DE2533119A1 - Hochmolekulare polytriazine aus loeslichen polymeren n-cyan-isoharnstoffaethern - Google Patents
Hochmolekulare polytriazine aus loeslichen polymeren n-cyan-isoharnstoffaethernInfo
- Publication number
- DE2533119A1 DE2533119A1 DE19752533119 DE2533119A DE2533119A1 DE 2533119 A1 DE2533119 A1 DE 2533119A1 DE 19752533119 DE19752533119 DE 19752533119 DE 2533119 A DE2533119 A DE 2533119A DE 2533119 A1 DE2533119 A1 DE 2533119A1
- Authority
- DE
- Germany
- Prior art keywords
- mol
- aromatic
- ether
- numbers
- high molecular
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 title claims description 40
- 229920000642 polymer Polymers 0.000 title claims description 8
- -1 cycloaliphatic Chemical group 0.000 claims description 58
- 239000002904 solvent Substances 0.000 claims description 22
- GIVGDJZVMHYWDM-UHFFFAOYSA-N cyanourea Chemical compound NC(=O)NC#N GIVGDJZVMHYWDM-UHFFFAOYSA-N 0.000 claims description 15
- 239000000203 mixture Substances 0.000 claims description 15
- 150000001912 cyanamides Chemical class 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 9
- 239000003054 catalyst Substances 0.000 claims description 9
- 229910052760 oxygen Inorganic materials 0.000 claims description 9
- 239000001301 oxygen Substances 0.000 claims description 9
- 125000003118 aryl group Chemical group 0.000 claims description 7
- 239000003960 organic solvent Substances 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 5
- 229920006158 high molecular weight polymer Polymers 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 25
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 14
- 238000002329 infrared spectrum Methods 0.000 description 11
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 8
- 125000000217 alkyl group Chemical group 0.000 description 8
- 125000004093 cyano group Chemical group *C#N 0.000 description 8
- 150000003254 radicals Chemical class 0.000 description 8
- 239000002585 base Substances 0.000 description 7
- CHJMFFKHPHCQIJ-UHFFFAOYSA-L zinc;octanoate Chemical compound [Zn+2].CCCCCCCC([O-])=O.CCCCCCCC([O-])=O CHJMFFKHPHCQIJ-UHFFFAOYSA-L 0.000 description 7
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 6
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 125000002947 alkylene group Chemical group 0.000 description 6
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 6
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 6
- 229910052736 halogen Inorganic materials 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 6
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 6
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- JMANVNJQNLATNU-UHFFFAOYSA-N glycolonitrile Natural products N#CC#N JMANVNJQNLATNU-UHFFFAOYSA-N 0.000 description 5
- 150000002367 halogens Chemical class 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 5
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 4
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical group C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000004305 biphenyl Substances 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 125000001651 cyanato group Chemical group [*]OC#N 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- KZTYYGOKRVBIMI-UHFFFAOYSA-N diphenyl sulfone Chemical compound C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 150000003457 sulfones Chemical class 0.000 description 3
- 239000011592 zinc chloride Substances 0.000 description 3
- 235000005074 zinc chloride Nutrition 0.000 description 3
- FFUGFEZHSFMOTP-UHFFFAOYSA-N (4-cyclohexylphenyl) cyanate Chemical compound C1=CC(OC#N)=CC=C1C1CCCCC1 FFUGFEZHSFMOTP-UHFFFAOYSA-N 0.000 description 2
- UWYZHKAOTLEWKK-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline Chemical compound C1=CC=C2CNCCC2=C1 UWYZHKAOTLEWKK-UHFFFAOYSA-N 0.000 description 2
- QVCUKHQDEZNNOC-UHFFFAOYSA-N 1,2-diazabicyclo[2.2.2]octane Chemical compound C1CC2CCN1NC2 QVCUKHQDEZNNOC-UHFFFAOYSA-N 0.000 description 2
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N 3-Methylbutan-2-one Chemical compound CC(C)C(C)=O SYBYTAAJFKOIEJ-UHFFFAOYSA-N 0.000 description 2
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- ALOFEFDEYGMKDK-UHFFFAOYSA-N [3-(cyanoamino)cyclohexyl]cyanamide Chemical compound N#CNC1CCCC(NC#N)C1 ALOFEFDEYGMKDK-UHFFFAOYSA-N 0.000 description 2
- HEJGXMCFSSDPOA-UHFFFAOYSA-N [4-(4-cyanatophenyl)phenyl] cyanate Chemical group C1=CC(OC#N)=CC=C1C1=CC=C(OC#N)C=C1 HEJGXMCFSSDPOA-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- XABJJJZIQNZSIM-UHFFFAOYSA-N azane;phenol Chemical compound [NH4+].[O-]C1=CC=CC=C1 XABJJJZIQNZSIM-UHFFFAOYSA-N 0.000 description 2
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 239000004643 cyanate ester Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- 229950011008 tetrachloroethylene Drugs 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- PYGFCFSLFFALAX-UHFFFAOYSA-N (2,5-ditert-butyl-4-cyanatophenyl) cyanate Chemical compound CC(C)(C)C1=CC(OC#N)=C(C(C)(C)C)C=C1OC#N PYGFCFSLFFALAX-UHFFFAOYSA-N 0.000 description 1
- WLVWUJYFJWGNHS-UHFFFAOYSA-N (2,6-dimethyl-4-propylphenyl) cyanate Chemical compound CCCC1=CC(C)=C(OC#N)C(C)=C1 WLVWUJYFJWGNHS-UHFFFAOYSA-N 0.000 description 1
- IALZLVVOMYFDGE-UHFFFAOYSA-N (2-chloro-5-cyanatophenyl) cyanate Chemical compound ClC1=CC=C(OC#N)C=C1OC#N IALZLVVOMYFDGE-UHFFFAOYSA-N 0.000 description 1
- NGGIZAWDYJYQBS-UHFFFAOYSA-N (2-tert-butyl-4-cyanatophenyl) cyanate Chemical compound CC(C)(C)C1=CC(OC#N)=CC=C1OC#N NGGIZAWDYJYQBS-UHFFFAOYSA-N 0.000 description 1
- UFKLQICEQCIWNE-UHFFFAOYSA-N (3,5-dicyanatophenyl) cyanate Chemical compound N#COC1=CC(OC#N)=CC(OC#N)=C1 UFKLQICEQCIWNE-UHFFFAOYSA-N 0.000 description 1
- UVKWYPJUDVBJBS-UHFFFAOYSA-N (3-cyanato-2,4,6-trimethylphenyl) cyanate Chemical compound CC1=CC(C)=C(OC#N)C(C)=C1OC#N UVKWYPJUDVBJBS-UHFFFAOYSA-N 0.000 description 1
- XSQMOWKODCDFPI-UHFFFAOYSA-N (3-cyanato-2,4-dimethylphenyl) cyanate Chemical compound CC1=CC=C(OC#N)C(C)=C1OC#N XSQMOWKODCDFPI-UHFFFAOYSA-N 0.000 description 1
- NZTBWEVKIDDAOM-UHFFFAOYSA-N (4-cyanato-2,3,5,6-tetramethylphenyl) cyanate Chemical compound CC1=C(C)C(OC#N)=C(C)C(C)=C1OC#N NZTBWEVKIDDAOM-UHFFFAOYSA-N 0.000 description 1
- GUGZCSAPOLLKNG-UHFFFAOYSA-N (4-cyanatophenyl) cyanate Chemical compound N#COC1=CC=C(OC#N)C=C1 GUGZCSAPOLLKNG-UHFFFAOYSA-N 0.000 description 1
- VRNDCGVZVFFBGA-UHFFFAOYSA-N (4-cyclohexylphenyl)cyanamide Chemical compound C1=CC(NC#N)=CC=C1C1CCCCC1 VRNDCGVZVFFBGA-UHFFFAOYSA-N 0.000 description 1
- JDIPZHAYUYYGSN-UHFFFAOYSA-N (4-propylphenyl) cyanate Chemical compound CCCC1=CC=C(OC#N)C=C1 JDIPZHAYUYYGSN-UHFFFAOYSA-N 0.000 description 1
- LSDSKTNVDFCPNI-UHFFFAOYSA-N (4-propylphenyl)cyanamide Chemical compound CCCC1=CC=C(NC#N)C=C1 LSDSKTNVDFCPNI-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- MRLFIPVFEOENRZ-UHFFFAOYSA-N 10-(cyanoamino)decylcyanamide Chemical compound N#CNCCCCCCCCCCNC#N MRLFIPVFEOENRZ-UHFFFAOYSA-N 0.000 description 1
- HHBZZTKMMLDNDN-UHFFFAOYSA-N 2-butan-2-yloxybutane Chemical compound CCC(C)OC(C)CC HHBZZTKMMLDNDN-UHFFFAOYSA-N 0.000 description 1
- IIEPAQNLXCHENX-UHFFFAOYSA-N 4-(cyanoamino)butylcyanamide Chemical compound N#CNCCCCNC#N IIEPAQNLXCHENX-UHFFFAOYSA-N 0.000 description 1
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 1
- IFCUMEVTYOQGOA-UHFFFAOYSA-N 5-(cyanoamino)pentylcyanamide Chemical compound N#CNCCCCCNC#N IFCUMEVTYOQGOA-UHFFFAOYSA-N 0.000 description 1
- PLHYQJABEPDNHQ-UHFFFAOYSA-N 6-(cyanoamino)hexylcyanamide Chemical compound N#CNCCCCCCNC#N PLHYQJABEPDNHQ-UHFFFAOYSA-N 0.000 description 1
- ULDADFYYQVABQT-UHFFFAOYSA-N 7-(cyanoamino)heptylcyanamide Chemical compound N#CNCCCCCCCNC#N ULDADFYYQVABQT-UHFFFAOYSA-N 0.000 description 1
- QBBYWGSMDRMCGB-UHFFFAOYSA-N 8-(cyanoamino)octylcyanamide Chemical compound N#CNCCCCCCCCNC#N QBBYWGSMDRMCGB-UHFFFAOYSA-N 0.000 description 1
- SDDLEVPIDBLVHC-UHFFFAOYSA-N Bisphenol Z Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)CCCCC1 SDDLEVPIDBLVHC-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- SVYKKECYCPFKGB-UHFFFAOYSA-N N,N-dimethylcyclohexylamine Chemical compound CN(C)C1CCCCC1 SVYKKECYCPFKGB-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- JPRVQIIIENBRFS-UHFFFAOYSA-N OC#N.OC#N.OC1=CC=CC(O)=C1 Chemical compound OC#N.OC#N.OC1=CC=CC(O)=C1 JPRVQIIIENBRFS-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- YKONYNBAMHVIMF-UHFFFAOYSA-N [2,6-dichloro-4-[2-(3,5-dichloro-4-cyanatophenyl)propan-2-yl]phenyl] cyanate Chemical compound C=1C(Cl)=C(OC#N)C(Cl)=CC=1C(C)(C)C1=CC(Cl)=C(OC#N)C(Cl)=C1 YKONYNBAMHVIMF-UHFFFAOYSA-N 0.000 description 1
- IYKHMVYPRXSAPS-UHFFFAOYSA-N [3-[(cyanoamino)methyl]-3,5,5-trimethylcyclohexyl]cyanamide Chemical compound CC1(C)CC(NC#N)CC(C)(CNC#N)C1 IYKHMVYPRXSAPS-UHFFFAOYSA-N 0.000 description 1
- RNJYNVHWRGQBSV-UHFFFAOYSA-N [3-[(cyanoamino)methyl]phenyl]methylcyanamide Chemical compound N#CNCC1=CC=CC(CNC#N)=C1 RNJYNVHWRGQBSV-UHFFFAOYSA-N 0.000 description 1
- SPPHTMLVUBCBKQ-UHFFFAOYSA-N [4-(4-cyanatobenzoyl)phenyl] cyanate Chemical compound C=1C=C(OC#N)C=CC=1C(=O)C1=CC=C(OC#N)C=C1 SPPHTMLVUBCBKQ-UHFFFAOYSA-N 0.000 description 1
- BUPOATPDNYBPMR-UHFFFAOYSA-N [4-(4-cyanatophenyl)sulfonylphenyl] cyanate Chemical compound C=1C=C(OC#N)C=CC=1S(=O)(=O)C1=CC=C(OC#N)C=C1 BUPOATPDNYBPMR-UHFFFAOYSA-N 0.000 description 1
- UCCHXROTALQSNW-UHFFFAOYSA-N [4-(cyanoamino)cyclohexyl]cyanamide Chemical compound N#CNC1CCC(NC#N)CC1 UCCHXROTALQSNW-UHFFFAOYSA-N 0.000 description 1
- BUXJZRDCHOUYJL-UHFFFAOYSA-N [4-[(cyanoamino)methyl]phenyl]methylcyanamide Chemical compound N#CNCC1=CC=C(CNC#N)C=C1 BUXJZRDCHOUYJL-UHFFFAOYSA-N 0.000 description 1
- QPRSISFFVLZHIJ-UHFFFAOYSA-N [4-[1-[4-(cyanoamino)phenyl]cyclohexyl]phenyl]cyanamide Chemical compound C1=CC(NC#N)=CC=C1C1(C=2C=CC(NC#N)=CC=2)CCCCC1 QPRSISFFVLZHIJ-UHFFFAOYSA-N 0.000 description 1
- KHBNIEBZWXZEPA-UHFFFAOYSA-N [4-[2-(4-cyanato-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenyl] cyanate Chemical compound CC1=C(OC#N)C(C)=CC(C(C)(C)C=2C=C(C)C(OC#N)=C(C)C=2)=C1 KHBNIEBZWXZEPA-UHFFFAOYSA-N 0.000 description 1
- AHZMUXQJTGRNHT-UHFFFAOYSA-N [4-[2-(4-cyanatophenyl)propan-2-yl]phenyl] cyanate Chemical compound C=1C=C(OC#N)C=CC=1C(C)(C)C1=CC=C(OC#N)C=C1 AHZMUXQJTGRNHT-UHFFFAOYSA-N 0.000 description 1
- QYZSTICTJJGQJZ-UHFFFAOYSA-N [4-[2-[4-(cyanoamino)phenyl]propan-2-yl]phenyl]cyanamide Chemical compound C=1C=C(NC#N)C=CC=1C(C)(C)C1=CC=C(NC#N)C=C1 QYZSTICTJJGQJZ-UHFFFAOYSA-N 0.000 description 1
- HRZZMSJNQALMIJ-UHFFFAOYSA-N [6-(cyanoamino)-2,4,4-trimethylhexyl]cyanamide Chemical compound N#CNCC(C)CC(C)(C)CCNC#N HRZZMSJNQALMIJ-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000005529 alkyleneoxy group Chemical group 0.000 description 1
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 159000000009 barium salts Chemical class 0.000 description 1
- DGIURKXLVHHDMU-UHFFFAOYSA-N benzene-1,4-diol cyanic acid Chemical compound OC#N.OC#N.OC1=CC=C(O)C=C1 DGIURKXLVHHDMU-UHFFFAOYSA-N 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Chemical group 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- ZIPLUEXSCPLCEI-UHFFFAOYSA-N cyanamide group Chemical group C(#N)[NH-] ZIPLUEXSCPLCEI-UHFFFAOYSA-N 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate group Chemical group [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-N cyanic acid Chemical class OC#N XLJMAIOERFSOGZ-UHFFFAOYSA-N 0.000 description 1
- ATDGTVJJHBUTRL-UHFFFAOYSA-N cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 description 1
- QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical compound ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 1
- NAPSCFZYZVSQHF-UHFFFAOYSA-N dimantine Chemical compound CCCCCCCCCCCCCCCCCCN(C)C NAPSCFZYZVSQHF-UHFFFAOYSA-N 0.000 description 1
- 229950010007 dimantine Drugs 0.000 description 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 1
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical compound C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000010030 laminating Methods 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- MTHFROHDIWGWFD-UHFFFAOYSA-N n-butyl-n-methylbutan-1-amine Chemical compound CCCCN(C)CCCC MTHFROHDIWGWFD-UHFFFAOYSA-N 0.000 description 1
- GNVRJGIVDSQCOP-UHFFFAOYSA-N n-ethyl-n-methylethanamine Chemical compound CCN(C)CC GNVRJGIVDSQCOP-UHFFFAOYSA-N 0.000 description 1
- IITLRKXIQJEWFI-UHFFFAOYSA-N n-methyl-n-nonylnonan-1-amine Chemical compound CCCCCCCCCN(C)CCCCCCCCC IITLRKXIQJEWFI-UHFFFAOYSA-N 0.000 description 1
- NXPPAOGUKPJVDI-UHFFFAOYSA-N naphthalene-1,2-diol Chemical compound C1=CC=CC2=C(O)C(O)=CC=C21 NXPPAOGUKPJVDI-UHFFFAOYSA-N 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- VLZLOWPYUQHHCG-UHFFFAOYSA-N nitromethylbenzene Chemical compound [O-][N+](=O)CC1=CC=CC=C1 VLZLOWPYUQHHCG-UHFFFAOYSA-N 0.000 description 1
- 229920003986 novolac Polymers 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- 229940031826 phenolate Drugs 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- ILVXOBCQQYKLDS-UHFFFAOYSA-N pyridine N-oxide Chemical compound [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- NESLWCLHZZISNB-UHFFFAOYSA-M sodium phenolate Chemical compound [Na+].[O-]C1=CC=CC=C1 NESLWCLHZZISNB-UHFFFAOYSA-M 0.000 description 1
- WSFQLUVWDKCYSW-UHFFFAOYSA-M sodium;2-hydroxy-3-morpholin-4-ylpropane-1-sulfonate Chemical compound [Na+].[O-]S(=O)(=O)CC(O)CN1CCOCC1 WSFQLUVWDKCYSW-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 235000015096 spirit Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- YMBCJWGVCUEGHA-UHFFFAOYSA-M tetraethylammonium chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC YMBCJWGVCUEGHA-UHFFFAOYSA-M 0.000 description 1
- 238000007669 thermal treatment Methods 0.000 description 1
- KSBAEPSJVUENNK-UHFFFAOYSA-L tin(ii) 2-ethylhexanoate Chemical compound [Sn+2].CCCCC(CC)C([O-])=O.CCCCC(CC)C([O-])=O KSBAEPSJVUENNK-UHFFFAOYSA-L 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G73/00—Macromolecular compounds obtained by reactions forming a linkage containing nitrogen with or without oxygen or carbon in the main chain of the macromolecule, not provided for in groups C08G12/00 - C08G71/00
- C08G73/06—Polycondensates having nitrogen-containing heterocyclic rings in the main chain of the macromolecule
- C08G73/0622—Polycondensates containing six-membered rings, not condensed with other rings, with nitrogen atoms as the only ring hetero atoms
- C08G73/0638—Polycondensates containing six-membered rings, not condensed with other rings, with nitrogen atoms as the only ring hetero atoms with at least three nitrogen atoms in the ring
- C08G73/065—Preparatory processes
- C08G73/0655—Preparatory processes from polycyanurates
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752533119 DE2533119A1 (de) | 1975-07-24 | 1975-07-24 | Hochmolekulare polytriazine aus loeslichen polymeren n-cyan-isoharnstoffaethern |
| JP51086093A JPS5214695A (en) | 1975-07-24 | 1976-07-21 | Polytriazine with high molecular weight |
| IT50558/76A IT1066033B (it) | 1975-07-24 | 1976-07-22 | Politriazine di alto peso molecolare di eteri n-ciano-isoureici polimerici solubili e procedimento per produrle |
| US05/707,543 US4066577A (en) | 1975-07-24 | 1976-07-22 | High molecular weight polytriazines of soluble polymeric n-cyano-isourea ethers |
| GB30592/76A GB1529589A (en) | 1975-07-24 | 1976-07-22 | High molecular weight polytriazines of soluble polymeric n-cyano-isourea ethers |
| CH941276A CH603717A5 (enExample) | 1975-07-24 | 1976-07-22 | |
| CA257,573A CA1086892A (en) | 1975-07-24 | 1976-07-22 | High molecular weight polytriazines of soluble polymeric n-cyano-isourea ethers |
| BE169124A BE844386A (fr) | 1975-07-24 | 1976-07-22 | Polytriazines a poids moleculaire eleve a partir de n-cyano-isouree-ethers polymeres solubles |
| FR7622562A FR2318888A1 (fr) | 1975-07-24 | 1976-07-23 | Polytriazines a poids moleculaire eleve a partir de n-cyano-isouree-ethers polymeres solubles |
| NL7608212A NL7608212A (nl) | 1975-07-24 | 1976-07-23 | Polytriazinen met een grootmoleculairgewicht uit oplosbare polymere n-cyaanisoureumethers. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752533119 DE2533119A1 (de) | 1975-07-24 | 1975-07-24 | Hochmolekulare polytriazine aus loeslichen polymeren n-cyan-isoharnstoffaethern |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2533119A1 true DE2533119A1 (de) | 1977-02-10 |
Family
ID=5952368
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752533119 Withdrawn DE2533119A1 (de) | 1975-07-24 | 1975-07-24 | Hochmolekulare polytriazine aus loeslichen polymeren n-cyan-isoharnstoffaethern |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4066577A (enExample) |
| JP (1) | JPS5214695A (enExample) |
| BE (1) | BE844386A (enExample) |
| CA (1) | CA1086892A (enExample) |
| CH (1) | CH603717A5 (enExample) |
| DE (1) | DE2533119A1 (enExample) |
| FR (1) | FR2318888A1 (enExample) |
| GB (1) | GB1529589A (enExample) |
| IT (1) | IT1066033B (enExample) |
| NL (1) | NL7608212A (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1584801A (en) * | 1977-06-01 | 1981-02-18 | Ciba Geigy Ag | Reinforced composites |
| US4368317A (en) * | 1980-05-23 | 1983-01-11 | Ciba-Geigy Corporation | Mixtures for the preparation of nitrogen-containing polyadducts |
| US4383107A (en) * | 1980-08-28 | 1983-05-10 | Ciba-Geigy Corporation | Mixture containing N-cyanolactam for the preparation of nitrogen-containing polyadducts |
| US5428125A (en) * | 1989-07-17 | 1995-06-27 | The Dow Chemical Company | Mesogenic polycyanates and thermosets thereof |
| US5442039A (en) * | 1989-07-17 | 1995-08-15 | The Dow Chemical Company | Mesogenic polycyanates and thermosets thereof |
| US5206321A (en) * | 1991-10-03 | 1993-04-27 | The Dow Chemical Company | Polycyanates containing mesogenic moieties as lateral substituents |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3130224A (en) * | 1961-10-26 | 1964-04-21 | Nippon Carbide Kogyo Kk | Manufacturing method of alkylenedicyanamide |
| US3308101A (en) * | 1963-09-24 | 1967-03-07 | Du Pont | Novel polymeric materials |
| GB1320683A (en) * | 1969-09-29 | 1973-06-20 | Ici Ltd | Organic cyanamides |
-
1975
- 1975-07-24 DE DE19752533119 patent/DE2533119A1/de not_active Withdrawn
-
1976
- 1976-07-21 JP JP51086093A patent/JPS5214695A/ja active Pending
- 1976-07-22 BE BE169124A patent/BE844386A/xx unknown
- 1976-07-22 GB GB30592/76A patent/GB1529589A/en not_active Expired
- 1976-07-22 CH CH941276A patent/CH603717A5/xx not_active IP Right Cessation
- 1976-07-22 US US05/707,543 patent/US4066577A/en not_active Expired - Lifetime
- 1976-07-22 IT IT50558/76A patent/IT1066033B/it active
- 1976-07-22 CA CA257,573A patent/CA1086892A/en not_active Expired
- 1976-07-23 FR FR7622562A patent/FR2318888A1/fr active Granted
- 1976-07-23 NL NL7608212A patent/NL7608212A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2318888B1 (enExample) | 1979-07-20 |
| IT1066033B (it) | 1985-03-04 |
| BE844386A (fr) | 1977-01-24 |
| FR2318888A1 (fr) | 1977-02-18 |
| CA1086892A (en) | 1980-09-30 |
| NL7608212A (nl) | 1977-01-26 |
| JPS5214695A (en) | 1977-02-03 |
| CH603717A5 (enExample) | 1978-08-31 |
| GB1529589A (en) | 1978-10-25 |
| US4066577A (en) | 1978-01-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3886454T2 (de) | Härtbare Harzzusammensetzung. | |
| DE2533124A1 (de) | Verfahren zur herstellung von polytriazinen in gegenwart hochsiedender ester | |
| JPS61501094A (ja) | 芳香族ポリシアナ−ト類からポリトリアジン類の製造方法 | |
| DE2363784A1 (de) | Verfahren zum herstellen von polyaetherimiden | |
| DE1720627A1 (de) | Verfahren zur Herstellung von Polyimiden | |
| EP0079020B1 (de) | Verfahren zur Herstellung von Hydantoinen | |
| DE2612312A1 (de) | Formmassen aus mischungen halogenhaltiger und halogenfreier, polyfunktioneller, aromatischer cyansaeureester | |
| DE2533123A1 (de) | Hydrolysestabile polytriazine und ein verfahren zu ihrer herstellung | |
| DE2533119A1 (de) | Hochmolekulare polytriazine aus loeslichen polymeren n-cyan-isoharnstoffaethern | |
| DE3883134T2 (de) | Aromatische Aminharze, ihr Herstellungsverfahren und diese verwendende wärmehärtende Harzmischungen. | |
| DE2533126A1 (de) | Polytriazine und ein verfahren zu deren herstellung | |
| DE3220726C2 (de) | Härtbare Harzzusammensetzung | |
| DE2433169A1 (de) | Polyimidpolymere und verfahren zu deren herstellung | |
| DE60005650T2 (de) | Flammwidrige cyanatester | |
| DE2544740A1 (de) | Verfahren zur katalytischen trimerisierung aromatischer nitrilverbindungen sowie auf diese weise hergestellte polymerisate und mischpolymerisate auf basis vernetzter triaryl-s-triazinringe | |
| DE2533121A1 (de) | Hochmolekulare polytriazine aus loeslichen polymeren n-cyan-isoharnstoffaethern | |
| DE2121179A1 (enExample) | ||
| DE2533122A1 (de) | Verfahren zur herstellung flammwidriger polytriazine | |
| DE2202145B2 (de) | Verfahren zur Herstellung von Polyamidimide!! | |
| DE2533127A1 (de) | Polytriazine und ein verfahren zu deren herstellung | |
| DE2546369A1 (de) | Verfahren zur herstellung von polytriazinen | |
| DE2536011A1 (de) | Verfahren zur herstellung von feuchtigkeitsunempfindlichen, teilweise flammwidrigen polytriazinen | |
| DE1811588B2 (de) | Verfahren zur herstellung eines thermisch stabilen films aus polymermaterial | |
| DE2546355A1 (de) | Polytriazine und ein verfahren zu deren herstellung | |
| DE2549569A1 (de) | Verfahren zur herstellung flammwidriger elastischer polytriazine |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |