DE2450851C2 - - Google Patents
Info
- Publication number
- DE2450851C2 DE2450851C2 DE2450851A DE2450851A DE2450851C2 DE 2450851 C2 DE2450851 C2 DE 2450851C2 DE 2450851 A DE2450851 A DE 2450851A DE 2450851 A DE2450851 A DE 2450851A DE 2450851 C2 DE2450851 C2 DE 2450851C2
- Authority
- DE
- Germany
- Prior art keywords
- weight
- styrene
- bisphenol
- copolymer
- parts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical group C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 61
- 229920000515 polycarbonate Polymers 0.000 claims description 48
- 239000004417 polycarbonate Substances 0.000 claims description 48
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 40
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 claims description 34
- 229930185605 Bisphenol Natural products 0.000 claims description 27
- 125000003118 aryl group Chemical group 0.000 claims description 27
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 20
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 18
- 239000000203 mixture Substances 0.000 claims description 18
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 claims description 17
- 239000011342 resin composition Substances 0.000 claims description 17
- 229920001577 copolymer Polymers 0.000 claims description 12
- 239000003063 flame retardant Substances 0.000 claims description 11
- -1 vinyl aromatic hydrocarbon Chemical class 0.000 claims description 10
- 229920000642 polymer Polymers 0.000 claims description 9
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 8
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 239000005062 Polybutadiene Substances 0.000 claims description 5
- 239000000654 additive Substances 0.000 claims description 5
- 150000002367 halogens Chemical group 0.000 claims description 5
- 229920002857 polybutadiene Polymers 0.000 claims description 5
- 229920005989 resin Polymers 0.000 claims description 5
- 239000011347 resin Substances 0.000 claims description 5
- 229920002554 vinyl polymer Polymers 0.000 claims description 5
- 229920001971 elastomer Polymers 0.000 claims description 4
- 239000006057 Non-nutritive feed additive Substances 0.000 claims description 3
- 239000003963 antioxidant agent Substances 0.000 claims description 3
- 239000000975 dye Substances 0.000 claims description 3
- 229920000578 graft copolymer Polymers 0.000 claims description 3
- 239000000049 pigment Substances 0.000 claims description 3
- 239000004014 plasticizer Substances 0.000 claims description 3
- 239000012744 reinforcing agent Substances 0.000 claims description 3
- 239000003381 stabilizer Substances 0.000 claims description 3
- 239000004709 Chlorinated polyethylene Substances 0.000 claims description 2
- 239000006096 absorbing agent Substances 0.000 claims description 2
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 claims description 2
- 239000004676 acrylonitrile butadiene styrene Substances 0.000 claims description 2
- 150000001463 antimony compounds Chemical class 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 229920002959 polymer blend Polymers 0.000 claims description 2
- 239000004800 polyvinyl chloride Substances 0.000 claims description 2
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 2
- 229920003048 styrene butadiene rubber Polymers 0.000 claims description 2
- 238000000034 method Methods 0.000 description 13
- 238000012360 testing method Methods 0.000 description 9
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 7
- 238000003825 pressing Methods 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 230000000704 physical effect Effects 0.000 description 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 238000010557 suspension polymerization reaction Methods 0.000 description 3
- IRIAEXORFWYRCZ-UHFFFAOYSA-N Butylbenzyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCC1=CC=CC=C1 IRIAEXORFWYRCZ-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 238000007720 emulsion polymerization reaction Methods 0.000 description 2
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 2
- 239000000347 magnesium hydroxide Substances 0.000 description 2
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 238000006068 polycondensation reaction Methods 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000005060 rubber Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 1
- YAJYJWXEWKRTPO-UHFFFAOYSA-N 2,3,3,4,4,5-hexamethylhexane-2-thiol Chemical compound CC(C)C(C)(C)C(C)(C)C(C)(C)S YAJYJWXEWKRTPO-UHFFFAOYSA-N 0.000 description 1
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 description 1
- BTOVVHWKPVSLBI-UHFFFAOYSA-N 2-methylprop-1-enylbenzene Chemical compound CC(C)=CC1=CC=CC=C1 BTOVVHWKPVSLBI-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- QHPQWRBYOIRBIT-UHFFFAOYSA-N 4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C=C1 QHPQWRBYOIRBIT-UHFFFAOYSA-N 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 229920000049 Carbon (fiber) Polymers 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 102100029290 Transthyretin Human genes 0.000 description 1
- 108050000089 Transthyretin Proteins 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000004917 carbon fiber Substances 0.000 description 1
- 239000012295 chemical reaction liquid Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 150000003440 styrenes Chemical class 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 229920005992 thermoplastic resin Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- STCOOQWBFONSKY-UHFFFAOYSA-N tributyl phosphate Chemical compound CCCCOP(=O)(OCCCC)OCCCC STCOOQWBFONSKY-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L55/00—Compositions of homopolymers or copolymers, obtained by polymerisation reactions only involving carbon-to-carbon unsaturated bonds, not provided for in groups C08L23/00 - C08L53/00
- C08L55/02—ABS [Acrylonitrile-Butadiene-Styrene] polymers
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L69/00—Compositions of polycarbonates; Compositions of derivatives of polycarbonates
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP12016173A JPS5430417B2 (enExample) | 1973-10-25 | 1973-10-25 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2450851A1 DE2450851A1 (de) | 1975-04-30 |
| DE2450851C2 true DE2450851C2 (enExample) | 1990-11-15 |
Family
ID=14779450
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742450851 Granted DE2450851A1 (de) | 1973-10-25 | 1974-10-25 | Feuerhemmende schlagfeste harzmassen |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3947524A (enExample) |
| JP (1) | JPS5430417B2 (enExample) |
| DE (1) | DE2450851A1 (enExample) |
| FR (1) | FR2249123B1 (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3988389A (en) * | 1972-12-06 | 1976-10-26 | Bayer Aktiengesellschaft | Moulding compositions contain polycarbonate and graft copolymer of a resin forming monomer on a rubber |
| DE2712171C2 (de) * | 1977-03-19 | 1984-09-27 | Bayer Ag, 5090 Leverkusen | Thermoplastische Formmassen |
| DE2712231C2 (de) * | 1977-03-19 | 1985-06-05 | Bayer Ag, 5090 Leverkusen | Segmentpolymere |
| DE2818679A1 (de) * | 1978-04-27 | 1979-10-31 | Bayer Ag | Thermoplastische formmassen |
| WO1980000154A1 (en) * | 1978-06-22 | 1980-02-07 | Gen Electric | Low melt viscosity polycarbonate compositions having improved impact strength |
| DE2853574A1 (de) * | 1978-12-12 | 1980-07-03 | Bayer Ag | Waermestandfeste thermoplastisch- elastomere polymermischung |
| NL8005972A (nl) * | 1980-10-31 | 1982-05-17 | Stamicarbon | Polymeercompositie. |
| JPS5883044A (ja) * | 1981-11-12 | 1983-05-18 | Sumitomo Naugatuck Co Ltd | 熱可塑性樹脂組成物 |
| DE3277772D1 (en) * | 1981-09-09 | 1988-01-14 | Sumitomo Naugatuck | Thermoplastic composition |
| DE3377138D1 (en) * | 1982-09-10 | 1988-07-28 | Bayer Ag | Flame-retardant polymer mixtures |
| JPS5966450A (ja) * | 1982-10-07 | 1984-04-14 | Sumitomo Naugatuck Co Ltd | 熱可塑性樹脂組成物 |
| US4602051A (en) * | 1983-09-07 | 1986-07-22 | Denki Kagaku Kogyo Kabushiki Kaisha | Resin composition having electromagnetic wave shielding effort |
| DE3338502A1 (de) * | 1983-10-22 | 1985-05-02 | Bayer Ag, 5090 Leverkusen | Selbstverloeschende thermoplastische formmassen aus polycarbonat und abs-polymerisaten |
| US4710534A (en) * | 1985-12-09 | 1987-12-01 | General Electric Company | Low gloss, flame reterdant, impact resistant polycarbonate composition |
| US4855357A (en) * | 1988-10-12 | 1989-08-08 | General Electric Company | Low-temperature impact blends of polycarbonate, graft copolymer and rigid copolymer |
| US4918125A (en) * | 1988-12-27 | 1990-04-17 | General Electric Company | Flame retardant carbonate polymer blends |
| US5227443A (en) * | 1989-12-21 | 1993-07-13 | General Electric Company | Flame retardant polymer with stable polymeric additive |
| IL153812A0 (en) * | 2003-01-06 | 2003-07-31 | Bromine Compounds Ltd | Improved wood-plastic composites |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE532543A (enExample) * | 1953-10-16 | |||
| US3062781A (en) * | 1958-07-02 | 1962-11-06 | Bayer Ag | Process for the production of polycarbonates |
| US3130177A (en) * | 1961-03-24 | 1964-04-21 | Borg Warner | Blends of polycarbonates with polybutadiene, styrene, acrylonitrile graft copolymers |
| US3162695A (en) * | 1961-06-26 | 1964-12-22 | Borg Warner | Blends of polycarbonates with butadiene-styrene, methyl methacrylate, styrene graft copolymer |
| GB1045533A (en) * | 1963-02-21 | 1966-10-12 | Gen Electric | Flame-resistant polycarbonate compositions |
| DE1900756C3 (de) * | 1969-01-08 | 1981-06-04 | Bayer Ag, 5090 Leverkusen | Thermoplastische Formmassen und Formkörper aus Polycarbonat und einem ABS-Pfropfpolymerisat |
| US3649712A (en) * | 1969-10-23 | 1972-03-14 | Borg Warner | Thermoplastic polycarbonate/polysulfone/flame retardant blends |
| BE790385A (fr) * | 1971-11-01 | 1973-02-15 | Gen Electric | Perfectionnements aux compositions thermoplastiques a inflammation retardee, et aux procedes pour leur |
| JPS52503B2 (enExample) * | 1971-12-29 | 1977-01-08 | ||
| US3801673A (en) * | 1972-01-03 | 1974-04-02 | Gen Electric | Process for preparing polycarbonate alloys |
| DE2329548C2 (de) * | 1973-06-09 | 1987-02-12 | Bayer Ag, 5090 Leverkusen | Thermoplastische Massen |
-
1973
- 1973-10-25 JP JP12016173A patent/JPS5430417B2/ja not_active Expired
-
1974
- 1974-10-23 US US05/517,197 patent/US3947524A/en not_active Expired - Lifetime
- 1974-10-25 DE DE19742450851 patent/DE2450851A1/de active Granted
- 1974-10-25 FR FR7435899A patent/FR2249123B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2249123A1 (enExample) | 1975-05-23 |
| US3947524A (en) | 1976-03-30 |
| JPS5430417B2 (enExample) | 1979-10-01 |
| DE2450851A1 (de) | 1975-04-30 |
| FR2249123B1 (enExample) | 1979-02-23 |
| JPS5071741A (enExample) | 1975-06-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2450851C2 (enExample) | ||
| DE2653143C2 (de) | Thermoplastische Formmassen | |
| EP0244856B1 (de) | Thermoplastische Formmasse auf Basis von Polycarbonat, ASA und Vinylaromaten/AN enthaltenden Copolymerisaten | |
| DE60009573T2 (de) | Polycarbonate mischungen mit verbesserter fliessfähigkeit | |
| DE2947421C2 (enExample) | ||
| EP0429957B1 (de) | Thermoplastische Formmassen mit hoher Kältezähigkeit | |
| DE2264104B2 (de) | Thermoplastische Polycarbonat-Formmassen | |
| DE2418763A1 (de) | Thermoplastische masse | |
| EP0158931A1 (de) | Thermoplastische Formmassen auf Basis von Polycarbonat-Pfropfpolymerisat-Gemischen | |
| EP0312929A2 (de) | Thermoplastische Formmasse, Verfahren zu ihrer Herstellung und deren Verwendung | |
| DE3855484T2 (de) | Feuerhemmende, schlagmodifizierte Karbonatpolymerzusammensetzung und Verfahren zu deren Herstellung | |
| DE3782567T2 (de) | Mischungen auf basis von polycarbonaten mit verbesserten physikalischen und chemischen eigenschaften. | |
| DE3001901C3 (de) | Feuerhemmende Harzmasse und ihre Verwendung | |
| DE69627958T2 (de) | Flammfeste Polycarbonatzusammensetzung enthaltend Pfropfcopolymere | |
| DE2446327C3 (de) | Schlagfeste, feuerhemmende Formmasse | |
| DE3338502A1 (de) | Selbstverloeschende thermoplastische formmassen aus polycarbonat und abs-polymerisaten | |
| DE69330025T2 (de) | Thermoplastische Harzzusammensetzungen | |
| EP0230914A2 (de) | Schlagzähe thermoplastische Formmasse und deren Verwendung | |
| DE60012959T2 (de) | Polycarbonatmischungen mit verbesserter fliessfähigkeit | |
| EP0096301A2 (de) | Einphasige Polymermischungen | |
| DE3332325A1 (de) | Thermoplastische formmasse | |
| EP0391296A1 (de) | Thermoplastische Formmasse | |
| DE3130774A1 (de) | Thermoplastische formmasse | |
| DE69210046T2 (de) | Entzündungsfeste carbonatpolymermischungen welche niedermolekulare halogenierte epoxidverbindungen enthalten | |
| DE3326562A1 (de) | Polycarbonat-gemische mit verbesserter schlagzaehigkeit |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8178 | Suspension cancelled | ||
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8366 | Restricted maintained after opposition proceedings | ||
| 8305 | Restricted maintenance of patent after opposition | ||
| D4 | Patent maintained restricted |