DE2557141C2 - Reaktivfarbstoffe, deren Herstellung und Verwendung - Google Patents
Reaktivfarbstoffe, deren Herstellung und VerwendungInfo
- Publication number
- DE2557141C2 DE2557141C2 DE2557141A DE2557141A DE2557141C2 DE 2557141 C2 DE2557141 C2 DE 2557141C2 DE 2557141 A DE2557141 A DE 2557141A DE 2557141 A DE2557141 A DE 2557141A DE 2557141 C2 DE2557141 C2 DE 2557141C2
- Authority
- DE
- Germany
- Prior art keywords
- formula
- parts
- dye
- sulfo
- dyes
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000985 reactive dye Substances 0.000 title description 5
- 239000000975 dye Substances 0.000 claims description 79
- -1 hydroxy, carboxy Chemical group 0.000 claims description 52
- BOLDJAUMGUJJKM-LSDHHAIUSA-N renifolin D Natural products CC(=C)[C@@H]1Cc2c(O)c(O)ccc2[C@H]1CC(=O)c3ccc(O)cc3O BOLDJAUMGUJJKM-LSDHHAIUSA-N 0.000 claims description 22
- VMKJWLXVLHBJNK-UHFFFAOYSA-N cyanuric fluoride Chemical compound FC1=NC(F)=NC(F)=N1 VMKJWLXVLHBJNK-UHFFFAOYSA-N 0.000 claims description 18
- VMGAPWLDMVPYIA-HIDZBRGKSA-N n'-amino-n-iminomethanimidamide Chemical compound N\N=C\N=N VMGAPWLDMVPYIA-HIDZBRGKSA-N 0.000 claims description 18
- 150000001412 amines Chemical class 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 8
- 229910052731 fluorine Inorganic materials 0.000 claims description 6
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 claims description 5
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 claims description 5
- 150000004056 anthraquinones Chemical class 0.000 claims description 5
- PPSZHCXTGRHULJ-UHFFFAOYSA-N dioxazine Chemical compound O1ON=CC=C1 PPSZHCXTGRHULJ-UHFFFAOYSA-N 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 4
- PJANXHGTPQOBST-VAWYXSNFSA-N Stilbene Natural products C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 claims description 4
- 239000000460 chlorine Chemical group 0.000 claims description 4
- 229910052801 chlorine Chemical group 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- 150000004985 diamines Chemical class 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical compound C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 claims description 4
- 235000021286 stilbenes Nutrition 0.000 claims description 4
- AAAQKTZKLRYKHR-UHFFFAOYSA-N triphenylmethane Chemical compound C1=CC=CC=C1C(C=1C=CC=CC=1)C1=CC=CC=C1 AAAQKTZKLRYKHR-UHFFFAOYSA-N 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- IFVTZJHWGZSXFD-UHFFFAOYSA-N biphenylene Chemical group C1=CC=C2C3=CC=CC=C3C2=C1 IFVTZJHWGZSXFD-UHFFFAOYSA-N 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Natural products C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000000542 sulfonic acid group Chemical group 0.000 claims description 2
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 claims 1
- 229920002494 Zein Polymers 0.000 claims 1
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 239000013067 intermediate product Substances 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- 239000005019 zein Substances 0.000 claims 1
- 229940093612 zein Drugs 0.000 claims 1
- 239000000243 solution Substances 0.000 description 26
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 238000009833 condensation Methods 0.000 description 18
- 230000005494 condensation Effects 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 239000010949 copper Substances 0.000 description 14
- 229920000742 Cotton Polymers 0.000 description 12
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- 235000002639 sodium chloride Nutrition 0.000 description 10
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 238000004043 dyeing Methods 0.000 description 8
- 239000000543 intermediate Substances 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 239000011780 sodium chloride Substances 0.000 description 8
- 150000004699 copper complex Chemical class 0.000 description 7
- 239000004744 fabric Substances 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 6
- ZMCHBSMFKQYNKA-UHFFFAOYSA-N 2-aminobenzenesulfonic acid Chemical compound NC1=CC=CC=C1S(O)(=O)=O ZMCHBSMFKQYNKA-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 125000003277 amino group Chemical group 0.000 description 5
- 239000001045 blue dye Substances 0.000 description 5
- 125000001153 fluoro group Chemical group F* 0.000 description 5
- RLGHWJVBICGXRA-UHFFFAOYSA-N n'-amino-n-hydrazinylidenemethanimidamide Chemical compound NN=CN=NN RLGHWJVBICGXRA-UHFFFAOYSA-N 0.000 description 5
- 230000007935 neutral effect Effects 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- HIMMCCJEMMCUJS-UHFFFAOYSA-N 4-fluorotriazine Chemical compound FC1=CC=NN=N1 HIMMCCJEMMCUJS-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- 229920003043 Cellulose fiber Polymers 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 235000011114 ammonium hydroxide Nutrition 0.000 description 4
- 239000003086 colorant Substances 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 239000001488 sodium phosphate Substances 0.000 description 4
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 3
- 240000007817 Olea europaea Species 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 230000009257 reactivity Effects 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 210000002268 wool Anatomy 0.000 description 3
- QJGHJWKPZQIOSN-UHFFFAOYSA-N (4-aminophenyl)methanesulfonic acid Chemical compound NC1=CC=C(CS(O)(=O)=O)C=C1 QJGHJWKPZQIOSN-UHFFFAOYSA-N 0.000 description 2
- FIDRAVVQGKNYQK-UHFFFAOYSA-N 1,2,3,4-tetrahydrotriazine Chemical compound C1NNNC=C1 FIDRAVVQGKNYQK-UHFFFAOYSA-N 0.000 description 2
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 2
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 2
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 239000007844 bleaching agent Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 2
- 229910000397 disodium phosphate Inorganic materials 0.000 description 2
- 235000019800 disodium phosphate Nutrition 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 2
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 2
- 235000019799 monosodium phosphate Nutrition 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000005185 salting out Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 2
- 238000001694 spray drying Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 2
- HRXKRNGNAMMEHJ-UHFFFAOYSA-K trisodium citrate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O HRXKRNGNAMMEHJ-UHFFFAOYSA-K 0.000 description 2
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- JVMSQRAXNZPDHF-UHFFFAOYSA-N 2,4-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(N)=C1 JVMSQRAXNZPDHF-UHFFFAOYSA-N 0.000 description 1
- VOZKAJLKRJDJLL-UHFFFAOYSA-N 2,4-diaminotoluene Chemical compound CC1=CC=C(N)C=C1N VOZKAJLKRJDJLL-UHFFFAOYSA-N 0.000 description 1
- HEAHMJLHQCESBZ-UHFFFAOYSA-N 2,5-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(N)C(S(O)(=O)=O)=C1 HEAHMJLHQCESBZ-UHFFFAOYSA-N 0.000 description 1
- UONVFNLDGRWLKF-UHFFFAOYSA-N 2,5-diaminobenzoic acid Chemical compound NC1=CC=C(N)C(C(O)=O)=C1 UONVFNLDGRWLKF-UHFFFAOYSA-N 0.000 description 1
- FECNOIODIVNEKI-UHFFFAOYSA-N 2-[(2-aminobenzoyl)amino]benzoic acid Chemical class NC1=CC=CC=C1C(=O)NC1=CC=CC=C1C(O)=O FECNOIODIVNEKI-UHFFFAOYSA-N 0.000 description 1
- GIHJOOSCQVEDGA-UHFFFAOYSA-N 2-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1NC1=NC(F)=NC(F)=N1 GIHJOOSCQVEDGA-UHFFFAOYSA-N 0.000 description 1
- MJNYPLCGWXFYPD-UHFFFAOYSA-N 2-amino-5-sulfobenzoic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1C(O)=O MJNYPLCGWXFYPD-UHFFFAOYSA-N 0.000 description 1
- BMDSAXKBAODBMC-UHFFFAOYSA-N 2-hydrazinylbenzene-1,4-disulfonic acid Chemical compound NNC1=CC(S(O)(=O)=O)=CC=C1S(O)(=O)=O BMDSAXKBAODBMC-UHFFFAOYSA-N 0.000 description 1
- KNOUFVBOBNEGMH-UHFFFAOYSA-N 3,7-diaminonaphthalene-1,5-disulfonic acid Chemical compound C1=C(N)C=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 KNOUFVBOBNEGMH-UHFFFAOYSA-N 0.000 description 1
- AJHPGXZOIAYYDW-UHFFFAOYSA-N 3-(2-cyanophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)NC(C(O)=O)CC1=CC=CC=C1C#N AJHPGXZOIAYYDW-UHFFFAOYSA-N 0.000 description 1
- VTSFNCCQCOEPKF-UHFFFAOYSA-N 3-amino-1h-pyridin-2-one Chemical compound NC1=CC=CN=C1O VTSFNCCQCOEPKF-UHFFFAOYSA-N 0.000 description 1
- SIXYIEWSUKAOEN-UHFFFAOYSA-N 3-aminobenzaldehyde Chemical compound NC1=CC=CC(C=O)=C1 SIXYIEWSUKAOEN-UHFFFAOYSA-N 0.000 description 1
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 1
- AIRRELHUAAZTTL-UHFFFAOYSA-N 3-nitrobenzenesulfonic acid;sodium Chemical compound [Na].OS(=O)(=O)C1=CC=CC([N+]([O-])=O)=C1 AIRRELHUAAZTTL-UHFFFAOYSA-N 0.000 description 1
- BPWSQBVQMDHRSQ-UHFFFAOYSA-N 4,6-difluoro-1,3,5-triazin-2-amine Chemical compound NC1=NC(F)=NC(F)=N1 BPWSQBVQMDHRSQ-UHFFFAOYSA-N 0.000 description 1
- BXWKHWCXQWEOBL-UHFFFAOYSA-N 4,6-difluoro-n-phenyl-1,3,5-triazin-2-amine Chemical compound FC1=NC(F)=NC(NC=2C=CC=CC=2)=N1 BXWKHWCXQWEOBL-UHFFFAOYSA-N 0.000 description 1
- HLBLWEWZXPIGSM-UHFFFAOYSA-N 4-Aminophenyl ether Chemical compound C1=CC(N)=CC=C1OC1=CC=C(N)C=C1 HLBLWEWZXPIGSM-UHFFFAOYSA-N 0.000 description 1
- MBJAPGAZEWPEFB-UHFFFAOYSA-N 5-amino-2-(4-amino-2-sulfophenyl)benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1C1=CC=C(N)C=C1S(O)(=O)=O MBJAPGAZEWPEFB-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000530268 Lycaena heteronea Species 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- QKZIVVMOMKTVIK-UHFFFAOYSA-N anilinomethanesulfonic acid Chemical compound OS(=O)(=O)CNC1=CC=CC=C1 QKZIVVMOMKTVIK-UHFFFAOYSA-N 0.000 description 1
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 229940018564 m-phenylenediamine Drugs 0.000 description 1
- LVWZTYCIRDMTEY-UHFFFAOYSA-N metamizole Chemical compound O=C1C(N(CS(O)(=O)=O)C)=C(C)N(C)N1C1=CC=CC=C1 LVWZTYCIRDMTEY-UHFFFAOYSA-N 0.000 description 1
- SQYUJKVKVFILNB-UHFFFAOYSA-N methyl 2-amino-4-[(2,5-dichlorophenyl)carbamoyl]benzoate Chemical compound C1=C(N)C(C(=O)OC)=CC=C1C(=O)NC1=CC(Cl)=CC=C1Cl SQYUJKVKVFILNB-UHFFFAOYSA-N 0.000 description 1
- 125000005184 naphthylamino group Chemical group C1(=CC=CC2=CC=CC=C12)N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 1
- 239000003415 peat Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/02—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring
- C09B62/04—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring to a triazine ring
- C09B62/043—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring to a triazine ring containing two or more triazine rings linked together by a non-chromophoric link
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/02—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring
- C09B62/04—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring to a triazine ring
- C09B62/046—Specific dyes not provided for in group C09B62/06 - C09B62/10
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1703974A CH612448A5 (cg-RX-API-DMAC7.html) | 1974-12-20 | 1974-12-20 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2557141A1 DE2557141A1 (de) | 1976-07-01 |
| DE2557141C2 true DE2557141C2 (de) | 1983-05-11 |
Family
ID=4422283
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2557141A Expired DE2557141C2 (de) | 1974-12-20 | 1975-12-18 | Reaktivfarbstoffe, deren Herstellung und Verwendung |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4556706A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5533777B2 (cg-RX-API-DMAC7.html) |
| BE (1) | BE836852A (cg-RX-API-DMAC7.html) |
| BR (1) | BR7508483A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1070676A (cg-RX-API-DMAC7.html) |
| CH (1) | CH612448A5 (cg-RX-API-DMAC7.html) |
| CS (2) | CS190548B2 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2557141C2 (cg-RX-API-DMAC7.html) |
| ES (1) | ES443667A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2295090A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1511730A (cg-RX-API-DMAC7.html) |
| IN (1) | IN144619B (cg-RX-API-DMAC7.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2747011A1 (de) * | 1976-10-21 | 1978-04-27 | Ciba Geigy Ag | Verfahren zur monoacylierung von aminohydroxynaphtalinsulfonsaeuren mit 2,4,6-triflour-s-triazin |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1121683B (it) * | 1975-11-06 | 1986-04-10 | Ciba Geigy Ag | Coloranti reattivi per fibre de procedimento per la loro produzione ed applicazione |
| LU78082A1 (de) * | 1977-09-06 | 1979-05-23 | Ciba Geigy Ag | Farbstoffe,deren herstellung und verwendung |
| DE2840380C2 (de) * | 1978-09-16 | 1985-05-30 | Bayer Ag, 5090 Leverkusen | Faserreaktive Azofarbstoffe |
| JPS6018357B2 (ja) * | 1979-06-20 | 1985-05-09 | 住友化学工業株式会社 | セルロ−ズ系繊維の染色法 |
| JPS5915451A (ja) * | 1982-07-19 | 1984-01-26 | Sumitomo Chem Co Ltd | 金属ホルマザン化合物、その製造法およびそれを用いる繊維材料の染色方法 |
| JPS6067562A (ja) * | 1983-09-24 | 1985-04-17 | Nippon Kayaku Co Ltd | ホルマザン化合物及びこれを用いるセルロ−ス系繊維の染色法 |
| DE3440265A1 (de) * | 1984-11-03 | 1986-05-15 | Hoechst Ag, 6230 Frankfurt | Kupfer-formazanverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| DE3516667A1 (de) * | 1985-05-09 | 1986-11-13 | Bayer Ag, 5090 Leverkusen | Metallkomplex-farbstoffe |
| US4872881A (en) * | 1987-06-30 | 1989-10-10 | Mitsubishi Kasei Corporation | Mixtures of water-soluble red and yellow or blue reactive dyes and a method of dyeing cellulosic fibers using such dye mixtures |
| DE3737536A1 (de) * | 1987-11-05 | 1989-05-18 | Basf Ag | Kupfer-formazanreaktivfarbstoffe und ihre verwendung |
| DE3743236A1 (de) * | 1987-12-19 | 1989-06-29 | Bayer Ag | Schwermetallhaltige formazanfarbstoffe, verfahren zu ihrer herstellung und ihre verwendung zum faerben und bedrucken von fasermaterialien |
| EP0333656B1 (de) * | 1988-03-17 | 1993-04-28 | Ciba-Geigy Ag | Reaktivfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung |
| US4960180A (en) * | 1988-05-13 | 1990-10-02 | Livingston Products, Inc. | Wheelchair |
| EP0352222B1 (de) * | 1988-06-29 | 1994-05-25 | Ciba-Geigy Ag | Faserreaktive Formazanfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung |
| DE3840653A1 (de) * | 1988-12-02 | 1990-06-07 | Basf Ag | Reaktivfarbstoffe auf basis von kupfer-formazan |
| DE3910649A1 (de) * | 1989-04-01 | 1990-10-11 | Basf Ag | Reaktivfarbstoffe, die zwei oder drei stickstoffhaltige halogenheterocyclen als anker aufweisen |
| US5245020A (en) * | 1989-04-01 | 1993-09-14 | Basf Aktiengesellschaft | Reactive dyes with two or three nitrogen-containing haloheterocycles as reactive system |
| DE3917046A1 (de) * | 1989-05-25 | 1990-11-29 | Bayer Ag | Verfahren zur herstellung von substituierten 2,4-diamino-6-fluor-s-triazinen |
| DE59010337D1 (de) * | 1989-11-01 | 1996-06-27 | Ciba Geigy Ag | Faserreaktive Formazanfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung |
| DE4142766C1 (cg-RX-API-DMAC7.html) * | 1991-12-04 | 1993-02-18 | Bayer Ag, 5090 Leverkusen, De | |
| KR0135648B1 (ko) * | 1995-04-08 | 1998-04-22 | 성낙관 | 2환성 금속착염포르마잔유도체, 그 유도체의 제조방법, 그 유도체를 함유하는 조성물 및 그 유도체를 이용한 염색방법 |
| US5936073A (en) * | 1998-12-04 | 1999-08-10 | Everlight Usa, Inc. | Reactive formazan dyestuffs |
| US6407220B1 (en) * | 2001-12-14 | 2002-06-18 | Everlight Usa, Inc. | Reactive formazan dyestuffs |
| CN102311668B (zh) * | 2010-07-08 | 2013-09-18 | 上海雅运纺织化工股份有限公司 | 蓝色活性染料组合物及其在纤维上的染色应用 |
| CN103422368B (zh) * | 2012-05-22 | 2015-06-17 | 江南大学 | 一种棉制品低浴比还原染料染色方法 |
| EP3408331B1 (en) | 2016-01-29 | 2021-10-20 | Huntsman Advanced Materials (Switzerland) GmbH | Fibre reactive formazan dyes, their preparation and their use |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3068219A (en) * | 1959-11-13 | 1962-12-11 | Geigy Ag J R | Formazane dyes containing a halogen-pyrimidyl substituent |
| GB950861A (en) * | 1959-11-13 | 1964-02-26 | Geigy Ag J R | Improvements relating to metal-containing formazane reactive dyestuffs and their use |
| DE1152774B (de) * | 1959-11-13 | 1963-08-14 | Geigy Ag J R | Verfahren zur Herstellung von metallhaltigen, reaktiven Farbstoffen |
| DE1155872B (de) * | 1960-01-15 | 1963-10-17 | Geigy Ag J R | Verfahren zur Herstellung von metallhaltigen, reaktiven Farbstoffen |
| GB963426A (en) * | 1960-01-15 | 1964-07-08 | Geigy Ag J R | Improvements relating to metal-containing formazane reactive dyestuffs and their use |
| DE1198469B (de) * | 1961-02-27 | 1965-08-12 | Basf Ag | Verfahren zur Herstellung von wasserloeslichen Reaktivfarbstoffen der Anthrachinonreihe |
| CH431758A (de) * | 1963-07-10 | 1967-03-15 | Geigy Ag J R | Verfahren zur Herstellung neuer reaktiver Farbstoffe |
| CH499604A (de) * | 1966-04-22 | 1970-11-30 | Ciba Geigy Ag | Verfahren zur Herstellung von faserreaktiven schwermetallhaltigen Formazanazofarbstoffen |
| CH484243A (de) * | 1966-04-22 | 1970-01-15 | Geigy Ag J R | Verfahren zur Herstellung von schwermetallhaltigen Formazanazofarbstoffen |
| FR1532010A (fr) * | 1966-07-21 | 1968-07-05 | Geigy Ag J R | Colorants de la série des formazans, leur préparation et leurs applications |
| US4024123A (en) * | 1966-07-21 | 1977-05-17 | Paul Dussy | Fiber-reactive, heavy metal-containing formazane dyestuffs |
| DE1644208C3 (de) * | 1967-04-19 | 1978-06-01 | Bayer Ag, 5090 Leverkusen | Reaktivfarbstoffe |
| BE757602A (fr) * | 1969-10-17 | 1971-04-16 | Geigy Ag J R | Colorants reactifs et leur preparation |
| GB1389054A (en) * | 1972-02-22 | 1975-04-03 | Ici Ltd | Reactive dyestuff |
| GB1398601A (en) * | 1972-08-31 | 1975-06-25 | Ici Ltd | Reactive formazan dyestuffs |
-
1974
- 1974-12-20 CH CH1703974A patent/CH612448A5/xx not_active IP Right Cessation
-
1975
- 1975-12-11 IN IN2328/CAL/1975A patent/IN144619B/en unknown
- 1975-12-16 CS CS772008A patent/CS190548B2/cs unknown
- 1975-12-16 CS CS758578A patent/CS190506B2/cs unknown
- 1975-12-17 FR FR7538708A patent/FR2295090A1/fr active Granted
- 1975-12-18 CA CA242,023A patent/CA1070676A/en not_active Expired
- 1975-12-18 DE DE2557141A patent/DE2557141C2/de not_active Expired
- 1975-12-19 BR BR7508483*A patent/BR7508483A/pt unknown
- 1975-12-19 GB GB52229/75A patent/GB1511730A/en not_active Expired
- 1975-12-19 ES ES443667A patent/ES443667A1/es not_active Expired
- 1975-12-19 BE BE162919A patent/BE836852A/xx not_active IP Right Cessation
- 1975-12-20 JP JP15269275A patent/JPS5533777B2/ja not_active Expired
-
1980
- 1980-04-28 US US06/144,140 patent/US4556706A/en not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2747011A1 (de) * | 1976-10-21 | 1978-04-27 | Ciba Geigy Ag | Verfahren zur monoacylierung von aminohydroxynaphtalinsulfonsaeuren mit 2,4,6-triflour-s-triazin |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1511730A (en) | 1978-05-24 |
| BE836852A (fr) | 1976-06-21 |
| FR2295090A1 (fr) | 1976-07-16 |
| JPS5188518A (cg-RX-API-DMAC7.html) | 1976-08-03 |
| ES443667A1 (es) | 1977-04-16 |
| US4556706A (en) | 1985-12-03 |
| CS190548B2 (en) | 1979-05-31 |
| DE2557141A1 (de) | 1976-07-01 |
| CH612448A5 (cg-RX-API-DMAC7.html) | 1979-07-31 |
| CA1070676A (en) | 1980-01-29 |
| IN144619B (cg-RX-API-DMAC7.html) | 1978-05-20 |
| FR2295090B1 (cg-RX-API-DMAC7.html) | 1978-05-19 |
| CS190506B2 (en) | 1979-05-31 |
| BR7508483A (pt) | 1976-08-24 |
| JPS5533777B2 (cg-RX-API-DMAC7.html) | 1980-09-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2557141C2 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| EP0070807B1 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| CH628670A5 (de) | Verfahren zur herstellung von reaktivfarbstoffen. | |
| DE2050948A1 (de) | Reaktive Farbstoffe und Verfahren zu deren Herstellung | |
| DE60101903T2 (de) | Faserreaktive disazoverbindungen | |
| DE2657341C2 (de) | Faserreaktive Azofarbstoffe, deren Herstellung und Verwendung | |
| CH618458A5 (cg-RX-API-DMAC7.html) | ||
| DE2601043A1 (de) | Tetrareaktive disazofarbstoffe, deren herstellung und verwendung | |
| DE69934115T2 (de) | Mono- und disazoreaktivfarbstoffe | |
| EP0120807B1 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| DE2729011A1 (de) | Reaktivfarbstoffe | |
| EP0096659B1 (de) | Verfahren zum Färben oder Bedrucken von textilen Fasermaterialien mit Reaktivfarbstoffen | |
| DE69810765T2 (de) | Fasereaktive disazofarbstoffe | |
| DE69702963T2 (de) | Faserreaktive farbstoffe | |
| CH641197A5 (de) | Reaktive monoazofarbstoffe und verfahren zu deren herstellung. | |
| EP0333656B1 (de) | Reaktivfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung | |
| EP0112797A1 (de) | Verfahren zum Färben oder Bedrucken von cellulosehaltigem Fasermaterial mit Reaktivfarbstoffen | |
| EP0761767A1 (de) | Aluminium-Phthalocyanin-Reaktivfarbstoffe | |
| KR0181491B1 (ko) | 반응성 염료 및 이의 염료제제 | |
| EP0134197B1 (de) | Reaktivfarbstoffe der Disazoreihe, deren Herstellung und Verwendung | |
| EP0230210B1 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| US6084077A (en) | Disazo dyestuffs | |
| DE2751293A1 (de) | Faserreaktive azofarbstoffe, deren herstellung und verwendung | |
| CH640558A5 (de) | Reaktivfarbstoffe. | |
| DE3151959A1 (de) | Bisazoreaktivfarbstoffe, verfahren zu ihrer herstellung und ihre verwendung zum faerben und bedrucken von hydroxylgruppen- oder stickstoffhaltigem fasermaterial |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8126 | Change of the secondary classification |
Ipc: D06P 1/382 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: SCHWABE, H., DIPL.-ING. SANDMAIR, K., DIPL.-CHEM. DR.JUR. DR.RER.NAT., PAT.-ANW., 8000 MUENCHEN |