DE2516003C2 - Wäßriges halbflüssiges Reinigungsmittel mit scheuernder Wirkung - Google Patents
Wäßriges halbflüssiges Reinigungsmittel mit scheuernder WirkungInfo
- Publication number
- DE2516003C2 DE2516003C2 DE2516003A DE2516003A DE2516003C2 DE 2516003 C2 DE2516003 C2 DE 2516003C2 DE 2516003 A DE2516003 A DE 2516003A DE 2516003 A DE2516003 A DE 2516003A DE 2516003 C2 DE2516003 C2 DE 2516003C2
- Authority
- DE
- Germany
- Prior art keywords
- liquid
- weight
- semi
- cleaning agent
- abrasive
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000007788 liquid Substances 0.000 title claims description 88
- 239000012459 cleaning agent Substances 0.000 title claims description 67
- 230000000694 effects Effects 0.000 title description 6
- 239000000203 mixture Substances 0.000 claims description 68
- 230000009969 flowable effect Effects 0.000 claims description 44
- 239000000945 filler Substances 0.000 claims description 42
- -1 polyethylene Polymers 0.000 claims description 42
- 239000003599 detergent Substances 0.000 claims description 38
- 239000004927 clay Substances 0.000 claims description 31
- 239000002245 particle Substances 0.000 claims description 26
- 239000003082 abrasive agent Substances 0.000 claims description 25
- 239000010451 perlite Substances 0.000 claims description 23
- 235000019362 perlite Nutrition 0.000 claims description 23
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 23
- 239000003795 chemical substances by application Substances 0.000 claims description 19
- 239000004743 Polypropylene Substances 0.000 claims description 16
- 229920001155 polypropylene Polymers 0.000 claims description 16
- 239000008346 aqueous phase Substances 0.000 claims description 12
- 230000005484 gravity Effects 0.000 claims description 11
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 7
- 239000000377 silicon dioxide Substances 0.000 claims description 7
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 6
- 229910000275 saponite Inorganic materials 0.000 claims description 6
- 239000004793 Polystyrene Substances 0.000 claims description 5
- 239000011521 glass Substances 0.000 claims description 4
- 229910000271 hectorite Inorganic materials 0.000 claims description 4
- KWLMIXQRALPRBC-UHFFFAOYSA-L hectorite Chemical compound [Li+].[OH-].[OH-].[Na+].[Mg+2].O1[Si]2([O-])O[Si]1([O-])O[Si]([O-])(O1)O[Si]1([O-])O2 KWLMIXQRALPRBC-UHFFFAOYSA-L 0.000 claims description 4
- 238000005191 phase separation Methods 0.000 claims description 4
- 239000008262 pumice Substances 0.000 claims description 4
- 239000004576 sand Substances 0.000 claims description 4
- 229920000877 Melamine resin Polymers 0.000 claims description 3
- 239000004698 Polyethylene Substances 0.000 claims description 3
- 229920001807 Urea-formaldehyde Polymers 0.000 claims description 3
- GZCGUPFRVQAUEE-SLPGGIOYSA-N aldehydo-D-glucose Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O GZCGUPFRVQAUEE-SLPGGIOYSA-N 0.000 claims description 3
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 3
- 239000001506 calcium phosphate Substances 0.000 claims description 3
- 229910000389 calcium phosphate Inorganic materials 0.000 claims description 3
- 235000011010 calcium phosphates Nutrition 0.000 claims description 3
- 239000010433 feldspar Substances 0.000 claims description 3
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 claims description 3
- 238000005498 polishing Methods 0.000 claims description 3
- 229920001225 polyester resin Polymers 0.000 claims description 3
- 239000004645 polyester resin Substances 0.000 claims description 3
- 229920000573 polyethylene Polymers 0.000 claims description 3
- 229920002223 polystyrene Polymers 0.000 claims description 3
- 239000010453 quartz Substances 0.000 claims description 3
- 239000010454 slate Substances 0.000 claims description 3
- 239000004408 titanium dioxide Substances 0.000 claims description 3
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 claims description 3
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 claims description 3
- 229910000276 sauconite Inorganic materials 0.000 claims description 2
- 239000010455 vermiculite Substances 0.000 claims description 2
- 229910052902 vermiculite Inorganic materials 0.000 claims description 2
- 235000019354 vermiculite Nutrition 0.000 claims description 2
- 239000011806 microball Substances 0.000 claims 2
- 235000019687 Lamb Nutrition 0.000 claims 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 claims 1
- 229910000273 nontronite Inorganic materials 0.000 claims 1
- 229910000269 smectite group Inorganic materials 0.000 claims 1
- 239000012071 phase Substances 0.000 description 31
- 239000007844 bleaching agent Substances 0.000 description 28
- 239000000126 substance Substances 0.000 description 27
- 239000004094 surface-active agent Substances 0.000 description 26
- 239000000463 material Substances 0.000 description 24
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 19
- 239000011734 sodium Substances 0.000 description 17
- 229910052708 sodium Inorganic materials 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 239000004615 ingredient Substances 0.000 description 12
- 239000007864 aqueous solution Substances 0.000 description 11
- 239000000872 buffer Substances 0.000 description 11
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 10
- 239000011591 potassium Substances 0.000 description 10
- 229910052700 potassium Inorganic materials 0.000 description 10
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 10
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 9
- 238000009991 scouring Methods 0.000 description 9
- 229910021647 smectite Inorganic materials 0.000 description 9
- 150000008051 alkyl sulfates Chemical class 0.000 description 8
- 239000007791 liquid phase Substances 0.000 description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- 235000011180 diphosphates Nutrition 0.000 description 7
- 229910052625 palygorskite Inorganic materials 0.000 description 7
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 229960000892 attapulgite Drugs 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- 239000000975 dye Substances 0.000 description 6
- 239000000395 magnesium oxide Substances 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 239000002304 perfume Substances 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 description 6
- 229910019142 PO4 Inorganic materials 0.000 description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 150000001768 cations Chemical group 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 5
- 229910052500 inorganic mineral Inorganic materials 0.000 description 5
- 239000011707 mineral Substances 0.000 description 5
- 235000010755 mineral Nutrition 0.000 description 5
- 235000021317 phosphate Nutrition 0.000 description 5
- 238000000926 separation method Methods 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 229910000404 tripotassium phosphate Inorganic materials 0.000 description 5
- 235000019798 tripotassium phosphate Nutrition 0.000 description 5
- 235000013162 Cocos nucifera Nutrition 0.000 description 4
- 244000060011 Cocos nucifera Species 0.000 description 4
- 239000005708 Sodium hypochlorite Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 239000011777 magnesium Substances 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- 238000005029 sieve analysis Methods 0.000 description 4
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 4
- 239000001488 sodium phosphate Substances 0.000 description 4
- 238000003860 storage Methods 0.000 description 4
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 4
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 4
- 235000019801 trisodium phosphate Nutrition 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- QDHHCQZDFGDHMP-UHFFFAOYSA-N Chloramine Chemical class ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 description 3
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 3
- 239000004115 Sodium Silicate Substances 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 239000006172 buffering agent Substances 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 150000002191 fatty alcohols Chemical class 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 3
- 239000010452 phosphate Substances 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 3
- 229910052911 sodium silicate Inorganic materials 0.000 description 3
- 239000000375 suspending agent Substances 0.000 description 3
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 2
- 229910004298 SiO 2 Inorganic materials 0.000 description 2
- 238000005299 abrasion Methods 0.000 description 2
- UBNVDFUEPGQZQS-UHFFFAOYSA-N acetic acid;n,n-dimethyldodecan-1-amine Chemical compound CC([O-])=O.CCCCCCCCCCCC[NH+](C)C UBNVDFUEPGQZQS-UHFFFAOYSA-N 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 238000013019 agitation Methods 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 239000012928 buffer substance Substances 0.000 description 2
- 230000003139 buffering effect Effects 0.000 description 2
- 229910001424 calcium ion Inorganic materials 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- CEJLBZWIKQJOAT-UHFFFAOYSA-N dichloroisocyanuric acid Chemical compound ClN1C(=O)NC(=O)N(Cl)C1=O CEJLBZWIKQJOAT-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 125000005456 glyceride group Chemical group 0.000 description 2
- VGUANSONTIBISX-UHFFFAOYSA-N hexadecyl(dimethyl)azanium;acetate Chemical compound CC(O)=O.CCCCCCCCCCCCCCCCN(C)C VGUANSONTIBISX-UHFFFAOYSA-N 0.000 description 2
- BXFPJFWOBWLKSR-UHFFFAOYSA-N hexadecyl(dimethyl)azanium;hexanoate Chemical compound CCCCCC([O-])=O.CCCCCCCCCCCCCCCC[NH+](C)C BXFPJFWOBWLKSR-UHFFFAOYSA-N 0.000 description 2
- 230000036571 hydration Effects 0.000 description 2
- 238000006703 hydration reaction Methods 0.000 description 2
- 239000002198 insoluble material Substances 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 229910001425 magnesium ion Inorganic materials 0.000 description 2
- 239000000391 magnesium silicate Substances 0.000 description 2
- 238000012423 maintenance Methods 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 239000004005 microsphere Substances 0.000 description 2
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 229910001562 pearlite Inorganic materials 0.000 description 2
- 239000005011 phenolic resin Substances 0.000 description 2
- 229920001568 phenolic resin Polymers 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 229920001021 polysulfide Polymers 0.000 description 2
- 239000005077 polysulfide Substances 0.000 description 2
- 150000008117 polysulfides Polymers 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 230000000717 retained effect Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 235000010339 sodium tetraborate Nutrition 0.000 description 2
- 235000019832 sodium triphosphate Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000004575 stone Substances 0.000 description 2
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 2
- 230000008961 swelling Effects 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 239000003760 tallow Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 230000008719 thickening Effects 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- YRIZYWQGELRKNT-UHFFFAOYSA-N 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione Chemical compound ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O YRIZYWQGELRKNT-UHFFFAOYSA-N 0.000 description 1
- HJTAZXHBEBIQQX-UHFFFAOYSA-N 1,5-bis(chloromethyl)naphthalene Chemical compound C1=CC=C2C(CCl)=CC=CC2=C1CCl HJTAZXHBEBIQQX-UHFFFAOYSA-N 0.000 description 1
- HLZKNKRTKFSKGZ-UHFFFAOYSA-N 1-Tetradecanol Natural products CCCCCCCCCCCCCCO HLZKNKRTKFSKGZ-UHFFFAOYSA-N 0.000 description 1
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241001474374 Blennius Species 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- ZKQDCIXGCQPQNV-UHFFFAOYSA-N Calcium hypochlorite Chemical compound [Ca+2].Cl[O-].Cl[O-] ZKQDCIXGCQPQNV-UHFFFAOYSA-N 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N Calcium oxide Chemical compound [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 241000243251 Hydra Species 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- FUVGZDDOHNQZEO-UHFFFAOYSA-N NS(=O)(=O)NCl Chemical compound NS(=O)(=O)NCl FUVGZDDOHNQZEO-UHFFFAOYSA-N 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- 241000124033 Salix Species 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000323 aluminium silicate Inorganic materials 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- GOLCXWYRSKYTSP-UHFFFAOYSA-N arsenic trioxide Inorganic materials O1[As]2O[As]1O2 GOLCXWYRSKYTSP-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 239000002981 blocking agent Substances 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- ZMEVAQQMUSEIJD-UHFFFAOYSA-N butanoate;dimethyl(tetradecyl)azanium Chemical compound CCCC([O-])=O.CCCCCCCCCCCCCC[NH+](C)C ZMEVAQQMUSEIJD-UHFFFAOYSA-N 0.000 description 1
- XLIRVORAQHWLJE-UHFFFAOYSA-N butanoate;dodecyl(dimethyl)azanium Chemical compound CCCC([O-])=O.CCCCCCCCCCCC[NH+](C)C XLIRVORAQHWLJE-UHFFFAOYSA-N 0.000 description 1
- SCEJTWKEWDOCKV-UHFFFAOYSA-N butanoate;hexadecyl(dimethyl)azanium Chemical compound CCCC([O-])=O.CCCCCCCCCCCCCCCC[NH+](C)C SCEJTWKEWDOCKV-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 238000002144 chemical decomposition reaction Methods 0.000 description 1
- VDQQXEISLMTGAB-UHFFFAOYSA-N chloramine T Chemical compound [Na+].CC1=CC=C(S(=O)(=O)[N-]Cl)C=C1 VDQQXEISLMTGAB-UHFFFAOYSA-N 0.000 description 1
- JFBJUMZWZDHTIF-UHFFFAOYSA-N chlorine chlorite Inorganic materials ClOCl=O JFBJUMZWZDHTIF-UHFFFAOYSA-N 0.000 description 1
- 239000002734 clay mineral Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- JSYGRUBHOCKMGQ-UHFFFAOYSA-N dichloramine Chemical class ClNCl JSYGRUBHOCKMGQ-UHFFFAOYSA-N 0.000 description 1
- DWVAEDTZGRQKKP-UHFFFAOYSA-N diethyl(tetradecyl)azanium;pentanoate Chemical compound CCCCC([O-])=O.CCCCCCCCCCCCCC[NH+](CC)CC DWVAEDTZGRQKKP-UHFFFAOYSA-N 0.000 description 1
- WOJPVXQAVGCDIA-UHFFFAOYSA-N dimethyl(tetradecyl)azanium;acetate Chemical compound CC(O)=O.CCCCCCCCCCCCCCN(C)C WOJPVXQAVGCDIA-UHFFFAOYSA-N 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- FZFYOUJTOSBFPQ-UHFFFAOYSA-M dipotassium;hydroxide Chemical compound [OH-].[K+].[K+] FZFYOUJTOSBFPQ-UHFFFAOYSA-M 0.000 description 1
- QMMXHYMFTNPOPG-UHFFFAOYSA-N dipropyl(tetradecyl)azanium;pentanoate Chemical compound CCCCC([O-])=O.CCCCCCCCCCCCCC[NH+](CCC)CCC QMMXHYMFTNPOPG-UHFFFAOYSA-N 0.000 description 1
- UQGFMSUEHSUPRD-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound [Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 UQGFMSUEHSUPRD-UHFFFAOYSA-N 0.000 description 1
- CDMADVZSLOHIFP-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane;decahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 CDMADVZSLOHIFP-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- QKHKGSULBQVNMO-UHFFFAOYSA-N dodecyl(dimethyl)azanium;hexanoate Chemical compound CCCCCC([O-])=O.CCCCCCCCCCCC[NH+](C)C QKHKGSULBQVNMO-UHFFFAOYSA-N 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- STNGULMWFPMOCE-UHFFFAOYSA-N ethyl 4-butyl-3,5-dimethyl-1h-pyrrole-2-carboxylate Chemical compound CCCCC1=C(C)NC(C(=O)OCC)=C1C STNGULMWFPMOCE-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229940005740 hexametaphosphate Drugs 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 239000002563 ionic surfactant Substances 0.000 description 1
- QRXWMOHMRWLFEY-UHFFFAOYSA-N isoniazide Chemical compound NNC(=O)C1=CC=NC=C1 QRXWMOHMRWLFEY-UHFFFAOYSA-N 0.000 description 1
- 239000011344 liquid material Substances 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000012243 magnesium silicates Nutrition 0.000 description 1
- YZQBYALVHAANGI-UHFFFAOYSA-N magnesium;dihypochlorite Chemical compound [Mg+2].Cl[O-].Cl[O-] YZQBYALVHAANGI-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 150000001457 metallic cations Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 229940043348 myristyl alcohol Drugs 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- PJBJJXCZRAHMCK-UHFFFAOYSA-N n,n-dichlorobenzenesulfonamide Chemical compound ClN(Cl)S(=O)(=O)C1=CC=CC=C1 PJBJJXCZRAHMCK-UHFFFAOYSA-N 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N n-heptadecyl alcohol Natural products CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- BXWNKGSJHAJOGX-UHFFFAOYSA-N n-hexadecyl alcohol Natural products CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 1
- 229910000480 nickel oxide Inorganic materials 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- NDLPOXTZKUMGOV-UHFFFAOYSA-N oxo(oxoferriooxy)iron hydrate Chemical compound O.O=[Fe]O[Fe]=O NDLPOXTZKUMGOV-UHFFFAOYSA-N 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- SATVIFGJTRRDQU-UHFFFAOYSA-N potassium hypochlorite Chemical compound [K+].Cl[O-] SATVIFGJTRRDQU-UHFFFAOYSA-N 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- ONQDVAFWWYYXHM-UHFFFAOYSA-M potassium lauryl sulfate Chemical compound [K+].CCCCCCCCCCCCOS([O-])(=O)=O ONQDVAFWWYYXHM-UHFFFAOYSA-M 0.000 description 1
- IFIDXBCRSWOUSB-UHFFFAOYSA-N potassium;1,3-dichloro-1,3,5-triazinane-2,4,6-trione Chemical compound [K+].ClN1C(=O)NC(=O)N(Cl)C1=O IFIDXBCRSWOUSB-UHFFFAOYSA-N 0.000 description 1
- JTXIPOLAHSBNJM-UHFFFAOYSA-M potassium;decyl sulfate Chemical compound [K+].CCCCCCCCCCOS([O-])(=O)=O JTXIPOLAHSBNJM-UHFFFAOYSA-M 0.000 description 1
- 238000003672 processing method Methods 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 238000005201 scrubbing Methods 0.000 description 1
- 210000002374 sebum Anatomy 0.000 description 1
- 238000010008 shearing Methods 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 235000019795 sodium metasilicate Nutrition 0.000 description 1
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 1
- 229910000031 sodium sesquicarbonate Inorganic materials 0.000 description 1
- 235000018341 sodium sesquicarbonate Nutrition 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- XZTJQQLJJCXOLP-UHFFFAOYSA-M sodium;decyl sulfate Chemical compound [Na+].CCCCCCCCCCOS([O-])(=O)=O XZTJQQLJJCXOLP-UHFFFAOYSA-M 0.000 description 1
- 239000008234 soft water Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229940012831 stearyl alcohol Drugs 0.000 description 1
- 238000013517 stratification Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000005496 tempering Methods 0.000 description 1
- 230000009974 thixotropic effect Effects 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 1
- WCTAGTRAWPDFQO-UHFFFAOYSA-K trisodium;hydrogen carbonate;carbonate Chemical compound [Na+].[Na+].[Na+].OC([O-])=O.[O-]C([O-])=O WCTAGTRAWPDFQO-UHFFFAOYSA-K 0.000 description 1
- SOBHUZYZLFQYFK-UHFFFAOYSA-K trisodium;hydroxy-[[phosphonatomethyl(phosphonomethyl)amino]methyl]phosphinate Chemical class [Na+].[Na+].[Na+].OP(O)(=O)CN(CP(O)([O-])=O)CP([O-])([O-])=O SOBHUZYZLFQYFK-UHFFFAOYSA-K 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 239000002888 zwitterionic surfactant Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/0008—Detergent materials or soaps characterised by their shape or physical properties aqueous liquid non soap compositions
- C11D17/0013—Liquid compositions with insoluble particles in suspension
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/124—Silicon containing, e.g. silica, silex, quartz or glass beads
- C11D3/1246—Silicates, e.g. diatomaceous earth
- C11D3/1253—Layer silicates, e.g. talcum, kaolin, clay, bentonite, smectite, montmorillonite, hectorite or attapulgite
- C11D3/1266—Layer silicates, e.g. talcum, kaolin, clay, bentonite, smectite, montmorillonite, hectorite or attapulgite in liquid compositions
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/14—Fillers; Abrasives ; Abrasive compositions; Suspending or absorbing agents not provided for in one single group of C11D3/12; Specific features concerning abrasives, e.g. granulometry or mixtures
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB16814/74A GB1495549A (en) | 1974-04-17 | 1974-04-17 | Scouring compositions |
| US05/504,218 US3985668A (en) | 1974-04-17 | 1974-09-09 | Scouring compositions |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2516003A1 DE2516003A1 (de) | 1975-11-06 |
| DE2516003C2 true DE2516003C2 (de) | 1983-12-29 |
Family
ID=26252259
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2516003A Expired DE2516003C2 (de) | 1974-04-17 | 1975-04-12 | Wäßriges halbflüssiges Reinigungsmittel mit scheuernder Wirkung |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3985668A (enExample) |
| JP (1) | JPS593517B2 (enExample) |
| BE (1) | BE827991A (enExample) |
| CA (1) | CA1041307A (enExample) |
| DE (1) | DE2516003C2 (enExample) |
| FR (1) | FR2268071B1 (enExample) |
| GB (1) | GB1495549A (enExample) |
| IT (1) | IT1037342B (enExample) |
| NL (1) | NL185784C (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2539733A1 (de) * | 1974-09-09 | 1976-03-18 | Procter & Gamble | Reinigungskompositionen mit schmirgelwirkung |
Families Citing this family (85)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4051055A (en) * | 1976-12-21 | 1977-09-27 | The Procter & Gamble Company | Cleansing compositions |
| US4116851A (en) * | 1977-06-20 | 1978-09-26 | The Procter & Gamble Company | Thickened bleach compositions for treating hard-to-remove soils |
| US4158553A (en) * | 1978-01-16 | 1979-06-19 | S. C. Johnson & Son, Inc. | Non-scratching liquid scouring cleanser using abrasives with a Mohs hardness of greater than 3 |
| US4352678A (en) | 1978-10-02 | 1982-10-05 | Lever Brothers Company | Thickened abrasive bleaching compositions |
| US4240919A (en) * | 1978-11-29 | 1980-12-23 | S. C. Johnson & Son, Inc. | Thixotropic abrasive liquid scouring composition |
| US4248728A (en) * | 1979-02-28 | 1981-02-03 | Chemed Corporation | Liquid scouring cleanser |
| NL7908798A (nl) | 1979-12-05 | 1981-07-01 | Unilever Nv | Vloeibaar, verdikt chloorbleekmiddel. |
| EP0030986A1 (en) * | 1979-12-24 | 1981-07-01 | THE PROCTER & GAMBLE COMPANY | Abrasive-containing, built liquid detergent composition |
| US4287079A (en) * | 1980-06-02 | 1981-09-01 | Purex Corporation | Liquid cleanser formula |
| ATE7307T1 (de) * | 1980-10-16 | 1984-05-15 | Unilever Nv | Stabile, fluessige detergenssuspensionen. |
| US4388204A (en) * | 1982-03-23 | 1983-06-14 | The Drackett Company | Thickened alkali metal hypochlorite compositions |
| GB8328075D0 (en) * | 1983-10-20 | 1983-11-23 | Unilever Plc | Dishwashing compositions |
| US4599186A (en) * | 1984-04-20 | 1986-07-08 | The Clorox Company | Thickened aqueous abrasive scouring cleanser |
| US4657692A (en) * | 1984-04-20 | 1987-04-14 | The Clorox Company | Thickened aqueous abrasive scouring cleanser |
| NZ212921A (en) * | 1984-08-13 | 1988-06-30 | Colgate Palmolive Co | Process for the manufacture of thixotropic detergent compositions |
| US4927555A (en) * | 1984-08-13 | 1990-05-22 | Colgate-Palmolive Company | Process for making thixotropic detergent compositions |
| US4594175A (en) * | 1984-08-29 | 1986-06-10 | Economics Laboratory, Inc. | Mechanical dishwashing rinse composition having a low foaming sulfonic acid rinsing agent, a hydrotrope and a source of active halogen |
| US4751016A (en) * | 1985-02-26 | 1988-06-14 | The Clorox Company | Liquid aqueous abrasive cleanser |
| US5427707A (en) * | 1985-06-14 | 1995-06-27 | Colgate Palmolive Co. | Thixotropic aqueous compositions containing adipic or azelaic acid stabilizer |
| US5064553A (en) * | 1989-05-18 | 1991-11-12 | Colgate-Palmolive Co. | Linear-viscoelastic aqueous liquid automatic dishwasher detergent composition |
| DE3545288A1 (de) * | 1985-12-20 | 1987-06-25 | Vorwerk Co Interholding | Fluessige reinigungssuspension |
| US4828748A (en) * | 1986-01-03 | 1989-05-09 | The Drackett Company | Thickened alkali metal hypochlorite compositions |
| NZ218730A (en) * | 1986-01-03 | 1990-04-26 | Bristol Myers Co | Bleaching composition including thickening agent |
| US4704222A (en) * | 1986-09-05 | 1987-11-03 | Noxell Corporation | Gelled abrasive detergent composition |
| US4804491A (en) * | 1986-11-03 | 1989-02-14 | The Clorox Company | Aqueous based acidic hard surface cleaner |
| US4895669A (en) * | 1986-11-03 | 1990-01-23 | The Clorox Company | Aqueous based acidic hard surface cleaner |
| US5176713A (en) * | 1987-07-15 | 1993-01-05 | Colgate-Palmolive Co. | Stable non-aqueous cleaning composition method of use |
| IL87008A (en) * | 1987-07-15 | 1992-03-29 | Colgate Palmolive Co | Stable non-aqueous cleaning composition containing low density filler and method of use |
| US4931195A (en) * | 1987-07-15 | 1990-06-05 | Colgate-Palmolive Company | Low viscosity stable non-aqueous suspension containing organophilic clay and low density filler |
| US4828723A (en) * | 1987-07-15 | 1989-05-09 | Colgate-Palmolive Company | Stable non-aqueous suspension containing organophilic clay and low density filler |
| US4838948A (en) * | 1987-07-27 | 1989-06-13 | Phillips Petroleum Company | Process for cleaning polymer processing equipment |
| US4970016A (en) * | 1987-09-29 | 1990-11-13 | Colgate-Palmolive Co. | Thixotropic aqueous liquid automatic dishwashing detergent composition |
| US4968445A (en) * | 1987-09-29 | 1990-11-06 | Colgate-Palmolive Co. | Thixotropic aqueous liquid automatic dishwashing detergent composition |
| US5205954A (en) * | 1987-11-05 | 1993-04-27 | Colgate-Palmolive Co. | Automatic dishwasher powder detergent composition |
| US4968446A (en) * | 1987-11-05 | 1990-11-06 | Colgate-Palmolive Co. | Thixotropic aqueous liquid automatic dishwashing detergent composition |
| US4844824A (en) * | 1988-02-08 | 1989-07-04 | The Procter & Gamble Company | Stable heavy duty liquid detergent compositions which contain a softener and antistatic agent |
| US4943429A (en) * | 1988-05-23 | 1990-07-24 | Church & Dwight Co., Inc. | Dentifrice gels containing sodium bicarbonate |
| JPH01139131A (ja) * | 1988-07-21 | 1989-05-31 | Takeda Chem Ind Ltd | スラリーの輸送方法 |
| US5190693A (en) * | 1988-07-29 | 1993-03-02 | Ausidet S.P.A. | Stable aqueous suspensions of inorganic silica-based materials insoluble in water |
| EP0352358A1 (en) * | 1988-07-29 | 1990-01-31 | AUSIDET S.p.A. | Stable aqueous suspensions of inorganic silica-based materials insoluble in water |
| US4986926A (en) * | 1989-04-10 | 1991-01-22 | The Drackett Company | Thickened alkali metal hypochlorite compositions |
| US5196139A (en) * | 1989-06-19 | 1993-03-23 | Lever Brothers Company, Division Of Conopco, Inc. | Bleach article containing polyacrylate or copolymer of acrylic and maleic |
| US5041236A (en) | 1989-10-27 | 1991-08-20 | The Procter & Gamble Company | Antimicrobial methods and compositions employing certain lysozymes and endoglycosidases |
| WO1991012313A1 (en) * | 1990-02-16 | 1991-08-22 | Unilever N.V. | Liquid cleaning products |
| US5120465A (en) * | 1990-02-22 | 1992-06-09 | Dry Branch Kaolin Company | Detergent or cleansing composition and additive for imparting thixotropic properties thereto |
| EP0517311A1 (en) | 1991-06-07 | 1992-12-09 | Colgate-Palmolive Company | Linear viscoelastic aqueous liquid automatic dishwasher detergent composition |
| US5279755A (en) * | 1991-09-16 | 1994-01-18 | The Clorox Company | Thickening aqueous abrasive cleaner with improved colloidal stability |
| US5346641A (en) * | 1992-01-17 | 1994-09-13 | The Clorox Company | Thickened aqueous abrasive cleanser with improved colloidal stability |
| GB2269597A (en) * | 1992-08-04 | 1994-02-16 | Hee Sun Kaw | Cleaning composition |
| US5393446A (en) * | 1992-12-16 | 1995-02-28 | Eco Japan Co., Ltd. | Process for preparing detergent composition containing sodium and potassium oxides |
| ES2131664T3 (es) * | 1993-01-14 | 1999-08-01 | Weissenfluh Hawe Neos | Pasta dental. |
| GB9315761D0 (en) * | 1993-07-30 | 1993-09-15 | Unilever Plc | Bleach compositions |
| US5529711A (en) * | 1993-09-23 | 1996-06-25 | The Clorox Company | Phase stable, thickened aqueous abrasive bleaching cleanser |
| US5470499A (en) * | 1993-09-23 | 1995-11-28 | The Clorox Company | Thickened aqueous abrasive cleanser with improved rinsability |
| WO1996035771A1 (en) * | 1995-05-11 | 1996-11-14 | Reckitt & Colman Inc. | Thickened scouring cleanser containing inorganic abrasives and hypochlorite bleach |
| GB2304113B (en) * | 1995-08-10 | 1999-08-04 | Reckitt & Colman Inc | Hard surface cleaner |
| GB2305434B (en) * | 1995-09-19 | 1999-03-10 | Reckitt & Colmann Sa | Abrasive cleaning composition |
| GB2311996A (en) * | 1996-04-12 | 1997-10-15 | Reckitt & Colman Inc | Hard surface scouring cleansers ` |
| JP3856843B2 (ja) * | 1996-11-14 | 2006-12-13 | 花王株式会社 | 磁気記録媒体基板用研磨材組成物及びこれを用いた磁気記録媒体基板の製造方法 |
| US6010683A (en) * | 1997-11-05 | 2000-01-04 | Ultradent Products, Inc. | Compositions and methods for reducing the quantity but not the concentration of active ingredients delivered by a dentifrice |
| US5997764A (en) * | 1997-12-04 | 1999-12-07 | The B.F. Goodrich Company | Thickened bleach compositions |
| WO2000074638A1 (en) * | 1999-06-04 | 2000-12-14 | Unilever N.V. | Oral composition containing perlite |
| US6332708B1 (en) | 2000-08-31 | 2001-12-25 | Cametox 2000 Inc. | Method of shipping manganese dioxide |
| US20030118626A1 (en) * | 2001-09-21 | 2003-06-26 | John Kibbee | Stable pesticidal chemical formulations |
| US7860116B2 (en) * | 2007-05-24 | 2010-12-28 | Worldwide Packets, Inc. | Processing packets of a virtual interface associated with tunnels |
| EP2350247B1 (en) * | 2008-09-30 | 2016-04-20 | The Procter & Gamble Company | Liquid hard surface cleaning composition |
| EP2328998A1 (en) | 2008-09-30 | 2011-06-08 | The Procter & Gamble Company | Liquid hard surface cleaning composition |
| WO2010039574A1 (en) * | 2008-09-30 | 2010-04-08 | The Procter & Gamble Company | Liquid hard surface cleaning composition |
| WO2011087739A1 (en) | 2009-12-22 | 2011-07-21 | The Procter & Gamble Company | Liquid cleaning and/or cleansing composition |
| US9163200B2 (en) | 2009-12-22 | 2015-10-20 | The Procter & Gamble Company | Liquid cleaning and/or cleansing composition |
| RU2530020C2 (ru) | 2010-04-21 | 2014-10-10 | Дзе Проктер Энд Гэмбл Компани | Жидкий чистящий и/или дезинфицирующий состав |
| EP2431451A1 (en) | 2010-09-21 | 2012-03-21 | The Procter & Gamble Company | Liquid detergent composition with abrasive particles |
| US9353337B2 (en) | 2010-09-21 | 2016-05-31 | The Procter & Gamble Company | Liquid cleaning composition |
| US8445422B2 (en) | 2010-09-21 | 2013-05-21 | The Procter & Gamble Company | Liquid cleaning composition |
| US9546346B2 (en) | 2011-04-07 | 2017-01-17 | The Dial Corporation | Use of polyethylene glycol to control the spray pattern of sprayable liquid abrasive cleansers |
| EP2537917A1 (en) | 2011-06-20 | 2012-12-26 | The Procter & Gamble Company | Liquid detergent composition with abrasive particles |
| US8852643B2 (en) | 2011-06-20 | 2014-10-07 | The Procter & Gamble Company | Liquid cleaning and/or cleansing composition |
| MX338952B (es) | 2011-06-20 | 2016-05-05 | Procter & Gamble | Composicion liquida de limpieza y/o lavado. |
| WO2012177617A1 (en) | 2011-06-20 | 2012-12-27 | The Procter & Gamble Company | Liquid cleaning and/or cleansing composition |
| ES2577147T3 (es) | 2012-10-15 | 2016-07-13 | The Procter & Gamble Company | Composición detergente líquida con partículas abrasivas |
| CN107151580A (zh) * | 2017-05-31 | 2017-09-12 | 江苏精盾节能科技有限公司 | 一种中空玻璃专用清理液及其制备方法 |
| CN108276680B (zh) * | 2018-03-09 | 2020-12-22 | 西华大学 | 一种改性聚丙烯复合材料及其制备方法 |
| US10986841B2 (en) * | 2018-11-06 | 2021-04-27 | The Clorox Company | Bleach compositions |
| GB2579252A (en) | 2018-11-28 | 2020-06-17 | For Spills Ltd | Biocidal formulation |
| US11845916B2 (en) | 2020-06-24 | 2023-12-19 | The Clorox Company | Burstable sporicidal cleaning wipe system containing stabilized hypochlorite |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2489848A (en) * | 1947-10-10 | 1949-11-29 | Wyandotte Chemicals Corp | Abrasive scouring powder |
| US3042622A (en) * | 1957-11-01 | 1962-07-03 | Colgate Palmolive Co | Abrasive cleaning composition |
| US3446893A (en) * | 1967-02-23 | 1969-05-27 | Olin Mathieson | Solid deodorizing compositions |
| US3530071A (en) * | 1967-06-26 | 1970-09-22 | Procter & Gamble | Scouring cleanser containing chlorinated trisodium phosphate stabilized against loss of bleaching effectiveness with borax |
| US3558496A (en) * | 1967-11-13 | 1971-01-26 | Barney Joseph Zmoda | Thickened liquid bleach and process for preparing same |
| US3716488A (en) * | 1970-09-04 | 1973-02-13 | Stevens & Co Inc J P | Textile fabric cleaning compositions |
| US3702826A (en) * | 1971-01-25 | 1972-11-14 | Colgate Palmolive Co | Scouring cleanser |
| US3715314A (en) * | 1971-04-02 | 1973-02-06 | Procter & Gamble | Scouring cleanser composition |
-
1974
- 1974-04-17 GB GB16814/74A patent/GB1495549A/en not_active Expired
- 1974-09-09 US US05/504,218 patent/US3985668A/en not_active Expired - Lifetime
-
1975
- 1975-04-01 CA CA223,481A patent/CA1041307A/en not_active Expired
- 1975-04-12 DE DE2516003A patent/DE2516003C2/de not_active Expired
- 1975-04-16 BE BE155450A patent/BE827991A/xx not_active IP Right Cessation
- 1975-04-16 FR FR7511815A patent/FR2268071B1/fr not_active Expired
- 1975-04-16 NL NLAANVRAGE7504507,A patent/NL185784C/xx not_active IP Right Cessation
- 1975-04-17 JP JP50046938A patent/JPS593517B2/ja not_active Expired
- 1975-04-17 IT IT22455/75A patent/IT1037342B/it active
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2539733A1 (de) * | 1974-09-09 | 1976-03-18 | Procter & Gamble | Reinigungskompositionen mit schmirgelwirkung |
Also Published As
| Publication number | Publication date |
|---|---|
| AU8019775A (en) | 1976-10-21 |
| JPS593517B2 (ja) | 1984-01-24 |
| GB1495549A (en) | 1977-12-21 |
| FR2268071A1 (enExample) | 1975-11-14 |
| IT1037342B (it) | 1979-11-10 |
| DE2516003A1 (de) | 1975-11-06 |
| NL185784C (nl) | 1990-07-16 |
| BE827991A (fr) | 1975-10-16 |
| CA1041307A (en) | 1978-10-31 |
| NL7504507A (nl) | 1975-10-21 |
| NL185784B (nl) | 1990-02-16 |
| JPS5116308A (enExample) | 1976-02-09 |
| FR2268071B1 (enExample) | 1979-03-23 |
| US3985668A (en) | 1976-10-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2516003C2 (de) | Wäßriges halbflüssiges Reinigungsmittel mit scheuernder Wirkung | |
| DE2432053C2 (de) | Wäßriges scheuerndes Reinigungsmittel | |
| AT398780B (de) | Wasserhaltiges thixotropes reinigungsmittel | |
| DE68920182T2 (de) | Verdickte wässrige Reiniger für harte Oberflächen. | |
| DE2844399C2 (de) | Fluessiger allzweckreiniger | |
| DE3206379C2 (enExample) | ||
| DE2948924A1 (de) | Fluessige reinigungszusammensetzungen, enthaltend hypochlorit und paraffinsulfonate | |
| CH655325A5 (de) | Wasserhaltiges, thixotropes geschirrwaschmittel, insbesondere fuer automatische geschirrspuelmaschinen. | |
| CH654849A5 (de) | Geschirrwaschmittel auf waessriger basis fuer automatische spuelmaschinen. | |
| DE2204842A1 (de) | Rieselfähige nichtionogene Waschmittelzusätze | |
| DE3240088A1 (de) | Stabile waessrige reinigungsmittel und verfahren zu ihrer herstellung | |
| DE3344098A1 (de) | Teilchenfoermiger, als waschmittelzusatz geeigneter textilweichmacher | |
| DE2539733C2 (de) | Flüssiges Reinigungsmittel mit Schmirgelwirkung | |
| DE3311368A1 (de) | Teilchenfoermiges, bleichendes und weichmachendes textilwaschmittel | |
| CH650016A5 (de) | Verfahren zur verhinderung der gelierung von bicarbonat-carbonat-silikat seifenmischer-aufschlaemmungen. | |
| DE69502484T2 (de) | Bleichmittel | |
| AT397389B (de) | Gelartiges, thixotropes, wässeriges, flüssiges, für geschirrspülautomaten geeignetes reinigungsmittel | |
| AT394379B (de) | Teilchenfoermiges waschmittelprodukt | |
| DE3880191T2 (de) | Verdicktes waessriges scheuermittel, keine synerese zeigend und dessen herstellungsverfahren. | |
| EP0941300B1 (de) | Geformte seifenprodukte | |
| DE68920181T2 (de) | Verdicktes wässriges giessbares Scheuermittel. | |
| DE1792163A1 (de) | Detergenzzusammensetzungen | |
| DE3833648A1 (de) | Verfahren zur herstellung teilchenfoermiger waschmittel | |
| AT233151B (de) | Scheuer- und Reiningungsmittelzusammensetzung | |
| CH675252A5 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8126 | Change of the secondary classification |
Ipc: ENTFAELLT |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |