DE2461077C2 - Flammhemmende aromatische Polycarbonatzusammensetzung - Google Patents
Flammhemmende aromatische PolycarbonatzusammensetzungInfo
- Publication number
- DE2461077C2 DE2461077C2 DE2461077A DE2461077A DE2461077C2 DE 2461077 C2 DE2461077 C2 DE 2461077C2 DE 2461077 A DE2461077 A DE 2461077A DE 2461077 A DE2461077 A DE 2461077A DE 2461077 C2 DE2461077 C2 DE 2461077C2
- Authority
- DE
- Germany
- Prior art keywords
- udf54
- udf53
- aromatic
- composition according
- salt
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000515 polycarbonate Polymers 0.000 title claims description 35
- 239000000203 mixture Substances 0.000 title claims description 32
- 239000004417 polycarbonate Substances 0.000 title claims description 32
- 239000003063 flame retardant Substances 0.000 title claims description 26
- 125000003118 aryl group Chemical group 0.000 claims description 31
- -1 alkaline earth metal salt Chemical class 0.000 claims description 22
- 150000003839 salts Chemical class 0.000 claims description 16
- 150000003254 radicals Chemical class 0.000 claims description 14
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 13
- 229910052751 metal Inorganic materials 0.000 claims description 9
- 239000002184 metal Substances 0.000 claims description 9
- 239000003513 alkali Substances 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000001447 alkali salts Chemical class 0.000 claims description 5
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 150000002367 halogens Chemical group 0.000 claims description 4
- 150000003460 sulfonic acids Chemical class 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000004953 trihalomethyl group Chemical group 0.000 claims description 2
- JEVCWSUVFOYBFI-UHFFFAOYSA-N cyanyl Chemical group N#[C] JEVCWSUVFOYBFI-UHFFFAOYSA-N 0.000 claims 1
- 239000000654 additive Substances 0.000 description 40
- 230000000996 additive effect Effects 0.000 description 22
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 21
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 9
- DEIGXXQKDWULML-UHFFFAOYSA-N 1,2,5,6,9,10-hexabromocyclododecane Chemical compound BrC1CCC(Br)C(Br)CCC(Br)C(Br)CCC1Br DEIGXXQKDWULML-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 230000000052 comparative effect Effects 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 230000000694 effects Effects 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 4
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 239000002243 precursor Substances 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 3
- 239000000370 acceptor Substances 0.000 description 3
- 238000010998 test method Methods 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 241000790917 Dioxys <bee> Species 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- 229920001400 block copolymer Polymers 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 230000006866 deterioration Effects 0.000 description 2
- KZTYYGOKRVBIMI-UHFFFAOYSA-N diphenyl sulfone Chemical compound C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 229910052701 rubidium Inorganic materials 0.000 description 2
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052712 strontium Inorganic materials 0.000 description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 2
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- YMTYZTXUZLQUSF-UHFFFAOYSA-N 3,3'-Dimethylbisphenol A Chemical compound C1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=CC=2)=C1 YMTYZTXUZLQUSF-UHFFFAOYSA-N 0.000 description 1
- MLDIQALUMKMHCC-UHFFFAOYSA-N 4,4-Bis(4-hydroxyphenyl)heptane Chemical compound C=1C=C(O)C=CC=1C(CCC)(CCC)C1=CC=C(O)C=C1 MLDIQALUMKMHCC-UHFFFAOYSA-N 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- 229940106691 bisphenol a Drugs 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 159000000006 cesium salts Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 230000002542 deteriorative effect Effects 0.000 description 1
- KCIDZIIHRGYJAE-YGFYJFDDSA-L dipotassium;[(2r,3r,4s,5r,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate Chemical class [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O KCIDZIIHRGYJAE-YGFYJFDDSA-L 0.000 description 1
- 125000006575 electron-withdrawing group Chemical group 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000012757 flame retardant agent Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920005668 polycarbonate resin Polymers 0.000 description 1
- 239000004431 polycarbonate resin Substances 0.000 description 1
- 150000003071 polychlorinated biphenyls Chemical group 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
- C08K5/41—Compounds containing sulfur bound to oxygen
- C08K5/42—Sulfonic acids; Derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L69/00—Compositions of polycarbonates; Compositions of derivatives of polycarbonates
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L81/00—Compositions of macromolecular compounds obtained by reactions forming in the main chain of the macromolecule a linkage containing sulfur with or without nitrogen, oxygen or carbon only; Compositions of polysulfones; Compositions of derivatives of such polymers
- C08L81/06—Polysulfones; Polyethersulfones
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Fireproofing Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/429,121 US3948851A (en) | 1973-12-28 | 1973-12-28 | Flame retardant polycarbonate composition |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2461077A1 DE2461077A1 (de) | 1975-07-10 |
| DE2461077C2 true DE2461077C2 (de) | 1987-05-07 |
Family
ID=23701899
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2461077A Expired DE2461077C2 (de) | 1973-12-28 | 1974-12-23 | Flammhemmende aromatische Polycarbonatzusammensetzung |
Country Status (8)
| Country | Link |
|---|---|
| US (2) | US3948851A (OSRAM) |
| JP (1) | JPS5813587B2 (OSRAM) |
| BR (1) | BR7410859D0 (OSRAM) |
| DE (1) | DE2461077C2 (OSRAM) |
| FR (1) | FR2256209B1 (OSRAM) |
| GB (1) | GB1495970A (OSRAM) |
| IT (1) | IT1027814B (OSRAM) |
| NL (1) | NL174952C (OSRAM) |
Families Citing this family (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3948851A (en) * | 1973-12-28 | 1976-04-06 | General Electric Company | Flame retardant polycarbonate composition |
| US4001175A (en) * | 1975-10-29 | 1977-01-04 | General Electric Company | Flame retardant polycarbonate composition |
| US4104253A (en) * | 1976-10-15 | 1978-08-01 | General Electric Company | Flame retardant polycarbonate composition |
| US4110299A (en) * | 1976-10-15 | 1978-08-29 | General Electric Company | Flame-retardant polycarbonate composition |
| GB1559907A (en) * | 1976-11-29 | 1980-01-30 | Gen Electric | Process for preparation aryl sulphone sulphonic acids |
| US4620950A (en) * | 1976-11-29 | 1986-11-04 | General Electric Company | Process for preparing aryl sulfone sulfonic acids |
| US4093589A (en) * | 1977-02-03 | 1978-06-06 | General Electric Company | Non-opaque flame retardant polycarbonate composition |
| US4239678A (en) * | 1978-01-06 | 1980-12-16 | General Electric Company | Flame retardant thermoplastic compositions |
| DE2810462A1 (de) * | 1978-03-10 | 1979-09-13 | Bayer Ag | Polyarylsulfone mit verbesserter bestaendigkeit gegen spannungsrisskorrosion |
| US4263201A (en) * | 1978-12-07 | 1981-04-21 | General Electric Company | Flame retardant polycarbonate composition |
| DE2903100A1 (de) * | 1979-01-27 | 1980-07-31 | Gen Electric | Flammhemmende thermoplastische zusammensetzungen |
| US4358569A (en) * | 1980-12-31 | 1982-11-09 | General Electric Company | Blends of copolyester-carbonate with polysulfone |
| US4464497A (en) * | 1982-12-15 | 1984-08-07 | General Electric Company | Carbon black filled flame retardant polycarbonate compositions |
| US4476275A (en) * | 1983-01-10 | 1984-10-09 | The Standard Oil Company | Metal dodecylbenzenesulfonates as processing aids for polycarbonates |
| DE3334822A1 (de) * | 1983-09-26 | 1985-04-04 | Bayer Ag, 5090 Leverkusen | Neue flammschutzmittel, ihre herstellung und ihre verwendung zur flammfestausruestung von polycarbonaten |
| US4600742A (en) * | 1984-08-17 | 1986-07-15 | The Lubrizol Corporation | Polycarbonate compositions |
| US5037889A (en) * | 1986-12-23 | 1991-08-06 | General Electric Company | Resin blends exhibiting improved impact properties |
| US4902737A (en) * | 1986-12-23 | 1990-02-20 | General Electric Company | Resin blends exhibiting improved impact properties |
| US4735978A (en) * | 1986-12-24 | 1988-04-05 | General Electric Company | Flame retardant polycarbonate composition |
| US5162405A (en) * | 1987-12-24 | 1992-11-10 | Elf Atochem North America, Inc. | Single-functional and mixtures of multi-functional oligomeric performance additive compositions and their uses |
| US5013777A (en) * | 1987-12-24 | 1991-05-07 | Atochem North America, Inc. | Novel single-functional and mixtures of multi-functional oligomeric performance additive compositions and their uses |
| US4918125A (en) * | 1988-12-27 | 1990-04-17 | General Electric Company | Flame retardant carbonate polymer blends |
| US4994510A (en) * | 1990-04-05 | 1991-02-19 | General Electric Company | Poly(carbonate-siloxane) with reduced tendency to burn |
| WO1994007956A1 (en) * | 1992-10-07 | 1994-04-14 | General Electric Company | Flame resistant thermoplastic blends having reduced drippage |
| US5494997A (en) | 1994-08-01 | 1996-02-27 | General Electric Company | Preparation of by the bischloroformate process of soft segment polycarbonate |
| US5663280A (en) * | 1995-10-23 | 1997-09-02 | The Dow Chemical Company | Carbonate polymer resins containing low volatility aromatic phosphate ester compounds |
| AU2002239769A1 (en) * | 2000-12-20 | 2002-07-01 | General Electric Company | Flame retardant polycarbonate resin/abs graft copolymer blends |
| US6605659B2 (en) | 2000-12-20 | 2003-08-12 | General Electric Company | Flame retardant polycarbonate resin/ABS graft copolymer blends |
| US6518347B1 (en) | 2000-12-27 | 2003-02-11 | 3M Innovative Properties Company | Flame retardant carbonate polymers and use thereof |
| US6753367B2 (en) * | 2001-08-20 | 2004-06-22 | General Electric Company | Flame retardant polycarbonate compositions with improved weathering performance containing cyanoacrylic esters |
| US6995212B2 (en) | 2003-08-08 | 2006-02-07 | Bayer Materialscience Llc | Flame retardant, thermoplastic polycarbonate molding compositions |
| US20080014446A1 (en) * | 2004-10-07 | 2008-01-17 | General Electric Company | Window shade and a multi-layered article, and methods of making the same |
| US8691895B2 (en) * | 2008-06-30 | 2014-04-08 | Bayer Materialscience Llc | Flame retardant, optically clear thermoplastic molding composition |
| US8445568B2 (en) * | 2008-09-25 | 2013-05-21 | Sabic Innovative Plastics Ip B.V. | Flame retardant thermoplastic composition and articles formed therefrom |
| US20100280159A1 (en) * | 2008-09-25 | 2010-11-04 | Christianus Johannes Jacobus Maas | Flame retardant thermoplastic composition and articles formed therefrom |
| US8771829B2 (en) * | 2008-09-25 | 2014-07-08 | Sabic Innovative Plastics Ip B.V. | Flame retardant thermoplastic polymer composition, method of manufacture, and articles formed therefrom |
| KR101455488B1 (ko) | 2010-03-31 | 2014-10-27 | 미쓰비시 가가꾸 가부시키가이샤 | 폴리카보네이트 수지 조성물, 그 제조 방법 및 동 수지 조성물의 성형체 |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2141893A (en) * | 1935-08-17 | 1938-12-27 | Gen Aniline Works Inc | Trifluoromethyl-aryl-sulphonic acids and a process of preparing them |
| US2283236A (en) * | 1939-06-23 | 1942-05-19 | United Gas Improvement Co | Sulphonated derivatives of polymerized methylstyrene |
| DE962489C (de) * | 1954-02-10 | 1957-04-25 | Dehydag Gmbh | Sparbeizmittel zum Schutze von Metallen bei der Behandlung mit sauren Mitteln |
| NL99360C (OSRAM) * | 1956-05-21 | 1900-01-01 | ||
| GB1015028A (en) * | 1963-09-23 | 1965-12-31 | Berk F W & Co Ltd | Halogenated diphenylsulphides and polymer compositions containing them |
| US3374210A (en) * | 1965-09-20 | 1968-03-19 | Grefco | Sulfonated aromatic resins |
| FR1494897A (OSRAM) * | 1966-08-02 | 1967-09-15 | ||
| US3546164A (en) * | 1968-04-19 | 1970-12-08 | Fmc Corp | Polyester resins stabilized with sulfones |
| AT297333B (de) * | 1969-06-13 | 1972-03-27 | Bayer Ag | Verfahren zur Herstellung von Polycarbonaten mit verminderter Brennbarkeit |
| US3576617A (en) * | 1969-11-25 | 1971-04-27 | Eugene P Di Bella | Method of promoting the growth of plants |
| US3686362A (en) * | 1970-05-22 | 1972-08-22 | Unlroyal Inc | Flame resistant composition of abs, polyarylene polysulfone and bromo-aryl compound |
| FR2096940B1 (OSRAM) * | 1970-07-09 | 1973-08-10 | Rhodiaceta | |
| DE2149311A1 (de) * | 1971-10-02 | 1973-04-05 | Bayer Ag | Flammwidrige polycarbonate |
| BE790919R (fr) * | 1971-11-03 | 1973-05-03 | Bayer Ag | Polycarbonates thermoplastiques a poids moleculaire eleve de phenols |
| US3948851A (en) * | 1973-12-28 | 1976-04-06 | General Electric Company | Flame retardant polycarbonate composition |
-
1973
- 1973-12-28 US US05/429,121 patent/US3948851A/en not_active Expired - Lifetime
-
1974
- 1974-12-16 GB GB54240/74A patent/GB1495970A/en not_active Expired
- 1974-12-19 IT IT30736/74A patent/IT1027814B/it active
- 1974-12-20 NL NLAANVRAGE7416728,A patent/NL174952C/xx not_active IP Right Cessation
- 1974-12-23 DE DE2461077A patent/DE2461077C2/de not_active Expired
- 1974-12-26 JP JP751084A patent/JPS5813587B2/ja not_active Expired
- 1974-12-26 BR BR10859/74A patent/BR7410859D0/pt unknown
- 1974-12-27 FR FR7443087A patent/FR2256209B1/fr not_active Expired
-
1975
- 1975-10-29 US US05/626,939 patent/US4092291A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| NL174952C (nl) | 1984-09-03 |
| GB1495970A (en) | 1977-12-21 |
| DE2461077A1 (de) | 1975-07-10 |
| NL7416728A (nl) | 1975-07-01 |
| AU7570374A (en) | 1976-05-27 |
| US3948851A (en) | 1976-04-06 |
| FR2256209B1 (OSRAM) | 1982-02-26 |
| NL174952B (nl) | 1984-04-02 |
| IT1027814B (it) | 1978-12-20 |
| US4092291A (en) | 1978-05-30 |
| FR2256209A1 (OSRAM) | 1975-07-25 |
| JPS5813587B2 (ja) | 1983-03-14 |
| BR7410859D0 (pt) | 1975-09-02 |
| JPS5098549A (OSRAM) | 1975-08-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2461077C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2461063C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2461146C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2460937C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2458968C2 (de) | Flammhemmende Polycarbonatzusammensetzung | |
| DE2460786C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2458527C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2461144A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2461145A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2535262C2 (OSRAM) | ||
| DE2948871A1 (de) | Flammhemmende polycarbonat-zusammensetzung | |
| DE2460787A1 (de) | Flammhemmende polycarbonat-zusammensetzung | |
| DE2242509A1 (de) | Nicht-tropfende, flammhemmende, mit glas verstaerkte polyesterharze | |
| DE2460788A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2460935A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2744018C2 (OSRAM) | ||
| DE2460945A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2915563A1 (de) | Flammhemmende kristalline polycarbonatzusammensetzungen | |
| DE2460946A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2644114A1 (de) | Nicht-opake, flammhemmende polycarbonat-zusammensetzung | |
| DE2744017A1 (de) | Nicht-opake, feuerhemmende polycarbonat-zusammensetzung | |
| DE2346177B2 (de) | Selbsterlöschende Formmasse | |
| DE2800923A1 (de) | Flammfeste aromatische polycarbonate mit guten mechanischen eigenschaften und guter schmelzstabilitaet | |
| DE2643256A1 (de) | Flammhemmende polycarbonat-zusammensetzung | |
| DE2460944C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |