DE2411739A1 - Papiermaschine - Google Patents
PapiermaschineInfo
- Publication number
- DE2411739A1 DE2411739A1 DE2411739A DE2411739A DE2411739A1 DE 2411739 A1 DE2411739 A1 DE 2411739A1 DE 2411739 A DE2411739 A DE 2411739A DE 2411739 A DE2411739 A DE 2411739A DE 2411739 A1 DE2411739 A1 DE 2411739A1
- Authority
- DE
- Germany
- Prior art keywords
- cylinder
- sieve
- area
- belt
- lower sieve
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000725 suspension Substances 0.000 claims description 8
- 238000003860 storage Methods 0.000 claims description 7
- 230000000694 effects Effects 0.000 claims description 4
- 238000010924 continuous production Methods 0.000 claims description 3
- 235000010724 Wisteria floribunda Nutrition 0.000 claims description 2
- 230000001154 acute effect Effects 0.000 claims description 2
- 238000000151 deposition Methods 0.000 claims description 2
- 239000000835 fiber Substances 0.000 description 17
- 239000004744 fabric Substances 0.000 description 12
- 239000000463 material Substances 0.000 description 10
- 239000000126 substance Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 239000007788 liquid Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 238000007599 discharging Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 1
- 241000375392 Tana Species 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- CWWARWOPSKGELM-SARDKLJWSA-N methyl (2s)-2-[[(2s)-2-[[2-[[(2s)-2-[[(2s)-2-[[(2s)-5-amino-2-[[(2s)-5-amino-2-[[(2s)-1-[(2s)-6-amino-2-[[(2s)-1-[(2s)-2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]hexanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-5 Chemical compound C([C@@H](C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)OC)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCCN)NC(=O)[C@H]1N(CCC1)C(=O)[C@@H](N)CCCN=C(N)N)C1=CC=CC=C1 CWWARWOPSKGELM-SARDKLJWSA-N 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21F—PAPER-MAKING MACHINES; METHODS OF PRODUCING PAPER THEREON
- D21F11/00—Processes for making continuous lengths of paper, or of cardboard, or of wet web for fibre board production, on paper-making machines
- D21F11/02—Processes for making continuous lengths of paper, or of cardboard, or of wet web for fibre board production, on paper-making machines of the Fourdrinier type
- D21F11/04—Processes for making continuous lengths of paper, or of cardboard, or of wet web for fibre board production, on paper-making machines of the Fourdrinier type paper or board consisting on two or more layers
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21F—PAPER-MAKING MACHINES; METHODS OF PRODUCING PAPER THEREON
- D21F9/00—Complete machines for making continuous webs of paper
- D21F9/02—Complete machines for making continuous webs of paper of the Fourdrinier type
Landscapes
- Paper (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2878273A JPS547884B2 (enExample) | 1973-03-12 | 1973-03-12 | |
| US42179873A | 1973-12-05 | 1973-12-05 | |
| US05/607,824 US3985612A (en) | 1973-03-12 | 1975-08-25 | Paper making system including forming fabrics and porous forming cylinders |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2411739A1 true DE2411739A1 (de) | 1974-09-26 |
Family
ID=27286317
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2411739A Withdrawn DE2411739A1 (de) | 1973-03-12 | 1974-03-12 | Papiermaschine |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3985612A (enExample) |
| JP (1) | JPS547884B2 (enExample) |
| CA (1) | CA1003254A (enExample) |
| DE (1) | DE2411739A1 (enExample) |
| FR (1) | FR2221578B1 (enExample) |
| GB (1) | GB1461103A (enExample) |
| SE (1) | SE394700B (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2647295A1 (de) * | 1976-10-20 | 1978-04-27 | Voith Gmbh J M | Papiermaschine |
| US4417950A (en) | 1980-11-26 | 1983-11-29 | Escher Wyss Gmbh | Papermaking machine containing two movable water pervious dewatering bands |
| DE10231512A1 (de) * | 2002-07-12 | 2004-01-22 | Voith Paper Patent Gmbh | Siebpartie zur Herstellung einer mehrlagigen Faserstoffbahn |
| DE10322516A1 (de) * | 2003-05-19 | 2004-12-09 | Voith Paper Patent Gmbh | Bahnführungseinrichtung |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI74060C (fi) * | 1975-09-17 | 1987-12-10 | Valmet Oy | Tissuepappersmaskin. |
| CH608051A5 (enExample) * | 1976-01-19 | 1978-12-15 | Escher Wyss Gmbh | |
| US4207144A (en) * | 1976-10-20 | 1980-06-10 | J. M. Voith, Gmbh | Papermaking machines |
| FI70739C (fi) * | 1977-04-28 | 1986-10-06 | Valmet Oy | Banbildningsenhet vid framstaellning av flerskiktskartong |
| US4161205A (en) * | 1977-06-08 | 1979-07-17 | Beloit Corporation | Method and apparatus for plybonding control |
| AT373309B (de) * | 1980-03-18 | 1984-01-10 | Escher Wyss Gmbh | Papiermaschine |
| AT375111B (de) | 1981-04-08 | 1984-07-10 | Escher Wyss Gmbh | Doppelsieb-papiermaschine |
| FI71377B (fi) * | 1984-05-11 | 1986-09-09 | Ahlstroem Oy | Foerfarande foer framstaellning av flerskiktskartong |
| GB8710428D0 (en) * | 1987-05-01 | 1987-06-03 | Beloit Corp | Multi-ply web forming apparatus |
| US5468348A (en) * | 1990-07-10 | 1995-11-21 | Beloit Technologies, Inc. | Multi-ply web former and method |
| DE4031038C2 (de) * | 1990-10-01 | 1997-01-23 | Voith Sulzer Papiermasch Gmbh | Vorrichtung zum Herstellen eines mehrlagigen Papiers oder Kartons |
| DE4402273C2 (de) * | 1994-01-27 | 1995-11-23 | Voith Gmbh J M | Papiermaschine zur Herstellung mehrlagiger Papierbahnen |
| DE4402274C2 (de) * | 1994-01-27 | 1995-04-06 | Voith Gmbh J M | Doppelsiebpartie |
| DE19530983B4 (de) * | 1995-08-23 | 2006-04-27 | Voith Paper Patent Gmbh | Vorrichtung zum Herstellen eines mehrlagigen Papiers oder Kartons |
| US6702926B1 (en) * | 1996-12-11 | 2004-03-09 | Voith Sulzer Papiermaschinen Gmbh | Process for forming a multi-ply fiber web |
| DE19651493A1 (de) * | 1996-12-11 | 1998-06-18 | Voith Sulzer Papiermasch Gmbh | Siebpartie und Verfahren zum Formen einer mehrlagigen Faserstoffbahn |
| US6440273B1 (en) * | 1999-12-16 | 2002-08-27 | Metso Paper Karlstad Aktiebolag (Ab) | Compact multilevel paper making machine for manufacturing a web of paper |
| US7024067B2 (en) * | 2001-10-19 | 2006-04-04 | Visteon Global Technologies, Inc. | Communication system with a signal conduction matrix and surface signal router |
| FI116688B (fi) * | 2004-02-13 | 2006-01-31 | Metso Paper Inc | Monikerrosrainan muodostusosa |
| FI116628B (fi) * | 2004-02-13 | 2006-01-13 | Metso Paper Inc | Monikerrosrainan muodostusosa |
| JP5207507B2 (ja) * | 2007-01-20 | 2013-06-12 | 株式会社シード | 古紙再生装置の抄紙装置 |
| US10280565B2 (en) * | 2016-02-26 | 2019-05-07 | Ecolab Usa Inc. | Drainage management in multi-ply papermaking |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3201305A (en) * | 1962-11-05 | 1965-08-17 | David R Webster | Sheet forming method and apparatus |
| US3846232A (en) * | 1973-03-23 | 1974-11-05 | Valmet Oy | Twin-wire paper forming with wires wrapping around a suction web-forming breast roll and then following a curved path to a suction couch roll |
| US3432385A (en) * | 1965-12-15 | 1969-03-11 | Huyck Corp | Water extraction devices |
| US3547777A (en) * | 1968-12-16 | 1970-12-15 | Allis Chalmers Mfg Co | Vertical dual wire paper web former |
| FI58367C (fi) * | 1969-03-03 | 1981-01-12 | Tampella Oy Ab | Kombinerad pappersmaskin |
| US3752734A (en) * | 1970-08-12 | 1973-08-14 | Black Clawson Co | Multi ply paper machine |
| US3726758A (en) * | 1971-07-08 | 1973-04-10 | J Parker | Twin-wire web forming system with dewatering by centrifugal forces |
| US3772140A (en) * | 1971-12-27 | 1973-11-13 | Kobayashi Tadashi | High speed paper web forming and combining system with a stationary water guide |
-
1973
- 1973-03-12 JP JP2878273A patent/JPS547884B2/ja not_active Expired
- 1973-10-31 SE SE7314811A patent/SE394700B/xx unknown
-
1974
- 1974-02-28 CA CA193,716A patent/CA1003254A/en not_active Expired
- 1974-03-05 GB GB994374A patent/GB1461103A/en not_active Expired
- 1974-03-12 FR FR7408437A patent/FR2221578B1/fr not_active Expired
- 1974-03-12 DE DE2411739A patent/DE2411739A1/de not_active Withdrawn
-
1975
- 1975-08-25 US US05/607,824 patent/US3985612A/en not_active Expired - Lifetime
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2647295A1 (de) * | 1976-10-20 | 1978-04-27 | Voith Gmbh J M | Papiermaschine |
| US4417950A (en) | 1980-11-26 | 1983-11-29 | Escher Wyss Gmbh | Papermaking machine containing two movable water pervious dewatering bands |
| DE10231512A1 (de) * | 2002-07-12 | 2004-01-22 | Voith Paper Patent Gmbh | Siebpartie zur Herstellung einer mehrlagigen Faserstoffbahn |
| DE10322516A1 (de) * | 2003-05-19 | 2004-12-09 | Voith Paper Patent Gmbh | Bahnführungseinrichtung |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1461103A (en) | 1977-01-13 |
| US3985612A (en) | 1976-10-12 |
| FR2221578B1 (enExample) | 1978-03-31 |
| JPS547884B2 (enExample) | 1979-04-11 |
| SE394700B (sv) | 1977-07-04 |
| CA1003254A (en) | 1977-01-11 |
| AU6652874A (en) | 1975-09-11 |
| FR2221578A1 (enExample) | 1974-10-11 |
| JPS49116306A (enExample) | 1974-11-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2411739A1 (de) | Papiermaschine | |
| DE2641714B2 (de) | Tissue-Papiermaschine | |
| EP4087965B1 (de) | Anlage und verfahren zur herstellung eines ein- oder mehrlagigen vlieses | |
| EP0656967B1 (de) | Formiersieb | |
| DE2102717A1 (de) | Verfahren und Vorrichtung zur Herstellung von Papier, Karton oder einer ähnlichen Fasermaterialbahn | |
| EP4149751B1 (de) | Anlage zur herstellung eines mehrlagigen vlieses und verfahren zur herstellung eines vlieses | |
| DE4328024A1 (de) | Doppelsieb-Blattbildner | |
| DE1147470B (de) | Vorrichtung zum Herstellen von Bahnen aus Papier, Pappe od. dgl. | |
| EP3987113B1 (de) | Maschine zur herstellung einer faserstoffbahn | |
| EP0894894A2 (de) | Verfahren und Vorrichtung zum Bilden einer Faserstoffbahn | |
| DE1815104A1 (de) | Zentrifugale Mehrschichtenbahnherstellungsmaschine | |
| DE3120073A1 (de) | Doppelsiebpapiermaschine | |
| EP1077283A2 (de) | Pressenpartie | |
| DE4103040A1 (de) | Vorrichtung zur entwaesserung von faserstoffbahnen | |
| EP2096207A1 (de) | Schrägsiebformer einer Maschine zur Herstellung einer Faserstoffbahn aus mindestens einer Faserstoffsuspension | |
| AT505760B1 (de) | Vorrichtung und verfahren zur entwasserung einer materialbahn | |
| EP2003243A1 (de) | Trockenpartie | |
| EP4328376B1 (de) | Schrägsiebformer | |
| AT375695B (de) | Doppelsieb-papiermaschine | |
| DE3008468A1 (de) | Papierformwalze | |
| DE3000100A1 (de) | Verfahren und vorrichtung zur behandlung einer faserstoffbahn | |
| WO2012041624A1 (de) | Maschine für die entwässerung von zellstoff | |
| DE2548794A1 (de) | Doppelsieb-papiermaschine | |
| DE2262966C3 (de) | Papiermaschine | |
| DE19950805A1 (de) | Former |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8130 | Withdrawal |