DE2515425C3 - Brikettiertes Düngemittel aus Isoburylidendiharnstoff - Google Patents
Brikettiertes Düngemittel aus IsoburylidendiharnstoffInfo
- Publication number
- DE2515425C3 DE2515425C3 DE2515425A DE2515425A DE2515425C3 DE 2515425 C3 DE2515425 C3 DE 2515425C3 DE 2515425 A DE2515425 A DE 2515425A DE 2515425 A DE2515425 A DE 2515425A DE 2515425 C3 DE2515425 C3 DE 2515425C3
- Authority
- DE
- Germany
- Prior art keywords
- fertilizer
- molding
- hardness
- oil
- isobutylidenediurea
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003337 fertilizer Substances 0.000 title claims description 45
- XMKLTEGSALONPH-UHFFFAOYSA-N 1,2,4,5-tetrazinane-3,6-dione Chemical compound O=C1NNC(=O)NN1 XMKLTEGSALONPH-UHFFFAOYSA-N 0.000 title 1
- QFHMNFAUXJAINK-UHFFFAOYSA-N [1-(carbamoylamino)-2-methylpropyl]urea Chemical compound NC(=O)NC(C(C)C)NC(N)=O QFHMNFAUXJAINK-UHFFFAOYSA-N 0.000 claims description 22
- 239000008187 granular material Substances 0.000 claims description 20
- 238000000465 moulding Methods 0.000 claims description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 17
- 230000004720 fertilization Effects 0.000 claims description 9
- 239000002480 mineral oil Substances 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 235000010446 mineral oil Nutrition 0.000 claims 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- 230000006835 compression Effects 0.000 description 11
- 238000007906 compression Methods 0.000 description 11
- 230000000694 effects Effects 0.000 description 9
- 239000000295 fuel oil Substances 0.000 description 9
- 239000003921 oil Substances 0.000 description 9
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 238000000748 compression moulding Methods 0.000 description 5
- 229940057995 liquid paraffin Drugs 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 230000012010 growth Effects 0.000 description 3
- 239000010763 heavy fuel oil Substances 0.000 description 3
- 229940097789 heavy mineral oil Drugs 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000012423 maintenance Methods 0.000 description 3
- 238000007493 shaping process Methods 0.000 description 3
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 2
- 239000004484 Briquette Substances 0.000 description 2
- 101000677562 Homo sapiens Isobutyryl-CoA dehydrogenase, mitochondrial Proteins 0.000 description 2
- 102100021646 Isobutyryl-CoA dehydrogenase, mitochondrial Human genes 0.000 description 2
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 239000001099 ammonium carbonate Substances 0.000 description 2
- 235000012501 ammonium carbonate Nutrition 0.000 description 2
- 239000010426 asphalt Substances 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 239000010687 lubricating oil Substances 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- 235000013379 molasses Nutrition 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- GHCZTIFQWKKGSB-UHFFFAOYSA-N 2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid Chemical compound OP(O)(O)=O.OC(=O)CC(O)(C(O)=O)CC(O)=O GHCZTIFQWKKGSB-UHFFFAOYSA-N 0.000 description 1
- BPBWQJOFULENOZ-UHFFFAOYSA-N 2-methylpropylideneurea Chemical compound CC(C)C=NC(N)=O BPBWQJOFULENOZ-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 241000218645 Cedrus Species 0.000 description 1
- VCUFZILGIRCDQQ-KRWDZBQOSA-N N-[[(5S)-2-oxo-3-(2-oxo-3H-1,3-benzoxazol-6-yl)-1,3-oxazolidin-5-yl]methyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C1O[C@H](CN1C1=CC2=C(NC(O2)=O)C=C1)CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F VCUFZILGIRCDQQ-KRWDZBQOSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229920005551 calcium lignosulfonate Polymers 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- RYAGRZNBULDMBW-UHFFFAOYSA-L calcium;3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Ca+2].COC1=CC=CC(CC(CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O RYAGRZNBULDMBW-UHFFFAOYSA-L 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 239000010721 machine oil Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000002367 phosphate rock Substances 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- -1 polyethylene Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- 230000013278 single fertilization Effects 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000008399 tap water Substances 0.000 description 1
- 235000020679 tap water Nutrition 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 239000010723 turbine oil Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C05—FERTILISERS; MANUFACTURE THEREOF
- C05C—NITROGENOUS FERTILISERS
- C05C9/00—Fertilisers containing urea or urea compounds
- C05C9/005—Post-treatment
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Fertilizers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4021674A JPS5424942B2 (cg-RX-API-DMAC10.html) | 1974-04-09 | 1974-04-09 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2515425A1 DE2515425A1 (de) | 1975-10-16 |
| DE2515425B2 DE2515425B2 (de) | 1978-02-09 |
| DE2515425C3 true DE2515425C3 (de) | 1978-09-21 |
Family
ID=12574569
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2515425A Expired DE2515425C3 (de) | 1974-04-09 | 1975-04-09 | Brikettiertes Düngemittel aus Isoburylidendiharnstoff |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4304589A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5424942B2 (cg-RX-API-DMAC10.html) |
| CA (1) | CA1050779A (cg-RX-API-DMAC10.html) |
| DE (1) | DE2515425C3 (cg-RX-API-DMAC10.html) |
| FI (1) | FI58628C (cg-RX-API-DMAC10.html) |
| FR (1) | FR2267293B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1481115A (cg-RX-API-DMAC10.html) |
| SE (1) | SE413020B (cg-RX-API-DMAC10.html) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5424942B2 (cg-RX-API-DMAC10.html) * | 1974-04-09 | 1979-08-24 | ||
| DE3247917A1 (de) * | 1982-12-24 | 1984-06-28 | Basf Ag, 6700 Ludwigshafen | Isobutylidendiharnstoff-haltige duengerstaebchen |
| US4587358A (en) * | 1985-08-26 | 1986-05-06 | Tennessee Valley Authority | Production of high-strength, storage-stable particulate urea |
| US5238480A (en) * | 1989-06-29 | 1993-08-24 | Vigoro Industries, Inc. | Fertilizer compositions and method of making such compositions |
| US5174804A (en) * | 1989-09-29 | 1992-12-29 | Vigoro Industries, Inc. | Fertilizer/pesticide composition and method of treating plants |
| US5549730A (en) * | 1993-07-06 | 1996-08-27 | Mitsubishi Chemical Corporation | Compression molded tablet fertilizer and method the production thereof |
| JP4141678B2 (ja) * | 2000-12-05 | 2008-08-27 | チッソ旭肥料株式会社 | 肥料、肥料の製造方法、および尿素−脂肪族アルデヒド縮合物の無機化速度制御方法 |
| US8574631B2 (en) * | 2002-09-16 | 2013-11-05 | The Andersons, Inc. | Water-dispersible pellets containing a isobutylene diurea and a lignin binder |
| US6884756B2 (en) | 2001-09-14 | 2005-04-26 | The Andersons Agriservices, Inc. | Water-dispersible pellets |
| US8491692B2 (en) * | 2006-02-08 | 2013-07-23 | The Andersons, Inc. | Dispersable potash granule |
| US8609145B2 (en) * | 2006-02-08 | 2013-12-17 | The Andersons, Inc. | Dispersible struvite particles |
| US9624139B2 (en) | 2013-12-03 | 2017-04-18 | The Andersons, Inc. | Water-dispersible particles formed with granules embedded in crystallized matrix |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3024098A (en) * | 1958-10-06 | 1962-03-06 | Crown Zellerbach Corp | Fertilizer product, its manufacture and application |
| US3054669A (en) * | 1959-02-04 | 1962-09-18 | Basf Ag | Slow-acting fertilizers comprising crotylidene diurea |
| US3322528A (en) * | 1960-08-30 | 1967-05-30 | Hamamoto Masao | Fertilizer compositions consisting of isobutylidene-diurea and method of using |
| US3219432A (en) * | 1962-03-06 | 1965-11-23 | Hoechst Ag | Fertilizer composition containing condensation products of urea and aldehyde |
| USRE27238E (en) | 1962-05-01 | 1971-11-23 | Method of preparing slow release fertilizer compositions | |
| US3232740A (en) * | 1962-10-24 | 1966-02-01 | Exxon Research Engineering Co | Agricultural nutrient containing urea |
| US3459529A (en) * | 1966-04-26 | 1969-08-05 | Uss Agri Chem Inc | Urea-biuret condensation products as slow release nitrogen fertilizer and the preparation thereof |
| US3502458A (en) * | 1967-02-28 | 1970-03-24 | Roy U Schenk | Method of making a slow release fertilizer |
| US3580715A (en) * | 1969-04-16 | 1971-05-25 | Olin Corp | Coated fertilizer |
| US3647416A (en) * | 1969-07-18 | 1972-03-07 | Edmond L D Ouville | Slow-release fertilizer spike having high crush-resistance |
| US3697245A (en) * | 1970-08-12 | 1972-10-10 | Joseph T Dilday | Coated fertilizer |
| JPS477329U (cg-RX-API-DMAC10.html) * | 1971-02-19 | 1972-09-27 | ||
| JPS516221Y2 (cg-RX-API-DMAC10.html) * | 1971-03-13 | 1976-02-20 | ||
| US3725029A (en) * | 1971-09-27 | 1973-04-03 | Ga Pacific Corp | Preparation of ammonium sulfate fertilizer constituent |
| US3925053A (en) * | 1973-05-14 | 1975-12-09 | Swift Chemical Company | Slow acting fertilizer |
| DE2355212C2 (de) * | 1973-11-05 | 1975-10-23 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von körnigem Isobutylidendiharnstoff |
| JPS5424942B2 (cg-RX-API-DMAC10.html) * | 1974-04-09 | 1979-08-24 |
-
1974
- 1974-04-09 JP JP4021674A patent/JPS5424942B2/ja not_active Expired
-
1975
- 1975-04-02 GB GB13552/75A patent/GB1481115A/en not_active Expired
- 1975-04-08 CA CA224,110A patent/CA1050779A/en not_active Expired
- 1975-04-08 SE SE7504035A patent/SE413020B/xx not_active IP Right Cessation
- 1975-04-08 FR FR7510927A patent/FR2267293B1/fr not_active Expired
- 1975-04-09 DE DE2515425A patent/DE2515425C3/de not_active Expired
- 1975-04-09 FI FI751060A patent/FI58628C/fi not_active IP Right Cessation
-
1980
- 1980-06-30 US US06/164,693 patent/US4304589A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE2515425A1 (de) | 1975-10-16 |
| FI751060A7 (cg-RX-API-DMAC10.html) | 1975-10-10 |
| FR2267293A1 (cg-RX-API-DMAC10.html) | 1975-11-07 |
| GB1481115A (en) | 1977-07-27 |
| FI58628C (fi) | 1981-03-10 |
| US4304589A (en) | 1981-12-08 |
| FI58628B (fi) | 1980-11-28 |
| SE7504035L (sv) | 1975-10-10 |
| JPS50134867A (cg-RX-API-DMAC10.html) | 1975-10-25 |
| CA1050779A (en) | 1979-03-20 |
| DE2515425B2 (de) | 1978-02-09 |
| SE413020B (sv) | 1980-03-31 |
| FR2267293B1 (cg-RX-API-DMAC10.html) | 1977-04-15 |
| JPS5424942B2 (cg-RX-API-DMAC10.html) | 1979-08-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2515425C3 (de) | Brikettiertes Düngemittel aus Isoburylidendiharnstoff | |
| DE1767998A1 (de) | Schwefelumhuellung von Duengemitteln zur gesteuerten Aufloesung | |
| EP0099052A2 (de) | Verfahren zur Aufbereitung von fäkalen Abfällen | |
| EP0104355B1 (de) | Verfahren zur Herstellung eines vollwertigen Humusträgers und Düngers auf Rindenbasis | |
| DE1146080B (de) | Kondensationsprodukte aus Harnstoff und Aldehyden enthaltende Duengemittel | |
| DE3586371T2 (de) | Verfahren zur behandlung des bodens und zusammensetzung zur konservierung von stickstoff im boden. | |
| DE821946C (de) | Verfahren zur Herstellung von granulierten humushaltigen Duengemitteln aus Klaerschlamm | |
| DE4240807C1 (de) | Organisch-mineralisches Düngemittel | |
| DE863946C (de) | Verfahren zur Herstellung von granuliertem Superphosphat | |
| DE863947C (de) | Verfahren zur Herstellung von granuliertem Superphosphat | |
| DE3237905C2 (cg-RX-API-DMAC10.html) | ||
| EP0076910B1 (de) | Nitrifikationshemmendes Mittel und Verfahren zu seiner Herstellung | |
| DE3024737C2 (de) | Substrat für Bepflanzungen | |
| DE851070C (de) | Verfahren zur Herstellung von granulierten, humushaltigen Duenge-mitteln aus Klaerschlamm | |
| DE2412602A1 (de) | Mittel und verfahren zur bodenverbesserung oder duengung von anbauflaechen | |
| CH679040A5 (cg-RX-API-DMAC10.html) | ||
| DE887949C (de) | Verfahren zur Herstellung von granuliertem Superphosphat | |
| DE892760C (de) | Verfahren zur Herstellung von granulierten, humushaltigen Duengemitteln aus Klaerschlamm | |
| DE2739618B2 (de) | Organisches Düngemittel aus Kaffeebohnenhäutchen und/oder ErdnuBhäutchen | |
| DE4018395A1 (de) | Mittel zur hemmung bzw. regelung der nitrifikation von ammoniumstickstoff in kulturboeden | |
| DE909104C (de) | Verfahren zur Herstellung von Stickstoff enthaltenden Kalkhumat-Duengemitteln | |
| DE1695915C3 (de) | Verfahren zur Verhinderung der Nitrifikation von Ammonium-Stickstoff | |
| DE1592609B1 (de) | Verfahren zur Herstellung eines granulierten, schwefel und gegebenenfalls kalisalzhaltigen Phosphatdüngemittels | |
| WO1990012771A2 (de) | Verfahren zur verarbeitung von gülle zu einem festen düngemittel-produkt | |
| DE2362759A1 (de) | Duengemitteldorn und verfahren zu dessen herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: MITSUBISHI KASEI CORP., TOKIO/TOKYO, JP |
|
| 8328 | Change in the person/name/address of the agent |
Free format text: DANNENBERG, G., DIPL.-ING., 6000 FRANKFURT WEINHOLD, P., DIPL.-CHEM. DR., 8000 MUENCHEN GUDEL, D., DR.PHIL., PAT.-ANWAELTE, 6000 FRANKFURT |
|
| 8339 | Ceased/non-payment of the annual fee |