DE2539895C2 - Verfahren zur Herstellung von 2- Dihalogenvinylcyclopropancarbonsäureestern - Google Patents
Verfahren zur Herstellung von 2- DihalogenvinylcyclopropancarbonsäureesternInfo
- Publication number
- DE2539895C2 DE2539895C2 DE2539895A DE2539895A DE2539895C2 DE 2539895 C2 DE2539895 C2 DE 2539895C2 DE 2539895 A DE2539895 A DE 2539895A DE 2539895 A DE2539895 A DE 2539895A DE 2539895 C2 DE2539895 C2 DE 2539895C2
- Authority
- DE
- Germany
- Prior art keywords
- acid
- general formula
- radical
- ethyl ester
- ester
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002253 acid Substances 0.000 title claims description 63
- 150000002148 esters Chemical class 0.000 title claims description 34
- 238000000034 method Methods 0.000 title claims description 30
- 238000002360 preparation method Methods 0.000 title claims description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 84
- 150000001875 compounds Chemical class 0.000 claims description 65
- -1 cycloalkyl radicals Chemical class 0.000 claims description 62
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 48
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 32
- 239000002904 solvent Substances 0.000 claims description 28
- 125000004494 ethyl ester group Chemical group 0.000 claims description 26
- 239000003054 catalyst Substances 0.000 claims description 22
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 20
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 18
- 150000001733 carboxylic acid esters Chemical class 0.000 claims description 17
- 229910052799 carbon Inorganic materials 0.000 claims description 16
- 239000007858 starting material Substances 0.000 claims description 15
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 13
- 150000002905 orthoesters Chemical class 0.000 claims description 13
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 claims description 12
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 11
- 229910052708 sodium Inorganic materials 0.000 claims description 11
- 239000011734 sodium Substances 0.000 claims description 11
- 230000002378 acidificating effect Effects 0.000 claims description 7
- 239000000460 chlorine Chemical group 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 5
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 5
- 229910052740 iodine Inorganic materials 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 230000003197 catalytic effect Effects 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 238000006704 dehydrohalogenation reaction Methods 0.000 claims description 4
- 125000001153 fluoro group Chemical group F* 0.000 claims description 4
- 125000002560 nitrile group Chemical group 0.000 claims description 4
- 229910052700 potassium Inorganic materials 0.000 claims description 4
- 239000011591 potassium Substances 0.000 claims description 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 238000009833 condensation Methods 0.000 claims description 3
- 230000005494 condensation Effects 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical group ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000005907 alkyl ester group Chemical group 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 239000000010 aprotic solvent Substances 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- PIUGWHOPZWEXQQ-UHFFFAOYSA-N ethyl 4,6,6-trichloro-3,3-dimethylhex-5-enoate Chemical compound CCOC(=O)CC(C)(C)C(Cl)C=C(Cl)Cl PIUGWHOPZWEXQQ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 2
- 238000003776 cleavage reaction Methods 0.000 claims 2
- 230000007017 scission Effects 0.000 claims 2
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 claims 1
- OSGNWFPSDDVWTH-UHFFFAOYSA-N CCCC(C)C(C)C(=O)OCC Chemical compound CCCC(C)C(C)C(=O)OCC OSGNWFPSDDVWTH-UHFFFAOYSA-N 0.000 claims 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- IPRBKIRSQCAGNE-UHFFFAOYSA-N [Br].CCl Chemical compound [Br].CCl IPRBKIRSQCAGNE-UHFFFAOYSA-N 0.000 claims 1
- 125000003710 aryl alkyl group Chemical group 0.000 claims 1
- 125000001589 carboacyl group Chemical group 0.000 claims 1
- DDFJIALOXWLNSA-UHFFFAOYSA-N ethyl 4,6,6-trichloro-2,3,3-trimethylhex-5-enoate Chemical compound CCOC(=O)C(C)C(C)(C)C(Cl)C=C(Cl)Cl DDFJIALOXWLNSA-UHFFFAOYSA-N 0.000 claims 1
- 238000005063 solubilization Methods 0.000 claims 1
- 229940035339 tri-chlor Drugs 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 87
- 239000000243 solution Substances 0.000 description 68
- 239000000203 mixture Substances 0.000 description 60
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 44
- 238000006243 chemical reaction Methods 0.000 description 42
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 40
- 238000005481 NMR spectroscopy Methods 0.000 description 35
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 34
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 30
- 238000009835 boiling Methods 0.000 description 25
- 150000003254 radicals Chemical class 0.000 description 25
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 21
- 235000019341 magnesium sulphate Nutrition 0.000 description 21
- 239000000543 intermediate Substances 0.000 description 20
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 20
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 18
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 17
- 239000013067 intermediate product Substances 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 15
- ZLDOMUPTDYCDBS-UHFFFAOYSA-N ethyl 3,3-dimethylpent-4-enoate Chemical compound CCOC(=O)CC(C)(C)C=C ZLDOMUPTDYCDBS-UHFFFAOYSA-N 0.000 description 14
- 239000004342 Benzoyl peroxide Substances 0.000 description 13
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 13
- 235000019400 benzoyl peroxide Nutrition 0.000 description 13
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 13
- 239000000047 product Substances 0.000 description 13
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 description 12
- 239000002585 base Substances 0.000 description 11
- 238000001816 cooling Methods 0.000 description 11
- 239000012259 ether extract Substances 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- 239000005457 ice water Substances 0.000 description 10
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 229910052786 argon Inorganic materials 0.000 description 9
- 238000004519 manufacturing process Methods 0.000 description 9
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 9
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical class [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- 238000004458 analytical method Methods 0.000 description 8
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 8
- 239000007789 gas Substances 0.000 description 8
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 8
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical class OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 description 7
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 7
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- 229910052723 transition metal Inorganic materials 0.000 description 7
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 6
- 241000723353 Chrysanthemum Species 0.000 description 6
- 235000007516 Chrysanthemum Nutrition 0.000 description 6
- 238000004587 chromatography analysis Methods 0.000 description 6
- 238000004817 gas chromatography Methods 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 5
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 5
- 238000010521 absorption reaction Methods 0.000 description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 5
- XNNQFQFUQLJSQT-UHFFFAOYSA-N bromo(trichloro)methane Chemical compound ClC(Cl)(Cl)Br XNNQFQFUQLJSQT-UHFFFAOYSA-N 0.000 description 5
- IKYLWHDWLWHILP-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-3,3-dimethylhexanoate Chemical compound CCOC(=O)CC(C)(C)C(Cl)CC(Cl)(Cl)Cl IKYLWHDWLWHILP-UHFFFAOYSA-N 0.000 description 5
- 230000001681 protective effect Effects 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- VXSIXFKKSNGRRO-MXOVTSAMSA-N [(1s)-2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;[(1s)-2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-3-[(e)-3-methoxy-2-methyl-3-oxoprop-1-enyl Chemical class CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1.CC1(C)[C@H](/C=C(\C)C(=O)OC)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1 VXSIXFKKSNGRRO-MXOVTSAMSA-N 0.000 description 4
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- JPOXNPPZZKNXOV-UHFFFAOYSA-N bromochloromethane Chemical compound ClCBr JPOXNPPZZKNXOV-UHFFFAOYSA-N 0.000 description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 238000006317 isomerization reaction Methods 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 150000004702 methyl esters Chemical class 0.000 description 4
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- ASUAYTHWZCLXAN-UHFFFAOYSA-N prenol Chemical compound CC(C)=CCO ASUAYTHWZCLXAN-UHFFFAOYSA-N 0.000 description 4
- 235000019260 propionic acid Nutrition 0.000 description 4
- HYJYGLGUBUDSLJ-UHFFFAOYSA-N pyrethrin Natural products CCC(=O)OC1CC(=C)C2CC3OC3(C)C2C2OC(=O)C(=C)C12 HYJYGLGUBUDSLJ-UHFFFAOYSA-N 0.000 description 4
- 229940070846 pyrethrins Drugs 0.000 description 4
- 239000002728 pyrethroid Substances 0.000 description 4
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 4
- 230000008707 rearrangement Effects 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 4
- PDOBSLHNWIVQJX-UHFFFAOYSA-N 1-ethenylcyclopropane-1-carboxylic acid Chemical class OC(=O)C1(C=C)CC1 PDOBSLHNWIVQJX-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 244000078856 Prunus padus Species 0.000 description 3
- VQXSOUPNOZTNAI-UHFFFAOYSA-N Pyrethrin I Natural products CC(=CC1CC1C(=O)OC2CC(=O)C(=C2C)CC=C/C=C)C VQXSOUPNOZTNAI-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 3
- 150000004696 coordination complex Chemical class 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 150000002596 lactones Chemical class 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- ROVGZAWFACYCSP-VUMXUWRFSA-N pyrethrin I Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1 ROVGZAWFACYCSP-VUMXUWRFSA-N 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- 238000005809 transesterification reaction Methods 0.000 description 3
- 150000003624 transition metals Chemical class 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- KGANAERDZBAECK-UHFFFAOYSA-N (3-phenoxyphenyl)methanol Chemical compound OCC1=CC=CC(OC=2C=CC=CC=2)=C1 KGANAERDZBAECK-UHFFFAOYSA-N 0.000 description 2
- RUYFMTUASPQEFD-UHFFFAOYSA-N (3-phenoxyphenyl)methyl 3,3-dimethylpent-4-enoate Chemical compound C=CC(C)(C)CC(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 RUYFMTUASPQEFD-UHFFFAOYSA-N 0.000 description 2
- NKTOLZVEWDHZMU-UHFFFAOYSA-N 2,5-xylenol Chemical compound CC1=CC=C(C)C(O)=C1 NKTOLZVEWDHZMU-UHFFFAOYSA-N 0.000 description 2
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 2
- LULAYUGMBFYYEX-UHFFFAOYSA-N 3-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 2
- 238000003747 Grignard reaction Methods 0.000 description 2
- 241000238631 Hexapoda Species 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- OYNLAAXHIJNWOH-UHFFFAOYSA-N O.O.O.O.O.O.[Cl] Chemical compound O.O.O.O.O.O.[Cl] OYNLAAXHIJNWOH-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 2
- 239000004327 boric acid Substances 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 241001233037 catfish Species 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- ZQMIGQNCOMNODD-UHFFFAOYSA-N diacetyl peroxide Chemical compound CC(=O)OOC(C)=O ZQMIGQNCOMNODD-UHFFFAOYSA-N 0.000 description 2
- LFLSVOVPJVCWKQ-UHFFFAOYSA-N ethyl 2-methylhexanoate Chemical compound CCCCC(C)C(=O)OCC LFLSVOVPJVCWKQ-UHFFFAOYSA-N 0.000 description 2
- DQXFSJSZHGLPEF-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-3-methylhexanoate Chemical compound CCOC(=O)CC(C)C(Cl)CC(Cl)(Cl)Cl DQXFSJSZHGLPEF-UHFFFAOYSA-N 0.000 description 2
- XZJCFWCRVAGWSC-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-3-phenylhexanoate Chemical compound CCOC(=O)CC(C(Cl)CC(Cl)(Cl)Cl)C1=CC=CC=C1 XZJCFWCRVAGWSC-UHFFFAOYSA-N 0.000 description 2
- KNFSAYWTBCWRER-UHFFFAOYSA-N ethyl 4-bromo-6,6,6-trichloro-3-methylhexanoate Chemical compound CCOC(=O)CC(C)C(Br)CC(Cl)(Cl)Cl KNFSAYWTBCWRER-UHFFFAOYSA-N 0.000 description 2
- YVPJCJLMRRTDMQ-UHFFFAOYSA-N ethyl diazoacetate Chemical compound CCOC(=O)C=[N+]=[N-] YVPJCJLMRRTDMQ-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000003999 initiator Substances 0.000 description 2
- NQXWGWZJXJUMQB-UHFFFAOYSA-K iron trichloride hexahydrate Chemical compound O.O.O.O.O.O.[Cl-].Cl[Fe+]Cl NQXWGWZJXJUMQB-UHFFFAOYSA-K 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-methyl-PhOH Natural products CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-methyl phenol Natural products CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 2
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 238000005949 ozonolysis reaction Methods 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- LHTVMBMETNGEAN-UHFFFAOYSA-N pent-1-en-1-ol Chemical class CCCC=CO LHTVMBMETNGEAN-UHFFFAOYSA-N 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 2
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 229940005605 valeric acid Drugs 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- JLYXXMFPNIAWKQ-UHFFFAOYSA-N γ Benzene hexachloride Chemical compound ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl JLYXXMFPNIAWKQ-UHFFFAOYSA-N 0.000 description 2
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 1
- NDQXKKFRNOPRDW-UHFFFAOYSA-N 1,1,1-triethoxyethane Chemical compound CCOC(C)(OCC)OCC NDQXKKFRNOPRDW-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- IUMXVGBDKFYIDZ-UHFFFAOYSA-N 1-(2-chloroethenyl)cyclopropane-1-carboxylic acid Chemical class ClC=CC1(CC1)C(=O)O IUMXVGBDKFYIDZ-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- JZODKRWQWUWGCD-UHFFFAOYSA-N 2,5-di-tert-butylbenzene-1,4-diol Chemical compound CC(C)(C)C1=CC(O)=C(C(C)(C)C)C=C1O JZODKRWQWUWGCD-UHFFFAOYSA-N 0.000 description 1
- WCASXYBKJHWFMY-NSCUHMNNSA-N 2-Buten-1-ol Chemical compound C\C=C\CO WCASXYBKJHWFMY-NSCUHMNNSA-N 0.000 description 1
- IQUPABOKLQSFBK-UHFFFAOYSA-N 2-nitrophenol Chemical compound OC1=CC=CC=C1[N+]([O-])=O IQUPABOKLQSFBK-UHFFFAOYSA-N 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- SMNGQGWPUVVORF-UHFFFAOYSA-N 3,5-ditert-butyl-4-methylphenol Chemical compound CC1=C(C(C)(C)C)C=C(O)C=C1C(C)(C)C SMNGQGWPUVVORF-UHFFFAOYSA-N 0.000 description 1
- NSPPRYXGGYQMPY-UHFFFAOYSA-N 3-Methylbuten-2-ol-1 Natural products CC(C)C(O)=C NSPPRYXGGYQMPY-UHFFFAOYSA-N 0.000 description 1
- RTZZCYNQPHTPPL-UHFFFAOYSA-N 3-nitrophenol Chemical compound OC1=CC=CC([N+]([O-])=O)=C1 RTZZCYNQPHTPPL-UHFFFAOYSA-N 0.000 description 1
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 1
- IEBXZRQOXHLIGF-UHFFFAOYSA-N 5,5-dimethyl-4-(2-methylprop-1-enyl)oxolan-2-one Chemical compound CC(C)=CC1CC(=O)OC1(C)C IEBXZRQOXHLIGF-UHFFFAOYSA-N 0.000 description 1
- GGBXJDKSEHTBLW-UHFFFAOYSA-N 5-methylhex-4-en-2-one Chemical compound CC(C)=CCC(C)=O GGBXJDKSEHTBLW-UHFFFAOYSA-N 0.000 description 1
- 206010063659 Aversion Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- LTNDZDRYUXNFCU-NEWSRXKRSA-N Cinerin II Natural products CC=CCC1=C(C)[C@H](CC1=O)OC(=O)[C@@H]2[C@@H](C=C(C)OC(=O)C)C2(C)C LTNDZDRYUXNFCU-NEWSRXKRSA-N 0.000 description 1
- 244000223760 Cinnamomum zeylanicum Species 0.000 description 1
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 1
- 239000005751 Copper oxide Substances 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- PTVSRINJXWDIKP-UHFFFAOYSA-N Ethyl 4-pentenoate Chemical compound CCOC(=O)CCC=C PTVSRINJXWDIKP-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 229910004373 HOAc Inorganic materials 0.000 description 1
- 239000005569 Iron sulphate Substances 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- 241001608568 Phaedon Species 0.000 description 1
- 241001608567 Phaedon cochleariae Species 0.000 description 1
- 235000017372 Piretro di Dalmazia Nutrition 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 241000250966 Tanacetum cinerariifolium Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 238000006136 alcoholysis reaction Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- KTTWBXNQECIUKC-UHFFFAOYSA-N benzyl 3,3-dimethylpent-4-enoate Chemical compound C=CC(C)(C)CC(=O)OCC1=CC=CC=C1 KTTWBXNQECIUKC-UHFFFAOYSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- SHCRDCOTRILILT-WOBDGSLYSA-N cinerin II Chemical compound CC1(C)[C@H](/C=C(\C)C(=O)OC)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C)C(=O)C1 SHCRDCOTRILILT-WOBDGSLYSA-N 0.000 description 1
- 235000017803 cinnamon Nutrition 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229910000431 copper oxide Inorganic materials 0.000 description 1
- HNWNJTQIXVJQEH-UHFFFAOYSA-N copper rhodium Chemical compound [Cu].[Rh] HNWNJTQIXVJQEH-UHFFFAOYSA-N 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- FMWMEQINULDRBI-UHFFFAOYSA-L copper;sulfite Chemical compound [Cu+2].[O-]S([O-])=O FMWMEQINULDRBI-UHFFFAOYSA-L 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- VZFUCHSFHOYXIS-UHFFFAOYSA-N cycloheptane carboxylic acid Natural products OC(=O)C1CCCCCC1 VZFUCHSFHOYXIS-UHFFFAOYSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000007269 dehydrobromination reaction Methods 0.000 description 1
- OZJPLYNZGCXSJM-UHFFFAOYSA-N delta-Valerolactone Natural products O=C1CCCCO1 OZJPLYNZGCXSJM-UHFFFAOYSA-N 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- HLHKUPHDJBANAX-UHFFFAOYSA-N diethyl 2-(1,3,3,3-tetrachloropropyl)butanedioate Chemical compound CCOC(=O)CC(C(Cl)CC(Cl)(Cl)Cl)C(=O)OCC HLHKUPHDJBANAX-UHFFFAOYSA-N 0.000 description 1
- JOFYMZIPTJXCRG-UHFFFAOYSA-N diethyl 2-benzoyl-3-ethenylbutanedioate Chemical compound CCOC(=O)C(C=C)C(C(=O)OCC)C(=O)C1=CC=CC=C1 JOFYMZIPTJXCRG-UHFFFAOYSA-N 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 1
- JMPOBIJJBNUTAV-UHFFFAOYSA-N ethyl 2,3,3-trimethylpent-4-enoate Chemical compound CCOC(=O)C(C)C(C)(C)C=C JMPOBIJJBNUTAV-UHFFFAOYSA-N 0.000 description 1
- CPHJRGIJAQUSAN-UHFFFAOYSA-N ethyl 2,3-dimethylpent-4-enoate Chemical compound CCOC(=O)C(C)C(C)C=C CPHJRGIJAQUSAN-UHFFFAOYSA-N 0.000 description 1
- ARSJUVUDSBOBOO-UHFFFAOYSA-N ethyl 2-(2-methylbut-3-en-2-yl)-3-oxohexanoate Chemical compound CCCC(=O)C(C(C)(C)C=C)C(=O)OCC ARSJUVUDSBOBOO-UHFFFAOYSA-N 0.000 description 1
- RUYKNBQHWQEXMP-UHFFFAOYSA-N ethyl 2-acetyl-3,3-dimethylpent-4-enoate Chemical compound CCOC(=O)C(C(C)=O)C(C)(C)C=C RUYKNBQHWQEXMP-UHFFFAOYSA-N 0.000 description 1
- NGKHKAKWDOBGFK-UHFFFAOYSA-N ethyl 2-benzoyl-4-bromo-6,6,6-trichlorohexanoate Chemical compound C(C1=CC=CC=C1)(=O)C(C(=O)OCC)CC(CC(Cl)(Cl)Cl)Br NGKHKAKWDOBGFK-UHFFFAOYSA-N 0.000 description 1
- NZJNDBLDSYLYLM-UHFFFAOYSA-N ethyl 2-butanoyl-4,6,6,6-tetrachloro-3,3-dimethylhexanoate Chemical compound CCCC(=O)C(C(=O)OCC)C(C)(C)C(Cl)CC(Cl)(Cl)Cl NZJNDBLDSYLYLM-UHFFFAOYSA-N 0.000 description 1
- KYROVBOLSDUJPK-UHFFFAOYSA-N ethyl 2-cyclopentylpent-4-enoate Chemical compound CCOC(=O)C(CC=C)C1CCCC1 KYROVBOLSDUJPK-UHFFFAOYSA-N 0.000 description 1
- VJPFFFRJHDKLMA-UHFFFAOYSA-N ethyl 2-methyl-3-phenylpent-4-enoate Chemical compound CCOC(=O)C(C)C(C=C)C1=CC=CC=C1 VJPFFFRJHDKLMA-UHFFFAOYSA-N 0.000 description 1
- JQFWSELAMIOZPM-UHFFFAOYSA-N ethyl 2-methylhex-4-enoate Chemical compound CCOC(=O)C(C)CC=CC JQFWSELAMIOZPM-UHFFFAOYSA-N 0.000 description 1
- FPBCVSQPCDMMCX-UHFFFAOYSA-N ethyl 3,3-diphenylpent-4-enoate Chemical compound C=1C=CC=CC=1C(C=C)(CC(=O)OCC)C1=CC=CC=C1 FPBCVSQPCDMMCX-UHFFFAOYSA-N 0.000 description 1
- HWWZAPZBQITLIC-UHFFFAOYSA-N ethyl 3-acetyl-4,6,6,6-tetrachlorohexanoate Chemical compound CCOC(=O)CC(C(C)=O)C(Cl)CC(Cl)(Cl)Cl HWWZAPZBQITLIC-UHFFFAOYSA-N 0.000 description 1
- DBWRDGYTYQYALK-UHFFFAOYSA-N ethyl 3-acetylpent-4-enoate Chemical compound CCOC(=O)CC(C=C)C(C)=O DBWRDGYTYQYALK-UHFFFAOYSA-N 0.000 description 1
- OUDXLIYSFDHUBC-UHFFFAOYSA-N ethyl 3-benzoylpent-4-enoate Chemical compound CCOC(=O)CC(C=C)C(=O)C1=CC=CC=C1 OUDXLIYSFDHUBC-UHFFFAOYSA-N 0.000 description 1
- VASKIIJJOYDVRG-UHFFFAOYSA-N ethyl 3-benzyl-3-methylpent-4-enoate Chemical compound CCOC(=O)CC(C)(C=C)CC1=CC=CC=C1 VASKIIJJOYDVRG-UHFFFAOYSA-N 0.000 description 1
- KFURVOXVPAAPJX-UHFFFAOYSA-N ethyl 3-ethenyl-3-ethylhept-5-enoate Chemical compound CCOC(=O)CC(CC)(C=C)CC=CC KFURVOXVPAAPJX-UHFFFAOYSA-N 0.000 description 1
- PMUYQQOTIDSZKH-UHFFFAOYSA-N ethyl 3-ethenyl-3-methylhept-5-ynoate Chemical compound CCOC(=O)CC(C)(C=C)CC#CC PMUYQQOTIDSZKH-UHFFFAOYSA-N 0.000 description 1
- AJCJWMFNOODCHQ-UHFFFAOYSA-N ethyl 3-ethyl-3-methylpent-4-enoate Chemical compound CCOC(=O)CC(C)(CC)C=C AJCJWMFNOODCHQ-UHFFFAOYSA-N 0.000 description 1
- RDTAXBHHMJSWTH-UHFFFAOYSA-N ethyl 3-ethyl-3-propan-2-ylpent-4-enoate Chemical compound CCOC(=O)CC(CC)(C=C)C(C)C RDTAXBHHMJSWTH-UHFFFAOYSA-N 0.000 description 1
- AUAKFHKYJDJBKI-UHFFFAOYSA-N ethyl 3-methylpent-4-enoate Chemical compound CCOC(=O)CC(C)C=C AUAKFHKYJDJBKI-UHFFFAOYSA-N 0.000 description 1
- SNMOKXQMVVHRQM-UHFFFAOYSA-N ethyl 3-phenylpent-4-enoate Chemical compound CCOC(=O)CC(C=C)C1=CC=CC=C1 SNMOKXQMVVHRQM-UHFFFAOYSA-N 0.000 description 1
- KHNCHSYHHNUEOR-UHFFFAOYSA-N ethyl 3-tert-butyl-4,6,6,6-tetrachloro-3-propylhexanoate Chemical compound ClC(Cl)(Cl)CC(Cl)C(C(C)(C)C)(CCC)CC(=O)OCC KHNCHSYHHNUEOR-UHFFFAOYSA-N 0.000 description 1
- CWEYEQLAGICWNF-UHFFFAOYSA-N ethyl 4,6,6,6-tetrabromo-3,3-dimethylhexanoate Chemical compound CCOC(=O)CC(C)(C)C(Br)CC(Br)(Br)Br CWEYEQLAGICWNF-UHFFFAOYSA-N 0.000 description 1
- AYAONHNAKOKNNJ-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-2,3,3-trimethylhexanoate Chemical compound CCOC(=O)C(C)C(C)(C)C(Cl)CC(Cl)(Cl)Cl AYAONHNAKOKNNJ-UHFFFAOYSA-N 0.000 description 1
- HOADQNLSMQWCPD-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-2-methyl-3-phenylhexanoate Chemical compound CCOC(=O)C(C)C(C(Cl)CC(Cl)(Cl)Cl)C1=CC=CC=C1 HOADQNLSMQWCPD-UHFFFAOYSA-N 0.000 description 1
- UHKBOEHATRJBOK-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-3-(chloromethyl)hexanoate Chemical compound CCOC(=O)CC(CCl)C(Cl)CC(Cl)(Cl)Cl UHKBOEHATRJBOK-UHFFFAOYSA-N 0.000 description 1
- IOZLACDXFFAIPQ-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-3-cyanohexanoate Chemical compound CCOC(=O)CC(C#N)C(Cl)CC(Cl)(Cl)Cl IOZLACDXFFAIPQ-UHFFFAOYSA-N 0.000 description 1
- HZZVHPDMTVZFNU-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-3-cyclobutylhexanoate Chemical compound CCOC(=O)CC(C(Cl)CC(Cl)(Cl)Cl)C1CCC1 HZZVHPDMTVZFNU-UHFFFAOYSA-N 0.000 description 1
- MZLXYHZVCCPQGM-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-3-ethyl-3-methylhexanoate Chemical compound CCOC(=O)CC(C)(CC)C(Cl)CC(Cl)(Cl)Cl MZLXYHZVCCPQGM-UHFFFAOYSA-N 0.000 description 1
- ZZTOYLBZPKGVGW-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachloro-3-ethyl-3-propan-2-ylhexanoate Chemical compound CCOC(=O)CC(CC)(C(C)C)C(Cl)CC(Cl)(Cl)Cl ZZTOYLBZPKGVGW-UHFFFAOYSA-N 0.000 description 1
- HGBKSXQEXIUOAR-UHFFFAOYSA-N ethyl 4,6,6,6-tetrachlorohexanoate Chemical compound CCOC(=O)CCC(Cl)CC(Cl)(Cl)Cl HGBKSXQEXIUOAR-UHFFFAOYSA-N 0.000 description 1
- XASJSFQFRFTHAL-UHFFFAOYSA-N ethyl 4-bromo-6,6,6-trichloro-3,3-dimethylhexanoate Chemical compound CCOC(=O)CC(C)(C)C(Br)CC(Cl)(Cl)Cl XASJSFQFRFTHAL-UHFFFAOYSA-N 0.000 description 1
- XFIUHPVIZFWOIS-UHFFFAOYSA-N ethyl 6,6,6-trichloro-2,3,3-trimethylhex-4-enoate Chemical compound CCOC(=O)C(C)C(C)(C)C=CC(Cl)(Cl)Cl XFIUHPVIZFWOIS-UHFFFAOYSA-N 0.000 description 1
- OBNCKNCVKJNDBV-UHFFFAOYSA-N ethyl butyrate Chemical compound CCCC(=O)OCC OBNCKNCVKJNDBV-UHFFFAOYSA-N 0.000 description 1
- LDDOSDVZPSGLFZ-UHFFFAOYSA-N ethyl cyclopropanecarboxylate Chemical compound CCOC(=O)C1CC1 LDDOSDVZPSGLFZ-UHFFFAOYSA-N 0.000 description 1
- RBJLHYGZMJNFBK-UHFFFAOYSA-N ethyl hex-4-enoate Chemical compound CCOC(=O)CCC=CC RBJLHYGZMJNFBK-UHFFFAOYSA-N 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011953 free-radical catalyst Substances 0.000 description 1
- WCASXYBKJHWFMY-UHFFFAOYSA-N gamma-methylallyl alcohol Natural products CC=CCO WCASXYBKJHWFMY-UHFFFAOYSA-N 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- FBAFATDZDUQKNH-UHFFFAOYSA-M iron chloride Chemical compound [Cl-].[Fe] FBAFATDZDUQKNH-UHFFFAOYSA-M 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- PVFSDGKDKFSOTB-UHFFFAOYSA-K iron(3+);triacetate Chemical compound [Fe+3].CC([O-])=O.CC([O-])=O.CC([O-])=O PVFSDGKDKFSOTB-UHFFFAOYSA-K 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 238000011031 large-scale manufacturing process Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- HZVOZRGWRWCICA-UHFFFAOYSA-N methanediyl Chemical compound [CH2] HZVOZRGWRWCICA-UHFFFAOYSA-N 0.000 description 1
- COHFTBWCEOBGOR-UHFFFAOYSA-N methyl 1-methylcyclopropane-1-carboxylate Chemical compound COC(=O)C1(C)CC1 COHFTBWCEOBGOR-UHFFFAOYSA-N 0.000 description 1
- JNTGYTPFSRNYQS-UHFFFAOYSA-N methyl 6,6,6-trichloro-2-cyclohexyl-4-iodohexanoate Chemical compound ClC(Cl)(Cl)CC(I)CC(C(=O)OC)C1CCCCC1 JNTGYTPFSRNYQS-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- URXNVXOMQQCBHS-UHFFFAOYSA-N naphthalene;sodium Chemical compound [Na].C1=CC=CC2=CC=CC=C21 URXNVXOMQQCBHS-UHFFFAOYSA-N 0.000 description 1
- 239000005445 natural material Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 238000012858 packaging process Methods 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 238000007539 photo-oxidation reaction Methods 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- CBPYOHALYYGNOE-UHFFFAOYSA-M potassium;3,5-dinitrobenzoate Chemical compound [K+].[O-]C(=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 CBPYOHALYYGNOE-UHFFFAOYSA-M 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- ZKVXTAWLRFTQMT-UHFFFAOYSA-N propan-2-yl 2-benzyl-3,3-dimethylpent-4-enoate Chemical compound CC(C)OC(=O)C(C(C)(C)C=C)CC1=CC=CC=C1 ZKVXTAWLRFTQMT-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- YBCAZPLXEGKKFM-UHFFFAOYSA-K ruthenium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Ru+3] YBCAZPLXEGKKFM-UHFFFAOYSA-K 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- XRRQTXPFTQVNSN-UHFFFAOYSA-N tert-butyl 3,3-dimethylpent-4-enoate Chemical compound CC(C)(C)OC(=O)CC(C)(C)C=C XRRQTXPFTQVNSN-UHFFFAOYSA-N 0.000 description 1
- JDGNITFVNHULTI-UHFFFAOYSA-N tert-butyl 4-bromo-6,6,6-trichloro-2-cyano-3-ethylhexanoate Chemical compound ClC(Cl)(Cl)CC(Br)C(CC)C(C#N)C(=O)OC(C)(C)C JDGNITFVNHULTI-UHFFFAOYSA-N 0.000 description 1
- GJBRNHKUVLOCEB-UHFFFAOYSA-N tert-butyl benzenecarboperoxoate Chemical compound CC(C)(C)OOC(=O)C1=CC=CC=C1 GJBRNHKUVLOCEB-UHFFFAOYSA-N 0.000 description 1
- SWAXTRYEYUTSAP-UHFFFAOYSA-N tert-butyl ethaneperoxoate Chemical compound CC(=O)OOC(C)(C)C SWAXTRYEYUTSAP-UHFFFAOYSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- SFLKZLQXODICBP-UHFFFAOYSA-N trichloro(iodo)methane Chemical compound ClC(Cl)(Cl)I SFLKZLQXODICBP-UHFFFAOYSA-N 0.000 description 1
- HFFLGKNGCAIQMO-UHFFFAOYSA-N trichloroacetaldehyde Chemical compound ClC(Cl)(Cl)C=O HFFLGKNGCAIQMO-UHFFFAOYSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/32—Compounds having groups or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/03—Ethers having all ether-oxygen atoms bound to acyclic carbon atoms
- C07C43/14—Unsaturated ethers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/03—Preparation of carboxylic acid esters by reacting an ester group with a hydroxy group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/27—Preparation of carboxylic acid esters from ortho-esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/30—Preparation of carboxylic acid esters by modifying the acid moiety of the ester, such modification not being an introduction of an ester group
- C07C67/317—Preparation of carboxylic acid esters by modifying the acid moiety of the ester, such modification not being an introduction of an ester group by splitting-off hydrogen or functional groups; by hydrogenolysis of functional groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/30—Preparation of carboxylic acid esters by modifying the acid moiety of the ester, such modification not being an introduction of an ester group
- C07C67/333—Preparation of carboxylic acid esters by modifying the acid moiety of the ester, such modification not being an introduction of an ester group by isomerisation; by change of size of the carbon skeleton
- C07C67/343—Preparation of carboxylic acid esters by modifying the acid moiety of the ester, such modification not being an introduction of an ester group by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/02—Systems containing only non-condensed rings with a three-membered ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (18)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP10352174A JPS5141316A (en) | 1974-09-10 | 1974-09-10 | Ganmaa harokarubonsanesuterunoseizohoho |
| JP10352074A JPS5545062B2 (esLanguage) | 1974-09-10 | 1974-09-10 | |
| JP10997574A JPS5545063B2 (esLanguage) | 1974-09-26 | 1974-09-26 | |
| JP10997674A JPS5139624A (en) | 1974-09-26 | 1974-09-26 | Ganmaa fuhowa epushiron harokarubonsanesuteru no seizoho |
| JP13663274A JPS5165710A (en) | 1974-11-30 | 1974-11-30 | Ganma fuhowakarubonsanesuteruno seizohoho |
| JP13663174A JPS5165734A (ja) | 1974-11-30 | 1974-11-30 | Shikuropuropankarubonsanesuteruo seizosuru hoho |
| JP13702674A JPS5165735A (ja) | 1974-12-02 | 1974-12-02 | Shikuropuropankarubonsanesuteruo seizosuru hoho |
| JP13775274A JPS5165714A (en) | 1974-12-03 | 1974-12-03 | Ganma fuhowa ipushiron harokarubonsanesuteruo seizosuru hoho |
| JP50006429A JPS5182216A (en) | 1975-01-16 | 1975-01-16 | Ganma harokarubonsanesuteruno seizoho |
| JP50008673A JPS5817735B2 (ja) | 1975-01-22 | 1975-01-22 | ガンマ − フホウワカルボンサンエステルノセイホウ |
| JP1238975A JPS5821901B2 (ja) | 1975-01-31 | 1975-01-31 | 2−(2,2−ジクロルビニル)−3,3−ジメチルシクロプロパンカルボン酸エステルの製造方法 |
| JP50019918A JPS5198213A (en) | 1975-02-19 | 1975-02-19 | arufua chikan ganma harokarubonsanesuteruno seizohoho |
| JP1991775A JPS5821902B2 (ja) | 1975-02-19 | 1975-02-19 | アルフア− チカンシクロプロパンカルボンサンエステルノ セイゾウホウホウ |
| JP50021857A JPS5198248A (esLanguage) | 1975-02-24 | 1975-02-24 | |
| JP50028607A JPS5822463B2 (ja) | 1975-03-11 | 1975-03-11 | チカンビニルキオユウスル シクロプロパンカルボンサンユウドウタイノセイホウ |
| JP50028606A JPS5817451B2 (ja) | 1975-03-11 | 1975-03-11 | γ↓−クロル↓−δ↓−不飽和カルボン酸エステルの製法 |
| JP50066592A JPS5819661B2 (ja) | 1975-06-04 | 1975-06-04 | ガンマ− − ハロ−カルボンサンエステルノ セイゾウホウホウ |
| JP6659375A JPS5828263B2 (ja) | 1975-06-04 | 1975-06-04 | 3 3− ジメチル −2−(2 2− ジハロビニル ) シクロプロパンカルボンサンエステルノ セイゾウホウホウ |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2539895A1 DE2539895A1 (de) | 1976-03-18 |
| DE2539895C2 true DE2539895C2 (de) | 1983-10-20 |
Family
ID=27586099
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2539895A Expired DE2539895C2 (de) | 1974-09-10 | 1975-09-08 | Verfahren zur Herstellung von 2- Dihalogenvinylcyclopropancarbonsäureestern |
Country Status (14)
| Country | Link |
|---|---|
| US (2) | US4833266A (esLanguage) |
| BE (1) | BE833278A (esLanguage) |
| CA (1) | CA1212685A (esLanguage) |
| CH (1) | CH630891A5 (esLanguage) |
| DD (5) | DD128298A5 (esLanguage) |
| DE (1) | DE2539895C2 (esLanguage) |
| DK (1) | DK158614C (esLanguage) |
| FR (3) | FR2318143A1 (esLanguage) |
| IE (1) | IE43065B1 (esLanguage) |
| IN (1) | IN142702B (esLanguage) |
| NL (1) | NL185513C (esLanguage) |
| NO (1) | NO147792C (esLanguage) |
| NZ (1) | NZ178641A (esLanguage) |
| SE (1) | SE435618B (esLanguage) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2544150A1 (de) * | 1974-10-03 | 1976-04-15 | Kuraray Co | Verfahren zur herstellung von substituierten cyclopropancarbonsaeuren und ihren estern |
| US4425282A (en) | 1979-04-23 | 1984-01-10 | Bayer Aktiengesellschaft | Preparation of 3-(arylvinyl)-2,2-dimethyl-cyclopropane-1-carboxylic acid esters and new intermediate therefor |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IN142702B (esLanguage) * | 1974-09-10 | 1977-08-20 | Sagami Chem Res | |
| MX3200E (es) * | 1975-04-07 | 1980-07-03 | Ciba Geigy Ag | Procedimiento para la preparacion de esteres de acido ciclo propan carboxilico |
| US4195033A (en) | 1975-05-16 | 1980-03-25 | Imperial Chemical Industries Limited | 1-Acetyl or 1-cyano-2(2,2-dichlorovinyl)-3,3-dimethyl cyclopropane |
| US4198347A (en) | 1975-05-16 | 1980-04-15 | Imperial Chemical Industries Limited | 2(2,2-Dichlorovinyl)-3,3-dimethyl-cyclopropane carboxylates |
| AU511383B2 (en) | 1975-05-16 | 1980-08-14 | Imperial Chemical Industries Ltd | Intermediates inthe preparation of cyclopropanoid insecticides |
| GB1561502A (en) * | 1975-07-22 | 1980-02-20 | Kuraray Co | Y-lactone derivatives |
| JPS5912103B2 (ja) * | 1975-12-26 | 1984-03-21 | ザイダンホウジン サガミチユウオウカガクケンキユウシヨ | カルボンサンエステルノセイゾウホウホウ |
| DE2606635A1 (de) * | 1976-02-19 | 1977-08-25 | Bayer Ag | Verfahren zur herstellung von 2,2-dimethyl-3-(2',2'-dichlorvinyl) -cyclopropan-1-carbonsaeure |
| GB1503857A (en) * | 1976-05-25 | 1978-03-15 | Cheminova As | Production of chrysanthemic acid esters and homologues thereof |
| GB1580204A (en) * | 1976-07-07 | 1980-11-26 | Shell Int Research | 2-cyanohexanoic acid derivatives |
| DE2638356A1 (de) * | 1976-08-26 | 1978-03-02 | Bayer Ag | Verfahren zur herstellung vinylsubstituierter cyclopropancarbonsaeureester |
| DE2730515A1 (de) * | 1977-07-06 | 1979-01-18 | Bayer Ag | Substituierte phenoxybenzyloxycarbonylderivate, verfahren zu ihrer herstellung und ihre verwendung als insektizide und akarizide |
| US4166064A (en) | 1978-02-13 | 1979-08-28 | Fmc Corporation | Process for preparing high cis 3-(2,2,2-trichloroethyl)-2,2-dimethylcyclopropane-1-carboxylates |
| AU526817B2 (en) * | 1978-06-21 | 1983-02-03 | Ici Australia Limited | Pesticides |
| US4390547A (en) * | 1978-07-11 | 1983-06-28 | Kuraray Co., Ltd. | 2,2-Dimethyl-3-(substituted ethyl)cyclopropane carboxylate pesticidal compositions and methods |
| US4299839A (en) | 1978-07-11 | 1981-11-10 | Kuraray Co., Ltd. | Novel pesticides and pesticidal compositions cyclopropanecarboxylates and pesticidal method |
| US4532258A (en) * | 1978-07-11 | 1985-07-30 | Kuraray Co., Ltd. | Certain cyclopropane carboxylic acid esters and their pesticidal use |
| DE2916401A1 (de) * | 1979-04-23 | 1980-11-06 | Bayer Ag | Verfahren zur herstellung von 3-(2-arylvinyl)-2,2-dimethyl-cyclopropan-1-carbon- saeureestern und neue zwischenprodukte dafuer |
| DE2916375A1 (de) * | 1979-04-23 | 1980-11-06 | Bayer Ag | Verfahren zur herstellung von styryl-cyclopropan-carbonsaeureestern und neue zwischenprodukte dafuer |
| DE2916321A1 (de) * | 1979-04-23 | 1980-11-06 | Bayer Ag | Verfahren zur herstellung von styryl- cyclopropan-carbonsaeureestern und neue zwischenprodukte dafuer |
| DE68904244T2 (de) * | 1988-05-26 | 1993-05-06 | Sumitomo Chemical Co | Verfahren zur herstellung von trans-2,2-dimethyl-3-(2,2-dihalovinyl)-cyclopropancarbonsaeureestern. |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2561516A (en) * | 1948-02-20 | 1951-07-24 | Us Rubber Co | Trichloromethylalkenes |
| US2554533A (en) * | 1949-02-08 | 1951-05-29 | Us Rubber Co | Bromo-trichloro butenyl acetate |
| FR1356949A (fr) * | 1962-12-13 | 1964-04-03 | Rhone Poulenc Sa | Procédé de préparation de dérivés de l'acide cyclopropanecarboxylique |
| US3652652A (en) * | 1962-12-21 | 1972-03-28 | Rhone Poulenc Sa | 3-methallyllevulinates and preparation thereof |
| US3471579A (en) * | 1967-01-20 | 1969-10-07 | Phillips Petroleum Co | Addition of polyhalogenated compounds to olefinic compounds |
| US3862978A (en) * | 1967-08-24 | 1975-01-28 | Dow Chemical Co | Catalytic synthesis of organic halogen compounds from an ethylenically unsaturated compound and a halogenated organic compound |
| US3666789A (en) * | 1969-05-21 | 1972-05-30 | Sumitomo Chemical Co | Cyclopropanecarboxylic acid esters |
| BE818811R (en) * | 1973-08-15 | 1974-12-02 | Insecticidal stereoisomeric esters - of 2,2-dimethyl-3-(2,2-di-halovinyl) cyclopropane carboxylic acid which are very toxic to houseflies | |
| US3907718A (en) * | 1974-07-22 | 1975-09-23 | Int Flavors & Fragrances Inc | 2-Methyl-4-pentenoic acid ester fragrance |
| JPS5198248A (esLanguage) * | 1975-02-24 | 1976-08-30 | ||
| IN142702B (esLanguage) * | 1974-09-10 | 1977-08-20 | Sagami Chem Res |
-
1975
- 1975-08-20 IN IN1621/CAL/75A patent/IN142702B/en unknown
- 1975-08-28 IE IE1891/75A patent/IE43065B1/en unknown
- 1975-08-29 CA CA000234464A patent/CA1212685A/en not_active Expired
- 1975-09-05 NL NLAANVRAGE7510479,A patent/NL185513C/xx not_active IP Right Cessation
- 1975-09-08 DE DE2539895A patent/DE2539895C2/de not_active Expired
- 1975-09-08 CH CH1161375A patent/CH630891A5/de not_active IP Right Cessation
- 1975-09-09 NO NO75753085A patent/NO147792C/no unknown
- 1975-09-09 FR FR7527596A patent/FR2318143A1/fr active Granted
- 1975-09-09 DK DK402075A patent/DK158614C/da not_active IP Right Cessation
- 1975-09-09 SE SE7510042A patent/SE435618B/xx not_active IP Right Cessation
- 1975-09-09 NZ NZ178641A patent/NZ178641A/xx unknown
- 1975-09-10 DD DD7500196143A patent/DD128298A5/xx unknown
- 1975-09-10 DD DD7500196142A patent/DD128297A5/xx unknown
- 1975-09-10 DD DD188270A patent/DD122678A5/xx unknown
- 1975-09-10 DD DD7500196141A patent/DD128351A5/xx unknown
- 1975-09-10 BE BE159921A patent/BE833278A/xx not_active IP Right Cessation
- 1975-09-10 DD DD7500196145A patent/DD128352A5/xx unknown
-
1976
- 1976-07-13 FR FR7621448A patent/FR2333774A1/fr active Granted
- 1976-07-13 FR FR7621447A patent/FR2318144A1/fr active Granted
-
1983
- 1983-06-27 US US06/507,998 patent/US4833266A/en not_active Expired - Lifetime
-
1989
- 1989-04-26 US US07/343,318 patent/US4999451A/en not_active Expired - Lifetime
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2544150A1 (de) * | 1974-10-03 | 1976-04-15 | Kuraray Co | Verfahren zur herstellung von substituierten cyclopropancarbonsaeuren und ihren estern |
| US4425282A (en) | 1979-04-23 | 1984-01-10 | Bayer Aktiengesellschaft | Preparation of 3-(arylvinyl)-2,2-dimethyl-cyclopropane-1-carboxylic acid esters and new intermediate therefor |
Also Published As
| Publication number | Publication date |
|---|---|
| US4833266A (en) | 1989-05-23 |
| FR2318144A1 (fr) | 1977-02-11 |
| NL185513B (nl) | 1989-12-01 |
| DD128297A5 (de) | 1977-11-09 |
| IN142702B (esLanguage) | 1977-08-20 |
| DK158614B (da) | 1990-06-18 |
| DD128352A5 (de) | 1977-11-16 |
| NO147792C (no) | 1983-06-15 |
| NZ178641A (en) | 1978-04-03 |
| CH630891A5 (de) | 1982-07-15 |
| CA1212685A (en) | 1986-10-14 |
| BE833278A (fr) | 1976-03-10 |
| US4999451A (en) | 1991-03-12 |
| AU8425675A (en) | 1977-03-03 |
| SE435618B (sv) | 1984-10-08 |
| NO753085L (esLanguage) | 1976-03-11 |
| DE2539895A1 (de) | 1976-03-18 |
| DD128351A5 (de) | 1977-11-16 |
| NL7510479A (nl) | 1976-03-12 |
| DD128298A5 (de) | 1977-11-09 |
| FR2333774A1 (fr) | 1977-07-01 |
| NO147792B (no) | 1983-03-07 |
| NL185513C (nl) | 1990-05-01 |
| IE43065L (en) | 1976-03-10 |
| FR2318144B1 (esLanguage) | 1979-04-06 |
| FR2333774B1 (esLanguage) | 1981-08-21 |
| IE43065B1 (en) | 1980-12-17 |
| SE7510042L (sv) | 1976-05-07 |
| FR2318143B1 (esLanguage) | 1980-02-22 |
| DK402075A (da) | 1976-03-11 |
| DD122678A5 (esLanguage) | 1976-10-20 |
| FR2318143A1 (fr) | 1977-02-11 |
| DK158614C (da) | 1990-11-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2539895C2 (de) | Verfahren zur Herstellung von 2- Dihalogenvinylcyclopropancarbonsäureestern | |
| DE2034128C2 (de) | Cyclopentenolonester, Cyclopentenone und die Verwendung der Cyclopentenolonester als Insektizide | |
| DE2651341A1 (de) | Verfahren zur herstellung von phenoxybenzylestern | |
| DE2437882C3 (de) | Verfahren zur Herstellung von Estern des 3-Phenoxybenzylalkohols | |
| DE2708182C3 (de) | Verfahren zur Herstellung von Acylcyaniden | |
| DE2717414A1 (de) | Phenylessigsaeurederivate, verfahren zu deren herstellung und insektizide mittel | |
| DD142281A5 (de) | Verfahren zur bekaempfung von insekten und acaren | |
| CH638481A5 (de) | Verfahren zur herstellung viergliedriger cyclischer ketone. | |
| DE2616681A1 (de) | Verfahren zur reduktiven dehydrohalogenierung von alpha-halogenalkoholen | |
| US4214097A (en) | Process for preparing dihalovinylcyclopropanecarboxylates | |
| DE2560240C2 (de) | Hexansäure-, Hexensäure- und Cyclopropancarbonsäureester | |
| DE2747824A1 (de) | Verfahren zur herstellung von halogenvinyl-gamma-butyrolactonen | |
| DE2605398A1 (de) | Verfahren zur herstellung von beta- dihalogenaethenylcyclopropancarbonsaeure- derivaten | |
| EP0048370B1 (de) | Verfahren zur Herstellung von trans-3-(Z-2-Chlor-2-aryl-vinyl)-2,2-dimethyl-cyclopropan-1-carbon-säure-derivaten, neue Zwischenprodukte hierfür, Verfahren zu deren Herstellung und Verwendung von Zwischenprodukten in Schädlingsbekämpfungsmitteln | |
| CH641146A5 (en) | Process for the preparation of 2-dihalovinylcyclopropanecarboxylic acid esters | |
| DE2552615C2 (esLanguage) | ||
| US4454343A (en) | Intermediates in a process for preparing dihalovinylcyclopropanecarboxylates | |
| EP0187216B1 (de) | Verfahren zur Herstellung von halogenierten 3,3-Dimethyl-5-hexen-2-onen | |
| EP0002206A1 (de) | Halogenierte Buttersäurechloride, Verfahren zu deren Herstellung und ihre Verwendung als Zwischenprodukte zur Herstellung von Schädlingsbekämpfungsmitteln | |
| DE2659973C2 (de) | Halogencarbonylverbindungen | |
| US4681953A (en) | Process for preparing dihalovinylcyclopropanecarboxylates | |
| DE3225129A1 (de) | Benzylalkoholderivate, verfahren zu deren herstellung und pestizide unter deren verwendung | |
| DE2810031A1 (de) | Alpha- oder beta- substituierte isovaleriansaeureester enthaltendes schaedlingsbekaempfungsmittel | |
| AT358059B (de) | Verfahren zur herstellung von neuen oxiranen | |
| DE3045768A1 (de) | 2-(2',2'-dichlor-3',3',3'-trifluorpropyl)- und 2-(2',2',3'-trichlor-3',3'-difluorporpyl)-4-chlorcyclobutan-1-one |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OI | Miscellaneous see part 1 | ||
| OI | Miscellaneous see part 1 | ||
| AH | Division in |
Ref country code: DE Ref document number: 2560240 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: TAUCHNER, P., DIPL.-CHEM. DR.RER.NAT. HEUNEMANN, D., DIPL.-PHYS. DR.RER.NAT. RAUH, P., DIPL.-CHEM. DR.RER.NAT. HERMANN, G., DIPL.-PHYS. DR.RER.NAT. SCHMIDT, J., DIPL.-ING. JAENICHEN, H., DIPL.-BIOL. DR.RER.NAT., PAT.-ANWAELTE TREMMEL, H., RECHTSANW., 8000 MUENCHEN |