DE2523986A1 - Pneumatische blattransport- und ausrichtvorrichtung - Google Patents
Pneumatische blattransport- und ausrichtvorrichtungInfo
- Publication number
- DE2523986A1 DE2523986A1 DE19752523986 DE2523986A DE2523986A1 DE 2523986 A1 DE2523986 A1 DE 2523986A1 DE 19752523986 DE19752523986 DE 19752523986 DE 2523986 A DE2523986 A DE 2523986A DE 2523986 A1 DE2523986 A1 DE 2523986A1
- Authority
- DE
- Germany
- Prior art keywords
- sheet
- transport
- guide
- nozzles
- lateral
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 230000001154 acute effect Effects 0.000 claims description 3
- 238000007664 blowing Methods 0.000 claims description 3
- 235000015250 liver sausages Nutrition 0.000 claims 1
- XYSQXZCMOLNHOI-UHFFFAOYSA-N s-[2-[[4-(acetylsulfamoyl)phenyl]carbamoyl]phenyl] 5-pyridin-1-ium-1-ylpentanethioate;bromide Chemical compound [Br-].C1=CC(S(=O)(=O)NC(=O)C)=CC=C1NC(=O)C1=CC=CC=C1SC(=O)CCCC[N+]1=CC=CC=C1 XYSQXZCMOLNHOI-UHFFFAOYSA-N 0.000 claims 1
- 239000013598 vector Substances 0.000 description 8
- 238000007639 printing Methods 0.000 description 3
- 230000000994 depressogenic effect Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000003213 activating effect Effects 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 230000037373 wrinkle formation Effects 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B65—CONVEYING; PACKING; STORING; HANDLING THIN OR FILAMENTARY MATERIAL
- B65H—HANDLING THIN OR FILAMENTARY MATERIAL, e.g. SHEETS, WEBS, CABLES
- B65H5/00—Feeding articles separated from piles; Feeding articles to machines
- B65H5/22—Feeding articles separated from piles; Feeding articles to machines by air-blast or suction device
- B65H5/228—Feeding articles separated from piles; Feeding articles to machines by air-blast or suction device by air-blast devices
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B65—CONVEYING; PACKING; STORING; HANDLING THIN OR FILAMENTARY MATERIAL
- B65H—HANDLING THIN OR FILAMENTARY MATERIAL, e.g. SHEETS, WEBS, CABLES
- B65H9/00—Registering, e.g. orientating, articles; Devices therefor
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Registering Or Overturning Sheets (AREA)
- Delivering By Means Of Belts And Rollers (AREA)
- Collation Of Sheets And Webs (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US482310A US3918706A (en) | 1974-06-24 | 1974-06-24 | Pneumatic sheet transport and alignment mechanism |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2523986A1 true DE2523986A1 (de) | 1976-01-15 |
Family
ID=23915568
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752523986 Withdrawn DE2523986A1 (de) | 1974-06-24 | 1975-05-30 | Pneumatische blattransport- und ausrichtvorrichtung |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3918706A (enrdf_load_stackoverflow) |
| JP (1) | JPS512163A (enrdf_load_stackoverflow) |
| DE (1) | DE2523986A1 (enrdf_load_stackoverflow) |
| FR (1) | FR2276644A1 (enrdf_load_stackoverflow) |
| GB (1) | GB1461754A (enrdf_load_stackoverflow) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0029969A1 (de) * | 1979-11-28 | 1981-06-10 | Hoechst Aktiengesellschaft | Vorrichtung zum Ausrichten und Zuführen einer Vorlage |
| EP0695707A3 (de) * | 1994-08-03 | 1997-01-15 | Heidelberger Druckmasch Ag | Einrichtung zum berührungsfreien Führen bogenförmigen Materials |
| DE102022116484A1 (de) | 2022-07-01 | 2024-01-04 | Deutsche Post Ag | Vorrichtung zum Ausrichten von Objekten |
Families Citing this family (62)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4148476A (en) * | 1975-05-06 | 1979-04-10 | Ab Svenska Flaktfabriken | Conveyor for lamellar material |
| US4073001A (en) * | 1975-10-31 | 1978-02-07 | Xerox Corporation | Apparatus for neutralizing and registering an electrostatically charged sheet |
| SE7611828L (sv) * | 1975-10-31 | 1977-05-01 | Xerox Corp | Pneumatisk anordning for legesinstellning av ark. |
| DE2648226A1 (de) * | 1975-10-31 | 1977-05-05 | Xerox Corp | Verfahren zum foerdern und ausrichten von aufeinandergestapelten blaettern |
| US4171131A (en) * | 1975-10-31 | 1979-10-16 | Xerox Corporation | Pneumatic registration apparatus |
| CA1066316A (en) * | 1975-10-31 | 1979-11-13 | Thomas J. Hamlin | Registration station |
| US4043549A (en) * | 1975-11-24 | 1977-08-23 | Xerox Corporation | Impact feeder |
| US4066254A (en) * | 1975-11-28 | 1978-01-03 | Xerox Corporation | Three-way pneumatic registration apparatus |
| US3984098A (en) * | 1975-11-28 | 1976-10-05 | Xerox Corporation | Pneumatic registration and clamping apparatus |
| US4026542A (en) * | 1975-11-28 | 1977-05-31 | Xerox Corporation | Dual registration apparatus |
| US4062538A (en) * | 1976-01-15 | 1977-12-13 | Xerox Corporation | Speed regulated fluidic sheet transport |
| US4033579A (en) * | 1976-03-11 | 1977-07-05 | Xerox Corporation | Offset stacker |
| US4081201A (en) * | 1976-12-27 | 1978-03-28 | International Business Machines Corporation | Wafer air film transportation system |
| US4159824A (en) * | 1977-05-06 | 1979-07-03 | Xerox Corporation | Method for reversing the direction of travel of a sheet |
| US4144618A (en) * | 1977-06-22 | 1979-03-20 | E. I. Du Pont De Nemours And Company | Material converger |
| US4123113A (en) * | 1977-09-26 | 1978-10-31 | Ford Motor Company | Gas table |
| US4203510A (en) * | 1978-06-05 | 1980-05-20 | Gte Automatic Electric Laboratories Incorporated | Pneumatic diverter for hybrid thick film substrate processing equipment |
| US4229861A (en) * | 1978-08-10 | 1980-10-28 | E. I. Du Pont De Nemours And Company | Material converger |
| JPS55164242U (enrdf_load_stackoverflow) * | 1979-05-14 | 1980-11-26 | ||
| US4609134A (en) * | 1981-06-29 | 1986-09-02 | Gemcor Engineering Corp. | Jet guide rivet injector |
| US4645112A (en) * | 1981-12-21 | 1987-02-24 | Gemcor Engineering Corp. | Riveting machine |
| US4453709A (en) * | 1982-05-07 | 1984-06-12 | Crown Zellerbach Corporation | System for serially conveying discrete flexible articles |
| NL8300648A (nl) * | 1983-02-21 | 1984-09-17 | Integrated Automation | Floating transportbaan voor substraten. |
| NL8400658A (nl) * | 1984-03-01 | 1985-10-01 | Bok Edward | Verbeterde installatie voor vacuum processing van substraten. |
| NL8401777A (nl) * | 1984-06-04 | 1986-01-02 | Bok Edward | Gasslot voor in- en uitgang van tunnel, waarin verplaatsing en processing van wafers geschiedt met behulp van media onder double-floating conditie. |
| NL8401776A (nl) * | 1984-06-04 | 1986-01-02 | Bok Edward | Verbeterde double-floating wafer transport/processing installatie. |
| US4660819A (en) * | 1984-09-27 | 1987-04-28 | Xerox Corporation | Automatic restacking registration in a recirculating document handler |
| DE3442135A1 (de) * | 1984-11-17 | 1986-05-28 | Heidelberger Druckmaschinen Ag, 6900 Heidelberg | Verfahren zum ausrichten von bogen |
| JPH0338192Y2 (enrdf_load_stackoverflow) * | 1985-03-12 | 1991-08-13 | ||
| US5788425A (en) * | 1992-07-15 | 1998-08-04 | Imation Corp. | Flexible system for handling articles |
| US5432653A (en) * | 1993-06-22 | 1995-07-11 | Minnesota Mining And Manufacturing Company | Loop-shaped pneumatic drive |
| US5485325A (en) * | 1994-04-04 | 1996-01-16 | Minnesota Mining And Manufacturing Company | Magazine storage system for recording strips |
| US5634636A (en) * | 1996-01-11 | 1997-06-03 | Xerox Corporation | Flexible object handling system using feedback controlled air jets |
| US5941501A (en) * | 1996-09-06 | 1999-08-24 | Xerox Corporation | Passively addressable cantilever valves |
| US5897097A (en) * | 1996-09-06 | 1999-04-27 | Xerox Corporation | Passively addressable fluid valves having S-shaped blocking films |
| US5839722A (en) * | 1996-11-26 | 1998-11-24 | Xerox Corporation | Paper handling system having embedded control structures |
| US5971355A (en) * | 1996-11-27 | 1999-10-26 | Xerox Corporation | Microdevice valve structures to fluid control |
| US6123316A (en) * | 1996-11-27 | 2000-09-26 | Xerox Corporation | Conduit system for a valve array |
| US6089534A (en) * | 1998-01-08 | 2000-07-18 | Xerox Corporation | Fast variable flow microelectromechanical valves |
| US6032923A (en) * | 1998-01-08 | 2000-03-07 | Xerox Corporation | Fluid valves having cantilevered blocking films |
| US5951006A (en) * | 1998-05-22 | 1999-09-14 | Xerox Corporation | Modular air jet array with coanda exhausting for module decoupling |
| EP0960845A1 (en) * | 1998-05-28 | 1999-12-01 | Xerox Corporation | Pneumatic paper path |
| AT409183B (de) * | 2000-05-05 | 2002-06-25 | Ebner Peter Dipl Ing | Vorrichtung zum führen eines metallbandes auf einem gaskissen |
| US6846374B2 (en) | 2000-05-16 | 2005-01-25 | Kimberly-Clark Worldwide | Method and apparatus for making prefastened and refastenable pant with desired waist and hip fit |
| US6562167B2 (en) | 2000-05-16 | 2003-05-13 | Kimberly-Clark Worldwide, Inc. | Methods for making garments with fastening components |
| US6596113B2 (en) | 2000-05-16 | 2003-07-22 | Kimberly-Clark Worldwide, Inc. | Presentation and bonding of garment side panels |
| US6481362B2 (en) | 2000-05-16 | 2002-11-19 | Kimberly-Clark Worldwide, Inc. | Orbital motion device for seaming garments |
| US7387148B2 (en) | 2001-05-15 | 2008-06-17 | Kimberly-Clark Worldwide, Inc. | Garment side panel conveyor system and method |
| US6565691B2 (en) | 2000-05-16 | 2003-05-20 | Kimberly-Clark Worldwide, Inc. | Method and apparatus for forming a lap seam |
| US6723034B2 (en) | 2000-05-16 | 2004-04-20 | Kimberly-Clark Worldwide, Inc. | Presentation of fastening components for making prefastened and refastenable pants |
| US6513221B2 (en) | 2000-05-16 | 2003-02-04 | Kimberly-Clark Worldwide, Inc. | Garment side panel conveyor system and method |
| US6514187B2 (en) | 2000-05-16 | 2003-02-04 | Kimberly-Clark Worldwide, Inc. | Folding and manufacture of pants |
| US6497032B2 (en) | 2000-05-16 | 2002-12-24 | Kimberly-Clark Worldwide, Inc. | Refastenable bonding of garment side panels |
| EP1475339A1 (de) * | 2003-05-08 | 2004-11-10 | MASCHINENBAU OPPENWEILER BINDER GmbH & Co. KG | Verfahren und Vorrichtung zur Weiterverarbeitung gedruckter Bogen |
| DE50303820D1 (de) * | 2003-05-08 | 2006-07-27 | Oppenweiler Binder Gmbh Maschb | Bogenausrichteinrichtung mit einer Blasluftniederhaltervorrichtung |
| US20050209079A1 (en) * | 2004-03-16 | 2005-09-22 | Heidelberger Druckmaschinen Ag | Blower for a folder pocket |
| US7311234B2 (en) * | 2005-06-06 | 2007-12-25 | The Procter & Gamble Company | Vectored air web handling apparatus |
| US7726649B2 (en) * | 2005-06-07 | 2010-06-01 | Xerox Corporation | Air drag cooler for sheet transport apparatus |
| US8579284B2 (en) * | 2012-03-28 | 2013-11-12 | Xerox Corporation | Pneumatic sheet registration and clamping |
| JP6141049B2 (ja) * | 2013-03-01 | 2017-06-07 | キヤノン株式会社 | シート搬送装置及び画像形成装置 |
| US8944588B2 (en) * | 2013-03-12 | 2015-02-03 | Xerox Corporation | Pneumatic sheet registration and clamping with vectored air flow |
| CN108298342B (zh) * | 2016-10-18 | 2019-08-16 | 温州职业技术学院 | 物质的气悬浮柔性输送及定位装置及方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2240424A (en) * | 1938-05-21 | 1941-04-29 | Spiess Georg | Sheet feeding and registering device |
| US3103850A (en) * | 1961-12-14 | 1963-09-17 | Ibm | Pneumatically operated document sensing station |
| DE1761468A1 (de) * | 1968-05-24 | 1971-07-01 | Mabeg Maschb Gmbh Nachf Hense | Foerdervorrichtung fuer Bogen von Karton,Papier und Kunststoffolien |
| US3588096A (en) * | 1969-05-26 | 1971-06-28 | Singer Co | Registration device for fabric pieces |
| US3747922A (en) * | 1971-12-27 | 1973-07-24 | Sperry Rand Corp | Pneumatic transport track |
-
1974
- 1974-06-24 US US482310A patent/US3918706A/en not_active Expired - Lifetime
-
1975
- 1975-04-17 GB GB1577175A patent/GB1461754A/en not_active Expired
- 1975-05-06 FR FR7515092A patent/FR2276644A1/fr active Granted
- 1975-05-16 JP JP50057507A patent/JPS512163A/ja active Pending
- 1975-05-30 DE DE19752523986 patent/DE2523986A1/de not_active Withdrawn
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0029969A1 (de) * | 1979-11-28 | 1981-06-10 | Hoechst Aktiengesellschaft | Vorrichtung zum Ausrichten und Zuführen einer Vorlage |
| US4360195A (en) | 1979-11-28 | 1982-11-23 | Hoechst Aktiengesellschaft | Device for aligning and feeding an original |
| EP0695707A3 (de) * | 1994-08-03 | 1997-01-15 | Heidelberger Druckmasch Ag | Einrichtung zum berührungsfreien Führen bogenförmigen Materials |
| DE102022116484A1 (de) | 2022-07-01 | 2024-01-04 | Deutsche Post Ag | Vorrichtung zum Ausrichten von Objekten |
| US12358730B2 (en) | 2022-07-01 | 2025-07-15 | Deutsche Post Ag | Apparatus for orienting or rotating objects |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1461754A (en) | 1977-01-19 |
| FR2276644A1 (fr) | 1976-01-23 |
| JPS512163A (enrdf_load_stackoverflow) | 1976-01-09 |
| US3918706A (en) | 1975-11-11 |
| FR2276644B1 (enrdf_load_stackoverflow) | 1977-07-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2523986A1 (de) | Pneumatische blattransport- und ausrichtvorrichtung | |
| EP0792742B2 (de) | Bogentransportvorrichtung und Verfahren zur Führung von bogenförmigem Material in einer Druckmaschine, insbesondere in einer Bogenrotations-Offsetdruckmaschine | |
| EP0883566B1 (de) | Schwertfalzwerk | |
| CH403811A (de) | Verfahren und Vorrichtung zum Einbringen von Einlagen in gefalzte Umschlagbogen | |
| DE3203879A1 (de) | Offset-bogen-rotationsdruckmaschine | |
| DE2633183C2 (de) | Wendevorrichtung an einer von Schön- auf Schön- und Widerdruck umstellbaren Bogenrotationsmaschine | |
| DE3023533A1 (de) | Vorrichtung zum ablegen von bogen in einem stapel | |
| DE2829067A1 (de) | Verfahren und vorrichtung zum oeffnen gefalzter druckbogen | |
| DD142435A5 (de) | Mehrfarbendruckmaschine | |
| DE10102221A1 (de) | Vorrichtung zum Verlangsamen von Signaturen | |
| DE19733692A1 (de) | Bogenausleger einer Druckmaschine | |
| DE4424483A1 (de) | Ausleger einer bogenverarbeitenden Maschine | |
| DE19814006C1 (de) | Verfahren und Einrichtung zur Bogenführung an einer Leitrakel in Druckmaschinen | |
| EP1055626B1 (de) | Vorrichtung und Verfahren zum Ablenken von Bedruckstoffbogen | |
| DE3209259C1 (de) | Bogenanlegevorrichtung an bogenverarbeitenden Maschinen | |
| DE2326929B2 (de) | Vorrichtung zur Zuführung von Kartonagen u.dgl. Rohlingen | |
| DE3234155A1 (de) | Vorrichtung zum fuehren und niederhalten eines druckbogens in der transportebene einer druckmaschine | |
| DD285072A5 (de) | Blaseinrichtung | |
| DE3022772A1 (de) | Vorrichtung zum schneiden von prospekten, bedruckten blaettern o.dgl. gegenstaenden | |
| DE2435756C2 (de) | Vorrichtung für eine paßgenaue Anlage eines zu bedruckenden Bogens | |
| DE19713361A1 (de) | Verfahren und Vorrichtung zum abschmierfreien Führen eines bedruckten Bogens auf einem bogenführenden Zylinder einer Druckmaschine, insbesondere auf einer Wendetrommel einer Bogenrotations-Offsetdruckmaschine im Schöndruckbetrieb | |
| DE10060752A1 (de) | Vorrichtung zum fortlaufenden Falzen von flachem Material | |
| EP1110894B1 (de) | Verfahren und Vorrichtung zum Falzen von Materialbogen | |
| EP1055625A2 (de) | Vorrichtung und Verfahren zum Umlenken von Bedruckstoffbogen | |
| DE2334551A1 (de) | Blattfoerdervorrichtung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |