DE2508181A1 - 1,4-dihydropyridincarbonsaeurearal- kylester, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel - Google Patents
1,4-dihydropyridincarbonsaeurearal- kylester, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittelInfo
- Publication number
- DE2508181A1 DE2508181A1 DE19752508181 DE2508181A DE2508181A1 DE 2508181 A1 DE2508181 A1 DE 2508181A1 DE 19752508181 DE19752508181 DE 19752508181 DE 2508181 A DE2508181 A DE 2508181A DE 2508181 A1 DE2508181 A1 DE 2508181A1
- Authority
- DE
- Germany
- Prior art keywords
- mol
- ester
- acid
- yield
- ethanol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000002253 acid Substances 0.000 title claims description 137
- 238000000034 method Methods 0.000 title claims description 48
- 238000004519 manufacturing process Methods 0.000 title description 4
- 229940126601 medicinal product Drugs 0.000 title 1
- 150000002148 esters Chemical class 0.000 claims description 272
- 150000001875 compounds Chemical class 0.000 claims description 252
- -1 trifluoromethoxy, hydroxy Chemical group 0.000 claims description 152
- 125000000217 alkyl group Chemical group 0.000 claims description 37
- 125000004432 carbon atom Chemical group C* 0.000 claims description 35
- 125000001424 substituent group Chemical group 0.000 claims description 22
- 239000003960 organic solvent Substances 0.000 claims description 20
- 229910052736 halogen Inorganic materials 0.000 claims description 16
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 15
- 150000002367 halogens Chemical class 0.000 claims description 14
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 14
- 125000003545 alkoxy group Chemical group 0.000 claims description 13
- 239000000126 substance Substances 0.000 claims description 13
- 150000001412 amines Chemical class 0.000 claims description 12
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 12
- 150000003254 radicals Chemical class 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 11
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 239000003814 drug Substances 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 claims description 7
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 6
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 5
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 5
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 5
- 125000005956 isoquinolyl group Chemical group 0.000 claims description 5
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 5
- 229920006395 saturated elastomer Polymers 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 239000000969 carrier Substances 0.000 claims description 4
- 125000004122 cyclic group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 229940079593 drug Drugs 0.000 claims description 4
- 125000002541 furyl group Chemical group 0.000 claims description 4
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- 229930195734 saturated hydrocarbon Natural products 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 125000004434 sulfur atom Chemical group 0.000 claims description 4
- 125000001544 thienyl group Chemical group 0.000 claims description 4
- 229930195735 unsaturated hydrocarbon Natural products 0.000 claims description 4
- 150000005840 aryl radicals Chemical class 0.000 claims description 3
- 231100000252 nontoxic Toxicity 0.000 claims description 3
- 230000003000 nontoxic effect Effects 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000003107 substituted aryl group Chemical group 0.000 claims description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 2
- 125000004429 atom Chemical group 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 229910052757 nitrogen Inorganic materials 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 779
- 235000019441 ethanol Nutrition 0.000 description 267
- 238000010438 heat treatment Methods 0.000 description 264
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 186
- UKVYVZLTGQVOPX-IHWYPQMZSA-N (z)-3-aminobut-2-enoic acid Chemical compound C\C(N)=C\C(O)=O UKVYVZLTGQVOPX-IHWYPQMZSA-N 0.000 description 111
- 229910021529 ammonia Inorganic materials 0.000 description 92
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 75
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 59
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 56
- ZETIVVHRRQLWFW-UHFFFAOYSA-N 3-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC(C=O)=C1 ZETIVVHRRQLWFW-UHFFFAOYSA-N 0.000 description 52
- XKORCTIIRYKLLG-ARJAWSKDSA-N methyl (z)-3-aminobut-2-enoate Chemical compound COC(=O)\C=C(\C)N XKORCTIIRYKLLG-ARJAWSKDSA-N 0.000 description 49
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 38
- CMWKITSNTDAEDT-UHFFFAOYSA-N 2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC=C1C=O CMWKITSNTDAEDT-UHFFFAOYSA-N 0.000 description 35
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 35
- WDJHALXBUFZDSR-UHFFFAOYSA-M acetoacetate Chemical compound CC(=O)CC([O-])=O WDJHALXBUFZDSR-UHFFFAOYSA-M 0.000 description 29
- 238000002844 melting Methods 0.000 description 29
- 230000008018 melting Effects 0.000 description 29
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 27
- 238000006243 chemical reaction Methods 0.000 description 25
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 22
- WOFAGNLBCJWEOE-UHFFFAOYSA-N Benzyl acetoacetate Chemical compound CC(=O)CC(=O)OCC1=CC=CC=C1 WOFAGNLBCJWEOE-UHFFFAOYSA-N 0.000 description 21
- 239000002904 solvent Substances 0.000 description 20
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 19
- GVIIRWAJDFKJMJ-UHFFFAOYSA-N propan-2-yl 3-oxobutanoate Chemical compound CC(C)OC(=O)CC(C)=O GVIIRWAJDFKJMJ-UHFFFAOYSA-N 0.000 description 19
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 18
- WDJHALXBUFZDSR-UHFFFAOYSA-N Acetoacetic acid Natural products CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 18
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 18
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 18
- 239000000460 chlorine Substances 0.000 description 18
- 150000004702 methyl esters Chemical class 0.000 description 18
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 15
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 15
- 125000001318 4-trifluoromethylbenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])*)C(F)(F)F 0.000 description 14
- LPYNWRPARGBJOL-CLFYSBASSA-N benzyl (z)-3-aminobut-2-enoate Chemical compound C\C(N)=C\C(=O)OCC1=CC=CC=C1 LPYNWRPARGBJOL-CLFYSBASSA-N 0.000 description 14
- WOWBFOBYOAGEEA-UHFFFAOYSA-N diafenthiuron Chemical compound CC(C)C1=C(NC(=S)NC(C)(C)C)C(C(C)C)=CC(OC=2C=CC=CC=2)=C1 WOWBFOBYOAGEEA-UHFFFAOYSA-N 0.000 description 14
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 12
- 125000004494 ethyl ester group Chemical group 0.000 description 11
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 10
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 10
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 10
- BSIUTVXEBSLZFS-UHFFFAOYSA-N (4-methylphenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(C)C=C1 BSIUTVXEBSLZFS-UHFFFAOYSA-N 0.000 description 9
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 description 9
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 9
- 229910052801 chlorine Inorganic materials 0.000 description 9
- YPMPTULBFPFSEQ-PLNGDYQASA-N ethyl (z)-3-aminobut-2-enoate Chemical compound CCOC(=O)\C=C(\C)N YPMPTULBFPFSEQ-PLNGDYQASA-N 0.000 description 9
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 9
- PLHCSZRZWOWUBW-UHFFFAOYSA-N 2-methoxyethyl 3-oxobutanoate Chemical compound COCCOC(=O)CC(C)=O PLHCSZRZWOWUBW-UHFFFAOYSA-N 0.000 description 8
- 125000002774 3,4-dimethoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 8
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 8
- WTZXTWAKAQXSJH-UHFFFAOYSA-N (2-chlorophenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=CC=C1Cl WTZXTWAKAQXSJH-UHFFFAOYSA-N 0.000 description 7
- XCVDXVFGPDLBLG-UHFFFAOYSA-N (3,4-dichlorophenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(Cl)C(Cl)=C1 XCVDXVFGPDLBLG-UHFFFAOYSA-N 0.000 description 7
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 7
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 7
- 125000006512 3,4-dichlorobenzyl group Chemical group [H]C1=C(Cl)C(Cl)=C([H])C(=C1[H])C([H])([H])* 0.000 description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 7
- 150000001298 alcohols Chemical class 0.000 description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 7
- 229910052794 bromium Inorganic materials 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- GRNUWNYJUHOVPF-UHFFFAOYSA-N (3,4-dimethoxyphenyl)methyl 3-oxobutanoate Chemical compound COC1=CC=C(COC(=O)CC(C)=O)C=C1OC GRNUWNYJUHOVPF-UHFFFAOYSA-N 0.000 description 6
- AAEIYCKYVQEKRI-UHFFFAOYSA-N (4-chlorophenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(Cl)C=C1 AAEIYCKYVQEKRI-UHFFFAOYSA-N 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- 125000003352 4-tert-butyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])*)C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 6
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 6
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- FSOYSMKPRYWSAC-UHFFFAOYSA-N [4-(trifluoromethyl)phenyl]methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(C(F)(F)F)C=C1 FSOYSMKPRYWSAC-UHFFFAOYSA-N 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- 150000001299 aldehydes Chemical class 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 239000003085 diluting agent Substances 0.000 description 6
- 150000002170 ethers Chemical class 0.000 description 6
- 239000011737 fluorine Substances 0.000 description 6
- 229910052731 fluorine Inorganic materials 0.000 description 6
- 239000012362 glacial acetic acid Substances 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- IXTVRWMFPAPNFB-UHFFFAOYSA-N (3,4,5-trimethoxyphenyl)methyl 3-oxobutanoate Chemical compound COC1=CC(COC(=O)CC(C)=O)=CC(OC)=C1OC IXTVRWMFPAPNFB-UHFFFAOYSA-N 0.000 description 5
- VAIHMTKIAQSRRR-UHFFFAOYSA-N (3-chlorophenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=CC(Cl)=C1 VAIHMTKIAQSRRR-UHFFFAOYSA-N 0.000 description 5
- JWPKOCDHGKWCAK-UHFFFAOYSA-N (4-fluorophenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(F)C=C1 JWPKOCDHGKWCAK-UHFFFAOYSA-N 0.000 description 5
- ZHEYQPLFNSOAJI-UHFFFAOYSA-N (4-tert-butylphenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(C(C)(C)C)C=C1 ZHEYQPLFNSOAJI-UHFFFAOYSA-N 0.000 description 5
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical class C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 description 5
- OWKVONYXJNKQRG-UHFFFAOYSA-N 2-phenoxyethyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCCOC1=CC=CC=C1 OWKVONYXJNKQRG-UHFFFAOYSA-N 0.000 description 5
- 125000005806 3,4,5-trimethoxybenzyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1C([H])([H])* 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- YCKAGGHNUHZKCL-XQRVVYSFSA-N propan-2-yl (z)-3-aminobut-2-enoate Chemical compound CC(C)OC(=O)\C=C(\C)N YCKAGGHNUHZKCL-XQRVVYSFSA-N 0.000 description 5
- KDHRQKPVXJRBIX-UHFFFAOYSA-N (4-methoxyphenyl)methyl 3-oxobutanoate Chemical compound COC1=CC=C(COC(=O)CC(C)=O)C=C1 KDHRQKPVXJRBIX-UHFFFAOYSA-N 0.000 description 4
- KQPGVCMZXFBYMM-UHFFFAOYSA-N (4-nitrophenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C([N+]([O-])=O)C=C1 KQPGVCMZXFBYMM-UHFFFAOYSA-N 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- 230000003276 anti-hypertensive effect Effects 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- KXKVLQRXCPHEJC-UHFFFAOYSA-N methyl acetate Chemical compound COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 230000002792 vascular Effects 0.000 description 4
- ZDVRPKUWYQVVDX-UHFFFAOYSA-N 2-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=CC=C1C=O ZDVRPKUWYQVVDX-UHFFFAOYSA-N 0.000 description 3
- QVTPWONEVZJCCS-UHFFFAOYSA-N 2-formylbenzonitrile Chemical compound O=CC1=CC=CC=C1C#N QVTPWONEVZJCCS-UHFFFAOYSA-N 0.000 description 3
- 239000001431 2-methylbenzaldehyde Substances 0.000 description 3
- QOMFXOOKFCCSND-UHFFFAOYSA-N 2-phenylethyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCCC1=CC=CC=C1 QOMFXOOKFCCSND-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 229940022663 acetate Drugs 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- UGZNCYLVFNJCGV-UHFFFAOYSA-N cyclopentyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OC1CCCC1 UGZNCYLVFNJCGV-UHFFFAOYSA-N 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- CJBFCOOECPQZDM-VOTSOKGWSA-N methyl (e)-5-(2-nitrophenyl)-3-oxopent-4-enoate Chemical compound COC(=O)CC(=O)\C=C\C1=CC=CC=C1[N+]([O-])=O CJBFCOOECPQZDM-VOTSOKGWSA-N 0.000 description 3
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- KEUJDDUMMLYJOZ-VURMDHGXSA-N (2-chlorophenyl)methyl (z)-3-aminobut-2-enoate Chemical compound C\C(N)=C\C(=O)OCC1=CC=CC=C1Cl KEUJDDUMMLYJOZ-VURMDHGXSA-N 0.000 description 2
- VBQLDIYVRFHBGQ-CLFYSBASSA-N (4-methoxyphenyl)methyl (z)-3-aminobut-2-enoate Chemical compound COC1=CC=C(COC(=O)\C=C(\C)N)C=C1 VBQLDIYVRFHBGQ-CLFYSBASSA-N 0.000 description 2
- XEXXORROSNTCDJ-UHFFFAOYSA-N 1-(4-chlorophenyl)ethyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OC(C)C1=CC=C(Cl)C=C1 XEXXORROSNTCDJ-UHFFFAOYSA-N 0.000 description 2
- GSBJXOIVIOYPOW-UHFFFAOYSA-N 1-phenylethyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OC(C)C1=CC=CC=C1 GSBJXOIVIOYPOW-UHFFFAOYSA-N 0.000 description 2
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 2
- PKZJLOCLABXVMC-UHFFFAOYSA-N 2-Methoxybenzaldehyde Chemical compound COC1=CC=CC=C1C=O PKZJLOCLABXVMC-UHFFFAOYSA-N 0.000 description 2
- ZYXNLVMBIHVDRH-UHFFFAOYSA-N 2-Methylpropyl 3-oxobutanoate Chemical compound CC(C)COC(=O)CC(C)=O ZYXNLVMBIHVDRH-UHFFFAOYSA-N 0.000 description 2
- FPYUJUBAXZAQNL-UHFFFAOYSA-N 2-chlorobenzaldehyde Chemical compound ClC1=CC=CC=C1C=O FPYUJUBAXZAQNL-UHFFFAOYSA-N 0.000 description 2
- XJOLYWNYMOPRKQ-WAYWQWQTSA-N 2-methoxyethyl (z)-3-aminobut-2-enoate Chemical compound COCCOC(=O)\C=C(\C)N XJOLYWNYMOPRKQ-WAYWQWQTSA-N 0.000 description 2
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- WMPDAIZRQDCGFH-UHFFFAOYSA-N 3-methoxybenzaldehyde Chemical compound COC1=CC=CC(C=O)=C1 WMPDAIZRQDCGFH-UHFFFAOYSA-N 0.000 description 2
- FHSUFDYFOHSYHI-UHFFFAOYSA-N 3-oxopentanoic acid Chemical compound CCC(=O)CC(O)=O FHSUFDYFOHSYHI-UHFFFAOYSA-N 0.000 description 2
- RGHHSNMVTDWUBI-UHFFFAOYSA-N 4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1 RGHHSNMVTDWUBI-UHFFFAOYSA-N 0.000 description 2
- ISDBWOPVZKNQDW-UHFFFAOYSA-N 4-phenylbenzaldehyde Chemical compound C1=CC(C=O)=CC=C1C1=CC=CC=C1 ISDBWOPVZKNQDW-UHFFFAOYSA-N 0.000 description 2
- 125000000173 4-trifluoromethoxy benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC(F)(F)F)C([H])([H])* 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- WFSKTDJCPNBESS-NTMALXAHSA-N benzyl (z)-3-(methylamino)but-2-enoate Chemical compound CN\C(C)=C/C(=O)OCC1=CC=CC=C1 WFSKTDJCPNBESS-NTMALXAHSA-N 0.000 description 2
- 229940007550 benzyl acetate Drugs 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- 125000006487 butyl benzyl group Chemical group 0.000 description 2
- 210000004351 coronary vessel Anatomy 0.000 description 2
- WTWBUQJHJGUZCY-UHFFFAOYSA-N cuminaldehyde Chemical compound CC(C)C1=CC=C(C=O)C=C1 WTWBUQJHJGUZCY-UHFFFAOYSA-N 0.000 description 2
- GJOSRMAVDXJBCZ-UHFFFAOYSA-N cyclohexyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OC1CCCCC1 GJOSRMAVDXJBCZ-UHFFFAOYSA-N 0.000 description 2
- GCFAUZGWPDYAJN-UHFFFAOYSA-N cyclohexyl 3-phenylprop-2-enoate Chemical compound C=1C=CC=CC=1C=CC(=O)OC1CCCCC1 GCFAUZGWPDYAJN-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- UDRCONFHWYGWFI-UHFFFAOYSA-N ethyl 3-oxopentanoate Chemical compound CCOC(=O)CC(=O)CC UDRCONFHWYGWFI-UHFFFAOYSA-N 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 125000006501 nitrophenyl group Chemical group 0.000 description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 2
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 2
- FXLOVSHXALFLKQ-UHFFFAOYSA-N p-tolualdehyde Chemical compound CC1=CC=C(C=O)C=C1 FXLOVSHXALFLKQ-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- QJZUKDFHGGYHMC-UHFFFAOYSA-N pyridine-3-carbaldehyde Chemical compound O=CC1=CC=CN=C1 QJZUKDFHGGYHMC-UHFFFAOYSA-N 0.000 description 2
- 239000011435 rock Substances 0.000 description 2
- 210000002460 smooth muscle Anatomy 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- SYNWGGLUYPWKNG-UHFFFAOYSA-N (3,4,5-trichlorophenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC(Cl)=C(Cl)C(Cl)=C1 SYNWGGLUYPWKNG-UHFFFAOYSA-N 0.000 description 1
- GDCVNZSYFVHTGP-UITAMQMPSA-N (3,4,5-trimethoxyphenyl)methyl (z)-3-aminobut-2-enoate Chemical compound COC1=CC(COC(=O)\C=C(\C)N)=CC(OC)=C1OC GDCVNZSYFVHTGP-UITAMQMPSA-N 0.000 description 1
- XKDMJVNOOFPXMX-UHFFFAOYSA-N (3-chloro-4-methoxyphenyl)methyl 3-oxobutanoate Chemical compound COC1=CC=C(COC(=O)CC(C)=O)C=C1Cl XKDMJVNOOFPXMX-UHFFFAOYSA-N 0.000 description 1
- HCIDZVMGBROSSS-UITAMQMPSA-N (3-chloro-4-methylphenyl)methyl (z)-3-aminobut-2-enoate Chemical compound C\C(N)=C\C(=O)OCC1=CC=C(C)C(Cl)=C1 HCIDZVMGBROSSS-UITAMQMPSA-N 0.000 description 1
- YXTKKIWFXLGENS-UHFFFAOYSA-N (3-chloro-4-methylphenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(C)C(Cl)=C1 YXTKKIWFXLGENS-UHFFFAOYSA-N 0.000 description 1
- JUIOIACBBBDMGZ-UHFFFAOYSA-N (3-chloro-4-sulfamoylphenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(S(N)(=O)=O)C(Cl)=C1 JUIOIACBBBDMGZ-UHFFFAOYSA-N 0.000 description 1
- YSGBDRCLWLVPNL-UHFFFAOYSA-N (3-methoxyphenyl)methyl 3-oxobutanoate Chemical compound COC1=CC=CC(COC(=O)CC(C)=O)=C1 YSGBDRCLWLVPNL-UHFFFAOYSA-N 0.000 description 1
- MQOWLBLEQCJHED-UHFFFAOYSA-N (3-methylphenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=CC(C)=C1 MQOWLBLEQCJHED-UHFFFAOYSA-N 0.000 description 1
- UHXAJKAFTOQDFI-UHFFFAOYSA-N (4-aminophenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(N)C=C1 UHXAJKAFTOQDFI-UHFFFAOYSA-N 0.000 description 1
- VRPCQUFOHMYIGR-UHFFFAOYSA-N (4-bromo-3-chlorophenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(Br)C(Cl)=C1 VRPCQUFOHMYIGR-UHFFFAOYSA-N 0.000 description 1
- UATQVDRRYOOZMY-UHFFFAOYSA-N (4-bromophenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(Br)C=C1 UATQVDRRYOOZMY-UHFFFAOYSA-N 0.000 description 1
- DLRHNYXXYODHHP-UHFFFAOYSA-N (4-butoxyphenyl)methyl 3-oxobutanoate Chemical compound CCCCOC1=CC=C(COC(=O)CC(C)=O)C=C1 DLRHNYXXYODHHP-UHFFFAOYSA-N 0.000 description 1
- JGQTVYFZNZWAFX-UHFFFAOYSA-N (4-carbamoylphenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(C(N)=O)C=C1 JGQTVYFZNZWAFX-UHFFFAOYSA-N 0.000 description 1
- OOCADVIIRMYREE-UHFFFAOYSA-N (4-cyanophenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(C#N)C=C1 OOCADVIIRMYREE-UHFFFAOYSA-N 0.000 description 1
- RBYNXSAFOSBQTH-VURMDHGXSA-N (4-fluorophenyl)methyl (z)-3-aminobut-2-enoate Chemical compound C\C(N)=C\C(=O)OCC1=CC=C(F)C=C1 RBYNXSAFOSBQTH-VURMDHGXSA-N 0.000 description 1
- GXHHLAFHJDPBDD-UHFFFAOYSA-N (4-hydroxyphenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(O)C=C1 GXHHLAFHJDPBDD-UHFFFAOYSA-N 0.000 description 1
- KRSRWTKKEBSRGE-UHFFFAOYSA-N (4-methylsulfanylphenyl)methyl 3-oxobutanoate Chemical compound CSC1=CC=C(COC(=O)CC(C)=O)C=C1 KRSRWTKKEBSRGE-UHFFFAOYSA-N 0.000 description 1
- WJURQDOIIDZPRS-UHFFFAOYSA-N (4-methylsulfinylphenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(S(C)=O)C=C1 WJURQDOIIDZPRS-UHFFFAOYSA-N 0.000 description 1
- ZEYUGZDAMVLOMN-UHFFFAOYSA-N (4-methylsulfonylphenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(S(C)(=O)=O)C=C1 ZEYUGZDAMVLOMN-UHFFFAOYSA-N 0.000 description 1
- VYGMIONXHGKIJF-VURMDHGXSA-N (4-nitrophenyl)methyl (z)-3-aminobut-2-enoate Chemical compound C\C(N)=C\C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 VYGMIONXHGKIJF-VURMDHGXSA-N 0.000 description 1
- MUGIXZYKJBYPKZ-UHFFFAOYSA-N (4-propan-2-ylphenyl)methyl 3-oxobutanoate Chemical compound CC(C)C1=CC=C(COC(=O)CC(C)=O)C=C1 MUGIXZYKJBYPKZ-UHFFFAOYSA-N 0.000 description 1
- JQJQKHLGKIOAEB-UHFFFAOYSA-N (4-sulfamoylphenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(S(N)(=O)=O)C=C1 JQJQKHLGKIOAEB-UHFFFAOYSA-N 0.000 description 1
- LUYYHRGIQUPPMQ-UHFFFAOYSA-N 2,6-dimethyl-4-(2-methylsulfinylphenyl)-1,4-dihydropyridine Chemical compound CC=1NC(=CC(C1)C1=C(C=CC=C1)S(=O)C)C LUYYHRGIQUPPMQ-UHFFFAOYSA-N 0.000 description 1
- FEOAIYBLDKAOFS-UHFFFAOYSA-N 2,6-dimethyl-4-phenyl-1,4-dihydropyridine Chemical compound C1=C(C)NC(C)=CC1C1=CC=CC=C1 FEOAIYBLDKAOFS-UHFFFAOYSA-N 0.000 description 1
- YCWRFIYBUQBHJI-UHFFFAOYSA-N 2-(4-aminophenyl)acetonitrile Chemical group NC1=CC=C(CC#N)C=C1 YCWRFIYBUQBHJI-UHFFFAOYSA-N 0.000 description 1
- DGPBVJWCIDNDPN-UHFFFAOYSA-N 2-(dimethylamino)benzaldehyde Chemical compound CN(C)C1=CC=CC=C1C=O DGPBVJWCIDNDPN-UHFFFAOYSA-N 0.000 description 1
- CPHXLFKIUVVIOQ-UHFFFAOYSA-N 2-(trifluoromethoxy)benzaldehyde Chemical compound FC(F)(F)OC1=CC=CC=C1C=O CPHXLFKIUVVIOQ-UHFFFAOYSA-N 0.000 description 1
- IIBAAYFFTSJSFH-UHFFFAOYSA-N 2-butylbenzaldehyde Chemical compound CCCCC1=CC=CC=C1C=O IIBAAYFFTSJSFH-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- ZVDXHSUCDWVQEY-UHFFFAOYSA-N 2-cyclopropylbenzaldehyde Chemical compound O=CC1=CC=CC=C1C1CC1 ZVDXHSUCDWVQEY-UHFFFAOYSA-N 0.000 description 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- DHEJIZSVHGOKMJ-UHFFFAOYSA-N 2-ethenylbenzaldehyde Chemical compound C=CC1=CC=CC=C1C=O DHEJIZSVHGOKMJ-UHFFFAOYSA-N 0.000 description 1
- ZEDSAJWVTKUHHK-UHFFFAOYSA-N 2-ethynylbenzaldehyde Chemical compound O=CC1=CC=CC=C1C#C ZEDSAJWVTKUHHK-UHFFFAOYSA-N 0.000 description 1
- ZWDVQMVZZYIAHO-UHFFFAOYSA-N 2-fluorobenzaldehyde Chemical compound FC1=CC=CC=C1C=O ZWDVQMVZZYIAHO-UHFFFAOYSA-N 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- XIOBUABQJIVPCQ-UHFFFAOYSA-N 2-methylsulfanylbenzaldehyde Chemical compound CSC1=CC=CC=C1C=O XIOBUABQJIVPCQ-UHFFFAOYSA-N 0.000 description 1
- YLYIZDJUFXCITF-KTKRTIGZSA-N 2-phenoxyethyl (z)-3-aminobut-2-enoate Chemical compound C\C(N)=C\C(=O)OCCOC1=CC=CC=C1 YLYIZDJUFXCITF-KTKRTIGZSA-N 0.000 description 1
- DTALCVXXATYTQJ-UHFFFAOYSA-N 2-propan-2-ylbenzaldehyde Chemical compound CC(C)C1=CC=CC=C1C=O DTALCVXXATYTQJ-UHFFFAOYSA-N 0.000 description 1
- KQWHHDCWLCCRLQ-UHFFFAOYSA-N 3,4-dimethoxybenzyl acetate Chemical compound COC1=CC=C(COC(C)=O)C=C1OC KQWHHDCWLCCRLQ-UHFFFAOYSA-N 0.000 description 1
- NHYJRLYFKZYPMO-UHFFFAOYSA-N 3-(3,4-dichlorophenyl)propanoic acid Chemical compound OC(=O)CCC1=CC=C(Cl)C(Cl)=C1 NHYJRLYFKZYPMO-UHFFFAOYSA-N 0.000 description 1
- WUJQTKBVPNTQLU-UHFFFAOYSA-N 3-(dimethylamino)benzaldehyde Chemical compound CN(C)C1=CC=CC(C=O)=C1 WUJQTKBVPNTQLU-UHFFFAOYSA-N 0.000 description 1
- FQEVHRCPXFKJHF-UHFFFAOYSA-N 3-(trifluoromethoxy)benzaldehyde Chemical compound FC(F)(F)OC1=CC=CC(C=O)=C1 FQEVHRCPXFKJHF-UHFFFAOYSA-N 0.000 description 1
- NMTUHPSKJJYGML-UHFFFAOYSA-N 3-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=CC(C=O)=C1 NMTUHPSKJJYGML-UHFFFAOYSA-N 0.000 description 1
- UCJDGRYGBYCWMS-UHFFFAOYSA-N 3-azidobenzaldehyde Chemical compound [N-]=[N+]=NC1=CC=CC(C=O)=C1 UCJDGRYGBYCWMS-UHFFFAOYSA-N 0.000 description 1
- HGZJJKZPPMFIBU-UHFFFAOYSA-N 3-formylbenzonitrile Chemical compound O=CC1=CC=CC(C#N)=C1 HGZJJKZPPMFIBU-UHFFFAOYSA-N 0.000 description 1
- 125000006497 3-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- XNBZFDAETMEUHW-UHFFFAOYSA-N 3-o-[(2-chlorophenyl)methyl] 5-o-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CC(C)OC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C(=CC=CC=2)Cl)C1C1=CC=CC([N+]([O-])=O)=C1 XNBZFDAETMEUHW-UHFFFAOYSA-N 0.000 description 1
- UFEFVJKRKPFTGX-UHFFFAOYSA-N 3-o-[(3,4-dimethoxyphenyl)methyl] 5-o-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound C1=C(OC)C(OC)=CC=C1COC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)C)C1C1=CC=CC([N+]([O-])=O)=C1 UFEFVJKRKPFTGX-UHFFFAOYSA-N 0.000 description 1
- YXYDBRQYOFBJQF-UHFFFAOYSA-N 3-o-[(3-chlorophenyl)methyl] 5-o-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CC(C)OC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=C(Cl)C=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 YXYDBRQYOFBJQF-UHFFFAOYSA-N 0.000 description 1
- NGGMMCZLPUXDMA-UHFFFAOYSA-N 3-o-[(4-chlorophenyl)methyl] 5-o-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CC(C)OC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC(Cl)=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 NGGMMCZLPUXDMA-UHFFFAOYSA-N 0.000 description 1
- QOOSQNQQQLHMEX-UHFFFAOYSA-N 3-o-[(4-methylphenyl)methyl] 5-o-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CC(C)OC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC(C)=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 QOOSQNQQQLHMEX-UHFFFAOYSA-N 0.000 description 1
- FKJAZKVKERVMLO-UHFFFAOYSA-N 3-o-benzyl 5-o-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CC(C)OC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 FKJAZKVKERVMLO-UHFFFAOYSA-N 0.000 description 1
- FBHYWYVNVKCGGG-UHFFFAOYSA-N 3-o-methyl 5-o-[(4-methylphenyl)methyl] 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC(C)=CC=2)C1C1=CC=CC=C1[N+]([O-])=O FBHYWYVNVKCGGG-UHFFFAOYSA-N 0.000 description 1
- KSSFGJUSMXZBDD-UHFFFAOYSA-N 3-oxo-4-pentenoic acid Chemical compound OC(=O)CC(=O)C=C KSSFGJUSMXZBDD-UHFFFAOYSA-N 0.000 description 1
- VNMMLNVSLPRZDK-UHFFFAOYSA-N 3-oxo-5-phenylpent-4-enoic acid Chemical compound OC(=O)CC(=O)C=CC1=CC=CC=C1 VNMMLNVSLPRZDK-UHFFFAOYSA-N 0.000 description 1
- QPRCQXDTUKRNDC-UHFFFAOYSA-N 3-oxo-5-sulfonylpentanoic acid Chemical compound OC(=O)CC(=O)CC=S(=O)=O QPRCQXDTUKRNDC-UHFFFAOYSA-N 0.000 description 1
- FFQXEFNKZVGJDI-UHFFFAOYSA-N 3-propan-2-ylbenzaldehyde Chemical compound CC(C)C1=CC=CC(C=O)=C1 FFQXEFNKZVGJDI-UHFFFAOYSA-N 0.000 description 1
- KWXVVLHKADHVRM-UHFFFAOYSA-N 3-sulfanylbenzaldehyde Chemical compound SC1=CC=CC(C=O)=C1 KWXVVLHKADHVRM-UHFFFAOYSA-N 0.000 description 1
- 125000006495 3-trifluoromethyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])*)C(F)(F)F 0.000 description 1
- BGNGWHSBYQYVRX-UHFFFAOYSA-N 4-(dimethylamino)benzaldehyde Chemical compound CN(C)C1=CC=C(C=O)C=C1 BGNGWHSBYQYVRX-UHFFFAOYSA-N 0.000 description 1
- XQNVDQZWOBPLQZ-UHFFFAOYSA-N 4-(trifluoromethoxy)benzaldehyde Chemical compound FC(F)(F)OC1=CC=C(C=O)C=C1 XQNVDQZWOBPLQZ-UHFFFAOYSA-N 0.000 description 1
- BEOBZEOPTQQELP-UHFFFAOYSA-N 4-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=C(C=O)C=C1 BEOBZEOPTQQELP-UHFFFAOYSA-N 0.000 description 1
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 description 1
- ARIREUPIXAKDAY-UHFFFAOYSA-N 4-butylbenzaldehyde Chemical compound CCCCC1=CC=C(C=O)C=C1 ARIREUPIXAKDAY-UHFFFAOYSA-N 0.000 description 1
- WZWIQYMTQZCSKI-UHFFFAOYSA-N 4-cyanobenzaldehyde Chemical compound O=CC1=CC=C(C#N)C=C1 WZWIQYMTQZCSKI-UHFFFAOYSA-N 0.000 description 1
- CZUQVKFJAJAHGK-UHFFFAOYSA-N 4-cyclopropylbenzaldehyde Chemical compound C1=CC(C=O)=CC=C1C1CC1 CZUQVKFJAJAHGK-UHFFFAOYSA-N 0.000 description 1
- QRVYABWJVXXOTN-UHFFFAOYSA-N 4-methylsulfanylbenzaldehyde Chemical compound CSC1=CC=C(C=O)C=C1 QRVYABWJVXXOTN-UHFFFAOYSA-N 0.000 description 1
- BXRFQSNOROATLV-UHFFFAOYSA-N 4-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(C=O)C=C1 BXRFQSNOROATLV-UHFFFAOYSA-N 0.000 description 1
- PEIUWQZBAJOFIT-UHFFFAOYSA-N 5-o-[(3,4-dichlorophenyl)methyl] 3-o-methyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=C(Cl)C(Cl)=CC=2)C1C1=CC=CC=C1[N+]([O-])=O PEIUWQZBAJOFIT-UHFFFAOYSA-N 0.000 description 1
- XZXXOBGBMDWDFS-UHFFFAOYSA-N 5-o-[(3-chloro-4-methylphenyl)methyl] 3-o-methyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=C(Cl)C(C)=CC=2)C1C1=CC=CC=C1[N+]([O-])=O XZXXOBGBMDWDFS-UHFFFAOYSA-N 0.000 description 1
- NLPFUYUSPBZVDK-UHFFFAOYSA-N 5-o-[(4-chlorophenyl)methyl] 3-o-methyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC(Cl)=CC=2)C1C1=CC=CC=C1[N+]([O-])=O NLPFUYUSPBZVDK-UHFFFAOYSA-N 0.000 description 1
- CXAFBNDQDRSMSN-UHFFFAOYSA-N 5-o-[(4-chlorophenyl)methyl] 3-o-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC(Cl)=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 CXAFBNDQDRSMSN-UHFFFAOYSA-N 0.000 description 1
- FMODZYUNVIXMHG-UHFFFAOYSA-N 5-o-[(4-methoxyphenyl)methyl] 3-o-methyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC(OC)=CC=2)C1C1=CC=CC=C1[N+]([O-])=O FMODZYUNVIXMHG-UHFFFAOYSA-N 0.000 description 1
- DFCMHZMOHTZEBA-UHFFFAOYSA-N 5-o-[1-(4-chlorophenyl)ethyl] 3-o-(2-methoxyethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COCCOC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)C=2C=CC(Cl)=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 DFCMHZMOHTZEBA-UHFFFAOYSA-N 0.000 description 1
- IQGRGQXQSPSWNI-UHFFFAOYSA-N 5-o-benzyl 3-o-(2-methoxyethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COCCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 IQGRGQXQSPSWNI-UHFFFAOYSA-N 0.000 description 1
- XBIMVOAFFBILAE-UHFFFAOYSA-N 5-o-benzyl 3-o-methyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC=CC=2)C1C1=CC=CC=C1[N+]([O-])=O XBIMVOAFFBILAE-UHFFFAOYSA-N 0.000 description 1
- OOKUSDZYOMYKEJ-UHFFFAOYSA-N 6-phenylhex-5-ene-2,4-dione Chemical compound CC(=O)CC(=O)C=CC1=CC=CC=C1 OOKUSDZYOMYKEJ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 206010001497 Agitation Diseases 0.000 description 1
- 240000002470 Amphicarpaea bracteata Species 0.000 description 1
- REIYHFWZISXFKU-UHFFFAOYSA-N Butyl acetoacetate Chemical compound CCCCOC(=O)CC(C)=O REIYHFWZISXFKU-UHFFFAOYSA-N 0.000 description 1
- HTGWEPAGAUMUDB-UHFFFAOYSA-N C1C=CC=CC1(C=CC(=O)CC(=O)O)[N+](=O)[O-] Chemical compound C1C=CC=CC1(C=CC(=O)CC(=O)O)[N+](=O)[O-] HTGWEPAGAUMUDB-UHFFFAOYSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- DAMNPIJTOHITGJ-UHFFFAOYSA-N OC(CC(C=CC1=NC=CC=C1)=O)=O Chemical compound OC(CC(C=CC1=NC=CC=C1)=O)=O DAMNPIJTOHITGJ-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- JVVXZOOGOGPDRZ-SLFFLAALSA-N [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine Chemical compound NC[C@]1(C)CCC[C@]2(C)C3=CC=C(C(C)C)C=C3CC[C@H]21 JVVXZOOGOGPDRZ-SLFFLAALSA-N 0.000 description 1
- KCSLFZAJYGVRTO-UHFFFAOYSA-N [3-chloro-4-(trifluoromethyl)phenyl]methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(C(F)(F)F)C(Cl)=C1 KCSLFZAJYGVRTO-UHFFFAOYSA-N 0.000 description 1
- CHFXRFBEXQGCRX-UHFFFAOYSA-N [4-(butylamino)phenyl]methyl 3-oxobutanoate Chemical compound CCCCNC1=CC=C(COC(=O)CC(C)=O)C=C1 CHFXRFBEXQGCRX-UHFFFAOYSA-N 0.000 description 1
- GOSGJGOFPYHWKH-UHFFFAOYSA-N [4-(dimethylamino)phenyl]methyl 3-oxobutanoate Chemical compound CN(C)C1=CC=C(COC(=O)CC(C)=O)C=C1 GOSGJGOFPYHWKH-UHFFFAOYSA-N 0.000 description 1
- SOLDAWJOSVDELS-UHFFFAOYSA-N [4-(trifluoromethoxy)phenyl]methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(OC(F)(F)F)C=C1 SOLDAWJOSVDELS-UHFFFAOYSA-N 0.000 description 1
- YBCVMFKXIKNREZ-UHFFFAOYSA-N acoh acetic acid Chemical compound CC(O)=O.CC(O)=O YBCVMFKXIKNREZ-UHFFFAOYSA-N 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000003440 anti-fibrillation Effects 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 229940127088 antihypertensive drug Drugs 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- VCIWVYCTNYDCKY-UHFFFAOYSA-N benzyl 3-oxo-5-pyridin-2-ylpent-4-enoate Chemical compound C=1C=CC=CC=1COC(=O)CC(=O)C=CC1=CC=CC=N1 VCIWVYCTNYDCKY-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- SCFWSXWPGYNVRS-SREVYHEPSA-N cyclopentyl (z)-3-aminobut-2-enoate Chemical compound C\C(N)=C\C(=O)OC1CCCC1 SCFWSXWPGYNVRS-SREVYHEPSA-N 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- XZYGRRSTJVFZLS-UHFFFAOYSA-N ethyl 3-formylbenzoate Chemical compound CCOC(=O)C1=CC=CC(C=O)=C1 XZYGRRSTJVFZLS-UHFFFAOYSA-N 0.000 description 1
- SYFFHRPDTQNMQB-UHFFFAOYSA-N ethyl 3-oxopropanoate Chemical compound CCOC(=O)CC=O SYFFHRPDTQNMQB-UHFFFAOYSA-N 0.000 description 1
- IDSHKFRLCORRHY-UHFFFAOYSA-N ethyl 4-bromo-3-oxo-5-phenylpent-4-enoate Chemical compound C(C)OC(CC(=O)C(=CC1=CC=CC=C1)Br)=O IDSHKFRLCORRHY-UHFFFAOYSA-N 0.000 description 1
- XCLDSQRVMMXWMS-UHFFFAOYSA-N ethyl 4-methyl-3-oxopentanoate Chemical compound CCOC(=O)CC(=O)C(C)C XCLDSQRVMMXWMS-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000001631 hypertensive effect Effects 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 229940011051 isopropyl acetate Drugs 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- OVWYEQOVUDKZNU-UHFFFAOYSA-N m-tolualdehyde Chemical compound CC1=CC=CC(C=O)=C1 OVWYEQOVUDKZNU-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- QAKYFFYZPIPLDN-PLNGDYQASA-N methyl (z)-3-(methylamino)but-2-enoate Chemical compound CN\C(C)=C/C(=O)OC QAKYFFYZPIPLDN-PLNGDYQASA-N 0.000 description 1
- FCRJJPWNWLNCPA-UHFFFAOYSA-N methyl 3-oxo-5-phenylpent-4-enoate Chemical compound COC(=O)CC(=O)C=CC1=CC=CC=C1 FCRJJPWNWLNCPA-UHFFFAOYSA-N 0.000 description 1
- SJPCQNABHNCLPB-UHFFFAOYSA-N methyl 3-oxohexanoate Chemical compound CCCC(=O)CC(=O)OC SJPCQNABHNCLPB-UHFFFAOYSA-N 0.000 description 1
- XJMIXEAZMCTAGH-UHFFFAOYSA-N methyl 3-oxopentanoate Chemical compound CCC(=O)CC(=O)OC XJMIXEAZMCTAGH-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- BTFQKIATRPGRBS-UHFFFAOYSA-N o-tolualdehyde Chemical compound CC1=CC=CC=C1C=O BTFQKIATRPGRBS-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 125000006505 p-cyanobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C#N)C([H])([H])* 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- AXLMPTNTPOWPLT-UHFFFAOYSA-N prop-2-enyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC=C AXLMPTNTPOWPLT-UHFFFAOYSA-N 0.000 description 1
- 125000003186 propargylic group Chemical group 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UORVCLMRJXCDCP-UHFFFAOYSA-N propynoic acid Chemical compound OC(=O)C#C UORVCLMRJXCDCP-UHFFFAOYSA-N 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 210000002345 respiratory system Anatomy 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 239000011973 solid acid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 230000002048 spasmolytic effect Effects 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- KUCOHFSKRZZVRO-UHFFFAOYSA-N terephthalaldehyde Chemical compound O=CC1=CC=C(C=O)C=C1 KUCOHFSKRZZVRO-UHFFFAOYSA-N 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/08—Vasodilators for multiple indications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Cardiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- Heart & Thoracic Surgery (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (28)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752508181 DE2508181A1 (de) | 1975-02-26 | 1975-02-26 | 1,4-dihydropyridincarbonsaeurearal- kylester, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| GB4376375A GB1477114A (en) | 1975-02-26 | 1975-10-24 | 1,4-dihydropyridinecarboxylic acid aralkyl esters processes for their preparation and their use as medicaments |
| IN163/CAL/76A IN142197B (OSRAM) | 1975-02-26 | 1976-01-29 | |
| US05/654,278 US4044141A (en) | 1975-02-26 | 1976-02-02 | 1,4-Dihydropyridines |
| CA245,000A CA1069902A (en) | 1975-02-26 | 1976-02-04 | 1,4-dihydropyridines |
| NO76760470A NO146393C (no) | 1975-02-26 | 1976-02-13 | Analogifremgangsmaate til fremstilling av 1,4-dihydropyridin-karboksylsyrearalkylestere med virkning paa kretsloepet |
| JP51017182A JPS6025424B2 (ja) | 1975-02-26 | 1976-02-20 | 1,4‐ジヒドロピリジンカルボン酸アラルキルエステル |
| SU7602324514A SU574150A3 (ru) | 1975-02-26 | 1976-02-20 | Способ получени аралкиловых эфиров 1,4-дигидропиридинкарбоновой кислоты |
| CH214876A CH622506A5 (OSRAM) | 1975-02-26 | 1976-02-20 | |
| CS761175A CS188994B2 (en) | 1975-02-26 | 1976-02-23 | Process for preparing alkylesters of 1,4-dihydro-pyridincarboxylic acids |
| NL7601823A NL7601823A (nl) | 1975-02-26 | 1976-02-23 | Werkwijze voor het bereiden van 1.4-dihydropyri- dinecarbonzuuraralkylesters, alsmede de toepassing daarvan als geneesmiddelen. |
| AT132976A AT351024B (de) | 1975-02-26 | 1976-02-24 | Verfahren zur herstellung von neuen 1,4- dihydropyridincarbonsaeurearalkylestern |
| FI760475A FI61483C (fi) | 1975-02-26 | 1976-02-24 | Foerfarande foer framstaellning av terapeutiskt anvaendbara 1,-dihydropyridinkarboxylsyraaralkylestrar |
| IL7649095A IL49095A (en) | 1975-02-26 | 1976-02-24 | 1,4dihydropyridine-3,5-di-carboxylic acid aralkyl esters their preparation and pharmaceutical compositions containing them |
| LU74424A LU74424A1 (OSRAM) | 1975-02-26 | 1976-02-24 | |
| DD191458A DD125483A5 (OSRAM) | 1975-02-26 | 1976-02-24 | |
| PT64840A PT64840B (fr) | 1975-02-26 | 1976-02-24 | Procede de preparation d'esteres aralquiliques d'acide 1,4-dihydrapiridinocarboxilique a effet coronaire et antihypertensive application des memes pour la preparation de compositions pharmaceutiques a effet coronaire et antihypertensive et application de ces compositions pharmaceutiques pour le traitement de maladies de lacirculation sanguine |
| IE369/76A IE42643B1 (en) | 1975-02-26 | 1976-02-25 | 1,4-dihydropyridinecarboxylic acid aralkyl esters, processes for their preparation and their use as medicaments |
| BE164628A BE838924A (fr) | 1975-02-26 | 1976-02-25 | Nouveaux esters alkyliques d'acides 1,4-dihydropyridine-carboxyliques, leur procede de preparation et medicament les contenant |
| DK78876*#A DK78876A (da) | 1975-02-26 | 1976-02-25 | 1,4-dihydropyridincarboxylsyrearalkylestere, fremgangsmade til deres fremstilling samt deres anvendelse som legemidler |
| ES445508A ES445508A1 (es) | 1975-02-26 | 1976-02-25 | Procedimiento para la obtencion de 1,4-dihidropiridincarbo- xilatos de aralquilo. |
| PL1976187499A PL100906B1 (pl) | 1975-02-26 | 1976-02-25 | Sposob wytwarzania nowych estrow aralkilowych kwasu 1,4-dwuwodoropirydynokarboksylowego |
| RO7684916A RO68479A (ro) | 1975-02-26 | 1976-02-25 | Procedeu pentru prepararea unor 1,4-dihidropiridincarboxilati de aralchil |
| HU76BA00003374A HU171717B (hu) | 1975-02-26 | 1976-02-25 | Sposob poluchenija slozhnykh alkil'nykh ehfirov 1,4-digidropiridin-karbonovoj kisloty i lechebnykh preparatov soderzhahhikh takie soedinenija |
| SE7602317A SE7602317L (sv) | 1975-02-26 | 1976-02-25 | 1,4-dihydropyridinkarbonsyraalkylestrar till anvendning som lekemedel och sett att framstella desamma |
| ZA761118A ZA761118B (en) | 1975-02-26 | 1976-02-25 | 1,4-dihydropyridine-carboxylic acid aralkyl esters,processes for their preparations and their use as medicaments |
| FR7605383A FR2302093A1 (fr) | 1975-02-26 | 1976-02-26 | Nouveaux esters alkyliques |
| AU11438/76A AU493288B2 (en) | 1975-02-26 | 1976-02-26 | 1,4-dihydropyidine carboxylic acid aralkyl esters, processes for their preparation and their use as medicaments |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752508181 DE2508181A1 (de) | 1975-02-26 | 1975-02-26 | 1,4-dihydropyridincarbonsaeurearal- kylester, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2508181A1 true DE2508181A1 (de) | 1976-09-09 |
| DE2508181C2 DE2508181C2 (OSRAM) | 1988-12-01 |
Family
ID=5939797
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752508181 Granted DE2508181A1 (de) | 1975-02-26 | 1975-02-26 | 1,4-dihydropyridincarbonsaeurearal- kylester, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
Country Status (27)
| Country | Link |
|---|---|
| US (1) | US4044141A (OSRAM) |
| JP (1) | JPS6025424B2 (OSRAM) |
| AT (1) | AT351024B (OSRAM) |
| BE (1) | BE838924A (OSRAM) |
| CA (1) | CA1069902A (OSRAM) |
| CH (1) | CH622506A5 (OSRAM) |
| CS (1) | CS188994B2 (OSRAM) |
| DD (1) | DD125483A5 (OSRAM) |
| DE (1) | DE2508181A1 (OSRAM) |
| DK (1) | DK78876A (OSRAM) |
| ES (1) | ES445508A1 (OSRAM) |
| FI (1) | FI61483C (OSRAM) |
| FR (1) | FR2302093A1 (OSRAM) |
| GB (1) | GB1477114A (OSRAM) |
| HU (1) | HU171717B (OSRAM) |
| IE (1) | IE42643B1 (OSRAM) |
| IL (1) | IL49095A (OSRAM) |
| IN (1) | IN142197B (OSRAM) |
| LU (1) | LU74424A1 (OSRAM) |
| NL (1) | NL7601823A (OSRAM) |
| NO (1) | NO146393C (OSRAM) |
| PL (1) | PL100906B1 (OSRAM) |
| PT (1) | PT64840B (OSRAM) |
| RO (1) | RO68479A (OSRAM) |
| SE (1) | SE7602317L (OSRAM) |
| SU (1) | SU574150A3 (OSRAM) |
| ZA (1) | ZA761118B (OSRAM) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0001769A1 (de) * | 1977-10-22 | 1979-05-16 | Bayer Ag | 1,4-Dihydropyridincarbonsäureester mit schwefelhaltigen Estergruppen, ihre Herstellung und ihre Verwendung als Arzneimittel |
| EP0012180A1 (de) * | 1978-10-31 | 1980-06-25 | Bayer Ag | Neue 1,4-Dihydropyridinverbindungen, Verfahren zu ihrer Herstellung, die genannten Verbindungen enthaltende Arzneimittel und Verfahren zur Herstellung dieser Arzneimittel |
| EP0167068A3 (en) * | 1984-07-03 | 1988-08-10 | Bayer Ag | Isopropyl-2û2-(3-trifluoromethylphenoxy)ethyl¨ester of 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-pyridine-3,5-dicarboxylic acid, process for its preparation, and its use as a medicine |
| EP0244595A3 (de) * | 1986-03-12 | 1988-09-14 | Byk Gulden Lomberg Chemische Fabrik GmbH | Dihydropyridinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
| EP0657431A1 (de) * | 1993-12-10 | 1995-06-14 | Bayer Ag | 4-Phenyl-3-substituierte 1,4-Dihydropyridinester mit cerebraler Aktivität |
| WO1997025313A1 (en) * | 1996-01-10 | 1997-07-17 | Astra Aktiebolag | New manufacturing process |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2837477A1 (de) * | 1978-08-28 | 1980-03-13 | Bayer Ag | Sila-substituierte 1,4-dihydropyridin- derivate |
| DE2841667A1 (de) * | 1978-09-25 | 1980-04-10 | Bayer Ag | Fluorhaltige 1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2935451A1 (de) * | 1979-09-01 | 1981-03-19 | Bayer Ag, 5090 Leverkusen | Optisch aktive 1,4-dihydropyridine, verfahren zu ihrer herstellung und ihre verwendung als arneimittel |
| BE886259A (fr) * | 1979-11-23 | 1981-05-20 | Sandoz Sa | Nouveaux medicament a base de derives de la 1,4-dihydropyridine, pour le traitement de l'insuffisance cerebrovasculaire ou a action spamolytique |
| DE3018259A1 (de) * | 1980-05-13 | 1981-11-19 | Bayer Ag, 5090 Leverkusen | 1,4-dihydropyridine mit unterschiedlichen substituenten in 2- und 6-position, verfahren zu ihrer herstellung und ihre verwendung in arzneimitteln |
| JPS57171968A (en) * | 1981-04-17 | 1982-10-22 | Kyowa Hakko Kogyo Co Ltd | 1,4-dihydropyridine derivative |
| JPS57200364A (en) * | 1981-06-04 | 1982-12-08 | Yoshitomi Pharmaceut Ind Ltd | 1,4-dihydropyridine-3,5-dicarboxylic ester derivative and its salt |
| CH655110A5 (de) * | 1982-09-03 | 1986-03-27 | Otsuka Pharma Co Ltd | Carbostyrilderivate, verfahren zu deren herstellung und arzneimittel, welche diese enthalten. |
| US4656181A (en) * | 1982-11-24 | 1987-04-07 | Cermol S.A. | Esters of 1,4-dihydropyridines, processes for the preparation of the new esters, and medicaments containing the same |
| US5137889A (en) * | 1983-12-02 | 1992-08-11 | Otsuka Pharmaceutical Co., Ltd. | Dihydropyridine derivatives and process for preparing the same |
| JPS60120861A (ja) * | 1983-12-02 | 1985-06-28 | Otsuka Pharmaceut Co Ltd | ジヒドロピリジン誘導体 |
| JPS60248693A (ja) * | 1984-04-19 | 1985-12-09 | Nippon Shinyaku Co Ltd | ピリジン誘導体及び製法 |
| US4672068A (en) * | 1984-05-04 | 1987-06-09 | Fujirebio Kabushiki Kaisha | Antihypertensive 1,4-dihydropyridines having a conjugated ester |
| JPS6143165A (ja) * | 1984-08-07 | 1986-03-01 | Otsuka Pharmaceut Co Ltd | ジヒドロピリジン誘導体の製造法 |
| US4994476A (en) * | 1984-10-31 | 1991-02-19 | Bristol-Myers Company | Dihydropyridin-3,5-dicarboxylates incorporating aryloxypropanolamine moieties |
| US4757071A (en) * | 1984-12-14 | 1988-07-12 | Nisshin Flour Milling Co., Ltd. | 1,4-dihydropyridine derivatives, and pharmaceutical compositions containing same, useful for treating cardiovascular diseases |
| US4595690A (en) * | 1985-02-11 | 1986-06-17 | Syntex (U.S.A.) Inc. | Antihypertensive dihydropyridine derivatives |
| IL77843A (en) * | 1985-02-11 | 1989-07-31 | Syntex Inc | Dihydropyridine derivatives,process and novel intermediates for their preparation and pharmaceutical compositions containing them |
| US4593033A (en) * | 1985-04-24 | 1986-06-03 | Merck & Co., Inc. | Substituted indeno[2,1-c] pyridines useful as calcium channel blockers |
| US4605660A (en) * | 1985-06-03 | 1986-08-12 | Merck & Co., Inc. | Indeno[2,1-c]pyridine compounds, and their use as calcium channel blockers |
| US4670443A (en) * | 1985-07-02 | 1987-06-02 | Merck & Co., Inc. | Benzo(f)isoquinoline compounds useful as calcium entry blockers |
| US4721708A (en) * | 1985-11-26 | 1988-01-26 | Merck & Co., Inc. | Cyclized N-substituted-tetrahydropyridine compounds and cardiovascular use |
| US4788203A (en) * | 1985-11-26 | 1988-11-29 | Merck & Co., Inc. | Cyclized N-substituted-tetrahydropyridine compounds, useful in the treatment of cardiovascular disorders |
| DE3601196A1 (de) * | 1986-01-17 | 1987-07-23 | Merck Patent Gmbh | 1,4-dihydropyridine |
| US4761420A (en) * | 1986-06-13 | 1988-08-02 | Laboratoires Syntex S.A. | Antihypertensive dihydropyridine derivatives |
| JPH0688973B2 (ja) * | 1987-03-12 | 1994-11-09 | 京都薬品工業株式会社 | 1,4−ジヒドロピリジン誘導体 |
| ZA889252B (en) * | 1987-12-11 | 1990-08-29 | Syntex Lab | Neuroprotective compounds |
| US5216172A (en) * | 1988-02-24 | 1993-06-01 | Ajinomoto Co., Inc. | 1,4-dihydropyridine-4-aryl-2,6-dimethyl-3,5-dicarboxylates useful as agents against drug resistant tumor cells |
| EP0330470A3 (en) * | 1988-02-24 | 1992-01-02 | Ajinomoto Co., Inc. | 1,4-dihydropyridine derivatives useful against tumour cells |
| KR940003492B1 (ko) * | 1988-10-27 | 1994-04-23 | 주식회사 유한양행 | 1,4-디하이드로피리딘유도체 및 그의 제조방법 |
| JPH01151557A (ja) * | 1988-11-15 | 1989-06-14 | Otsuka Pharmaceut Co Ltd | 降圧剤 |
| DE4125271A1 (de) * | 1991-07-31 | 1993-02-11 | Bayer Ag | Neue n-alkylierte 1,4-dihydropyridindicarbonsaeureester |
| GB9119983D0 (en) * | 1991-09-19 | 1991-11-06 | Erba Carlo Spa | Dihydropyridine derivatives useful in antitumor therapy |
| EE03192B1 (et) * | 1993-12-10 | 1999-06-15 | Bayer Aktiengesellschaft | Isopropüül-(2-metoksüetüül)-4-(2-kloro-3-tsüanofenüül)-1,4-dihüdro-2,6-dimetüülpüri diin-3,5-dikarboksülaat, selle enantiomeerid ja vaheühend, meetodid nimetatud ühendite valmistamiseks ja kasutamine |
| DE4342193A1 (de) * | 1993-12-10 | 1995-06-14 | Bayer Ag | Arylsubstituierte Alkoxycarbonyl-1,4-dihydropyridin-5-carbonsäureester |
| CN106380405B (zh) * | 2016-08-24 | 2019-01-29 | 郑州瑞康制药有限公司 | 一种2-(3-硝基亚苄基)乙酰乙酸异丙酯的合成方法 |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1670827A1 (de) * | 1967-03-20 | 1971-03-11 | Bayer Ag | Neue Arzneimittel auf der Grundlage von 4-Aryl-1,4-dihydropyridinderivaten |
| DE1670824A1 (de) * | 1967-03-20 | 1971-04-01 | Bayer Ag | Verfahren zur Herstellung von 1,4-Dihydropyridinderivaten |
| DE2117571A1 (de) * | 1971-04-10 | 1972-10-19 | Unsymmetrische 1,4-Dihydropyridincarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel I. Arfm: Farbenfabriken Bayer AG, 5090 Leverkusen | |
| JPS49133381A (OSRAM) | 1973-05-02 | 1974-12-21 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE492229A (OSRAM) * | 1948-11-17 | |||
| DE2218644C3 (de) * | 1972-04-18 | 1982-08-19 | Bayer Ag, 5090 Leverkusen | Basische Ester von 1,4-Dihydropyridinen, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel |
| US3996234A (en) * | 1972-04-18 | 1976-12-07 | Bayer Aktiengesellschaft | 1,4-Dihydropyridine carboxylic acid esters |
-
1975
- 1975-02-26 DE DE19752508181 patent/DE2508181A1/de active Granted
- 1975-10-24 GB GB4376375A patent/GB1477114A/en not_active Expired
-
1976
- 1976-01-29 IN IN163/CAL/76A patent/IN142197B/en unknown
- 1976-02-02 US US05/654,278 patent/US4044141A/en not_active Expired - Lifetime
- 1976-02-04 CA CA245,000A patent/CA1069902A/en not_active Expired
- 1976-02-13 NO NO76760470A patent/NO146393C/no unknown
- 1976-02-20 CH CH214876A patent/CH622506A5/de not_active IP Right Cessation
- 1976-02-20 JP JP51017182A patent/JPS6025424B2/ja not_active Expired
- 1976-02-20 SU SU7602324514A patent/SU574150A3/ru active
- 1976-02-23 NL NL7601823A patent/NL7601823A/xx not_active Application Discontinuation
- 1976-02-23 CS CS761175A patent/CS188994B2/cs unknown
- 1976-02-24 PT PT64840A patent/PT64840B/pt unknown
- 1976-02-24 AT AT132976A patent/AT351024B/de not_active IP Right Cessation
- 1976-02-24 IL IL7649095A patent/IL49095A/xx unknown
- 1976-02-24 FI FI760475A patent/FI61483C/fi not_active IP Right Cessation
- 1976-02-24 LU LU74424A patent/LU74424A1/xx unknown
- 1976-02-24 DD DD191458A patent/DD125483A5/xx unknown
- 1976-02-25 BE BE164628A patent/BE838924A/xx unknown
- 1976-02-25 IE IE369/76A patent/IE42643B1/en unknown
- 1976-02-25 ES ES445508A patent/ES445508A1/es not_active Expired
- 1976-02-25 RO RO7684916A patent/RO68479A/ro unknown
- 1976-02-25 SE SE7602317A patent/SE7602317L/xx unknown
- 1976-02-25 HU HU76BA00003374A patent/HU171717B/hu not_active IP Right Cessation
- 1976-02-25 ZA ZA761118A patent/ZA761118B/xx unknown
- 1976-02-25 PL PL1976187499A patent/PL100906B1/pl unknown
- 1976-02-25 DK DK78876*#A patent/DK78876A/da unknown
- 1976-02-26 FR FR7605383A patent/FR2302093A1/fr active Granted
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1670827A1 (de) * | 1967-03-20 | 1971-03-11 | Bayer Ag | Neue Arzneimittel auf der Grundlage von 4-Aryl-1,4-dihydropyridinderivaten |
| DE1670824A1 (de) * | 1967-03-20 | 1971-04-01 | Bayer Ag | Verfahren zur Herstellung von 1,4-Dihydropyridinderivaten |
| DE2117571A1 (de) * | 1971-04-10 | 1972-10-19 | Unsymmetrische 1,4-Dihydropyridincarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel I. Arfm: Farbenfabriken Bayer AG, 5090 Leverkusen | |
| JPS49133381A (OSRAM) | 1973-05-02 | 1974-12-21 |
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0001769A1 (de) * | 1977-10-22 | 1979-05-16 | Bayer Ag | 1,4-Dihydropyridincarbonsäureester mit schwefelhaltigen Estergruppen, ihre Herstellung und ihre Verwendung als Arzneimittel |
| EP0012180A1 (de) * | 1978-10-31 | 1980-06-25 | Bayer Ag | Neue 1,4-Dihydropyridinverbindungen, Verfahren zu ihrer Herstellung, die genannten Verbindungen enthaltende Arzneimittel und Verfahren zur Herstellung dieser Arzneimittel |
| EP0167068A3 (en) * | 1984-07-03 | 1988-08-10 | Bayer Ag | Isopropyl-2û2-(3-trifluoromethylphenoxy)ethyl¨ester of 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-pyridine-3,5-dicarboxylic acid, process for its preparation, and its use as a medicine |
| EP0244595A3 (de) * | 1986-03-12 | 1988-09-14 | Byk Gulden Lomberg Chemische Fabrik GmbH | Dihydropyridinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
| EP0657431A1 (de) * | 1993-12-10 | 1995-06-14 | Bayer Ag | 4-Phenyl-3-substituierte 1,4-Dihydropyridinester mit cerebraler Aktivität |
| US5731333A (en) * | 1993-12-10 | 1998-03-24 | Bayer Aktiengesellschaft | 4-phenyl-3-substituted 1,4-dihydropyridine esters |
| US6066655A (en) * | 1993-12-10 | 2000-05-23 | Bayer Aktiengesellschaft | 4-phenyl-3-substituted 1,4-dihydropyridine esters |
| WO1997025313A1 (en) * | 1996-01-10 | 1997-07-17 | Astra Aktiebolag | New manufacturing process |
| US5942624A (en) * | 1996-01-10 | 1999-08-24 | Astra Aktiebolag | Manufacturing process for felodipine |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2508181C2 (OSRAM) | ||
| EP0002208B1 (de) | Nitrosubstituierte 1,4-Dihydropyridine, diese enthaltende Arzneimittel sowie deren Herstellung | |
| EP0088276B1 (de) | Neue Verbindungen, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| EP0103796B1 (de) | Neue Dihydropyrimidine, Verfahren zu ihrer Herstellung sowie ihre Verwendung in Arzneimitteln | |
| DE2847236A1 (de) | Neue dihydropyridine mit substituierten estergruppierungen, mehrer verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| CH635323A5 (de) | Verfahren zur herstellung von neuen in 2-position substituierten 1,4-dihydropyridin-derivaten. | |
| DE2210633A1 (de) | Neue brueckenkopfheterocyclen, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| EP0009206A2 (de) | Fluorhaltige 1,4-Dihydropyridine, diese enthaltende Arzneimittel sowie Verfahren zu ihrer Herstellung | |
| DE2210667A1 (de) | Kondensiert aromatisch substituierte 1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE3239273A1 (de) | Tetrahydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung in arzneimitteln | |
| EP0001769A1 (de) | 1,4-Dihydropyridincarbonsäureester mit schwefelhaltigen Estergruppen, ihre Herstellung und ihre Verwendung als Arzneimittel | |
| EP0039863B1 (de) | 1,4-Dihydropyridine mit unterschiedlichen Substituenten in 2- und 6-Position, Verfahren zu ihrer Herstellung und ihre Verwendung in Arzneimitteln | |
| DE2210674A1 (de) | Verfahren zur herstellung von neuen 2-amino-1,4-dihydropyridinen sowie ihre verwendung als coronarmittel | |
| CH634053A5 (de) | Verfahren zur herstellung neuer aminoalkylidenamino-1.4-dihydropyridine. | |
| DE2658804A1 (de) | Kreislaufbeeinflussende mittel | |
| EP0110259B1 (de) | 1,4-Dihydropyridinderivate, Verfahren zu ihrer Herstellung sowie ihre Verwendung in Arzneimitteln | |
| DE2242786A1 (de) | Verfahren zur herstellung von neuen 2-amino-1,4-dihydropyridinen mit einer carbonylfunktion sowie ihre verwendung als arzneimittel | |
| DE2616995A1 (de) | 1.4-dihydropyridine mit schwefelhaltigen substituenten mehrere verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2239815A1 (de) | Verfahren zur herstellung von neuen 2-alkylamino-dihydropyridinen sowie ihre verwendung als arzneimittel | |
| DE2639498A1 (de) | Neue schwefelhaltige amino-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2406198C2 (de) | Verfahren zur Herstellung von neuen 2-Amino-6-dialkylamino-dihydropyridinen | |
| DE2549568B2 (de) | 2,6-Dimethyl-3-methoxycarbonyl-4-(2>nitrophenyl)-1.4-di-hydropyridin-5-carbonsäureisobutylester, Verfahren zu seiner Herstellung sowie ihn enthaltende Arzneimittel | |
| DE2616991A1 (de) | Heterocyclisch-substituierte schwefelhaltige dihydropyridine, mehrere verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2210687A1 (de) | Verfahren zur herstellung von neuen 2,6-diamino-dihydropyridinen sowie ihre verwendung als arzneimittel | |
| DE2242787A1 (de) | Verfahren zur herstellung von neuen 3,4-dihydropyridonen sowie ihre verwendung als arzneimittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |