DE2454124C3 - Stabilisierte Polyphenylenäther-Harzmassen - Google Patents
Stabilisierte Polyphenylenäther-HarzmassenInfo
- Publication number
- DE2454124C3 DE2454124C3 DE2454124A DE2454124A DE2454124C3 DE 2454124 C3 DE2454124 C3 DE 2454124C3 DE 2454124 A DE2454124 A DE 2454124A DE 2454124 A DE2454124 A DE 2454124A DE 2454124 C3 DE2454124 C3 DE 2454124C3
- Authority
- DE
- Germany
- Prior art keywords
- bis
- phosphorous acid
- acid ester
- high molecular
- polyphenylene ether
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920001955 polyphenylene ether Polymers 0.000 title claims description 39
- 239000011342 resin composition Substances 0.000 title claims description 9
- -1 alkyl radical Chemical class 0.000 claims description 86
- 229920005989 resin Polymers 0.000 claims description 45
- 239000011347 resin Substances 0.000 claims description 45
- 239000003381 stabilizer Substances 0.000 claims description 39
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 32
- 239000000203 mixture Substances 0.000 claims description 32
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 18
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 14
- 238000006467 substitution reaction Methods 0.000 claims description 13
- 125000003118 aryl group Chemical group 0.000 claims description 11
- 239000000126 substance Substances 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 229920001577 copolymer Polymers 0.000 claims description 9
- 125000005843 halogen group Chemical group 0.000 claims description 7
- 229920001519 homopolymer Polymers 0.000 claims description 7
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- 229920000578 graft copolymer Polymers 0.000 claims description 6
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 claims description 6
- 150000003254 radicals Chemical class 0.000 claims description 5
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 150000001721 carbon Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- IIVWHGMLFGNMOW-UHFFFAOYSA-N 2-methylpropane Chemical compound C[C](C)C IIVWHGMLFGNMOW-UHFFFAOYSA-N 0.000 claims description 3
- BWVAOONFBYYRHY-UHFFFAOYSA-N [4-(hydroxymethyl)phenyl]methanol Chemical class OCC1=CC=C(CO)C=C1 BWVAOONFBYYRHY-UHFFFAOYSA-N 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- PTJWCLYPVFJWMP-UHFFFAOYSA-N 2-[[3-hydroxy-2-[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]methyl]-2-(hydroxymethyl)propoxy]methyl]-2-(hydroxymethyl)propane-1,3-diol Chemical compound OCC(CO)(CO)COCC(CO)(CO)COCC(CO)(CO)CO PTJWCLYPVFJWMP-UHFFFAOYSA-N 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000005529 alkyleneoxy group Chemical group 0.000 claims description 2
- 125000000732 arylene group Chemical group 0.000 claims description 2
- 125000003106 haloaryl group Chemical group 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims 3
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 claims 1
- OMIHGPLIXGGMJB-UHFFFAOYSA-N 7-oxabicyclo[4.1.0]hepta-1,3,5-triene Chemical compound C1=CC=C2OC2=C1 OMIHGPLIXGGMJB-UHFFFAOYSA-N 0.000 claims 1
- 230000000704 physical effect Effects 0.000 description 29
- 238000012360 testing method Methods 0.000 description 28
- 239000004793 Polystyrene Substances 0.000 description 19
- 238000001746 injection moulding Methods 0.000 description 19
- 229920002223 polystyrene Polymers 0.000 description 19
- 230000000052 comparative effect Effects 0.000 description 18
- 150000002989 phenols Chemical class 0.000 description 18
- 230000032683 aging Effects 0.000 description 15
- 230000000694 effects Effects 0.000 description 15
- 239000012760 heat stabilizer Substances 0.000 description 14
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- NLHYZPPCNGVOTB-UHFFFAOYSA-N 6-(2,2-diacetylhydrazinyl)-6-oxohexanoic acid Chemical compound C(C)(=O)N(NC(CCCCC(=O)O)=O)C(C)=O NLHYZPPCNGVOTB-UHFFFAOYSA-N 0.000 description 10
- 229920002857 polybutadiene Polymers 0.000 description 10
- 230000006641 stabilisation Effects 0.000 description 10
- 238000011105 stabilization Methods 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- 239000005062 Polybutadiene Substances 0.000 description 9
- 229910052810 boron oxide Inorganic materials 0.000 description 9
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 description 9
- 238000000034 method Methods 0.000 description 9
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical class OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 9
- 239000000463 material Substances 0.000 description 8
- 239000008188 pellet Substances 0.000 description 8
- 230000000087 stabilizing effect Effects 0.000 description 8
- 150000002148 esters Chemical class 0.000 description 7
- MXOZSWPTBCMKKO-UHFFFAOYSA-N 4-[(diacetylamino)carbamoyl]benzoic acid Chemical compound C(C)(=O)N(NC(C1=CC=C(C(=O)O)C=C1)=O)C(C)=O MXOZSWPTBCMKKO-UHFFFAOYSA-N 0.000 description 6
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 6
- 239000004417 polycarbonate Substances 0.000 description 6
- 229920000515 polycarbonate Polymers 0.000 description 6
- 230000008569 process Effects 0.000 description 6
- 230000002195 synergetic effect Effects 0.000 description 6
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 6
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 239000000654 additive Substances 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- 238000002845 discoloration Methods 0.000 description 4
- 239000003063 flame retardant Substances 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- XZZNDPSIHUTMOC-UHFFFAOYSA-N triphenyl phosphate Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)OC1=CC=CC=C1 XZZNDPSIHUTMOC-UHFFFAOYSA-N 0.000 description 4
- GURAKRDPDWIZES-UHFFFAOYSA-N 4-[(N-phenylanilino)carbamoyl]benzoic acid Chemical compound C1(=CC=CC=C1)N(NC(C1=CC=C(C(=O)O)C=C1)=O)C1=CC=CC=C1 GURAKRDPDWIZES-UHFFFAOYSA-N 0.000 description 3
- OOPQSDNLDOYGRA-UHFFFAOYSA-N 6-(2,2-diphenylhydrazinyl)-6-oxohexanoic acid Chemical compound C1(=CC=CC=C1)N(NC(CCCCC(=O)O)=O)C1=CC=CC=C1 OOPQSDNLDOYGRA-UHFFFAOYSA-N 0.000 description 3
- 229910003873 O—P—O Inorganic materials 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 238000006731 degradation reaction Methods 0.000 description 3
- 230000006866 deterioration Effects 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 238000010525 oxidative degradation reaction Methods 0.000 description 3
- 150000003008 phosphonic acid esters Chemical class 0.000 description 3
- 239000000049 pigment Substances 0.000 description 3
- 239000004014 plasticizer Substances 0.000 description 3
- 239000000344 soap Substances 0.000 description 3
- QOKVYXVBSRWSOD-UHFFFAOYSA-N 10-(2,2-diacetylhydrazinyl)-10-oxodecanoic acid Chemical compound C(C)(=O)N(NC(CCCCCCCCC(=O)O)=O)C(C)=O QOKVYXVBSRWSOD-UHFFFAOYSA-N 0.000 description 2
- QQOMQLYQAXGHSU-UHFFFAOYSA-N 2,3,6-Trimethylphenol Chemical compound CC1=CC=C(C)C(O)=C1C QQOMQLYQAXGHSU-UHFFFAOYSA-N 0.000 description 2
- UTXVNEOBKXBFLO-UHFFFAOYSA-N 6-(2,2-dibenzoylhydrazinyl)-6-oxohexanoic acid Chemical compound C(C1=CC=CC=C1)(=O)N(NC(CCCCC(=O)O)=O)C(C1=CC=CC=C1)=O UTXVNEOBKXBFLO-UHFFFAOYSA-N 0.000 description 2
- CIRRFAQIWQFQSS-UHFFFAOYSA-N 6-ethyl-o-cresol Chemical compound CCC1=CC=CC(C)=C1O CIRRFAQIWQFQSS-UHFFFAOYSA-N 0.000 description 2
- WCHXMNUCCYDVSI-UHFFFAOYSA-N 9-(N-(diacetylamino)anilino)-9-oxononanoic acid Chemical compound OC(=O)CCCCCCCC(=O)N(N(C(=O)C)C(C)=O)C1=CC=CC=C1 WCHXMNUCCYDVSI-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 229930185605 Bisphenol Natural products 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 229920000265 Polyparaphenylene Polymers 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical class OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 2
- 239000006096 absorbing agent Substances 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 229910002056 binary alloy Inorganic materials 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 229920005669 high impact polystyrene Polymers 0.000 description 2
- 239000004797 high-impact polystyrene Substances 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 230000007774 longterm Effects 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 150000003014 phosphoric acid esters Chemical class 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 239000005060 rubber Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- JZFMNFJEQDUBPL-UHFFFAOYSA-N 1-sulfanyl-4,5-dihydroimidazole Chemical class SN1CCN=C1 JZFMNFJEQDUBPL-UHFFFAOYSA-N 0.000 description 1
- NCCNZPFRALYMEG-UHFFFAOYSA-N 10-(2,2-dibenzoylhydrazinyl)-10-oxodecanoic acid Chemical compound C(C1=CC=CC=C1)(=O)N(NC(CCCCCCCCC(=O)O)=O)C(C1=CC=CC=C1)=O NCCNZPFRALYMEG-UHFFFAOYSA-N 0.000 description 1
- YKJFUZBSMHHVDA-UHFFFAOYSA-N 10-(2,2-dimethoxyhydrazinyl)-10-oxodecanoic acid Chemical compound CON(NC(CCCCCCCCC(=O)O)=O)OC YKJFUZBSMHHVDA-UHFFFAOYSA-N 0.000 description 1
- RXFWDGKGKQSEJW-UHFFFAOYSA-N 10-(2,2-dimethylhydrazinyl)-10-oxodecanoic acid Chemical compound CN(NC(CCCCCCCCC(=O)O)=O)C RXFWDGKGKQSEJW-UHFFFAOYSA-N 0.000 description 1
- XKUFDXKJXOKASK-UHFFFAOYSA-N 10-[(diacetylamino)-methylamino]-10-oxodecanoic acid Chemical compound CC(=O)N(C(C)=O)N(C)C(=O)CCCCCCCCC(O)=O XKUFDXKJXOKASK-UHFFFAOYSA-N 0.000 description 1
- CGFHDBXKYSYMEL-UHFFFAOYSA-N 10-[2,2-bis(2-methylphenyl)hydrazinyl]-10-oxodecanoic acid Chemical compound C1(=C(C=CC=C1)N(NC(CCCCCCCCC(=O)O)=O)C1=C(C=CC=C1)C)C CGFHDBXKYSYMEL-UHFFFAOYSA-N 0.000 description 1
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 1
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 1
- KTMBVSDBOVYQFE-UHFFFAOYSA-N 2-(dimethylaminocarbamoyl)benzoic acid Chemical compound CN(C)NC(=O)C1=CC=CC=C1C(O)=O KTMBVSDBOVYQFE-UHFFFAOYSA-N 0.000 description 1
- AXKDYXSRYSKAEQ-UHFFFAOYSA-N 2-[(2-methyl-N-(2-methylphenyl)anilino)carbamoyl]benzoic acid Chemical compound C1(=C(C=CC=C1)N(NC(C=1C(C(=O)O)=CC=CC=1)=O)C1=C(C=CC=C1)C)C AXKDYXSRYSKAEQ-UHFFFAOYSA-N 0.000 description 1
- RVIBPIAGIOWPNU-UHFFFAOYSA-N 2-[(N-phenylanilino)carbamoyl]benzoic acid Chemical compound C1(=CC=CC=C1)N(NC(C=1C(C(=O)O)=CC=CC=1)=O)C1=CC=CC=C1 RVIBPIAGIOWPNU-UHFFFAOYSA-N 0.000 description 1
- JZORNYRVXIAZAU-UHFFFAOYSA-N 2-[(diacetylamino)-methylcarbamoyl]benzoic acid Chemical compound CC(=O)N(C(C)=O)N(C)C(=O)C1=CC=CC=C1C(O)=O JZORNYRVXIAZAU-UHFFFAOYSA-N 0.000 description 1
- HVTLDKRMORSVRP-UHFFFAOYSA-N 2-[(diacetylamino)-phenylcarbamoyl]benzoic acid Chemical compound C=1C=CC=CC=1N(N(C(=O)C)C(C)=O)C(=O)C1=CC=CC=C1C(O)=O HVTLDKRMORSVRP-UHFFFAOYSA-N 0.000 description 1
- XQXHMJZZLQWEBJ-UHFFFAOYSA-N 2-[(diacetylamino)carbamoyl]benzoic acid Chemical compound C(C)(=O)N(NC(C=1C(C(=O)O)=CC=CC=1)=O)C(C)=O XQXHMJZZLQWEBJ-UHFFFAOYSA-N 0.000 description 1
- JOUIWLDISZFHMJ-UHFFFAOYSA-N 2-[(dibenzoylamino)carbamoyl]benzoic acid Chemical compound C(C1=CC=CC=C1)(=O)N(NC(C=1C(C(=O)O)=CC=CC=1)=O)C(C1=CC=CC=C1)=O JOUIWLDISZFHMJ-UHFFFAOYSA-N 0.000 description 1
- WYFBFQMVFIAJKU-UHFFFAOYSA-N 2-[(dimethoxyamino)carbamoyl]benzoic acid Chemical compound CON(NC(C=1C(C(=O)O)=CC=CC=1)=O)OC WYFBFQMVFIAJKU-UHFFFAOYSA-N 0.000 description 1
- KFETUQFRWIVAMU-UHFFFAOYSA-N 2-methyl-6-propan-2-ylphenol Chemical compound CC(C)C1=CC=CC(C)=C1O KFETUQFRWIVAMU-UHFFFAOYSA-N 0.000 description 1
- GVLZQVREHWQBJN-UHFFFAOYSA-N 3,5-dimethyl-7-oxabicyclo[2.2.1]hepta-1,3,5-triene Chemical compound CC1=C(O2)C(C)=CC2=C1 GVLZQVREHWQBJN-UHFFFAOYSA-N 0.000 description 1
- LOPIYORHGQINPF-UHFFFAOYSA-N 3-(2,2-dibenzoylhydrazinyl)-3-oxopropanoic acid Chemical compound C(C1=CC=CC=C1)(=O)N(NC(CC(=O)O)=O)C(C1=CC=CC=C1)=O LOPIYORHGQINPF-UHFFFAOYSA-N 0.000 description 1
- VOAJSONLUJBGAB-UHFFFAOYSA-N 3-(2,2-dimethoxyhydrazinyl)-3-oxopropanoic acid Chemical compound CON(NC(CC(=O)O)=O)OC VOAJSONLUJBGAB-UHFFFAOYSA-N 0.000 description 1
- UFVJMKPEHJTFIL-UHFFFAOYSA-N 3-(2,2-dimethylhydrazinyl)-3-oxopropanoic acid Chemical compound CN(C)NC(=O)CC(O)=O UFVJMKPEHJTFIL-UHFFFAOYSA-N 0.000 description 1
- XEQCHEPHDDOYKC-UHFFFAOYSA-N 3-(2,2-diphenylhydrazinyl)-3-oxopropanoic acid Chemical compound C1(=CC=CC=C1)N(NC(CC(=O)O)=O)C1=CC=CC=C1 XEQCHEPHDDOYKC-UHFFFAOYSA-N 0.000 description 1
- TYCHCHCSYMCKPY-UHFFFAOYSA-N 3-(dimethylaminocarbamoyl)benzoic acid Chemical compound CN(C)NC(=O)C1=CC=CC(C(O)=O)=C1 TYCHCHCSYMCKPY-UHFFFAOYSA-N 0.000 description 1
- ZXOMEZCFYUWPPQ-UHFFFAOYSA-N 3-[(2-methyl-N-(2-methylphenyl)anilino)carbamoyl]benzoic acid Chemical compound C1(=C(C=CC=C1)N(NC(C1=CC(C(=O)O)=CC=C1)=O)C1=C(C=CC=C1)C)C ZXOMEZCFYUWPPQ-UHFFFAOYSA-N 0.000 description 1
- DQMVHTFAAHEXIL-UHFFFAOYSA-N 3-[(N-phenylanilino)carbamoyl]benzoic acid Chemical compound C1(=CC=CC=C1)N(NC(C1=CC(C(=O)O)=CC=C1)=O)C1=CC=CC=C1 DQMVHTFAAHEXIL-UHFFFAOYSA-N 0.000 description 1
- VBGITAIEFQLZPE-UHFFFAOYSA-N 3-[(diacetylamino)-methylamino]-3-oxopropanoic acid Chemical compound CC(=O)N(C(C)=O)N(C)C(=O)CC(O)=O VBGITAIEFQLZPE-UHFFFAOYSA-N 0.000 description 1
- FTLPJJBRHGALLH-UHFFFAOYSA-N 3-[(diacetylamino)-methylcarbamoyl]benzoic acid Chemical compound CC(=O)N(C(C)=O)N(C)C(=O)C1=CC=CC(C(O)=O)=C1 FTLPJJBRHGALLH-UHFFFAOYSA-N 0.000 description 1
- BAOVCOIGNPSGER-UHFFFAOYSA-N 3-[(diacetylamino)-phenylcarbamoyl]benzoic acid Chemical compound C=1C=CC=CC=1N(N(C(=O)C)C(C)=O)C(=O)C1=CC=CC(C(O)=O)=C1 BAOVCOIGNPSGER-UHFFFAOYSA-N 0.000 description 1
- PNVWNFMMSVMLAE-UHFFFAOYSA-N 3-[(dibenzoylamino)carbamoyl]benzoic acid Chemical compound C(C1=CC=CC=C1)(=O)N(NC(C1=CC(C(=O)O)=CC=C1)=O)C(C1=CC=CC=C1)=O PNVWNFMMSVMLAE-UHFFFAOYSA-N 0.000 description 1
- ZOOLMOWWKXJTJG-UHFFFAOYSA-N 3-[(dimethoxyamino)carbamoyl]benzoic acid Chemical compound CON(NC(C1=CC(C(=O)O)=CC=C1)=O)OC ZOOLMOWWKXJTJG-UHFFFAOYSA-N 0.000 description 1
- FODYWQMZYSCRAX-UHFFFAOYSA-N 4-(2,2-diacetylhydrazinyl)-4-oxobutanoic acid Chemical compound C(C)(=O)N(NC(CCC(=O)O)=O)C(C)=O FODYWQMZYSCRAX-UHFFFAOYSA-N 0.000 description 1
- UCPBLZXUQYTNRD-UHFFFAOYSA-N 4-(2,2-diphenylhydrazinyl)-4-oxobutanoic acid Chemical compound C1(=CC=CC=C1)N(NC(CCC(=O)O)=O)C1=CC=CC=C1 UCPBLZXUQYTNRD-UHFFFAOYSA-N 0.000 description 1
- AATLQJBLMOSMDZ-UHFFFAOYSA-N 4-(N-(diacetylamino)anilino)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)N(N(C(=O)C)C(C)=O)C1=CC=CC=C1 AATLQJBLMOSMDZ-UHFFFAOYSA-N 0.000 description 1
- BGEPNPHMLMMQKV-UHFFFAOYSA-N 4-(dimethylaminocarbamoyl)benzoic acid Chemical compound CN(C)NC(=O)C1=CC=C(C(O)=O)C=C1 BGEPNPHMLMMQKV-UHFFFAOYSA-N 0.000 description 1
- NJBYWNJHCBVGMR-UHFFFAOYSA-N 4-[(2-methyl-N-(2-methylphenyl)anilino)carbamoyl]benzoic acid Chemical compound C1(=C(C=CC=C1)N(NC(C1=CC=C(C(=O)O)C=C1)=O)C1=C(C=CC=C1)C)C NJBYWNJHCBVGMR-UHFFFAOYSA-N 0.000 description 1
- OPIVLGPVDZEBDZ-UHFFFAOYSA-N 4-[(diacetylamino)-methylamino]-4-oxobutanoic acid Chemical compound CC(=O)N(C(C)=O)N(C)C(=O)CCC(O)=O OPIVLGPVDZEBDZ-UHFFFAOYSA-N 0.000 description 1
- UPPXXSLQBBEIBL-UHFFFAOYSA-N 4-[(diacetylamino)-methylcarbamoyl]benzoic acid Chemical compound CC(=O)N(C(C)=O)N(C)C(=O)C1=CC=C(C(O)=O)C=C1 UPPXXSLQBBEIBL-UHFFFAOYSA-N 0.000 description 1
- VCBZUFCMSHXMHT-UHFFFAOYSA-N 4-[(diacetylamino)-phenylcarbamoyl]benzoic acid Chemical compound C=1C=CC=CC=1N(N(C(=O)C)C(C)=O)C(=O)C1=CC=C(C(O)=O)C=C1 VCBZUFCMSHXMHT-UHFFFAOYSA-N 0.000 description 1
- ANLBTTSAFNINND-UHFFFAOYSA-N 4-[(dimethoxyamino)carbamoyl]benzoic acid Chemical compound CON(NC(C1=CC=C(C(=O)O)C=C1)=O)OC ANLBTTSAFNINND-UHFFFAOYSA-N 0.000 description 1
- VWYKSJIPZHRLNO-UHFFFAOYSA-N 4-chloro-2,6-dimethylphenol Chemical compound CC1=CC(Cl)=CC(C)=C1O VWYKSJIPZHRLNO-UHFFFAOYSA-N 0.000 description 1
- IGXGMFXMIVITAM-UHFFFAOYSA-N 5-(2,2-diacetylhydrazinyl)-5-oxopentanoic acid Chemical compound C(C)(=O)N(NC(CCCC(=O)O)=O)C(C)=O IGXGMFXMIVITAM-UHFFFAOYSA-N 0.000 description 1
- IJXZLOMYALWPHU-UHFFFAOYSA-N 5-(2,2-dibenzoylhydrazinyl)-5-oxopentanoic acid Chemical compound C(C1=CC=CC=C1)(=O)N(NC(CCCC(=O)O)=O)C(C1=CC=CC=C1)=O IJXZLOMYALWPHU-UHFFFAOYSA-N 0.000 description 1
- KNLVFHSTJGQCFY-UHFFFAOYSA-N 5-(2,2-dimethoxyhydrazinyl)-5-oxopentanoic acid Chemical compound CON(NC(CCCC(=O)O)=O)OC KNLVFHSTJGQCFY-UHFFFAOYSA-N 0.000 description 1
- OXODCSOKVMCICS-UHFFFAOYSA-N 5-(2,2-dimethylhydrazinyl)-5-oxopentanoic acid Chemical compound CN(C)NC(=O)CCCC(O)=O OXODCSOKVMCICS-UHFFFAOYSA-N 0.000 description 1
- XTXMTJJFYMPQSD-UHFFFAOYSA-N 5-(2,2-diphenylhydrazinyl)-5-oxopentanoic acid Chemical compound C1(=CC=CC=C1)N(NC(CCCC(=O)O)=O)C1=CC=CC=C1 XTXMTJJFYMPQSD-UHFFFAOYSA-N 0.000 description 1
- LGGPUSBTUZWGKS-UHFFFAOYSA-N 5-(N-(diacetylamino)anilino)-5-oxopentanoic acid Chemical compound OC(=O)CCCC(=O)N(N(C(=O)C)C(C)=O)C1=CC=CC=C1 LGGPUSBTUZWGKS-UHFFFAOYSA-N 0.000 description 1
- IHXHXUNKYWXHKJ-UHFFFAOYSA-N 5-[(diacetylamino)-methylamino]-5-oxopentanoic acid Chemical compound CC(=O)N(C(C)=O)N(C)C(=O)CCCC(O)=O IHXHXUNKYWXHKJ-UHFFFAOYSA-N 0.000 description 1
- QEOIZUKWBVMJDB-UHFFFAOYSA-N 6-(2,2-dimethylhydrazinyl)-6-oxohexanoic acid Chemical compound CN(C)NC(=O)CCCCC(O)=O QEOIZUKWBVMJDB-UHFFFAOYSA-N 0.000 description 1
- OPASULVTNJHOHQ-UHFFFAOYSA-N 6-(N-(diacetylamino)anilino)-6-oxohexanoic acid Chemical compound OC(=O)CCCCC(=O)N(N(C(=O)C)C(C)=O)C1=CC=CC=C1 OPASULVTNJHOHQ-UHFFFAOYSA-N 0.000 description 1
- CVJPDBPYJQPEJT-UHFFFAOYSA-N 6-[(diacetylamino)-methylamino]-6-oxohexanoic acid Chemical compound CC(=O)N(C(C)=O)N(C)C(=O)CCCCC(O)=O CVJPDBPYJQPEJT-UHFFFAOYSA-N 0.000 description 1
- OHMVNYPHQKOVHA-UHFFFAOYSA-N 6-[2,2-bis(2-methylphenyl)hydrazinyl]-6-oxohexanoic acid Chemical compound C1(=C(C=CC=C1)N(NC(CCCCC(=O)O)=O)C1=C(C=CC=C1)C)C OHMVNYPHQKOVHA-UHFFFAOYSA-N 0.000 description 1
- QVPHNXHWEWWVIM-UHFFFAOYSA-N 8-(2,2-diacetylhydrazinyl)-8-oxooctanoic acid Chemical compound C(C)(=O)N(NC(CCCCCCC(=O)O)=O)C(C)=O QVPHNXHWEWWVIM-UHFFFAOYSA-N 0.000 description 1
- QTCVEPTXBHONIN-UHFFFAOYSA-N 8-(2,2-dibenzoylhydrazinyl)-8-oxooctanoic acid Chemical compound C(C1=CC=CC=C1)(=O)N(NC(CCCCCCC(=O)O)=O)C(C1=CC=CC=C1)=O QTCVEPTXBHONIN-UHFFFAOYSA-N 0.000 description 1
- VLCSSYJEEQIRLC-UHFFFAOYSA-N 8-(2,2-dimethoxyhydrazinyl)-8-oxooctanoic acid Chemical compound CON(NC(CCCCCCC(=O)O)=O)OC VLCSSYJEEQIRLC-UHFFFAOYSA-N 0.000 description 1
- TUHBKRPJSFDWFX-UHFFFAOYSA-N 8-(2,2-dimethylhydrazinyl)-8-oxooctanoic acid Chemical compound CN(NC(CCCCCCC(=O)O)=O)C TUHBKRPJSFDWFX-UHFFFAOYSA-N 0.000 description 1
- KSSTUXUBQQMHSS-UHFFFAOYSA-N 8-(2,2-diphenylhydrazinyl)-8-oxooctanoic acid Chemical compound C1(=CC=CC=C1)N(NC(CCCCCCC(=O)O)=O)C1=CC=CC=C1 KSSTUXUBQQMHSS-UHFFFAOYSA-N 0.000 description 1
- OCYGHIYCAJYXHE-UHFFFAOYSA-N 8-(N-(diacetylamino)anilino)-8-oxooctanoic acid Chemical compound OC(=O)CCCCCCC(=O)N(N(C(=O)C)C(C)=O)C1=CC=CC=C1 OCYGHIYCAJYXHE-UHFFFAOYSA-N 0.000 description 1
- GEKDCMXVEUYFEM-UHFFFAOYSA-N 9-(2,2-diacetylhydrazinyl)-9-oxononanoic acid Chemical compound C(C)(=O)N(NC(CCCCCCCC(=O)O)=O)C(C)=O GEKDCMXVEUYFEM-UHFFFAOYSA-N 0.000 description 1
- JFUMWWCDWZGHTE-UHFFFAOYSA-N 9-(2,2-dibenzoylhydrazinyl)-9-oxononanoic acid Chemical compound C(C1=CC=CC=C1)(=O)N(NC(CCCCCCCC(=O)O)=O)C(C1=CC=CC=C1)=O JFUMWWCDWZGHTE-UHFFFAOYSA-N 0.000 description 1
- TYFFRFAPWXBYRP-UHFFFAOYSA-N 9-(2,2-dimethoxyhydrazinyl)-9-oxononanoic acid Chemical compound CON(NC(CCCCCCCC(=O)O)=O)OC TYFFRFAPWXBYRP-UHFFFAOYSA-N 0.000 description 1
- INVBCNARYVPDSD-UHFFFAOYSA-N 9-(2,2-dimethylhydrazinyl)-9-oxononanoic acid Chemical compound CN(NC(CCCCCCCC(=O)O)=O)C INVBCNARYVPDSD-UHFFFAOYSA-N 0.000 description 1
- HOBQOOCZPXXXRI-UHFFFAOYSA-N 9-(2,2-diphenylhydrazinyl)-9-oxononanoic acid Chemical compound C1(=CC=CC=C1)N(NC(CCCCCCCC(=O)O)=O)C1=CC=CC=C1 HOBQOOCZPXXXRI-UHFFFAOYSA-N 0.000 description 1
- QJMAQMWELSNDNL-UHFFFAOYSA-N 9-[(diacetylamino)-methylamino]-9-oxononanoic acid Chemical compound CC(=O)N(C(C)=O)N(C)C(=O)CCCCCCCC(O)=O QJMAQMWELSNDNL-UHFFFAOYSA-N 0.000 description 1
- 241000238876 Acari Species 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- XUKUURHRXDUEBC-KAYWLYCHSA-N Atorvastatin Chemical compound C=1C=CC=CC=1C1=C(C=2C=CC(F)=CC=2)N(CC[C@@H](O)C[C@@H](O)CC(O)=O)C(C(C)C)=C1C(=O)NC1=CC=CC=C1 XUKUURHRXDUEBC-KAYWLYCHSA-N 0.000 description 1
- 241000195940 Bryophyta Species 0.000 description 1
- 229920000089 Cyclic olefin copolymer Polymers 0.000 description 1
- NOQGZXFMHARMLW-UHFFFAOYSA-N Daminozide Chemical compound CN(C)NC(=O)CCC(O)=O NOQGZXFMHARMLW-UHFFFAOYSA-N 0.000 description 1
- 101100022451 Mus musculus Mbnl3 gene Proteins 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- JCOVWQVDUCYFLD-UHFFFAOYSA-N [acetyloxy(hydroxy)phosphanyl] acetate;hexanedioic acid Chemical compound CC(=O)OP(O)OC(C)=O.OC(=O)CCCCC(O)=O JCOVWQVDUCYFLD-UHFFFAOYSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-N benzene-dicarboxylic acid Natural products OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000010354 butylated hydroxytoluene Nutrition 0.000 description 1
- BBBFJLBPOGFECG-VJVYQDLKSA-N calcitonin Chemical compound N([C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H]([C@@H](C)O)C(=O)N1[C@@H](CCC1)C(N)=O)C(C)C)C(=O)[C@@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1 BBBFJLBPOGFECG-VJVYQDLKSA-N 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000000805 composite resin Substances 0.000 description 1
- 238000012790 confirmation Methods 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000002542 deteriorative effect Effects 0.000 description 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 150000004659 dithiocarbamates Chemical class 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 208000037805 labour Diseases 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 210000004914 menses Anatomy 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000000018 nitroso group Chemical group N(=O)* 0.000 description 1
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-N o-dicarboxybenzene Natural products OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical class OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 150000003017 phosphorus Chemical class 0.000 description 1
- DOIRQSBPFJWKBE-UHFFFAOYSA-N phthalic acid di-n-butyl ester Natural products CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 1
- 235000013824 polyphenols Nutrition 0.000 description 1
- 229920013636 polyphenyl ether polymer Polymers 0.000 description 1
- 229920013637 polyphenylene oxide polymer Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 229920005992 thermoplastic resin Polymers 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 239000012801 ultraviolet ray absorbent Substances 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B07—SEPARATING SOLIDS FROM SOLIDS; SORTING
- B07B—SEPARATING SOLIDS FROM SOLIDS BY SIEVING, SCREENING, SIFTING OR BY USING GAS CURRENTS; SEPARATING BY OTHER DRY METHODS APPLICABLE TO BULK MATERIAL, e.g. LOOSE ARTICLES FIT TO BE HANDLED LIKE BULK MATERIAL
