DE2448387A1 - Isocumarin-derivate enthaltende arzneimittel, neue isocumarin-derivate und verfahren zu ihrer herstellung - Google Patents
Isocumarin-derivate enthaltende arzneimittel, neue isocumarin-derivate und verfahren zu ihrer herstellungInfo
- Publication number
- DE2448387A1 DE2448387A1 DE19742448387 DE2448387A DE2448387A1 DE 2448387 A1 DE2448387 A1 DE 2448387A1 DE 19742448387 DE19742448387 DE 19742448387 DE 2448387 A DE2448387 A DE 2448387A DE 2448387 A1 DE2448387 A1 DE 2448387A1
- Authority
- DE
- Germany
- Prior art keywords
- carboxylic acid
- isocoumarin
- general formula
- group
- pharmacologically acceptable
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 22
- IQZZFVDIZRWADY-UHFFFAOYSA-N isocoumarin Chemical class C1=CC=C2C(=O)OC=CC2=C1 IQZZFVDIZRWADY-UHFFFAOYSA-N 0.000 title claims description 4
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- 229940126601 medicinal product Drugs 0.000 title claims 2
- 150000001875 compounds Chemical class 0.000 claims description 58
- 150000003839 salts Chemical class 0.000 claims description 26
- 239000003814 drug Substances 0.000 claims description 22
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 18
- 239000000203 mixture Substances 0.000 claims description 15
- 150000002512 isocoumarins Chemical class 0.000 claims description 14
- -1 tert-butoxy, phenyl Chemical group 0.000 claims description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 13
- 229910052717 sulfur Chemical group 0.000 claims description 13
- 125000004434 sulfur atom Chemical group 0.000 claims description 13
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 10
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 9
- 238000002347 injection Methods 0.000 claims description 8
- 239000007924 injection Substances 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 7
- KYWCUACNBIYDNL-UHFFFAOYSA-N 1-oxo-2h-isoquinoline-3-carboxylic acid Chemical compound C1=CC=C2C(=O)NC(C(=O)O)=CC2=C1 KYWCUACNBIYDNL-UHFFFAOYSA-N 0.000 claims description 6
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 6
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 6
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 6
- MFYRORXZDLTDBJ-UHFFFAOYSA-N 1-oxoisothiochromene-3-carboxylic acid Chemical compound C1=CC=C2C(=O)SC(C(=O)O)=CC2=C1 MFYRORXZDLTDBJ-UHFFFAOYSA-N 0.000 claims description 5
- 238000005903 acid hydrolysis reaction Methods 0.000 claims description 5
- 229910021529 ammonia Inorganic materials 0.000 claims description 5
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 claims description 5
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 5
- IIVRZNNHCNKESQ-UHFFFAOYSA-N 4-methyl-1-oxoisothiochromene-3-carboxylic acid Chemical compound C1=CC=C2C(C)=C(C(O)=O)SC(=O)C2=C1 IIVRZNNHCNKESQ-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 239000003513 alkali Substances 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- CRPAMTZHVXHTKH-UHFFFAOYSA-N 1-oxo-1H-isochromene-3-carboxylic acid Chemical compound C1=CC=C2C(=O)OC(C(=O)O)=CC2=C1 CRPAMTZHVXHTKH-UHFFFAOYSA-N 0.000 claims description 3
- HVBVPBGZSDEXCY-UHFFFAOYSA-N 4-methyl-1-oxo-2h-isoquinoline-3-carboxylic acid Chemical compound C1=CC=C2C(C)=C(C(O)=O)NC(=O)C2=C1 HVBVPBGZSDEXCY-UHFFFAOYSA-N 0.000 claims description 3
- KJFHUZPPSKJTDB-UHFFFAOYSA-N 6,7-dimethoxy-1-oxoisothiochromene-3-carboxylic acid Chemical compound C1=C(C(O)=O)SC(=O)C2=C1C=C(OC)C(OC)=C2 KJFHUZPPSKJTDB-UHFFFAOYSA-N 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 3
- 125000004423 acyloxy group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 150000001408 amides Chemical class 0.000 claims description 3
- 230000003266 anti-allergic effect Effects 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 239000002775 capsule Substances 0.000 claims description 3
- 125000002837 carbocyclic group Chemical group 0.000 claims description 3
- 239000012876 carrier material Substances 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 claims description 3
- 230000000144 pharmacologic effect Effects 0.000 claims description 3
- 239000000843 powder Substances 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 3
- 238000011282 treatment Methods 0.000 claims description 3
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 claims description 2
- UXOFKBQEKNWDJR-UHFFFAOYSA-N 4,8-dimethyl-1-oxoisochromene-3-carboxylic acid Chemical compound CC1=C(C(O)=O)OC(=O)C2=C1C=CC=C2C UXOFKBQEKNWDJR-UHFFFAOYSA-N 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- 229940124630 bronchodilator Drugs 0.000 claims description 2
- 239000000969 carrier Substances 0.000 claims description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 229960001317 isoprenaline Drugs 0.000 claims description 2
- 239000007788 liquid Substances 0.000 claims description 2
- 125000006606 n-butoxy group Chemical group 0.000 claims description 2
- 239000006187 pill Substances 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000005920 sec-butoxy group Chemical group 0.000 claims description 2
- 239000006188 syrup Substances 0.000 claims description 2
- 235000020357 syrup Nutrition 0.000 claims description 2
- 239000003826 tablet Substances 0.000 claims description 2
- YAPSJYCJCTVIQZ-UHFFFAOYSA-N 7-bromo-1-oxoisochromene-3-carboxylic acid Chemical compound C1=C(Br)C=C2C(=O)OC(C(=O)O)=CC2=C1 YAPSJYCJCTVIQZ-UHFFFAOYSA-N 0.000 claims 2
- 150000001735 carboxylic acids Chemical class 0.000 claims 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 2
- WGTKWKSCUZJIBY-UHFFFAOYSA-N 7-methoxy-1-oxoisochromene-3-carboxylic acid Chemical compound C1=C(C(O)=O)OC(=O)C2=CC(OC)=CC=C21 WGTKWKSCUZJIBY-UHFFFAOYSA-N 0.000 claims 1
- KJTNDSHTDRXCPQ-UHFFFAOYSA-N 7-methoxyisochromen-1-one Chemical compound C1=COC(=O)C2=CC(OC)=CC=C21 KJTNDSHTDRXCPQ-UHFFFAOYSA-N 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 claims 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims 1
- 230000007062 hydrolysis Effects 0.000 claims 1
- 238000006460 hydrolysis reaction Methods 0.000 claims 1
- VDBNYAPERZTOOF-UHFFFAOYSA-N isoquinolin-1(2H)-one Chemical compound C1=CC=C2C(=O)NC=CC2=C1 VDBNYAPERZTOOF-UHFFFAOYSA-N 0.000 claims 1
- 150000004682 monohydrates Chemical class 0.000 claims 1
- 239000011593 sulfur Substances 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 22
- 238000006243 chemical reaction Methods 0.000 description 10
- 238000001953 recrystallisation Methods 0.000 description 10
- 239000000543 intermediate Substances 0.000 description 6
- 206010002198 Anaphylactic reaction Diseases 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 208000003455 anaphylaxis Diseases 0.000 description 5
- 238000010790 dilution Methods 0.000 description 5
- 239000012895 dilution Substances 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 208000034656 Contusions Diseases 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 230000036783 anaphylactic response Effects 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- 210000002966 serum Anatomy 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- FNJVDWXUKLTFFL-UHFFFAOYSA-N diethyl 2-bromopropanedioate Chemical compound CCOC(=O)C(Br)C(=O)OCC FNJVDWXUKLTFFL-UHFFFAOYSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- PDPBEHRWSYREIE-UHFFFAOYSA-N 4-methyl-1-oxoisochromene-3-carboxylic acid Chemical compound C1=CC=C2C(C)=C(C(O)=O)OC(=O)C2=C1 PDPBEHRWSYREIE-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- 108010058846 Ovalbumin Proteins 0.000 description 2
- 241000700157 Rattus norvegicus Species 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 230000000172 allergic effect Effects 0.000 description 2
- 208000006673 asthma Diseases 0.000 description 2
- 208000010668 atopic eczema Diseases 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229940092253 ovalbumin Drugs 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- SGVBAFTXLZKMIP-UHFFFAOYSA-N 2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C=C1C(=O)NC(=S)S1 SGVBAFTXLZKMIP-UHFFFAOYSA-N 0.000 description 1
- WSBXOILPIAHLHF-UHFFFAOYSA-N 2-acetyl-4,5-dimethylbenzoic acid Chemical compound CC(=O)C1=CC(C)=C(C)C=C1C(O)=O WSBXOILPIAHLHF-UHFFFAOYSA-N 0.000 description 1
- PIWLKMHKNURVRN-UHFFFAOYSA-N 2-acetyl-6-methylbenzoic acid Chemical compound CC(=O)C1=CC=CC(C)=C1C(O)=O PIWLKMHKNURVRN-UHFFFAOYSA-N 0.000 description 1
- QDAWXRKTSATEOP-UHFFFAOYSA-N 2-acetylbenzoic acid Chemical compound CC(=O)C1=CC=CC=C1C(O)=O QDAWXRKTSATEOP-UHFFFAOYSA-N 0.000 description 1
- CXANNUKKXKKTKG-UHFFFAOYSA-N 2-formyl-4,5-dimethoxybenzoic acid Chemical compound COC1=CC(C=O)=C(C(O)=O)C=C1OC CXANNUKKXKKTKG-UHFFFAOYSA-N 0.000 description 1
- QCEQRNBCDJKUMU-UHFFFAOYSA-N 2-formyl-6-methylbenzoic acid Chemical compound CC1=CC=CC(C=O)=C1C(O)=O QCEQRNBCDJKUMU-UHFFFAOYSA-N 0.000 description 1
- DYNFCHNNOHNJFG-UHFFFAOYSA-N 2-formylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1C=O DYNFCHNNOHNJFG-UHFFFAOYSA-N 0.000 description 1
- KENOQFCIXCRXLA-UHFFFAOYSA-N 6,7-dimethoxy-1-oxo-2h-isoquinoline-3-carboxylic acid Chemical compound C1=C(C(O)=O)NC(=O)C2=C1C=C(OC)C(OC)=C2 KENOQFCIXCRXLA-UHFFFAOYSA-N 0.000 description 1
- CAGOEILZMOBELD-UHFFFAOYSA-N 6,7-dimethoxy-1-oxoisochromene-3-carboxylic acid Chemical compound C1=C(C(O)=O)OC(=O)C2=C1C=C(OC)C(OC)=C2 CAGOEILZMOBELD-UHFFFAOYSA-N 0.000 description 1
- HVXXOIGTXJOVON-UHFFFAOYSA-N 6-formyl-2,3-dimethoxybenzoic acid Chemical compound COC1=CC=C(C=O)C(C(O)=O)=C1OC HVXXOIGTXJOVON-UHFFFAOYSA-N 0.000 description 1
- PTHXWKGMBXFEBB-UHFFFAOYSA-N 7,8-dimethoxy-1-oxoisochromene-3-carboxylic acid Chemical compound C1=C(C(O)=O)OC(=O)C2=C(OC)C(OC)=CC=C21 PTHXWKGMBXFEBB-UHFFFAOYSA-N 0.000 description 1
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 1
- 206010011224 Cough Diseases 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 238000012754 cardiac puncture Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 230000008105 immune reaction Effects 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- SKBDLRWFSRLIPP-UHFFFAOYSA-N meta-hemipinic acid Natural products COC1=CC(C(O)=O)=C(C(O)=O)C=C1OC SKBDLRWFSRLIPP-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 235000012736 patent blue V Nutrition 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 206010039083 rhinitis Diseases 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000012384 transportation and delivery Methods 0.000 description 1
- KMIOJWCYOHBUJS-HAKPAVFJSA-N vorolanib Chemical compound C1N(C(=O)N(C)C)CC[C@@H]1NC(=O)C1=C(C)NC(\C=C/2C3=CC(F)=CC=C3NC\2=O)=C1C KMIOJWCYOHBUJS-HAKPAVFJSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D335/00—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom
- C07D335/04—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D335/06—Benzothiopyrans; Hydrogenated benzothiopyrans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/22—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the nitrogen-containing ring
- C07D217/26—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/76—Benzo[c]pyrans
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB47485/73A GB1480737A (en) | 1973-10-11 | 1973-10-11 | Isocoumarins thiaisocoumarins and isocarbostyrils and pharmaceutical compositions containing them |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2448387A1 true DE2448387A1 (de) | 1975-04-17 |
Family
ID=10445157
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742448387 Withdrawn DE2448387A1 (de) | 1973-10-11 | 1974-10-10 | Isocumarin-derivate enthaltende arzneimittel, neue isocumarin-derivate und verfahren zu ihrer herstellung |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3975535A (enExample) |
| JP (1) | JPS5064274A (enExample) |
| BE (1) | BE820791A (enExample) |
| DE (1) | DE2448387A1 (enExample) |
| DK (1) | DK530174A (enExample) |
| ES (2) | ES430949A1 (enExample) |
| FI (2) | FI295274A7 (enExample) |
| FR (1) | FR2247223B1 (enExample) |
| GB (1) | GB1480737A (enExample) |
| NL (1) | NL7413376A (enExample) |
| NO (1) | NO743655L (enExample) |
| SE (2) | SE7412714L (enExample) |
| ZA (1) | ZA746271B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4187309A (en) * | 1977-06-20 | 1980-02-05 | Sandoz, Inc. | 4-Hydroxy-2-quinolinone-3-carboxylic acids and salts thereof |
| US4360527A (en) * | 1977-10-13 | 1982-11-23 | Warner-Lambert Company | 9-(Hydroxy, lower alkoxy or lower alkanoyloxy)-2-(1H-tetrazol-5-yl)naphtho-(2,1-b)-pyran-1-ones and anti-allergic use thereof |
| US4210667A (en) * | 1979-04-19 | 1980-07-01 | Pfizer Inc. | Pharmaceutical preparations containing coumarin carboxylic acid derivatives |
| JPS5910570A (ja) * | 1982-07-08 | 1984-01-20 | Wakamoto Pharmaceut Co Ltd | 新規イソカルボスチリル誘導体及びその製法 |
| WO1992003419A1 (en) * | 1990-08-23 | 1992-03-05 | Synphar Laboratories, Inc. | Isocarbostiryl compounds and antitumor use thereof |
| WO2013030358A1 (en) | 2011-08-31 | 2013-03-07 | Merz Pharma Gmbh & Co. Kgaa | Glycine b antagonists |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1049289A (en) * | 1962-08-18 | 1966-11-23 | Benger Lab Ltd | Chromone derivatives and pharmaceutical compositions containing them |
| GB1147976A (en) * | 1965-12-21 | 1969-04-10 | Fisons Pharmaceuticals Ltd | Chromone derivatives |
| US3578705A (en) * | 1967-07-26 | 1971-05-11 | Merck & Co Inc | Process for the preparation of homophthalic acid |
| US3864493A (en) * | 1967-08-17 | 1975-02-04 | Fisons Ltd Felixstowe | Compositions and methods for the prevention of asthmatic symptoms |
| US3733338A (en) * | 1971-07-29 | 1973-05-15 | Ikeda Pharmaceutical Industry | 1-oxo-isochromenes |
| US3885038A (en) * | 1971-08-23 | 1975-05-20 | Syntex Inc | Method of using substituted xanthone carboxylic acid |
| US3883653A (en) * | 1972-10-24 | 1975-05-13 | Pfizer | Method of preventing asthmatic symptoms |
| ES426134A1 (es) * | 1973-05-09 | 1976-12-01 | Carter Wallace | Procedimiento para la produccion de ariltioalcanoles. |
-
1973
- 1973-10-11 GB GB47485/73A patent/GB1480737A/en not_active Expired
-
1974
- 1974-09-30 US US05/510,803 patent/US3975535A/en not_active Expired - Lifetime
- 1974-10-02 ZA ZA00746271A patent/ZA746271B/xx unknown
- 1974-10-07 BE BE149292A patent/BE820791A/xx unknown
- 1974-10-07 FR FR7433636A patent/FR2247223B1/fr not_active Expired
- 1974-10-09 SE SE7412714A patent/SE7412714L/xx unknown
- 1974-10-10 NL NL7413376A patent/NL7413376A/xx not_active Application Discontinuation
- 1974-10-10 DE DE19742448387 patent/DE2448387A1/de not_active Withdrawn
- 1974-10-10 FI FI2952/74A patent/FI295274A7/fi unknown
- 1974-10-10 NO NO743655A patent/NO743655L/no unknown
- 1974-10-10 DK DK530174A patent/DK530174A/da unknown
- 1974-10-11 ES ES430949A patent/ES430949A1/es not_active Expired
- 1974-10-11 JP JP49117000A patent/JPS5064274A/ja active Pending
-
1976
- 1976-07-08 ES ES449699A patent/ES449699A1/es not_active Expired
-
1977
- 1977-10-19 SE SE7711779A patent/SE7711779L/xx unknown
-
1980
- 1980-03-19 FI FI800849A patent/FI800849A7/fi not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| SE7711779L (sv) | 1977-10-19 |
| FI800849A7 (fi) | 1981-01-01 |
| FR2247223B1 (enExample) | 1978-07-21 |
| FR2247223A1 (enExample) | 1975-05-09 |
| ES449699A1 (es) | 1977-07-01 |
| BE820791A (fr) | 1975-04-07 |
| DK530174A (enExample) | 1975-06-09 |
| SE7412714L (enExample) | 1975-04-14 |
| GB1480737A (en) | 1977-07-20 |
| NL7413376A (nl) | 1975-04-15 |
| NO743655L (enExample) | 1975-05-05 |
| FI295274A7 (enExample) | 1975-04-12 |
| US3975535A (en) | 1976-08-17 |
| ZA746271B (en) | 1975-10-29 |
| AU7409174A (en) | 1976-04-15 |
| ES430949A1 (es) | 1977-01-01 |
| JPS5064274A (enExample) | 1975-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2228012C3 (de) | Phthalidester der 6- [D(-)- a Aminophenylacetamido] -penicillansäure und Verfahren zu seiner Herstellung | |
| DE2065636B2 (de) | Tricyclische Verbindungen, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| EP0028765B1 (de) | Alkylharnstoffderivate zur Behandlung von Erkrankungen des Fettstoffwechsels; Verfahren zu deren Herstellung, deren Verwendung in Arzneimitteln zur Behandlung von Fettstoffwechselstörungen, diese enthaltende Arzneimittel, Verfahren zur Herstellung der Arzneimittel sowie einige Alkylharnstoffverbindungen | |
| EP0025192A2 (de) | Substituierte Oxirancarbonsäuren, Verfahren zu ihrer Herstellung, ihre Verwendung und sie enthaltende Arzneimittel | |
| DE1134086B (de) | Verfahren zur Herstellung von analeptisch wirksamen alpha-Aminoisobutyrophenonen und deren Säureadditionssalzen | |
| EP0006114B1 (de) | 7-Methoxy-5-oxo-5H-thiazolo(2,3-b)chinazolin-2-carbonsäure und deren pharmazeutisch verwendbare Salze. Verfahren zu deren Herstellung und sie enthaltende Arzneimittel | |
| DE3035086A1 (de) | Cyclohexancarbonsaeurederivate, verfahren zu ihrer herstellung und sie enthaltende mittel | |
| DE2448387A1 (de) | Isocumarin-derivate enthaltende arzneimittel, neue isocumarin-derivate und verfahren zu ihrer herstellung | |
| EP0087655A1 (de) | Verfahren zur Herstellung von Acemetacin | |
| DE1804306A1 (de) | Verfahren zur Herstellung von neuen 2-Cycloalkyl-heteroaryl-Verbindungen | |
| DE2344799A1 (de) | Schwefelhaltige tricyclische verbindungen und diese enthaltende arzneimittel | |
| CH632749A5 (de) | Verfahren zur herstellung von benzimidazolderivaten. | |
| EP0027268A2 (de) | Chinazolin-Derivate, Verfahren und Zwischenprodukte zu deren Herstellung, Arzneimittel enthaltend solche Chinazolin-Derivate und deren pharmazeutische Verwendung | |
| DE2413125C2 (de) | Indolylacetylaminosäurederivate, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Arzneipräparate | |
| CH649289A5 (de) | 2-pyridyl- und 2-pyrimidylaminobenzoesaeuren. | |
| EP0033066A2 (de) | Penicillinderivate, Zwischenprodukte für ihre Herstellung, pharmazeutische Präparate enthaltend dieselben, ihre Herstellung, sowie ihre Verwendung | |
| DE2437147C2 (de) | Phosphin- und Phosphit-Goldkomplexe und ihre Verwendung | |
| EP0339342A1 (de) | N-Substituierte N-Amino-pyrrole | |
| DE2141124A1 (en) | Heterocyclic substituted pyrazole-4-acetic acids | |
| DE3738890A1 (de) | Heterosubstituierte phenyl-hydroxamsaeuren und ihre verwendung | |
| DE1493513C3 (de) | Sulfamylanthranilsäuren, deren therapeutisch verwendbare Salze, Verfahren zu ihrer Herstellung und diese enthaltenden pharmazeutischen Präparate | |
| DE1795004A1 (de) | Penicillansaeuren | |
| DE2415350A1 (de) | Acetophenonderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate | |
| DE2244471A1 (de) | Neue chromonverbindung und verfahren zu deren herstellung | |
| DE2609574A1 (de) | Monosubstituiertes piperazinderivat, verfahren zu seiner herstellung und es enthaltende arzneimittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |