 thiazolyl group Chemical group 0.000 claims 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 51
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 48
- 239000000243 solution Substances 0.000 description 38
- 239000000203 mixture Substances 0.000 description 36
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 30
- 239000000047 product Substances 0.000 description 23
- 239000002253 acid Substances 0.000 description 21
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 239000011541 reaction mixture Substances 0.000 description 16
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 13
- 238000003756 stirring Methods 0.000 description 13
- 150000003462 sulfoxides Chemical class 0.000 description 13
- KWUCXUIDQMYNFR-UHFFFAOYSA-N 2-thiophen-2-ylsulfinylacetic acid Chemical compound OC(=O)CS(=O)C1=CC=CS1 KWUCXUIDQMYNFR-UHFFFAOYSA-N 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 230000000845 anti-microbial effect Effects 0.000 description 10
- 239000007788 liquid Substances 0.000 description 10
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 9
- 241000894006 Bacteria Species 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 241000588724 Escherichia coli Species 0.000 description 9
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 description 9
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 238000002329 infrared spectrum Methods 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 241000191967 Staphylococcus aureus Species 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 6
- 201000010099 disease Diseases 0.000 description 6
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 6
- 125000001424 substituent group Chemical group 0.000 description 6
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 5
- PPAUMJSTRVZNNE-UHFFFAOYSA-N 2-(benzenesulfinyl)acetic acid Chemical compound OC(=O)CS(=O)C1=CC=CC=C1 PPAUMJSTRVZNNE-UHFFFAOYSA-N 0.000 description 5
- NVIAYEIXYQCDAN-CLZZGJSISA-N 7beta-aminodeacetoxycephalosporanic acid Chemical compound S1CC(C)=C(C(O)=O)N2C(=O)[C@@H](N)[C@@H]12 NVIAYEIXYQCDAN-CLZZGJSISA-N 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- DOJYVEULZCDFAR-UHFFFAOYSA-N 2-pyridin-4-ylsulfinylacetic acid Chemical compound OC(=O)CS(=O)C1=CC=NC=C1 DOJYVEULZCDFAR-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 230000002401 inhibitory effect Effects 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 3
- 241000588747 Klebsiella pneumoniae Species 0.000 description 3
- 241000588777 Providencia rettgeri Species 0.000 description 3
- 241000607760 Shigella sonnei Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- CSGFFYNMTALICU-ZWNOBZJWSA-N adipyl-7-aminodesacetoxycephalosporanic acid Natural products CC1=C(N2[C@H](SC1)[C@H](NC(=O)CCCCC(O)=O)C2=O)C(O)=O CSGFFYNMTALICU-ZWNOBZJWSA-N 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 229920001429 chelating resin Polymers 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 3
- 229940116357 potassium thiocyanate Drugs 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 229940115939 shigella sonnei Drugs 0.000 description 3
- BQIMPGFMMOZASS-HWZXHQHMSA-N (6r)-7-amino-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(CO)=C(C(O)=O)N2C(=O)C(N)[C@H]21 BQIMPGFMMOZASS-HWZXHQHMSA-N 0.000 description 2
- DLRUVOPHQGXQFC-UHFFFAOYSA-N 2-pyridin-2-ylsulfinylacetic acid Chemical compound OC(=O)CS(=O)C1=CC=CC=N1 DLRUVOPHQGXQFC-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000588767 Proteus vulgaris Species 0.000 description 2
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 2
- 241001354013 Salmonella enterica subsp. enterica serovar Enteritidis Species 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical class NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229940007042 proteus vulgaris Drugs 0.000 description 2
- 125000002098 pyridazinyl group Chemical group 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- KTRHRALDIQQKDX-BHGPYPJTSA-N (6R)-3-(1,3,4-oxadiazol-2-ylsulfanylmethyl)-8-oxo-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2OC=NN=2)C(=O)O)C1=O KTRHRALDIQQKDX-BHGPYPJTSA-N 0.000 description 1
- GECHKULHLVOVQS-VWHLGCFUSA-N (6R)-3-(1,3-oxazol-5-ylsulfanylmethyl)-8-oxo-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=CN=CO2)C(=O)O)C1=O GECHKULHLVOVQS-VWHLGCFUSA-N 0.000 description 1
- KPHCFFFUEJFYFZ-HORNICPTSA-N (6R)-3-[(2,4-diethyl-1,3-oxazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=C(N=C(O2)CC)CC)C(=O)O)C1=O KPHCFFFUEJFYFZ-HORNICPTSA-N 0.000 description 1
- ZQMYDSQNXALUPR-HORNICPTSA-N (6R)-3-[(2,4-diethyl-1,3-thiazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=C(N=C(S2)CC)CC)C(=O)O)C1=O ZQMYDSQNXALUPR-HORNICPTSA-N 0.000 description 1
- QCBBOIQMXHHQOJ-LOZNDDHJSA-N (6R)-3-[(2,4-dimethyl-1,3-thiazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=C(N=C(S2)C)C)C(=O)O)C1=O QCBBOIQMXHHQOJ-LOZNDDHJSA-N 0.000 description 1
- GYOGMDSGPDWIBR-WRSKSTTASA-N (6R)-3-[(2-ethyl-1,3-oxazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=CN=C(O2)CC)C(=O)O)C1=O GYOGMDSGPDWIBR-WRSKSTTASA-N 0.000 description 1
- JUGWMXIMIZVPPY-WRSKSTTASA-N (6R)-3-[(2-ethyl-1,3-thiazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=CN=C(S2)CC)C(=O)O)C1=O JUGWMXIMIZVPPY-WRSKSTTASA-N 0.000 description 1
- OEJXRXUPFGGRGI-BVCHHSEASA-N (6R)-3-[(2-methyl-1,3-oxazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=CN=C(O2)C)C(=O)O)C1=O OEJXRXUPFGGRGI-BVCHHSEASA-N 0.000 description 1
- RLHFMHAOIZZZIR-UJWUIMCGSA-N (6R)-3-[(4-methyl-1,3-thiazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=C(N=CS2)C)C(=O)O)C1=O RLHFMHAOIZZZIR-UJWUIMCGSA-N 0.000 description 1
- WAUGDSKTSVKRQE-BUZKPMONSA-N (6R)-3-methyl-8-oxo-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)C)C(=O)O)C1=O WAUGDSKTSVKRQE-BUZKPMONSA-N 0.000 description 1
- XOXRYINHDZYVPG-ANGWXVGLSA-N (6R)-7-[[2-(benzenesulfinyl)acetyl]amino]-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1(=CC=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CO)C(=O)O)C1=O XOXRYINHDZYVPG-ANGWXVGLSA-N 0.000 description 1
- QBHAEGRACIZJHC-BHGPYPJTSA-N (6R)-8-oxo-3-(1,2,4-thiadiazol-5-ylsulfanylmethyl)-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NC=NS2)C(=O)O)C1=O QBHAEGRACIZJHC-BHGPYPJTSA-N 0.000 description 1
- GBTLCUJXTFERJD-VWHLGCFUSA-N (6R)-8-oxo-3-(1,3-thiazol-5-ylsulfanylmethyl)-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=CN=CS2)C(=O)O)C1=O GBTLCUJXTFERJD-VWHLGCFUSA-N 0.000 description 1
- FPQOYFIYAFWMPJ-AVWCQEFESA-N (6R)-8-oxo-3-(2H-tetrazol-5-ylsulfanylmethyl)-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2)C(=O)O)C1=O FPQOYFIYAFWMPJ-AVWCQEFESA-N 0.000 description 1
- VSOLAOMVBOVDQR-BVCHHSEASA-N (6R)-8-oxo-3-(pyrazin-2-ylsulfanylmethyl)-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NC=CN=C2)C(=O)O)C1=O VSOLAOMVBOVDQR-BVCHHSEASA-N 0.000 description 1
- XALKMYZTHJSZAN-BVCHHSEASA-N (6R)-8-oxo-3-(pyridazin-3-ylsulfanylmethyl)-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2N=NC=CC=2)C(=O)O)C1=O XALKMYZTHJSZAN-BVCHHSEASA-N 0.000 description 1
- CGWFATQVCRUALK-IBKOBQKLSA-N (6R)-8-oxo-3-(pyridin-2-ylsulfanylmethyl)-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NC=CC=C2)C(=O)O)C1=O CGWFATQVCRUALK-IBKOBQKLSA-N 0.000 description 1
- DWFCZZIVERWNHX-BVCHHSEASA-N (6R)-8-oxo-3-(pyrimidin-4-ylsulfanylmethyl)-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NC=NC=C2)C(=O)O)C1=O DWFCZZIVERWNHX-BVCHHSEASA-N 0.000 description 1
- LBSFHRHQTRIKMD-AKHNDEDKSA-N (6r)-7-[[2-(benzenesulfinyl)acetyl]amino]-8-oxo-3-(2h-tetrazol-5-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C=1C=CC=CC=1S(=O)CC(=O)NC([C@H]1SC2)C(=O)N1C(C(=O)O)=C2CSC=1N=NNN=1 LBSFHRHQTRIKMD-AKHNDEDKSA-N 0.000 description 1
- LRGZZONZUPMKGF-HWZXHQHMSA-N (6r)-7-amino-8-oxo-3-(2h-tetrazol-5-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)N)CC=1CSC=1N=NNN=1 LRGZZONZUPMKGF-HWZXHQHMSA-N 0.000 description 1
- IKWLIQXIPRUIDU-ZCFIWIBFSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCS[C@@H]2CC(=O)N12 IKWLIQXIPRUIDU-ZCFIWIBFSA-N 0.000 description 1
- SIJJLKCHUXUKEI-NWTJFQKVSA-N (6r)-8-oxo-7-[(2-thiophen-2-ylsulfinylacetyl)amino]-3-(2h-triazol-4-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C=1C=CSC=1S(=O)CC(=O)NC([C@H]1SC2)C(=O)N1C(C(=O)O)=C2CSC=1C=NNN=1 SIJJLKCHUXUKEI-NWTJFQKVSA-N 0.000 description 1
- 125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 description 1
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 1
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 1
- 125000004517 1,2,5-thiadiazolyl group Chemical group 0.000 description 1
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical compound N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 description 1
- IZAMAHOXLXWGDM-UHFFFAOYSA-N 2-(1-methyltetrazol-5-yl)sulfinylacetic acid Chemical compound CN1N=NN=C1S(=O)CC(O)=O IZAMAHOXLXWGDM-UHFFFAOYSA-N 0.000 description 1
- AWFYPPSBLUWMFQ-UHFFFAOYSA-N 2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]-1-(1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NN=C(O1)CC(=O)N1CC2=C(CC1)NN=C2 AWFYPPSBLUWMFQ-UHFFFAOYSA-N 0.000 description 1
- 125000006280 2-bromobenzyl group Chemical group [H]C1=C([H])C(Br)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- WFWHMPLURQHHER-UHFFFAOYSA-N 2-thiophen-2-ylethanethioic s-acid Chemical compound SC(=O)CC1=CC=CS1 WFWHMPLURQHHER-UHFFFAOYSA-N 0.000 description 1
- KXWYPHNQESQOBK-UHFFFAOYSA-N 2-thiophen-3-ylsulfinylacetic acid Chemical compound OC(=O)CS(=O)C=1C=CSC=1 KXWYPHNQESQOBK-UHFFFAOYSA-N 0.000 description 1
- 125000005809 3,4,5-trimethoxyphenyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- 125000006279 3-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Br)=C1[H])C([H])([H])* 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- XIGLTAIYUXJUPG-UNCUMJNESA-N C(C)(C)(C)OC(=O)C1=C(CS[C@H]2N1C(C2NC(CS(=O)C=2SC=CC2)=O)=O)CSC2=NN=NN2C Chemical compound C(C)(C)(C)OC(=O)C1=C(CS[C@H]2N1C(C2NC(CS(=O)C=2SC=CC2)=O)=O)CSC2=NN=NN2C XIGLTAIYUXJUPG-UNCUMJNESA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- DZCDMUGOVYRUIP-UHFFFAOYSA-N ClC1(C(N(N(N(C1)Cl)Cl)Cl)(P(=O)(O)OP(=O)(O)OP(=O)(O)O)Cl)Cl Chemical compound ClC1(C(N(N(N(C1)Cl)Cl)Cl)(P(=O)(O)OP(=O)(O)OP(=O)(O)O)Cl)Cl DZCDMUGOVYRUIP-UHFFFAOYSA-N 0.000 description 1
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 1
- 241000588914 Enterobacter Species 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- 206010034038 Parotitis Diseases 0.000 description 1
- 206010035664 Pneumonia Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 206010037596 Pyelonephritis Diseases 0.000 description 1
- KYVLERSRHDYBEX-HTGMIYTESA-M S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)[O-])C1=O.[Na+] Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)[O-])C1=O.[Na+] KYVLERSRHDYBEX-HTGMIYTESA-M 0.000 description 1
- NTXOVVYCXZYVPE-CFYGOAOJSA-N S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2CC)C(=O)O)C1=O Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2CC)C(=O)O)C1=O NTXOVVYCXZYVPE-CFYGOAOJSA-N 0.000 description 1
- DTYAMYPMGOIEMK-QPTWLILBSA-N S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2SC=CC2)C(=O)O)C1=O Chemical compound S1C(=CC=C1)S(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2SC=CC2)C(=O)O)C1=O DTYAMYPMGOIEMK-QPTWLILBSA-N 0.000 description 1
- 241000607142 Salmonella Species 0.000 description 1
- 206010040047 Sepsis Diseases 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- SWEDAZLCYJDAGW-UHFFFAOYSA-N Thiophene-2-thiol Chemical compound SC1=CC=CS1 SWEDAZLCYJDAGW-UHFFFAOYSA-N 0.000 description 1
- 210000000683 abdominal cavity Anatomy 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000004849 alkoxymethyl group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical group 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- RTEXIPZMMDUXMR-UHFFFAOYSA-N benzene;ethyl acetate Chemical compound CCOC(C)=O.C1=CC=CC=C1 RTEXIPZMMDUXMR-UHFFFAOYSA-N 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- MDHYEMXUFSJLGV-UHFFFAOYSA-N beta-phenethyl acetate Natural products CC(=O)OCCC1=CC=CC=C1 MDHYEMXUFSJLGV-UHFFFAOYSA-N 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 210000000941 bile Anatomy 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 206010006451 bronchitis Diseases 0.000 description 1
- RRKTZKIUPZVBMF-IBTVXLQLSA-N brucine Chemical compound O([C@@H]1[C@H]([C@H]2C3)[C@@H]4N(C(C1)=O)C=1C=C(C(=CC=11)OC)OC)CC=C2CN2[C@@H]3[C@]41CC2 RRKTZKIUPZVBMF-IBTVXLQLSA-N 0.000 description 1
- RRKTZKIUPZVBMF-UHFFFAOYSA-N brucine Natural products C1=2C=C(OC)C(OC)=CC=2N(C(C2)=O)C3C(C4C5)C2OCC=C4CN2C5C31CC2 RRKTZKIUPZVBMF-UHFFFAOYSA-N 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 201000001352 cholecystitis Diseases 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 201000003146 cystitis Diseases 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- UCQFCFPECQILOL-UHFFFAOYSA-N diethyl hydrogen phosphate Chemical compound CCOP(O)(=O)OCC UCQFCFPECQILOL-UHFFFAOYSA-N 0.000 description 1
- 239000008151 electrolyte solution Substances 0.000 description 1
- 229940021013 electrolyte solution Drugs 0.000 description 1
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000012847 fine chemical Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002596 lactones Chemical group 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- XELZGAJCZANUQH-UHFFFAOYSA-N methyl 1-acetylthieno[3,2-c]pyrazole-5-carboxylate Chemical compound CC(=O)N1N=CC2=C1C=C(C(=O)OC)S2 XELZGAJCZANUQH-UHFFFAOYSA-N 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- ACTNHJDHMQSOGL-UHFFFAOYSA-N n',n'-dibenzylethane-1,2-diamine Chemical class C=1C=CC=CC=1CN(CCN)CC1=CC=CC=C1 ACTNHJDHMQSOGL-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 201000008383 nephritis Diseases 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 206010034674 peritonitis Diseases 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 208000008423 pleurisy Diseases 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical class CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- 201000004537 pyelitis Diseases 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 208000013223 septicemia Diseases 0.000 description 1
- VYPDUQYOLCLEGS-UHFFFAOYSA-M sodium;2-ethylhexanoate Chemical compound [Na+].CCCCC(CC)C([O-])=O VYPDUQYOLCLEGS-UHFFFAOYSA-M 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- ZHBAHLGOXUKPGD-QHDYGNBISA-N tert-butyl (6r)-7-amino-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound CN1N=NN=C1SCC1=C(C(=O)OC(C)(C)C)N2C(=O)C(N)[C@H]2SC1 ZHBAHLGOXUKPGD-QHDYGNBISA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000004149 thio group Chemical group *S* 0.000 description 1
- XJLBFCVPIIFHQU-UHFFFAOYSA-N triazine;trihydrochloride Chemical compound Cl.Cl.Cl.C1=CN=NN=C1 XJLBFCVPIIFHQU-UHFFFAOYSA-N 0.000 description 1
- 208000025301 tympanitis Diseases 0.000 description 1
- 210000001635 urinary tract Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/30—Hetero atoms other than halogen
- C07D333/34—Sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP14918074A JPS5180886A (ja) | 1974-12-28 | 1974-12-28 | Ganiosefuarosuhorinnoseiho |
| JP6958975A JPS51146492A (en) | 1975-06-11 | 1975-06-11 | Process for preparing phenylsulfinylacetamidocephalosporins |
| JP8576375A JPS5210289A (en) | 1975-07-15 | 1975-07-15 | Process for preparing penicillins and cephalosporins having thionylsul finyl group |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH622799A5 true CH622799A5 (enExample) | 1981-04-30 |
Family
ID=27300085
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1685075A CH622799A5 (enExample) | 1974-12-28 | 1975-12-29 |
Country Status (10)
| Country | Link |
|---|---|
| US (2) | US4172197A (enExample) |
| CA (1) | CA1072080A (enExample) |
| CH (1) | CH622799A5 (enExample) |
| DE (1) | DE2558869C2 (enExample) |
| DK (1) | DK586175A (enExample) |
| FR (1) | FR2295752A1 (enExample) |
| GB (1) | GB1527109A (enExample) |
| HU (1) | HU171207B (enExample) |
| NL (1) | NL7515085A (enExample) |
| SE (1) | SE7514646L (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1527109A (en) * | 1974-12-28 | 1978-10-04 | Asahi Chemical Ind | Cephalosporin derivatives and process for preparing same |
| US4229573A (en) | 1977-06-21 | 1980-10-21 | Asahi Kasei Kogyo Kabushiki Kaisha | 7α-Methoxycephalosporin derivatives |
| US4314059A (en) * | 1978-03-09 | 1982-02-02 | Chisei Shibuya | Process for preparing cephalosporin compounds |
| US4968815A (en) * | 1990-04-16 | 1990-11-06 | Merck & Co., Inc. | Synthesis of (S)-3-(thien-2-ylthio)butyric acid analogs |
| US4968814A (en) * | 1990-04-18 | 1990-11-06 | Merck & Co., Inc. | (S)-Alkyl 3-(thien-2-ylthio)butyrate and analogs and synthesis thereof |
| US5567698A (en) * | 1995-02-15 | 1996-10-22 | Bristol-Myers Squibb Company | Pyridinium thiomethyl substituted chepholosporin derivatives |
| KR20060109871A (ko) * | 2003-11-14 | 2006-10-23 | 템플 유니버시티-오브 더 커먼웰쓰 시스템 오브 하이어 에듀케이션 | 증식성 질병 치료용 알파, 베타-불포화 설폭시드 |
| US8198434B2 (en) * | 2008-05-07 | 2012-06-12 | Idexx Laboratories, Inc. | Process for preparing cefsulodin sodium |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2581626A (en) * | 1948-10-06 | 1952-01-08 | Socony Vacuum Oil Co Inc | Thienylthio carboxylic acids and thienylthio carboxylic acid esters in lubricating compositions |
| US3288859A (en) * | 1965-03-30 | 1966-11-29 | Procter & Gamble | Reactions of alkali metal salts of sulfinyl carbanions and alkanesulfenates with epoxy compounds and novel compounds derived therefrom |
| US3382238A (en) * | 1967-04-27 | 1968-05-07 | Squibb & Sons Inc | Penicillin and cephalosporin derivatives |
| US3865819A (en) * | 1972-05-03 | 1975-02-11 | Smithkline Corp | Substituted sulfonylacetamido cephalosporins |
| US3828037A (en) * | 1972-07-20 | 1974-08-06 | Smithkline Corp | Trifluoromethylmercaptoacetamidocephalosporins |
| US3904606A (en) * | 1973-01-12 | 1975-09-09 | Upjohn Co | Process for preparing optically active 6-(' -amino-acetamido)penicillanic acids and 7-(' -aminoacetamido) cephalosporanic acids |
| US3912726A (en) * | 1973-02-16 | 1975-10-14 | Squibb & Sons Inc | Process for the preparation of 7-(D-2-amino-2-(1,4-cyclo-hexadienyl) acetamido) desacetoxycephalosporanic acid and 7-(D-2-amino-2-(1,4-cyclohexadienyl) acetamido) cephalosporanic acid |
| US3880848A (en) * | 1973-06-18 | 1975-04-29 | Smithkline Corp | 7-Trifluorome thylsulfinylacetamido cephalosporins |
| DE2424740C3 (de) * | 1974-05-21 | 1981-02-19 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Thiophenderivate, Verfahren zu |
| GB1527109A (en) * | 1974-12-28 | 1978-10-04 | Asahi Chemical Ind | Cephalosporin derivatives and process for preparing same |
| US4093723A (en) * | 1976-05-19 | 1978-06-06 | Smithkline Corporation | 7-Acyl-3-(sulfonic acid and sulfamoyl substituted tetrazolyl thiomethyl) cephalosporins |
| US4045438A (en) * | 1975-10-24 | 1977-08-30 | Yeda Research And Development Co. Ltd. | Cephalosporin antibiotics |
| US4118491A (en) * | 1976-03-11 | 1978-10-03 | Smithkline Corporation | 7-Acyl-3-(sulfaminoalkyl substituted tetrazolylthiomethyl)cephalosporins, antibacterial compositions containing them and methods of treating bacterial infections with them |
| US4025626A (en) * | 1975-12-09 | 1977-05-24 | Smithkline Corporation | 7-Acyl-3-(ureidoalkyl substituted tetrazolylthiomethyl)-cephalosporins |
-
1975
- 1975-12-22 GB GB52467/75A patent/GB1527109A/en not_active Expired
- 1975-12-22 DK DK586175A patent/DK586175A/da unknown
- 1975-12-23 HU HU75AA00000838A patent/HU171207B/hu unknown
- 1975-12-23 SE SE7514646A patent/SE7514646L/xx not_active Application Discontinuation
- 1975-12-24 NL NL7515085A patent/NL7515085A/xx not_active Application Discontinuation
- 1975-12-24 US US05/644,241 patent/US4172197A/en not_active Expired - Lifetime
- 1975-12-26 FR FR7539873A patent/FR2295752A1/fr active Granted
- 1975-12-27 DE DE2558869A patent/DE2558869C2/de not_active Expired
- 1975-12-29 CA CA242,568A patent/CA1072080A/en not_active Expired
- 1975-12-29 CH CH1685075A patent/CH622799A5/de not_active IP Right Cessation
-
1979
- 1979-09-27 US US06/079,256 patent/US4245107A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| NL7515085A (nl) | 1976-06-30 |
| GB1527109A (en) | 1978-10-04 |
| US4245107A (en) | 1981-01-13 |
| DE2558869A1 (de) | 1976-07-01 |
| SE7514646L (sv) | 1976-06-29 |
| CA1072080A (en) | 1980-02-19 |
| DK586175A (da) | 1976-06-29 |
| US4172197A (en) | 1979-10-23 |
| FR2295752A1 (fr) | 1976-07-23 |
| HU171207B (hu) | 1977-12-28 |
| FR2295752B1 (enExample) | 1981-07-31 |
| DE2558869C2 (de) | 1982-09-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2519400C3 (de) | Penicillinverbindungen, Verfahren zur Herstellung derselben und Mittel mit einem Gehalt derselben | |
| CH628058A5 (de) | Verfahren zur herstellung von cephemverbindungen. | |
| DE3512225A1 (de) | Cephalosporinverbindungen, verfahren zu ihrer herstellung und pharmazeutische mittel | |
| DE2538804A1 (de) | Neue cephalosporinderivate, verfahren zu ihrer herstellung und sie enthaltende mittel | |
| CH622799A5 (enExample) | ||
| DE2714214A1 (de) | 7-alpha-ureidoacylamido-7alpha- methoxy- und -desmethoxycephalosporansaeure-derivate | |
| EP0000500B1 (de) | Cephalosporinderivate, Verfahren zu deren Herstellung und deren pharmazeutische Präparate | |
| DE2539411A1 (de) | Cephamycine, ihre salze, verfahren zu ihrer herstellung und arzneipraeparate | |
| CH626624A5 (enExample) | ||
| CH666037A5 (de) | Verfahren zur herstellung von cephalosporin-syn-isomeren. | |
| CH615186A5 (en) | Process for the preparation of cephem compounds | |
| DE2253801A1 (de) | 2-(thiocarbonylamino)acetamidocephalosporansaeureverbindungen | |
| DE2559932C2 (de) | Cephalosporine, Verfahren zur Herstellung derselben und Mittel mit einem Gehalt derselben | |
| DE2632051A1 (de) | 7- eckige klammer auf alpha-amino- omega-(2,3-methylendioxyphenyl)acylamido eckige klammer zu cephalosporansaeure-derivate und verfahren zu deren herstellung | |
| DE2530228A1 (de) | (((alkylthiocarbonyl)oxy)acetyl) cephalosporine | |
| DE2655717A1 (de) | Thiadiazolylderivate von 7-acylamido-3-cephem-4-carbonsaeure, verfahren zu deren herstellung und dieselben enthaltende pharmazeutische und veterinaermedizinische mittel | |
| DE2236422C2 (de) | Cephalosporinverbindungen und Verfahren zu deren Herstellung | |
| CH627756A5 (en) | Process for the preparation of 3-acyloxymethylcephem compounds | |
| DE2727977C3 (de) | 7α -Methoxycephalosporinderivate und sie enthaltende Arzneimittel | |
| DE2722666C2 (de) | 7-Acylamino-3-pyrazinylthiomethyl- 3-cephem-4-carbonsäure-Verbindungen und ihre Verwendung/Bekämpfung bakterieller Infektionen | |
| US3962229A (en) | 2-(Thiocarbonylamino)acetamido-7α-methoxy cephalosporanic acid compounds | |
| DE2539214A1 (de) | 7-methoxythienyl- und -furyl-ureido- cephalosporine | |
| DE2344451C2 (de) | 7-[β-Aminoacylamino]-3-substituierte-3-cephem-4-carbonsäure-Derivate, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Mittel | |
| EP0053276A2 (de) | Neue Cephalosporine, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2443424A1 (de) | Cephalosporinverbindungen und ihre verwendung in arzneimitteln |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |