DE2448293C3 - Verfahren zur Aufhebung der Wirkung optischer Aufheller - Google Patents
Verfahren zur Aufhebung der Wirkung optischer AufhellerInfo
- Publication number
- DE2448293C3 DE2448293C3 DE2448293A DE2448293A DE2448293C3 DE 2448293 C3 DE2448293 C3 DE 2448293C3 DE 2448293 A DE2448293 A DE 2448293A DE 2448293 A DE2448293 A DE 2448293A DE 2448293 C3 DE2448293 C3 DE 2448293C3
- Authority
- DE
- Germany
- Prior art keywords
- group
- formula
- salts
- compounds
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000003287 optical effect Effects 0.000 title claims description 22
- 230000000694 effects Effects 0.000 title claims description 15
- 238000000034 method Methods 0.000 title claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 42
- 150000003839 salts Chemical class 0.000 claims description 25
- 239000002253 acid Substances 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 10
- 230000010933 acylation Effects 0.000 claims description 10
- 238000005917 acylation reaction Methods 0.000 claims description 10
- 239000002657 fibrous material Substances 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 8
- 125000002947 alkylene group Chemical group 0.000 claims description 6
- 230000029936 alkylation Effects 0.000 claims description 5
- 238000005804 alkylation reaction Methods 0.000 claims description 5
- 125000000129 anionic group Chemical group 0.000 claims description 5
- 238000005282 brightening Methods 0.000 claims description 5
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 3
- 125000001624 naphthyl group Chemical group 0.000 claims description 3
- 238000007363 ring formation reaction Methods 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 125000002636 imidazolinyl group Chemical group 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- 229920000642 polymer Polymers 0.000 claims description 2
- 229940126214 compound 3 Drugs 0.000 claims 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 6
- 239000004202 carbamide Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- -1 B. in starch Chemical class 0.000 description 5
- 230000001588 bifunctional effect Effects 0.000 description 5
- 229920002678 cellulose Polymers 0.000 description 5
- 239000001913 cellulose Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 238000001816 cooling Methods 0.000 description 4
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000003292 glue Substances 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 3
- VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- UDSFAEKRVUSQDD-UHFFFAOYSA-N Dimethyl adipate Chemical compound COC(=O)CCCCC(=O)OC UDSFAEKRVUSQDD-UHFFFAOYSA-N 0.000 description 2
- 241001070947 Fagus Species 0.000 description 2
- 235000010099 Fagus sylvatica Nutrition 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid group Chemical group C(CCCCC(=O)O)(=O)O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 2
- 238000005956 quaternization reaction Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- XMWGTKZEDLCVIG-UHFFFAOYSA-N 1-(chloromethyl)naphthalene Chemical compound C1=CC=C2C(CCl)=CC=CC2=C1 XMWGTKZEDLCVIG-UHFFFAOYSA-N 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- CREXVNNSNOKDHW-UHFFFAOYSA-N azaniumylideneazanide Chemical group N[N] CREXVNNSNOKDHW-UHFFFAOYSA-N 0.000 description 1
- 229940076134 benzene Drugs 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000012496 blank sample Substances 0.000 description 1
- 150000004651 carbonic acid esters Chemical class 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000006285 cell suspension Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- BUACSMWVFUNQET-UHFFFAOYSA-H dialuminum;trisulfate;hydrate Chemical compound O.[Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O BUACSMWVFUNQET-UHFFFAOYSA-H 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- ANNNGOUEZBONHD-UHFFFAOYSA-N ethyl phenylmethanesulfonate Chemical compound CCOS(=O)(=O)CC1=CC=CC=C1 ANNNGOUEZBONHD-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- CQDGTJPVBWZJAZ-UHFFFAOYSA-N monoethyl carbonate Chemical compound CCOC(O)=O CQDGTJPVBWZJAZ-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000010893 paper waste Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical class C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 230000002087 whitening effect Effects 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21H—PULP COMPOSITIONS; PREPARATION THEREOF NOT COVERED BY SUBCLASSES D21C OR D21D; IMPREGNATING OR COATING OF PAPER; TREATMENT OF FINISHED PAPER NOT COVERED BY CLASS B31 OR SUBCLASS D21G; PAPER NOT OTHERWISE PROVIDED FOR
- D21H21/00—Non-fibrous material added to the pulp, characterised by its function, form or properties; Paper-impregnating or coating material, characterised by its function, form or properties
- D21H21/14—Non-fibrous material added to the pulp, characterised by its function, form or properties; Paper-impregnating or coating material, characterised by its function, form or properties characterised by function or properties in or on the paper
- D21H21/30—Luminescent or fluorescent substances, e.g. for optical bleaching
Landscapes
- Paper (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Detergent Compositions (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1480873A CH572128A5 (enExample) | 1973-10-19 | 1973-10-19 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2448293A1 DE2448293A1 (de) | 1975-04-24 |
| DE2448293B2 DE2448293B2 (de) | 1979-03-29 |
| DE2448293C3 true DE2448293C3 (de) | 1979-11-15 |
Family
ID=4403990
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2448293A Expired DE2448293C3 (de) | 1973-10-19 | 1974-10-10 | Verfahren zur Aufhebung der Wirkung optischer Aufheller |
Country Status (16)
| Country | Link |
|---|---|
| JP (1) | JPS5414205B2 (enExample) |
| BE (1) | BE821261A (enExample) |
| BR (1) | BR7408687D0 (enExample) |
| CA (1) | CA1051144A (enExample) |
| CH (1) | CH572128A5 (enExample) |
| DD (1) | DD114109A5 (enExample) |
| DE (1) | DE2448293C3 (enExample) |
| FI (1) | FI58363C (enExample) |
| FR (1) | FR2248365B1 (enExample) |
| GB (1) | GB1490077A (enExample) |
| IT (1) | IT1023126B (enExample) |
| NL (1) | NL174749C (enExample) |
| NO (1) | NO145886C (enExample) |
| SE (1) | SE415043B (enExample) |
| SU (1) | SU878203A3 (enExample) |
| ZA (1) | ZA746641B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2916656A1 (de) * | 1979-04-25 | 1980-11-06 | Henkel Kgaa | Waschmittel fuer textilien |
| IT1127312B (it) * | 1979-12-21 | 1986-05-21 | Apital Prod Ind | Procedimento per l'eliminazione della fluorescenza dei candeggianti ottici |
| DE3415103A1 (de) * | 1984-04-21 | 1985-10-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur fluoreszenzloeschung und neue kationische aromatische nitroverbindungen |
| CH677167B5 (enExample) * | 1985-05-08 | 1991-10-31 | Sandoz Ag | |
| GB8518489D0 (en) * | 1985-07-22 | 1985-08-29 | Sandoz Ltd | Organic compounds |
| DE3535496A1 (de) | 1985-10-04 | 1987-04-16 | Bayer Ag | Verfahren zur fluoreszenzloeschung und neue kationische naphthalin-peri-dicarbonsaeureimid-derivate |
| JP4728646B2 (ja) * | 2005-01-06 | 2011-07-20 | 大王製紙株式会社 | 無蛍光板紙 |
| RU2495972C2 (ru) * | 2008-03-26 | 2013-10-20 | Клариант Финанс (Бви) Лимитед | Усовершенствованные композиции для оптического отбеливания |
-
1973
- 1973-10-19 CH CH1480873A patent/CH572128A5/xx not_active IP Right Cessation
-
1974
- 1974-10-10 SE SE7412745A patent/SE415043B/xx not_active IP Right Cessation
- 1974-10-10 FI FI2950/74A patent/FI58363C/fi active
- 1974-10-10 NO NO743648A patent/NO145886C/no unknown
- 1974-10-10 DE DE2448293A patent/DE2448293C3/de not_active Expired
- 1974-10-15 NL NLAANVRAGE7413523,A patent/NL174749C/xx not_active IP Right Cessation
- 1974-10-17 JP JP11878074A patent/JPS5414205B2/ja not_active Expired
- 1974-10-17 DD DD181766A patent/DD114109A5/xx unknown
- 1974-10-17 GB GB45025/74A patent/GB1490077A/en not_active Expired
- 1974-10-18 SU SU742071223A patent/SU878203A3/ru active
- 1974-10-18 BR BR8687/74A patent/BR7408687D0/pt unknown
- 1974-10-18 BE BE149697A patent/BE821261A/xx not_active IP Right Cessation
- 1974-10-18 CA CA211,769A patent/CA1051144A/en not_active Expired
- 1974-10-18 IT IT53617/74A patent/IT1023126B/it active
- 1974-10-18 ZA ZA00746641A patent/ZA746641B/xx unknown
- 1974-10-21 FR FR7435326A patent/FR2248365B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2248365A1 (enExample) | 1975-05-16 |
| JPS5414205B2 (enExample) | 1979-06-05 |
| DD114109A5 (enExample) | 1975-07-12 |
| CA1051144A (en) | 1979-03-20 |
| FR2248365B1 (enExample) | 1978-04-28 |
| DE2448293A1 (de) | 1975-04-24 |
| AU7445074A (en) | 1976-04-29 |
| SU878203A3 (ru) | 1981-10-30 |
| NL7413523A (nl) | 1975-04-22 |
| BE821261A (fr) | 1975-04-18 |
| SE7412745L (enExample) | 1975-04-21 |
| JPS5065610A (enExample) | 1975-06-03 |
| NL174749C (nl) | 1984-08-01 |
| NO743648L (enExample) | 1975-05-20 |
| DE2448293B2 (de) | 1979-03-29 |
| ZA746641B (en) | 1976-05-26 |
| NO145886B (no) | 1982-03-08 |
| IT1023126B (it) | 1978-05-10 |
| SE415043B (sv) | 1980-09-01 |
| GB1490077A (en) | 1977-10-26 |
| NL174749B (nl) | 1984-03-01 |
| CH572128A5 (enExample) | 1976-01-30 |
| NO145886C (no) | 1982-06-16 |
| FI295074A7 (enExample) | 1975-04-20 |
| FI58363B (fi) | 1980-09-30 |
| BR7408687D0 (pt) | 1975-09-16 |
| FI58363C (fi) | 1981-01-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2929512C2 (de) | Verfahren zur Herstellung von absorbierender Cellulosepulpe | |
| DE2040983C3 (de) | Acrylsäurederivate des 2,2,6,6-Tetramethylpiperidins und Verfahren zu deren Herstellung | |
| DE1795392A1 (de) | Kationaktive,wasserloesliche Polyamide | |
| DE2830177C2 (de) | Stärkeätherderivate, Verfahren zu deren Herstellung und deren Verwendung bei der Papierherstellung | |
| DE2828461A1 (de) | Verfahren zum herstellen kationischer staerkesubstanzen und danach hergestellte staerkematerialien | |
| DE2448293C3 (de) | Verfahren zur Aufhebung der Wirkung optischer Aufheller | |
| DE1930307C3 (de) | Kationische Derivate der 4,4'Biss-triazinylamino-stilben^^-disulfonsäure, Verfahren zu ihrer Herstellung und Verwendung ab optische Aufhellungsmittel | |
| DE950713C (de) | Lichtempfindliches Papier zur Herstellung von Flachdruckfolien | |
| DE60035109T2 (de) | Verfahren zur herstellung von thiamethoxam | |
| DE2406883C3 (de) | 4,4'-Bis-(s-triazinyl-amino)-stilben-2,2'-disulfonsäureverbindungen | |
| DE1223247C2 (de) | Verwendung von wasserloeslichen Copolymerisaten zur Papierleimung | |
| DE2301495B2 (de) | Grün-gelbe kationische Farbstoffe und Verfahren zu ihrer Herstellung | |
| DE1912647C3 (de) | Verfahren zur Aufhebung des durch optische Aufheller erzielten Aufhelleffektes | |
| DE1918415B2 (de) | Verfahren zum Oberflachenleimen einer Cellulosebahn | |
| DE2819039A1 (de) | Leimungsmittel fuer papier | |
| DE2301531C3 (de) | 4,4'-Diaminostilben-2,2'-disulfonsäurederivate und ihre Verwendung zur Fluoreszenzaufhellung von Papier, Zellulosefasern und Polyamidfasern | |
| EP0008761B1 (de) | Leimungsmittel für Papier und mit demselben geleimtes Papier | |
| DE2318894B2 (de) | Leimungsmittel fuer papier | |
| DE2002931C3 (de) | Verfahren zur Herstellung von Papier mit fluoreszierenden Eigenschaften | |
| DE3106217C2 (de) | Einen geradkettigen Fettsäureester des N-(β-Hydroxyethyl)-2,2,3,4,5,5-hexamethylpyrrolidins enthaltende Zusammensetzungen und die Verwendung dieser Ester als Anti-UV-Stabilisatoren in Polyolefinpolymeren | |
| EP0104528B1 (de) | Reaktivleimungsmittel für Papier | |
| DE69104008T2 (de) | Verfahren zur Herstellung von alkalischem Papier. | |
| DE1545672A1 (de) | Dikarbonsaeureimidderivate und Verfahren zu ihrer Herstellung | |
| AT242138B (de) | Verfahren zur Herstellung von neuen Estern von quaternären Ammoniumverbindungen | |
| DE765205C (de) | Verfahren zur Herstellung stickstoffhaltiger Carbonsaeuren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |