DE2458347A1 - Verfahren zur herstellung von basischen oxazinfarbstoffen - Google Patents
Verfahren zur herstellung von basischen oxazinfarbstoffenInfo
- Publication number
- DE2458347A1 DE2458347A1 DE19742458347 DE2458347A DE2458347A1 DE 2458347 A1 DE2458347 A1 DE 2458347A1 DE 19742458347 DE19742458347 DE 19742458347 DE 2458347 A DE2458347 A DE 2458347A DE 2458347 A1 DE2458347 A1 DE 2458347A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- formula
- parts
- lower alkyl
- solution
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000975 dye Substances 0.000 title claims description 36
- 238000000034 method Methods 0.000 title claims description 14
- 238000002360 preparation method Methods 0.000 title claims description 10
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 title claims description 5
- CWLKGDAVCFYWJK-UHFFFAOYSA-N 3-aminophenol Chemical compound NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 claims description 25
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- 150000001875 compounds Chemical class 0.000 claims description 12
- 150000002832 nitroso derivatives Chemical class 0.000 claims description 12
- 229940018563 3-aminophenol Drugs 0.000 claims description 11
- 239000000725 suspension Substances 0.000 claims description 11
- -1 amino compound Chemical class 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 8
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims description 6
- 150000001450 anions Chemical class 0.000 claims description 5
- 238000009833 condensation Methods 0.000 claims description 5
- 230000005494 condensation Effects 0.000 claims description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 4
- 230000002378 acidificating effect Effects 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 claims description 2
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical group [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 2
- 125000003262 carboxylic acid ester group Chemical group [H]C([H])([*:2])OC(=O)C([H])([H])[*:1] 0.000 claims description 2
- 238000004043 dyeing Methods 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 229940018564 m-phenylenediamine Drugs 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 2
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical group NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 claims description 2
- 125000001302 tertiary amino group Chemical group 0.000 claims description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims 1
- 125000002118 cyano ester group Chemical group 0.000 claims 1
- 239000002657 fibrous material Substances 0.000 claims 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 25
- 239000000243 solution Substances 0.000 description 22
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 13
- 239000000835 fiber Substances 0.000 description 10
- 239000002253 acid Substances 0.000 description 9
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 6
- MESJRHHDBDCQTH-UHFFFAOYSA-N 3-(dimethylamino)phenol Chemical compound CN(C)C1=CC=CC(O)=C1 MESJRHHDBDCQTH-UHFFFAOYSA-N 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 238000007034 nitrosation reaction Methods 0.000 description 5
- 235000002639 sodium chloride Nutrition 0.000 description 5
- 241000974482 Aricia saepiolus Species 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 230000009935 nitrosation Effects 0.000 description 4
- 229920002239 polyacrylonitrile Polymers 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 235000005074 zinc chloride Nutrition 0.000 description 4
- 239000011592 zinc chloride Substances 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 239000004952 Polyamide Substances 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 125000000018 nitroso group Chemical group N(=O)* 0.000 description 3
- 229920002647 polyamide Polymers 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 235000010288 sodium nitrite Nutrition 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000001045 blue dye Substances 0.000 description 2
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 238000001694 spray drying Methods 0.000 description 2
- 229920002994 synthetic fiber Polymers 0.000 description 2
- 239000012209 synthetic fiber Substances 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- RSAVZMLVLNTTOW-UHFFFAOYSA-N 1-n,1-n,4-trimethylbenzene-1,3-diamine Chemical compound CN(C)C1=CC=C(C)C(N)=C1 RSAVZMLVLNTTOW-UHFFFAOYSA-N 0.000 description 1
- TZMSYXZUNZXBOL-UHFFFAOYSA-N 10H-phenoxazine Chemical compound C1=CC=C2NC3=CC=CC=C3OC2=C1 TZMSYXZUNZXBOL-UHFFFAOYSA-N 0.000 description 1
- BAHPQISAXRFLCL-UHFFFAOYSA-N 2,4-Diaminoanisole Chemical compound COC1=CC=C(N)C=C1N BAHPQISAXRFLCL-UHFFFAOYSA-N 0.000 description 1
- NAZDVUBIEPVUKE-UHFFFAOYSA-N 2,5-dimethoxyaniline Chemical compound COC1=CC=C(OC)C(N)=C1 NAZDVUBIEPVUKE-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229920003043 Cellulose fiber Polymers 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- SBXKRBZKPQBLOD-UHFFFAOYSA-N aminohydroquinone Chemical class NC1=CC(O)=CC=C1O SBXKRBZKPQBLOD-UHFFFAOYSA-N 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- 239000001009 azin dye Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- YDVJBLJCSLVMSY-UHFFFAOYSA-N carbamoyl cyanide Chemical group NC(=O)C#N YDVJBLJCSLVMSY-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 231100001261 hazardous Toxicity 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000004988 m-phenylenediamines Chemical class 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920006149 polyester-amide block copolymer Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229920001864 tannin Polymers 0.000 description 1
- 235000018553 tannin Nutrition 0.000 description 1
- 239000001648 tannin Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B19/00—Oxazine dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742458347 DE2458347A1 (de) | 1974-12-10 | 1974-12-10 | Verfahren zur herstellung von basischen oxazinfarbstoffen |
| NL7514226A NL7514226A (nl) | 1974-12-10 | 1975-12-05 | Werkwijze voor het bereiden van basische oxazine- kleurstoffen. |
| IT3007975A IT1050008B (it) | 1974-12-10 | 1975-12-05 | Processo per la preparazione di coloranti ossazinici basici |
| DD18996175A DD125780A5 (en:Method) | 1974-12-10 | 1975-12-08 | |
| CH1593475A CH584738A5 (en:Method) | 1974-12-10 | 1975-12-08 | |
| JP14597375A JPS5183636A (ja) | 1974-12-10 | 1975-12-09 | Enkiseiokisajinsenryonoseiho |
| FR7537739A FR2294209A1 (fr) | 1974-12-10 | 1975-12-10 | Preparation de colorants oxaziniques basiques |
| BE162620A BE836490A (fr) | 1974-12-10 | 1975-12-10 | Preparation de colorants oxaziniques basiques |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742458347 DE2458347A1 (de) | 1974-12-10 | 1974-12-10 | Verfahren zur herstellung von basischen oxazinfarbstoffen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2458347A1 true DE2458347A1 (de) | 1976-06-16 |
Family
ID=5933051
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742458347 Pending DE2458347A1 (de) | 1974-12-10 | 1974-12-10 | Verfahren zur herstellung von basischen oxazinfarbstoffen |
Country Status (8)
| Country | Link |
|---|---|
| JP (1) | JPS5183636A (en:Method) |
| BE (1) | BE836490A (en:Method) |
| CH (1) | CH584738A5 (en:Method) |
| DD (1) | DD125780A5 (en:Method) |
| DE (1) | DE2458347A1 (en:Method) |
| FR (1) | FR2294209A1 (en:Method) |
| IT (1) | IT1050008B (en:Method) |
| NL (1) | NL7514226A (en:Method) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2631166A1 (de) * | 1976-07-10 | 1978-01-19 | Bayer Ag | Verfahren zur herstellung von oxazinfarbstoffen |
| US4289880A (en) * | 1978-07-21 | 1981-09-15 | Ciba-Geigy Corporation | Cationic oxazine dyes |
| DE2660747C2 (de) * | 1976-07-10 | 1985-07-11 | Bayer Ag, 5090 Leverkusen | Aminophenolether und deren Herstellung |
| WO2011114137A1 (en) * | 2010-03-17 | 2011-09-22 | Pharmalucia Limited | Toluidine blue derivatives as photosensitising compounds |
| WO2017140795A1 (de) * | 2016-02-19 | 2017-08-24 | Basf Se | Polyamidzusammensetzung enthaltend ein polyamid und ein additiv |
| US11802191B2 (en) | 2016-02-19 | 2023-10-31 | Basf Se | Processes, powders, and shaped bodies of polyamides and calcined kaolin with particular size distribution |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0005451A3 (de) * | 1978-04-21 | 1979-12-12 | Ciba-Geigy Ag | Verfahren zur Herstellung von kationischen Oxazinverbindungen, die Oxazinverbindungen sowie deren Verwendung zum Färben und Bedrucken von Textilmaterialien |
| FR2480767A1 (fr) * | 1980-04-18 | 1981-10-23 | Ugine Kuhlmann | Procede de preparation de colorants oxaziniques basiques |
| DE3033439A1 (de) * | 1980-09-05 | 1982-04-22 | Basf Ag, 6700 Ludwigshafen | Basische farbstoffe der oxazinreihe |
-
1974
- 1974-12-10 DE DE19742458347 patent/DE2458347A1/de active Pending
-
1975
- 1975-12-05 NL NL7514226A patent/NL7514226A/xx not_active Application Discontinuation
- 1975-12-05 IT IT3007975A patent/IT1050008B/it active
- 1975-12-08 CH CH1593475A patent/CH584738A5/xx not_active IP Right Cessation
- 1975-12-08 DD DD18996175A patent/DD125780A5/xx unknown
- 1975-12-09 JP JP14597375A patent/JPS5183636A/ja active Pending
- 1975-12-10 FR FR7537739A patent/FR2294209A1/fr not_active Withdrawn
- 1975-12-10 BE BE162620A patent/BE836490A/xx unknown
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2631166A1 (de) * | 1976-07-10 | 1978-01-19 | Bayer Ag | Verfahren zur herstellung von oxazinfarbstoffen |
| DE2660747C2 (de) * | 1976-07-10 | 1985-07-11 | Bayer Ag, 5090 Leverkusen | Aminophenolether und deren Herstellung |
| US4289880A (en) * | 1978-07-21 | 1981-09-15 | Ciba-Geigy Corporation | Cationic oxazine dyes |
| WO2011114137A1 (en) * | 2010-03-17 | 2011-09-22 | Pharmalucia Limited | Toluidine blue derivatives as photosensitising compounds |
| WO2017140795A1 (de) * | 2016-02-19 | 2017-08-24 | Basf Se | Polyamidzusammensetzung enthaltend ein polyamid und ein additiv |
| US11078362B2 (en) | 2016-02-19 | 2021-08-03 | Basf Se | Polyamide composition containing a polyamide and an additive |
| US11802191B2 (en) | 2016-02-19 | 2023-10-31 | Basf Se | Processes, powders, and shaped bodies of polyamides and calcined kaolin with particular size distribution |
Also Published As
| Publication number | Publication date |
|---|---|
| CH584738A5 (en:Method) | 1977-02-15 |
| JPS5183636A (ja) | 1976-07-22 |
| NL7514226A (nl) | 1976-06-14 |
| BE836490A (fr) | 1976-06-10 |
| IT1050008B (it) | 1981-03-10 |
| DD125780A5 (en:Method) | 1977-05-18 |
| FR2294209A1 (fr) | 1976-07-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2460491A1 (de) | Verfahren zur herstellung von xanthenfarbstoffen | |
| DE2458347A1 (de) | Verfahren zur herstellung von basischen oxazinfarbstoffen | |
| DE2208611A1 (de) | Verfahren zur herstellung von aryleckige klammer auf 4,4'-bis-(dialkylamino)benzhydryl eckige klammer auf -sulfonen | |
| DE2210074C3 (de) | Verfahren zur Herstellung von Oxazinfarbstoffen | |
| DE2518587C2 (de) | Verfahren zur Herstellung basischer Oxazinfarbstoffe | |
| DE1569603C3 (de) | Verfahren zur Herstellung von Oxazinfarbstoffen | |
| DE1919511C3 (de) | Basische Oxazinfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2134518C3 (de) | Verfahren zur Herstellung von Verbindungen der Benzothloxanthenreihe | |
| DE2533428C2 (en:Method) | ||
| DE1098652B (de) | Verfahren zur Herstellung von Farbstoffen der Triphenylrosanilinreihe | |
| DE1925052C3 (de) | Verfahren zur Herstellung von basischen Oxazinfarbstoffen | |
| DE1544469B1 (de) | Verfahren zur Herstellung von Pyridazinazofarbstoffen,neue Pyridazinazofarbstoffe und deren Verwendung | |
| DE2423548A1 (de) | Verfahren zur herstellung von 4-amino1,8-naphthalimid-verbindungen | |
| DE3011154A1 (de) | Neue zinkchloridkomplexverbindungen, verfahren zu ihrer herstellung und ihre verwendung | |
| DE915128C (de) | Verfahren zur Herstellung von unsymmetrischen Xantheniumverbindungen | |
| DE2030028B2 (de) | Basische Oxazinfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP0005451A2 (de) | Verfahren zur Herstellung von kationischen Oxazinverbindungen, die Oxazinverbindungen sowie deren Verwendung zum Färben und Bedrucken von Textilmaterialien | |
| AT226855B (de) | Verfahren zur Herstellung neuer basischer Hydrazonfarbstoffe | |
| CH616445A5 (en:Method) | ||
| CH617448A5 (en) | Process for preparing basic oxazine dyes | |
| DE278660C (en:Method) | ||
| DE1569716C (de) | Verfahren zur Herstellung von kationischen Farbstoffen, neue 5-Methoxy- und 5-Äthoxynaphthoylenbenzimidazoliumfarbstoffe und ihre Verwendung zum Färben von Polyacry lnitri lfasern | |
| CH627769A5 (de) | Verfahren zur herstellung von symmetrischen 4-halogen-4',4''-diarylamino-triphenylmethanverbindungen. | |
| AT223724B (de) | Verfahren zur Herstellung von neuen Cyaninfarbstoffen | |
| DE2005968C3 (de) | Verfahren zur Herstellung von substituierten 2-(3-cumarinyl)-13-dialkylbenzimidazoliumsalzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |