CA1041307A - Scouring compositions - Google Patents
Scouring compositionsInfo
- Publication number
- CA1041307A CA1041307A CA223,481A CA223481A CA1041307A CA 1041307 A CA1041307 A CA 1041307A CA 223481 A CA223481 A CA 223481A CA 1041307 A CA1041307 A CA 1041307A
- Authority
- CA
- Canada
- Prior art keywords
- composition
- sodium
- weight
- group
- potassium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 188
- 238000009991 scouring Methods 0.000 title claims abstract description 26
- 239000000463 material Substances 0.000 claims abstract description 82
- 239000010839 body fluid Substances 0.000 claims abstract description 40
- 239000000945 filler Substances 0.000 claims abstract description 40
- 210000001124 body fluid Anatomy 0.000 claims abstract description 38
- 239000011236 particulate material Substances 0.000 claims abstract description 8
- -1 polyethylene Polymers 0.000 claims description 44
- 239000007788 liquid Substances 0.000 claims description 36
- 239000004094 surface-active agent Substances 0.000 claims description 36
- 239000007844 bleaching agent Substances 0.000 claims description 33
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 32
- 239000003082 abrasive agent Substances 0.000 claims description 29
- 239000010451 perlite Substances 0.000 claims description 29
- 235000019362 perlite Nutrition 0.000 claims description 29
- 239000004927 clay Substances 0.000 claims description 28
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 claims description 24
- 239000002245 particle Substances 0.000 claims description 23
- 239000011734 sodium Substances 0.000 claims description 22
- 229910052708 sodium Inorganic materials 0.000 claims description 22
- 239000003795 chemical substances by application Substances 0.000 claims description 21
- 230000005484 gravity Effects 0.000 claims description 21
- 239000006172 buffering agent Substances 0.000 claims description 20
- 239000011591 potassium Substances 0.000 claims description 15
- 229910052700 potassium Inorganic materials 0.000 claims description 15
- 150000008051 alkyl sulfates Chemical class 0.000 claims description 14
- 239000007864 aqueous solution Substances 0.000 claims description 12
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 claims description 12
- 239000004743 Polypropylene Substances 0.000 claims description 11
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 10
- 229910021647 smectite Inorganic materials 0.000 claims description 10
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 claims description 10
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 9
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 235000011180 diphosphates Nutrition 0.000 claims description 9
- 229920001155 polypropylene Polymers 0.000 claims description 9
- 239000000377 silicon dioxide Substances 0.000 claims description 9
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 8
- 229910019142 PO4 Inorganic materials 0.000 claims description 8
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 239000008262 pumice Substances 0.000 claims description 8
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 7
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 claims description 7
- 239000011521 glass Substances 0.000 claims description 7
- 229910052901 montmorillonite Inorganic materials 0.000 claims description 7
- KWIUHFFTVRNATP-UHFFFAOYSA-N Betaine Natural products C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 claims description 6
- 235000013162 Cocos nucifera Nutrition 0.000 claims description 6
- 244000060011 Cocos nucifera Species 0.000 claims description 6
- 239000004115 Sodium Silicate Substances 0.000 claims description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 6
- 239000001488 sodium phosphate Substances 0.000 claims description 6
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 claims description 6
- 229910052911 sodium silicate Inorganic materials 0.000 claims description 6
- 229910000404 tripotassium phosphate Inorganic materials 0.000 claims description 6
- 235000019798 tripotassium phosphate Nutrition 0.000 claims description 6
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 claims description 6
- 229910000406 trisodium phosphate Inorganic materials 0.000 claims description 6
- 235000019801 trisodium phosphate Nutrition 0.000 claims description 6
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 5
- 239000005708 Sodium hypochlorite Substances 0.000 claims description 5
- 239000010452 phosphate Substances 0.000 claims description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 5
- 239000010453 quartz Substances 0.000 claims description 5
- 239000004576 sand Substances 0.000 claims description 5
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 claims description 5
- 241000894007 species Species 0.000 claims description 5
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 claims description 4
- 239000005909 Kieselgur Substances 0.000 claims description 4
- 229920000877 Melamine resin Polymers 0.000 claims description 4
- 241000276489 Merlangius merlangus Species 0.000 claims description 4
- 239000004698 Polyethylene Substances 0.000 claims description 4
- 239000004793 Polystyrene Substances 0.000 claims description 4
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 4
- 239000001506 calcium phosphate Substances 0.000 claims description 4
- 229910000389 calcium phosphate Inorganic materials 0.000 claims description 4
- 235000011010 calcium phosphates Nutrition 0.000 claims description 4
- 239000010433 feldspar Substances 0.000 claims description 4
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 claims description 4
- 239000004005 microsphere Substances 0.000 claims description 4
- 239000005011 phenolic resin Substances 0.000 claims description 4
- 229920001568 phenolic resin Polymers 0.000 claims description 4
- 229920001225 polyester resin Polymers 0.000 claims description 4
- 239000004645 polyester resin Substances 0.000 claims description 4
- 229920000573 polyethylene Polymers 0.000 claims description 4
- ODGAOXROABLFNM-UHFFFAOYSA-N polynoxylin Chemical compound O=C.NC(N)=O ODGAOXROABLFNM-UHFFFAOYSA-N 0.000 claims description 4
- 229920002223 polystyrene Polymers 0.000 claims description 4
- 239000005077 polysulfide Substances 0.000 claims description 4
- 150000008117 polysulfides Polymers 0.000 claims description 4
- 235000011181 potassium carbonates Nutrition 0.000 claims description 4
- 239000010458 rotten stone Substances 0.000 claims description 4
- 235000019795 sodium metasilicate Nutrition 0.000 claims description 4
- 239000003760 tallow Substances 0.000 claims description 4
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 claims description 4
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 claims description 4
- 229920001807 Urea-formaldehyde Polymers 0.000 claims description 3
- 229960003237 betaine Drugs 0.000 claims description 3
- 229920001021 polysulfide Polymers 0.000 claims description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 3
- 235000017550 sodium carbonate Nutrition 0.000 claims description 3
- 239000004408 titanium dioxide Substances 0.000 claims description 3
- 235000019354 vermiculite Nutrition 0.000 claims description 3
- YRIZYWQGELRKNT-UHFFFAOYSA-N 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione Chemical compound ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O YRIZYWQGELRKNT-UHFFFAOYSA-N 0.000 claims description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 claims description 2
- ZKQDCIXGCQPQNV-UHFFFAOYSA-N Calcium hypochlorite Chemical compound [Ca+2].Cl[O-].Cl[O-] ZKQDCIXGCQPQNV-UHFFFAOYSA-N 0.000 claims description 2
- FUVGZDDOHNQZEO-UHFFFAOYSA-N NS(=O)(=O)NCl Chemical compound NS(=O)(=O)NCl FUVGZDDOHNQZEO-UHFFFAOYSA-N 0.000 claims description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000000129 anionic group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000002091 cationic group Chemical group 0.000 claims description 2
- 239000003093 cationic surfactant Substances 0.000 claims description 2
- VDQQXEISLMTGAB-UHFFFAOYSA-N chloramine T Chemical compound [Na+].CC1=CC=C(S(=O)(=O)[N-]Cl)C=C1 VDQQXEISLMTGAB-UHFFFAOYSA-N 0.000 claims description 2
- CEJLBZWIKQJOAT-UHFFFAOYSA-N dichloroisocyanuric acid Chemical compound ClN1C(=O)NC(=O)N(Cl)C1=O CEJLBZWIKQJOAT-UHFFFAOYSA-N 0.000 claims description 2
- YZQBYALVHAANGI-UHFFFAOYSA-N magnesium;dihypochlorite Chemical compound [Mg+2].Cl[O-].Cl[O-] YZQBYALVHAANGI-UHFFFAOYSA-N 0.000 claims description 2
- ARGDYOIRHYLIMT-UHFFFAOYSA-N n,n-dichloro-4-methylbenzenesulfonamide Chemical compound CC1=CC=C(S(=O)(=O)N(Cl)Cl)C=C1 ARGDYOIRHYLIMT-UHFFFAOYSA-N 0.000 claims description 2
- PJBJJXCZRAHMCK-UHFFFAOYSA-N n,n-dichlorobenzenesulfonamide Chemical compound ClN(Cl)S(=O)(=O)C1=CC=CC=C1 PJBJJXCZRAHMCK-UHFFFAOYSA-N 0.000 claims description 2
- 239000002736 nonionic surfactant Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 claims description 2
- SATVIFGJTRRDQU-UHFFFAOYSA-N potassium hypochlorite Chemical compound [K+].Cl[O-] SATVIFGJTRRDQU-UHFFFAOYSA-N 0.000 claims description 2
- ONQDVAFWWYYXHM-UHFFFAOYSA-M potassium lauryl sulfate Chemical compound [K+].CCCCCCCCCCCCOS([O-])(=O)=O ONQDVAFWWYYXHM-UHFFFAOYSA-M 0.000 claims description 2
- IFIDXBCRSWOUSB-UHFFFAOYSA-N potassium;1,3-dichloro-1,3,5-triazinane-2,4,6-trione Chemical compound [K+].ClN1C(=O)NC(=O)N(Cl)C1=O IFIDXBCRSWOUSB-UHFFFAOYSA-N 0.000 claims description 2
- JTXIPOLAHSBNJM-UHFFFAOYSA-M potassium;decyl sulfate Chemical compound [K+].CCCCCCCCCCOS([O-])(=O)=O JTXIPOLAHSBNJM-UHFFFAOYSA-M 0.000 claims description 2
- XZTJQQLJJCXOLP-UHFFFAOYSA-M sodium;decyl sulfate Chemical compound [Na+].CCCCCCCCCCOS([O-])(=O)=O XZTJQQLJJCXOLP-UHFFFAOYSA-M 0.000 claims description 2
- ASTWEMOBIXQPPV-UHFFFAOYSA-K trisodium;phosphate;dodecahydrate Chemical class O.O.O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[Na+].[O-]P([O-])([O-])=O ASTWEMOBIXQPPV-UHFFFAOYSA-K 0.000 claims description 2
- 239000002888 zwitterionic surfactant Substances 0.000 claims description 2
- 229940093956 potassium carbonate Drugs 0.000 claims 2
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 claims 1
- KWIUHFFTVRNATP-UHFFFAOYSA-O N,N,N-trimethylglycinium Chemical compound C[N+](C)(C)CC(O)=O KWIUHFFTVRNATP-UHFFFAOYSA-O 0.000 claims 1
- 239000003945 anionic surfactant Substances 0.000 claims 1
- 239000002563 ionic surfactant Substances 0.000 claims 1
- PYILKOIEIHHYGD-UHFFFAOYSA-M sodium;1,5-dichloro-4,6-dioxo-1,3,5-triazin-2-olate;dihydrate Chemical compound O.O.[Na+].[O-]C1=NC(=O)N(Cl)C(=O)N1Cl PYILKOIEIHHYGD-UHFFFAOYSA-M 0.000 claims 1
- 239000012071 phase Substances 0.000 abstract 3
- 230000001747 exhibiting effect Effects 0.000 abstract 1
- 239000007791 liquid phase Substances 0.000 abstract 1
- 235000015424 sodium Nutrition 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 239000012530 fluid Substances 0.000 description 14
- 239000000126 substance Substances 0.000 description 14
- 229910001868 water Inorganic materials 0.000 description 13
- 150000001875 compounds Chemical class 0.000 description 10
- 238000013019 agitation Methods 0.000 description 9
- 235000007686 potassium Nutrition 0.000 description 9
- 229960003975 potassium Drugs 0.000 description 9
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 7
- 229910052500 inorganic mineral Inorganic materials 0.000 description 7
- 235000010755 mineral Nutrition 0.000 description 7
- 239000011707 mineral Substances 0.000 description 7
- 239000002304 perfume Substances 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 6
- 150000001768 cations Chemical class 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 6
- 229910052625 palygorskite Inorganic materials 0.000 description 6
- 235000021317 phosphate Nutrition 0.000 description 6
- 235000012239 silicon dioxide Nutrition 0.000 description 6
- 229960000892 attapulgite Drugs 0.000 description 5
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 150000002191 fatty alcohols Chemical class 0.000 description 5
- 238000005755 formation reaction Methods 0.000 description 5
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 5
- 239000000395 magnesium oxide Substances 0.000 description 5
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 5
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 229910000275 saponite Inorganic materials 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 239000000975 dye Substances 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 229940048084 pyrophosphate Drugs 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 4
- QDHHCQZDFGDHMP-UHFFFAOYSA-N Chloramine Chemical class ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 description 3
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 3
- 239000000440 bentonite Substances 0.000 description 3
- 229910000278 bentonite Inorganic materials 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 230000003993 interaction Effects 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 238000005191 phase separation Methods 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- 239000000375 suspending agent Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 2
- UBNVDFUEPGQZQS-UHFFFAOYSA-N acetic acid;n,n-dimethyldodecan-1-amine Chemical compound CC([O-])=O.CCCCCCCCCCCC[NH+](C)C UBNVDFUEPGQZQS-UHFFFAOYSA-N 0.000 description 2
- 229910000323 aluminium silicate Inorganic materials 0.000 description 2
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 2
- 238000004061 bleaching Methods 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 229910001424 calcium ion Inorganic materials 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 229910052681 coesite Inorganic materials 0.000 description 2
- 239000000084 colloidal system Substances 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 229910052906 cristobalite Inorganic materials 0.000 description 2
- CRPOUZQWHJYTMS-UHFFFAOYSA-N dialuminum;magnesium;disilicate Chemical compound [Mg+2].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-] CRPOUZQWHJYTMS-UHFFFAOYSA-N 0.000 description 2
- 125000005456 glyceride group Chemical group 0.000 description 2
- KWLMIXQRALPRBC-UHFFFAOYSA-L hectorite Chemical compound [Li+].[OH-].[OH-].[Na+].[Mg+2].O1[Si]2([O-])O[Si]1([O-])O[Si]([O-])(O1)O[Si]1([O-])O2 KWLMIXQRALPRBC-UHFFFAOYSA-L 0.000 description 2
- 229910000271 hectorite Inorganic materials 0.000 description 2
- 230000036571 hydration Effects 0.000 description 2
- 238000006703 hydration reaction Methods 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 229910001425 magnesium ion Inorganic materials 0.000 description 2
- 239000000391 magnesium silicate Substances 0.000 description 2
- 238000012423 maintenance Methods 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 239000008363 phosphate buffer Substances 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- CHWRSCGUEQEHOH-UHFFFAOYSA-N potassium oxide Chemical compound [O-2].[K+].[K+] CHWRSCGUEQEHOH-UHFFFAOYSA-N 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 2
- 235000019794 sodium silicate Nutrition 0.000 description 2
- 229940032158 sodium silicate Drugs 0.000 description 2
- 235000010339 sodium tetraborate Nutrition 0.000 description 2
- 235000019832 sodium triphosphate Nutrition 0.000 description 2
- 229910052682 stishovite Inorganic materials 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 230000009974 thixotropic effect Effects 0.000 description 2
- 229910052905 tridymite Inorganic materials 0.000 description 2
- 210000003462 vein Anatomy 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N Calcium oxide Chemical compound [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 241001050985 Disco Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000252067 Megalops atlanticus Species 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- JTSVYBPWSSQBEB-UHFFFAOYSA-N azanium;hexanoate Chemical compound [NH4+].CCCCCC([O-])=O JTSVYBPWSSQBEB-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 230000003139 buffering effect Effects 0.000 description 1
- 239000004067 bulking agent Substances 0.000 description 1
- ZMEVAQQMUSEIJD-UHFFFAOYSA-N butanoate;dimethyl(tetradecyl)azanium Chemical compound CCCC([O-])=O.CCCCCCCCCCCCCC[NH+](C)C ZMEVAQQMUSEIJD-UHFFFAOYSA-N 0.000 description 1
- XLIRVORAQHWLJE-UHFFFAOYSA-N butanoate;dodecyl(dimethyl)azanium Chemical compound CCCC([O-])=O.CCCCCCCCCCCC[NH+](C)C XLIRVORAQHWLJE-UHFFFAOYSA-N 0.000 description 1
- SCEJTWKEWDOCKV-UHFFFAOYSA-N butanoate;hexadecyl(dimethyl)azanium Chemical compound CCCC([O-])=O.CCCCCCCCCCCCCCCC[NH+](C)C SCEJTWKEWDOCKV-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- VNSBYDPZHCQWNB-UHFFFAOYSA-N calcium;aluminum;dioxido(oxo)silane;sodium;hydrate Chemical compound O.[Na].[Al].[Ca+2].[O-][Si]([O-])=O VNSBYDPZHCQWNB-UHFFFAOYSA-N 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000002144 chemical decomposition reaction Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000002734 clay mineral Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- JSYGRUBHOCKMGQ-UHFFFAOYSA-N dichloramine Chemical class ClNCl JSYGRUBHOCKMGQ-UHFFFAOYSA-N 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- QHNXEVRKFKHMRL-UHFFFAOYSA-N dimethylazanium;acetate Chemical compound CNC.CC(O)=O QHNXEVRKFKHMRL-UHFFFAOYSA-N 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- QMMXHYMFTNPOPG-UHFFFAOYSA-N dipropyl(tetradecyl)azanium;pentanoate Chemical compound CCCCC([O-])=O.CCCCCCCCCCCCCC[NH+](CCC)CCC QMMXHYMFTNPOPG-UHFFFAOYSA-N 0.000 description 1
- UQGFMSUEHSUPRD-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound [Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 UQGFMSUEHSUPRD-UHFFFAOYSA-N 0.000 description 1
- CDMADVZSLOHIFP-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane;decahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 CDMADVZSLOHIFP-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- QKHKGSULBQVNMO-UHFFFAOYSA-N dodecyl(dimethyl)azanium;hexanoate Chemical compound CCCCCC([O-])=O.CCCCCCCCCCCC[NH+](C)C QKHKGSULBQVNMO-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- VGUANSONTIBISX-UHFFFAOYSA-N hexadecyl(dimethyl)azanium;acetate Chemical compound CC(O)=O.CCCCCCCCCCCCCCCCN(C)C VGUANSONTIBISX-UHFFFAOYSA-N 0.000 description 1
- BXFPJFWOBWLKSR-UHFFFAOYSA-N hexadecyl(dimethyl)azanium;hexanoate Chemical compound CCCCCC([O-])=O.CCCCCCCCCCCCCCCC[NH+](C)C BXFPJFWOBWLKSR-UHFFFAOYSA-N 0.000 description 1
- 229940005740 hexametaphosphate Drugs 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical group ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000012243 magnesium silicates Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- NHLUVTZJQOJKCC-UHFFFAOYSA-N n,n-dimethylhexadecan-1-amine Chemical compound CCCCCCCCCCCCCCCCN(C)C NHLUVTZJQOJKCC-UHFFFAOYSA-N 0.000 description 1
- 229910000480 nickel oxide Inorganic materials 0.000 description 1
- 229910000273 nontronite Inorganic materials 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- NDLPOXTZKUMGOV-UHFFFAOYSA-N oxo(oxoferriooxy)iron hydrate Chemical compound O.O=[Fe]O[Fe]=O NDLPOXTZKUMGOV-UHFFFAOYSA-N 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000004686 pentahydrates Chemical class 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- 229910001950 potassium oxide Inorganic materials 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229910000276 sauconite Inorganic materials 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 229910001948 sodium oxide Inorganic materials 0.000 description 1
- 229910000031 sodium sesquicarbonate Inorganic materials 0.000 description 1
- 235000018341 sodium sesquicarbonate Nutrition 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 239000008234 soft water Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 1
- WCTAGTRAWPDFQO-UHFFFAOYSA-K trisodium;hydrogen carbonate;carbonate Chemical compound [Na+].[Na+].[Na+].OC([O-])=O.[O-]C([O-])=O WCTAGTRAWPDFQO-UHFFFAOYSA-K 0.000 description 1
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 1
- 239000010455 vermiculite Substances 0.000 description 1
- 229910052902 vermiculite Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/0008—Detergent materials or soaps characterised by their shape or physical properties aqueous liquid non soap compositions
- C11D17/0013—Liquid compositions with insoluble particles in suspension
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/124—Silicon containing, e.g. silica, silex, quartz or glass beads
- C11D3/1246—Silicates, e.g. diatomaceous earth
- C11D3/1253—Layer silicates, e.g. talcum, kaolin, clay, bentonite, smectite, montmorillonite, hectorite or attapulgite
- C11D3/1266—Layer silicates, e.g. talcum, kaolin, clay, bentonite, smectite, montmorillonite, hectorite or attapulgite in liquid compositions
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/14—Fillers; Abrasives ; Abrasive compositions; Suspending or absorbing agents not provided for in one single group of C11D3/12; Specific features concerning abrasives, e.g. granulometry or mixtures
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB16814/74A GB1495549A (en) | 1974-04-17 | 1974-04-17 | Scouring compositions |
| US05/504,218 US3985668A (en) | 1974-04-17 | 1974-09-09 | Scouring compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1041307A true CA1041307A (en) | 1978-10-31 |
Family
ID=26252259
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA223,481A Expired CA1041307A (en) | 1974-04-17 | 1975-04-01 | Scouring compositions |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3985668A (enExample) |
| JP (1) | JPS593517B2 (enExample) |
| BE (1) | BE827991A (enExample) |
| CA (1) | CA1041307A (enExample) |
| DE (1) | DE2516003C2 (enExample) |
| FR (1) | FR2268071B1 (enExample) |
| GB (1) | GB1495549A (enExample) |
| IT (1) | IT1037342B (enExample) |
| NL (1) | NL185784C (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5190693A (en) * | 1988-07-29 | 1993-03-02 | Ausidet S.P.A. | Stable aqueous suspensions of inorganic silica-based materials insoluble in water |
Families Citing this family (85)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2539733C2 (de) * | 1974-09-09 | 1986-08-21 | The Procter & Gamble Co., Cincinnati, Ohio | Flüssiges Reinigungsmittel mit Schmirgelwirkung |
| US4051055A (en) * | 1976-12-21 | 1977-09-27 | The Procter & Gamble Company | Cleansing compositions |
| US4116851A (en) * | 1977-06-20 | 1978-09-26 | The Procter & Gamble Company | Thickened bleach compositions for treating hard-to-remove soils |
| US4158553A (en) * | 1978-01-16 | 1979-06-19 | S. C. Johnson & Son, Inc. | Non-scratching liquid scouring cleanser using abrasives with a Mohs hardness of greater than 3 |
| US4352678A (en) * | 1978-10-02 | 1982-10-05 | Lever Brothers Company | Thickened abrasive bleaching compositions |
| US4240919A (en) * | 1978-11-29 | 1980-12-23 | S. C. Johnson & Son, Inc. | Thixotropic abrasive liquid scouring composition |
| US4248728A (en) * | 1979-02-28 | 1981-02-03 | Chemed Corporation | Liquid scouring cleanser |
| NL7908798A (nl) | 1979-12-05 | 1981-07-01 | Unilever Nv | Vloeibaar, verdikt chloorbleekmiddel. |
| EP0030986A1 (en) * | 1979-12-24 | 1981-07-01 | THE PROCTER & GAMBLE COMPANY | Abrasive-containing, built liquid detergent composition |
| US4287079A (en) * | 1980-06-02 | 1981-09-01 | Purex Corporation | Liquid cleanser formula |
| EP0050887B1 (en) * | 1980-10-16 | 1984-05-02 | Unilever N.V. | Stable liquid detergent suspensions |
| US4388204A (en) * | 1982-03-23 | 1983-06-14 | The Drackett Company | Thickened alkali metal hypochlorite compositions |
| GB8328075D0 (en) * | 1983-10-20 | 1983-11-23 | Unilever Plc | Dishwashing compositions |
| US4599186A (en) * | 1984-04-20 | 1986-07-08 | The Clorox Company | Thickened aqueous abrasive scouring cleanser |
| US4657692A (en) * | 1984-04-20 | 1987-04-14 | The Clorox Company | Thickened aqueous abrasive scouring cleanser |
| US4927555A (en) * | 1984-08-13 | 1990-05-22 | Colgate-Palmolive Company | Process for making thixotropic detergent compositions |
| NZ212921A (en) * | 1984-08-13 | 1988-06-30 | Colgate Palmolive Co | Process for the manufacture of thixotropic detergent compositions |
| US4594175A (en) * | 1984-08-29 | 1986-06-10 | Economics Laboratory, Inc. | Mechanical dishwashing rinse composition having a low foaming sulfonic acid rinsing agent, a hydrotrope and a source of active halogen |
| US4751016A (en) * | 1985-02-26 | 1988-06-14 | The Clorox Company | Liquid aqueous abrasive cleanser |
| US5427707A (en) * | 1985-06-14 | 1995-06-27 | Colgate Palmolive Co. | Thixotropic aqueous compositions containing adipic or azelaic acid stabilizer |
| US5064553A (en) * | 1989-05-18 | 1991-11-12 | Colgate-Palmolive Co. | Linear-viscoelastic aqueous liquid automatic dishwasher detergent composition |
| DE3545288A1 (de) * | 1985-12-20 | 1987-06-25 | Vorwerk Co Interholding | Fluessige reinigungssuspension |
| NZ218730A (en) * | 1986-01-03 | 1990-04-26 | Bristol Myers Co | Bleaching composition including thickening agent |
| US4828748A (en) * | 1986-01-03 | 1989-05-09 | The Drackett Company | Thickened alkali metal hypochlorite compositions |
| US4704222A (en) * | 1986-09-05 | 1987-11-03 | Noxell Corporation | Gelled abrasive detergent composition |
| US4804491A (en) * | 1986-11-03 | 1989-02-14 | The Clorox Company | Aqueous based acidic hard surface cleaner |
| US4895669A (en) * | 1986-11-03 | 1990-01-23 | The Clorox Company | Aqueous based acidic hard surface cleaner |
| US4828723A (en) * | 1987-07-15 | 1989-05-09 | Colgate-Palmolive Company | Stable non-aqueous suspension containing organophilic clay and low density filler |
| US5176713A (en) * | 1987-07-15 | 1993-01-05 | Colgate-Palmolive Co. | Stable non-aqueous cleaning composition method of use |
| ZA884860B (en) * | 1987-07-15 | 1990-03-28 | Colgate Palmolive Co | Stable non-aqueous cleaning composition containing low density filler and method of use |
| US4931195A (en) * | 1987-07-15 | 1990-06-05 | Colgate-Palmolive Company | Low viscosity stable non-aqueous suspension containing organophilic clay and low density filler |
| US4838948A (en) * | 1987-07-27 | 1989-06-13 | Phillips Petroleum Company | Process for cleaning polymer processing equipment |
| US4970016A (en) * | 1987-09-29 | 1990-11-13 | Colgate-Palmolive Co. | Thixotropic aqueous liquid automatic dishwashing detergent composition |
| US4968445A (en) * | 1987-09-29 | 1990-11-06 | Colgate-Palmolive Co. | Thixotropic aqueous liquid automatic dishwashing detergent composition |
| US4968446A (en) * | 1987-11-05 | 1990-11-06 | Colgate-Palmolive Co. | Thixotropic aqueous liquid automatic dishwashing detergent composition |
| US5205954A (en) * | 1987-11-05 | 1993-04-27 | Colgate-Palmolive Co. | Automatic dishwasher powder detergent composition |
| US4844824A (en) * | 1988-02-08 | 1989-07-04 | The Procter & Gamble Company | Stable heavy duty liquid detergent compositions which contain a softener and antistatic agent |
| US4943429A (en) * | 1988-05-23 | 1990-07-24 | Church & Dwight Co., Inc. | Dentifrice gels containing sodium bicarbonate |
| JPH01139131A (ja) * | 1988-07-21 | 1989-05-31 | Takeda Chem Ind Ltd | スラリーの輸送方法 |
| EP0352358A1 (en) * | 1988-07-29 | 1990-01-31 | AUSIDET S.p.A. | Stable aqueous suspensions of inorganic silica-based materials insoluble in water |
| US4986926A (en) * | 1989-04-10 | 1991-01-22 | The Drackett Company | Thickened alkali metal hypochlorite compositions |
| US5196139A (en) * | 1989-06-19 | 1993-03-23 | Lever Brothers Company, Division Of Conopco, Inc. | Bleach article containing polyacrylate or copolymer of acrylic and maleic |
| US5041236A (en) | 1989-10-27 | 1991-08-20 | The Procter & Gamble Company | Antimicrobial methods and compositions employing certain lysozymes and endoglycosidases |
| WO1991012313A1 (en) * | 1990-02-16 | 1991-08-22 | Unilever N.V. | Liquid cleaning products |
| US5120465A (en) * | 1990-02-22 | 1992-06-09 | Dry Branch Kaolin Company | Detergent or cleansing composition and additive for imparting thixotropic properties thereto |
| EP0517311A1 (en) | 1991-06-07 | 1992-12-09 | Colgate-Palmolive Company | Linear viscoelastic aqueous liquid automatic dishwasher detergent composition |
| US5279755A (en) * | 1991-09-16 | 1994-01-18 | The Clorox Company | Thickening aqueous abrasive cleaner with improved colloidal stability |
| US5346641A (en) * | 1992-01-17 | 1994-09-13 | The Clorox Company | Thickened aqueous abrasive cleanser with improved colloidal stability |
| GB2269597A (en) * | 1992-08-04 | 1994-02-16 | Hee Sun Kaw | Cleaning composition |
| US5393446A (en) * | 1992-12-16 | 1995-02-28 | Eco Japan Co., Ltd. | Process for preparing detergent composition containing sodium and potassium oxides |
| US5597553A (en) * | 1993-01-14 | 1997-01-28 | Hawe Neos Dental Dr H.V. Weissenfluh Ag | Expanded perlite toothpaste |
| GB9315761D0 (en) * | 1993-07-30 | 1993-09-15 | Unilever Plc | Bleach compositions |
| US5470499A (en) * | 1993-09-23 | 1995-11-28 | The Clorox Company | Thickened aqueous abrasive cleanser with improved rinsability |
| US5529711A (en) * | 1993-09-23 | 1996-06-25 | The Clorox Company | Phase stable, thickened aqueous abrasive bleaching cleanser |
| WO1996035771A1 (en) * | 1995-05-11 | 1996-11-14 | Reckitt & Colman Inc. | Thickened scouring cleanser containing inorganic abrasives and hypochlorite bleach |
| GB2304113B (en) * | 1995-08-10 | 1999-08-04 | Reckitt & Colman Inc | Hard surface cleaner |
| GB2305434B (en) * | 1995-09-19 | 1999-03-10 | Reckitt & Colmann Sa | Abrasive cleaning composition |
| GB2311996A (en) * | 1996-04-12 | 1997-10-15 | Reckitt & Colman Inc | Hard surface scouring cleansers ` |
| JP3856843B2 (ja) * | 1996-11-14 | 2006-12-13 | 花王株式会社 | 磁気記録媒体基板用研磨材組成物及びこれを用いた磁気記録媒体基板の製造方法 |
| US6010683A (en) * | 1997-11-05 | 2000-01-04 | Ultradent Products, Inc. | Compositions and methods for reducing the quantity but not the concentration of active ingredients delivered by a dentifrice |
| US5997764A (en) * | 1997-12-04 | 1999-12-07 | The B.F. Goodrich Company | Thickened bleach compositions |
| ATE232081T1 (de) * | 1999-06-04 | 2003-02-15 | Unilever Nv | Orale zusammensetzung enthaltend perlit |
| US6332708B1 (en) | 2000-08-31 | 2001-12-25 | Cametox 2000 Inc. | Method of shipping manganese dioxide |
| US20030118626A1 (en) * | 2001-09-21 | 2003-06-26 | John Kibbee | Stable pesticidal chemical formulations |
| US7860116B2 (en) * | 2007-05-24 | 2010-12-28 | Worldwide Packets, Inc. | Processing packets of a virtual interface associated with tunnels |
| WO2010039571A1 (en) * | 2008-09-30 | 2010-04-08 | The Procter & Gamble Company | Liquid hard surface cleaning composition |
| EP2328999A1 (en) | 2008-09-30 | 2011-06-08 | The Procter & Gamble Company | Liquid hard surface cleaning composition |
| ES2582573T3 (es) * | 2008-09-30 | 2016-09-13 | The Procter & Gamble Company | Composiciones limpiadoras líquidas de superficies duras |
| ES2444774T3 (es) * | 2009-12-22 | 2014-02-26 | The Procter & Gamble Company | Composición limpiadora y/o de lavado líquida |
| EP2516609B1 (en) | 2009-12-22 | 2013-11-27 | The Procter and Gamble Company | Liquid cleaning and/or cleansing composition |
| JP5902669B2 (ja) | 2010-04-21 | 2016-04-13 | ザ プロクター アンド ギャンブル カンパニー | 液体クリーニング及び/又はクレンジング組成物 |
| EP2431451A1 (en) | 2010-09-21 | 2012-03-21 | The Procter & Gamble Company | Liquid detergent composition with abrasive particles |
| JP5997161B2 (ja) | 2010-09-21 | 2016-09-28 | ザ プロクター アンド ギャンブル カンパニー | 液体洗浄組成物 |
| EP2431453B1 (en) | 2010-09-21 | 2019-06-19 | The Procter & Gamble Company | Liquid cleaning and/or cleansing composition |
| US9546346B2 (en) | 2011-04-07 | 2017-01-17 | The Dial Corporation | Use of polyethylene glycol to control the spray pattern of sprayable liquid abrasive cleansers |
| US8852643B2 (en) | 2011-06-20 | 2014-10-07 | The Procter & Gamble Company | Liquid cleaning and/or cleansing composition |
| US8470759B2 (en) | 2011-06-20 | 2013-06-25 | The Procter & Gamble Company | Liquid cleaning and/or cleansing composition comprising a polyhydroxy-alkanoate biodegradable abrasive |
| EP2537917A1 (en) | 2011-06-20 | 2012-12-26 | The Procter & Gamble Company | Liquid detergent composition with abrasive particles |
| JP6006306B2 (ja) | 2011-06-20 | 2016-10-12 | ザ プロクター アンド ギャンブル カンパニー | 液体クリーニング及び/又はクレンジング組成物 |
| EP2719752B1 (en) | 2012-10-15 | 2016-03-16 | The Procter and Gamble Company | Liquid detergent composition with abrasive particles |
| CN107151580A (zh) * | 2017-05-31 | 2017-09-12 | 江苏精盾节能科技有限公司 | 一种中空玻璃专用清理液及其制备方法 |
| CN108276680B (zh) * | 2018-03-09 | 2020-12-22 | 西华大学 | 一种改性聚丙烯复合材料及其制备方法 |
| US10986841B2 (en) | 2018-11-06 | 2021-04-27 | The Clorox Company | Bleach compositions |
| GB2579252A (en) | 2018-11-28 | 2020-06-17 | For Spills Ltd | Biocidal formulation |
| US11845916B2 (en) | 2020-06-24 | 2023-12-19 | The Clorox Company | Burstable sporicidal cleaning wipe system containing stabilized hypochlorite |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2489848A (en) * | 1947-10-10 | 1949-11-29 | Wyandotte Chemicals Corp | Abrasive scouring powder |
| US3042622A (en) * | 1957-11-01 | 1962-07-03 | Colgate Palmolive Co | Abrasive cleaning composition |
| US3446893A (en) * | 1967-02-23 | 1969-05-27 | Olin Mathieson | Solid deodorizing compositions |
| US3530071A (en) * | 1967-06-26 | 1970-09-22 | Procter & Gamble | Scouring cleanser containing chlorinated trisodium phosphate stabilized against loss of bleaching effectiveness with borax |
| US3558496A (en) * | 1967-11-13 | 1971-01-26 | Barney Joseph Zmoda | Thickened liquid bleach and process for preparing same |
| US3716488A (en) * | 1970-09-04 | 1973-02-13 | Stevens & Co Inc J P | Textile fabric cleaning compositions |
| US3702826A (en) * | 1971-01-25 | 1972-11-14 | Colgate Palmolive Co | Scouring cleanser |
| US3715314A (en) * | 1971-04-02 | 1973-02-06 | Procter & Gamble | Scouring cleanser composition |
-
1974
- 1974-04-17 GB GB16814/74A patent/GB1495549A/en not_active Expired
- 1974-09-09 US US05/504,218 patent/US3985668A/en not_active Expired - Lifetime
-
1975
- 1975-04-01 CA CA223,481A patent/CA1041307A/en not_active Expired
- 1975-04-12 DE DE2516003A patent/DE2516003C2/de not_active Expired
- 1975-04-16 NL NLAANVRAGE7504507,A patent/NL185784C/xx not_active IP Right Cessation
- 1975-04-16 BE BE155450A patent/BE827991A/xx not_active IP Right Cessation
- 1975-04-16 FR FR7511815A patent/FR2268071B1/fr not_active Expired
- 1975-04-17 JP JP50046938A patent/JPS593517B2/ja not_active Expired
- 1975-04-17 IT IT22455/75A patent/IT1037342B/it active
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5190693A (en) * | 1988-07-29 | 1993-03-02 | Ausidet S.P.A. | Stable aqueous suspensions of inorganic silica-based materials insoluble in water |
Also Published As
| Publication number | Publication date |
|---|---|
| NL185784C (nl) | 1990-07-16 |
| DE2516003C2 (de) | 1983-12-29 |
| GB1495549A (en) | 1977-12-21 |
| FR2268071B1 (enExample) | 1979-03-23 |
| US3985668A (en) | 1976-10-12 |
| NL7504507A (nl) | 1975-10-21 |
| FR2268071A1 (enExample) | 1975-11-14 |
| JPS5116308A (enExample) | 1976-02-09 |
| BE827991A (fr) | 1975-10-16 |
| DE2516003A1 (de) | 1975-11-06 |
| IT1037342B (it) | 1979-11-10 |
| NL185784B (nl) | 1990-02-16 |
| JPS593517B2 (ja) | 1984-01-24 |
| AU8019775A (en) | 1976-10-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1041307A (en) | Scouring compositions | |
| US4005027A (en) | Scouring compositions | |
| US4051056A (en) | Abrasive scouring compositions | |
| US4657692A (en) | Thickened aqueous abrasive scouring cleanser | |
| US4240919A (en) | Thixotropic abrasive liquid scouring composition | |
| AU721818B2 (en) | A thickened aqueous cleaning composition and methods of preparation thereof and cleaning therewith | |
| US4116851A (en) | Thickened bleach compositions for treating hard-to-remove soils | |
| US4235732A (en) | Liquid bleaching compositions | |
| US4695394A (en) | Thickened aqueous cleanser | |
| US4599186A (en) | Thickened aqueous abrasive scouring cleanser | |
| CA1095802A (en) | Cleansing composition | |
| CA1222426A (en) | Thixotropic automatic dishwasher composition with chlorine bleach | |
| CA1322707C (en) | Liquid automatic dishwashing compositions providing silver protection | |
| FI66902C (fi) | Stabila detergentsuspensioner i vaetskeform | |
| US4740327A (en) | Automatic dishwasher detergent compositions with chlorine bleach having thixotropic properties | |
| US4248728A (en) | Liquid scouring cleanser | |
| US5346641A (en) | Thickened aqueous abrasive cleanser with improved colloidal stability | |
| US5279755A (en) | Thickening aqueous abrasive cleaner with improved colloidal stability | |
| US5376297A (en) | Thickened pourable aqueous cleaner | |
| US4824590A (en) | Thickened aqueous compositions with suspended solids | |
| IE41793B1 (en) | Abrasive scouring compositions | |
| US5298181A (en) | Thickened pourable aqueous abrasive cleanser | |
| DE2739776A1 (de) | Reinigungsmittel | |
| EP0264975A1 (en) | Thickened aqueous dishwashing compositions | |
| AU606130B2 (en) | Thixotropic clay aqueous suspensions |