- B07B4/00—Separating solids from solids by subjecting their mixture to gas currents
- B07B4/02—Separating solids from solids by subjecting their mixture to gas currents while the mixtures fall
- B07B4/025—Separating solids from solids by subjecting their mixture to gas currents while the mixtures fall the material being slingered or fled out horizontally before falling, e.g. by dispersing elements
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J2/00—Processes or devices for granulating materials, e.g. fertilisers in general; Rendering particulate materials free flowing in general, e.g. making them hydrophobic
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J8/00—Chemical or physical processes in general, conducted in the presence of fluids and solid particles; Apparatus for such processes
- B01J8/08—Chemical or physical processes in general, conducted in the presence of fluids and solid particles; Apparatus for such processes with moving particles
- B01J8/12—Chemical or physical processes in general, conducted in the presence of fluids and solid particles; Apparatus for such processes with moving particles moved by gravity in a downward flow
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L71/00—Compositions of polyethers obtained by reactions forming an ether link in the main chain; Compositions of derivatives of such polymers
- C08L71/08—Polyethers derived from hydroxy compounds or from their metallic derivatives
- C08L71/10—Polyethers derived from hydroxy compounds or from their metallic derivatives from phenols
- C08L71/12—Polyphenylene oxides
- C08L71/123—Polyphenylene oxides not modified by chemical after-treatment
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L69/00—Compositions of polycarbonates; Compositions of derivatives of polycarbonates
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L85/00—Compositions of macromolecular compounds obtained by reactions forming a linkage in the main chain of the macromolecule containing atoms other than silicon, sulfur, nitrogen, oxygen and carbon; Compositions of derivatives of such polymers
- C08L85/02—Compositions of macromolecular compounds obtained by reactions forming a linkage in the main chain of the macromolecule containing atoms other than silicon, sulfur, nitrogen, oxygen and carbon; Compositions of derivatives of such polymers containing phosphorus
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP12792073A JPS5140899B2 (enExample) | 1973-11-14 | 1973-11-14 | |
| JP13899073A JPS5125266B2 (enExample) | 1973-12-12 | 1973-12-12 | |
| JP2555774A JPS5133939B2 (enExample) | 1974-03-05 | 1974-03-05 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2454124A1 DE2454124A1 (de) | 1975-05-15 |
| DE2454124B2 DE2454124B2 (de) | 1979-01-25 |
| DE2454124C3 true DE2454124C3 (de) | 1979-09-27 |
Family
ID=27285059
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2454124A Expired DE2454124C3 (de) | 1973-11-14 | 1974-11-14 | Stabilisierte Polyphenylenäther-Harzmassen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3952072A (enExample) |
| DE (1) | DE2454124C3 (enExample) |
| FR (2) | FR1060698A (enExample) |
| GB (1) | GB1494504A (enExample) |
| IT (1) | IT1025691B (enExample) |
| NL (2) | NL171593C (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4350793A (en) | 1980-01-26 | 1982-09-21 | Bayer Aktiengesellschaft | Flame-retardant composition of polyphenylene ether, polystyrene resin and polyphosphonate |
Families Citing this family (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1103900B (de) * | 1955-12-14 | 1961-04-06 | Salzdefurth Ver Kaliwerke | Verfahren zur Herstellung gleichmaessiger Granulate aus schmelzbaren Stoffen |
| JPS5146351A (en) * | 1974-10-18 | 1976-04-20 | Mitsubishi Gas Chemical Co | Shinkina horifuenireneeterukeijushisoseibutsu |
| US4525508A (en) * | 1976-12-28 | 1985-06-25 | General Electric Company | Plasticized reinforced compositions of a polyphenylene ether resin |
| US4141876A (en) * | 1977-09-23 | 1979-02-27 | Shell Oil Company | Adhesive composition containing a polyphenylene ether resin |
| US4228063A (en) * | 1979-05-25 | 1980-10-14 | American Cyanamid Company | Flame-retardant, polyphenylene-ether resin compositions containing a 2,5,5-trisubstituted 1,3,2-dioxaphosphorinane-2-oxide |
| CA1156439A (en) * | 1980-07-30 | 1983-11-08 | Abraham A. Pegels | Moving catalyst bed reactor treating hydrocarbons |
| CA1185726A (en) * | 1981-05-15 | 1985-04-16 | Gim F. Lee, Jr. | Impact strength improved polyphenylene ether resin compositions |
| NZ201977A (en) * | 1981-10-01 | 1985-08-16 | Peters Ag Claudius | Distributing particulate material into spray mixing vessel |
| JPS58103556A (ja) * | 1981-12-15 | 1983-06-20 | Mitsubishi Petrochem Co Ltd | 耐衝撃性ポリフエニレンエ−テル組成物 |
| JPS598751A (ja) * | 1982-07-07 | 1984-01-18 | Mitsubishi Gas Chem Co Inc | 安定化されたポリフエニレンエ−テル系樹脂組成物 |
| US4588764A (en) * | 1984-08-16 | 1986-05-13 | General Electric Company | Compositions of polyphenylene ether resin and diphosphites |
| NL8403863A (nl) * | 1984-12-20 | 1986-07-16 | Gen Electric | Polymeermengsel, dat een polyfenyleenether en een dihydrazide stabilisator bevat. |
| US4970272A (en) * | 1986-01-06 | 1990-11-13 | General Electric Company | Polyphenylene ether-polyamide compositions |
| GB8727701D0 (en) * | 1987-11-26 | 1987-12-31 | Hambro Machinery Ltd | Fluid distribution device |
| NL8901093A (nl) * | 1989-05-01 | 1990-12-03 | Gen Electric | Materiaal dat ten minste 20% polyfenyleenether bevat en dat een kleine hoeveelheid brandvertragend middel en desgewenst een weekmaker en verdere gebruikelijke toevoegsels bevat. |
| US5284886A (en) * | 1989-10-31 | 1994-02-08 | Elf Atochem North America, Inc. | Non-toxic polymeric compositions stabilized with organosulfide antioxidants |
| US5081169A (en) * | 1989-10-31 | 1992-01-14 | Atochem North America, Inc. | Organic sulfide stabilized polymeric engineering resins |
| IT1243441B (it) * | 1990-10-10 | 1994-06-10 | Montedipe Srl | Composizioni di polifenilenossido o di miscele di polifenilenossido ststabilizzate con beta-dichetoni |
| ES2120950T3 (es) * | 1990-12-17 | 1998-11-16 | Gen Electric | Mezclas de poli(fenilen eter) y caucho de dienos termicamente estables. |
| JP2501052B2 (ja) * | 1991-09-04 | 1996-05-29 | 信越化学工業株式会社 | 有機けい素化合物の着色防止方法 |
| KR940011606A (ko) * | 1992-11-05 | 1994-06-21 | 에른스트 알테르 | α,ω-알칸디페놀, 이를 함유하는 조성물 및 이들의 안정화제로서의 용도 |
| USH1725H (en) * | 1996-02-23 | 1998-05-05 | Shell Oil Company | Clear polyphenylene ether/block copolymer composition |
| US6861499B2 (en) * | 2003-02-24 | 2005-03-01 | Triton Systems, Inc. | Branched polyphosphonates that exhibit an advantageous combination of properties, and methods related thereto |
| US20040167283A1 (en) * | 2003-02-24 | 2004-08-26 | Michael Vinciguerra | Linear polyphosphonates that exhibit an advantageous combination of properties, and methods related thereto |
| US7560525B2 (en) * | 2004-04-02 | 2009-07-14 | Frx Polymers, Llc | Crystalline polyphosphonates and methods related thereto |
| WO2005121220A2 (en) * | 2004-06-04 | 2005-12-22 | Triton Systems, Inc. | Preparation of polyphosphonates via transesterification without a catalyst |
| US7569717B2 (en) * | 2005-07-19 | 2009-08-04 | Frx Polymers, Llc | Diaryl alkylphosphonates and method for preparing same |
| US7645850B2 (en) * | 2005-08-11 | 2010-01-12 | Frx Polymers, Inc. | Poly(block-phosphonato-ester) and poly(block-phosphonato-carbonate) and methods of making same |
| US7666932B2 (en) * | 2005-10-17 | 2010-02-23 | Frx Polymers, Inc. | Compositions comprising polyphosphonates and additives that exhibit an advantageous combination of properties, and methods related thereto |
| WO2007079272A2 (en) * | 2005-10-18 | 2007-07-12 | Frx Polymers Llc | Diaryl alkylphosphonates and methods for preparing same |
| US7838604B2 (en) * | 2005-12-01 | 2010-11-23 | Frx Polymers, Inc. | Method for the production of block copolycarbonate/phosphonates and compositions therefrom |
| US7928259B2 (en) * | 2008-02-12 | 2011-04-19 | Frx Polymers, Inc. | Diaryl alkylphosphonates and methods for preparing same |
| US8057873B2 (en) * | 2008-04-28 | 2011-11-15 | Sabic Innovative Plastics Ip B.V. | Injection molded article and method for the manufacture thereof |
| EP2328963B1 (en) * | 2008-08-29 | 2016-04-06 | Solvay Specialty Polymers USA, LLC. | Polyarylene compositions having enhanced flow properties |
| US7790791B2 (en) * | 2008-10-21 | 2010-09-07 | Sabic Innovative Plastics Ip B.V. | Injection molded article and method for the manufacture thereof |
| US8524137B2 (en) | 2011-05-26 | 2013-09-03 | Sabic Innovative Plastics Ip B.V. | Injection molded article and method for the manufacture thereof |
| CN103804158B (zh) * | 2012-11-02 | 2018-06-01 | Dic株式会社 | 受阻酚的制造方法及其制造中间体 |
| TW201439222A (zh) | 2013-01-22 | 2014-10-16 | Frx Polymers Inc | 含磷環氧化合物及源自其之組成物 |
| KR101714191B1 (ko) * | 2015-08-12 | 2017-03-08 | 현대자동차주식회사 | 고강성 및 고충격 폴리페닐렌 에테르 난연 수지 조성물 |
| US11345819B2 (en) * | 2017-12-08 | 2022-05-31 | Milliken & Company | Leuco compounds and compositions comprising the same |
| CN110818506B (zh) * | 2019-11-25 | 2021-11-30 | 史丹利农业集团股份有限公司 | 一种花生专用控释肥及其制备方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1101622A (en) * | 1965-01-13 | 1968-01-31 | Gen Electric | Polyphenylene oxide stabilizers |
| US3483271A (en) * | 1967-01-27 | 1969-12-09 | Gen Electric | Polyphenylene ethers stabilized with combinations of nitrogen-containing stabilizers |
| US3465062A (en) * | 1967-02-02 | 1969-09-02 | Gen Electric | Stable polyphenylene ether composition |
| JPS4643473B1 (enExample) * | 1967-09-02 | 1971-12-23 | ||
| US3639508A (en) * | 1969-01-03 | 1972-02-01 | Gen Electric | Thermoplastic blends of polyarylene oxide and block polymer and method for making them |
| US3700750A (en) * | 1970-01-07 | 1972-10-24 | Sumitomo Chemical Co | Stabilized polyphenylene oxide composition |
| US3761541A (en) * | 1971-10-12 | 1973-09-25 | Gen Electric | Stabilized polyphenylene ethers |
-
0
- NL NL90598D patent/NL90598C/xx active
-
1952
- 1952-07-31 FR FR1060698D patent/FR1060698A/fr not_active Expired
-
1974
- 1974-11-13 GB GB49176/74A patent/GB1494504A/en not_active Expired
- 1974-11-14 US US05/523,931 patent/US3952072A/en not_active Expired - Lifetime
- 1974-11-14 NL NLAANVRAGE7414883,A patent/NL171593C/xx not_active IP Right Cessation
- 1974-11-14 IT IT29427/74A patent/IT1025691B/it active
- 1974-11-14 DE DE2454124A patent/DE2454124C3/de not_active Expired
- 1974-11-27 FR FR7438807A patent/FR2266727B1/fr not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4350793A (en) | 1980-01-26 | 1982-09-21 | Bayer Aktiengesellschaft | Flame-retardant composition of polyphenylene ether, polystyrene resin and polyphosphonate |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2454124B2 (de) | 1979-01-25 |
| NL171593C (nl) | 1983-04-18 |
| GB1494504A (en) | 1977-12-07 |
| FR2266727A1 (enExample) | 1975-10-31 |
| NL90598C (enExample) | |
| IT1025691B (it) | 1978-08-30 |
| NL7414883A (nl) | 1975-05-16 |
| NL171593B (nl) | 1982-11-16 |
| FR2266727B1 (enExample) | 1978-08-18 |
| DE2454124A1 (de) | 1975-05-15 |
| FR1060698A (fr) | 1954-04-05 |
| US3952072A (en) | 1976-04-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2454124C3 (de) | Stabilisierte Polyphenylenäther-Harzmassen | |
| DE2446452C2 (de) | Thermoplastische Preßmasse | |
| DE69006286T2 (de) | Thermogeformte Polyestergegenstände. | |
| DE1694272A1 (de) | Natur- oder Synthesekautschukmassen | |
| DE2525513A1 (de) | Stabilisierte polyalkylenharz- gemische | |
| DE69032397T2 (de) | Stabilisierte aromatische polykarbonatzusammensetzung und herstellung | |
| DE2249680C3 (de) | Stabilisierte Polyphenylenäther | |
| DE1255303B (de) | Verfahren zum Stabilisieren von Homo- oder Mischpolymerisaten aus alpha-Monoolefinen | |
| DE1694354A1 (de) | Stabilisierte Polyphenylaether | |
| DE2421309A1 (de) | Veresterte isopropanolamine, verfahren zu ihrer herstellung und verwendung derselben | |
| EP0943654B1 (de) | Oligomeres Stabilisatorgemisch | |
| DE2013505A1 (de) | Polyesterformmasse mit verbesserter Verarbeitbarkeit | |
| DE1768750C3 (de) | Äther von 2,4,6, Tn s (di tert butyl hydroxy benzyl) phenolen | |
| DE1953132A1 (de) | Hexahydro-1,3,5-tris-(4-hydroxyaryl)-s-triazine und damit stabilisierte organische Materialien | |
| DE2749261C2 (de) | Formmasse | |
| DE2656748C2 (de) | Phosphitgemische, Verfahren zu ihrer Herstellung und ihre Verwendung zum Stabilisieren organischer Materialien | |
| DE1224924B (de) | Verfahren zum Stabilisieren von Polyolefinen | |
| DE1922327A1 (de) | Polyolefinpraeparat | |
| DE1226784B (de) | Verfahren zum Stabilisieren von Polyolefinen | |
| DE2730345B2 (de) | Flammhemmende Polyphenylenäther- | |
| DE1285172B (de) | Thermoplastische Massen zur Herstellung von gegen Lichteinfluss stabilisierten Formkoerpern aus Polyolefinen | |
| DE1812970C (de) | Wärmebeständige thermoplastische Massen aus kristallinem Polypropylen, 10 - 60 Gew.-% Chrysotil und einer Stabilisatorenkombination | |
| DE2321526A1 (de) | Acylderivate substituierter piperazine und deren verwendung zum stabilisieren von polymerisatzusammensetzungen | |
| DE2229550B2 (de) | Stabilisierte Masse aus einem Polyphenylenäther und einem Polystyrolharz | |
| DE1220602B (de) | Verfahren zum Stabilisieren von Polyolefinen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: BERENDT, T., DIPL.-CHEM. DR., PAT.-ANW., 8000 MUENCHEN |
|
| 8339 | Ceased/non-payment of the annual fee |