DE2400098A1 - Thermoplastische massen - Google Patents
Thermoplastische massenInfo
- Publication number
- DE2400098A1 DE2400098A1 DE2400098A DE2400098A DE2400098A1 DE 2400098 A1 DE2400098 A1 DE 2400098A1 DE 2400098 A DE2400098 A DE 2400098A DE 2400098 A DE2400098 A DE 2400098A DE 2400098 A1 DE2400098 A1 DE 2400098A1
- Authority
- DE
- Germany
- Prior art keywords
- thermoplastic compositions
- compositions according
- parts
- polyester resin
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 229920001169 thermoplastic Polymers 0.000 title claims description 40
- 239000004416 thermosoftening plastic Substances 0.000 title claims description 40
- 239000000203 mixture Substances 0.000 claims description 46
- 229920001225 polyester resin Polymers 0.000 claims description 29
- 239000004645 polyester resin Substances 0.000 claims description 29
- 239000003381 stabilizer Substances 0.000 claims description 29
- 230000015556 catabolic process Effects 0.000 claims description 22
- 238000006731 degradation reaction Methods 0.000 claims description 22
- 239000011521 glass Substances 0.000 claims description 19
- 239000000944 linseed oil Substances 0.000 claims description 14
- 235000021388 linseed oil Nutrition 0.000 claims description 14
- 239000012763 reinforcing filler Substances 0.000 claims description 14
- -1 phosphite compound Chemical class 0.000 claims description 12
- 125000003700 epoxy group Chemical group 0.000 claims description 10
- 229920002857 polybutadiene Polymers 0.000 claims description 9
- 239000005062 Polybutadiene Substances 0.000 claims description 8
- 239000003549 soybean oil Substances 0.000 claims description 8
- 235000012424 soybean oil Nutrition 0.000 claims description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- 239000000945 filler Substances 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 239000011152 fibreglass Substances 0.000 claims description 5
- 230000003014 reinforcing effect Effects 0.000 claims description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- 239000003365 glass fiber Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000010453 quartz Substances 0.000 claims description 3
- 150000004760 silicates Chemical class 0.000 claims description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 3
- 230000000087 stabilizing effect Effects 0.000 claims description 3
- 150000003626 triacylglycerols Chemical class 0.000 claims description 3
- 229910010293 ceramic material Inorganic materials 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- OKTJSMMVPCPJKN-BJUDXGSMSA-N carbon-11 Chemical compound [11C] OKTJSMMVPCPJKN-BJUDXGSMSA-N 0.000 claims 1
- 229920000728 polyester Polymers 0.000 description 17
- 239000000155 melt Substances 0.000 description 14
- 150000001875 compounds Chemical class 0.000 description 13
- 238000000034 method Methods 0.000 description 13
- 239000000654 additive Substances 0.000 description 11
- 239000000835 fiber Substances 0.000 description 11
- 230000008569 process Effects 0.000 description 9
- 238000000465 moulding Methods 0.000 description 8
- 229920000642 polymer Polymers 0.000 description 8
- 229920005989 resin Polymers 0.000 description 7
- 239000011347 resin Substances 0.000 description 7
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 6
- 238000001746 injection moulding Methods 0.000 description 6
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical class OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 6
- WSQZNZLOZXSBHA-UHFFFAOYSA-N 3,8-dioxabicyclo[8.2.2]tetradeca-1(12),10,13-triene-2,9-dione Chemical compound O=C1OCCCCOC(=O)C2=CC=C1C=C2 WSQZNZLOZXSBHA-UHFFFAOYSA-N 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- 229920001634 Copolyester Polymers 0.000 description 4
- 241000156978 Erebia Species 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000008188 pellet Substances 0.000 description 4
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 4
- 230000000704 physical effect Effects 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 238000003825 pressing Methods 0.000 description 4
- 238000012545 processing Methods 0.000 description 4
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 4
- 239000004593 Epoxy Substances 0.000 description 3
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical class OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 3
- 230000002411 adverse Effects 0.000 description 3
- 230000008859 change Effects 0.000 description 3
- 239000002738 chelating agent Substances 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 230000006866 deterioration Effects 0.000 description 3
- 150000002009 diols Chemical class 0.000 description 3
- 238000002845 discoloration Methods 0.000 description 3
- 239000003063 flame retardant Substances 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000012779 reinforcing material Substances 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 229920001283 Polyalkylene terephthalate Polymers 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 239000010425 asbestos Substances 0.000 description 2
- 238000004364 calculation method Methods 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 238000006735 epoxidation reaction Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000013213 extrapolation Methods 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 229910052895 riebeckite Inorganic materials 0.000 description 2
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- IAQRGUVFOMOMEM-ONEGZZNKSA-N trans-but-2-ene Chemical group C\C=C\C IAQRGUVFOMOMEM-ONEGZZNKSA-N 0.000 description 2
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 2
- CNUJLMSKURPSHE-UHFFFAOYSA-N trioctadecyl phosphite Chemical compound CCCCCCCCCCCCCCCCCCOP(OCCCCCCCCCCCCCCCCCC)OCCCCCCCCCCCCCCCCCC CNUJLMSKURPSHE-UHFFFAOYSA-N 0.000 description 2
- AXKZIDYFAMKWSA-UHFFFAOYSA-N 1,6-dioxacyclododecane-7,12-dione Chemical compound O=C1CCCCC(=O)OCCCCO1 AXKZIDYFAMKWSA-UHFFFAOYSA-N 0.000 description 1
- JJGUCQHANYXGFJ-UHFFFAOYSA-N 10-phenyldecyl dihydrogen phosphite Chemical compound OP(O)OCCCCCCCCCCC1=CC=CC=C1 JJGUCQHANYXGFJ-UHFFFAOYSA-N 0.000 description 1
- ZVSXNPBSZYQDKJ-UHFFFAOYSA-N 3,8-dioxabicyclo[8.3.1]tetradeca-1(14),10,12-triene-2,9-dione Chemical compound O=C1OCCCCOC(=O)C2=CC=CC1=C2 ZVSXNPBSZYQDKJ-UHFFFAOYSA-N 0.000 description 1
- HFGHRUCCKVYFKL-UHFFFAOYSA-N 4-ethoxy-2-piperazin-1-yl-7-pyridin-4-yl-5h-pyrimido[5,4-b]indole Chemical compound C1=C2NC=3C(OCC)=NC(N4CCNCC4)=NC=3C2=CC=C1C1=CC=NC=C1 HFGHRUCCKVYFKL-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- OYHQOLUKZRVURQ-HZJYTTRNSA-N Linoleic acid Chemical compound CCCCC\C=C/C\C=C/CCCCCCCC(O)=O OYHQOLUKZRVURQ-HZJYTTRNSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 235000019485 Safflower oil Nutrition 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 229910010413 TiO 2 Inorganic materials 0.000 description 1
- 241000838698 Togo Species 0.000 description 1
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- DTOSIQBPPRVQHS-PDBXOOCHSA-N alpha-linolenic acid Chemical compound CC\C=C/C\C=C/C\C=C/CCCCCCCC(O)=O DTOSIQBPPRVQHS-PDBXOOCHSA-N 0.000 description 1
- 235000020661 alpha-linolenic acid Nutrition 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000005388 borosilicate glass Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000004917 carbon fiber Substances 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 238000000748 compression moulding Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000002285 corn oil Substances 0.000 description 1
- 235000005687 corn oil Nutrition 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- GLOQRSIADGSLRX-UHFFFAOYSA-N decyl diphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OCCCCCCCCCC)OC1=CC=CC=C1 GLOQRSIADGSLRX-UHFFFAOYSA-N 0.000 description 1
- SWUYLUYFFADSNR-UHFFFAOYSA-N decyl phenyl hydrogen phosphite Chemical class CCCCCCCCCCOP(O)OC1=CC=CC=C1 SWUYLUYFFADSNR-UHFFFAOYSA-N 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- NMAKPIATXQEXBT-UHFFFAOYSA-N didecyl phenyl phosphite Chemical compound CCCCCCCCCCOP(OCCCCCCCCCC)OC1=CC=CC=C1 NMAKPIATXQEXBT-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002118 epoxides Chemical class 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000011872 intimate mixture Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 235000020778 linoleic acid Nutrition 0.000 description 1
- OYHQOLUKZRVURQ-IXWMQOLASA-N linoleic acid Natural products CCCCC\C=C/C\C=C\CCCCCCCC(O)=O OYHQOLUKZRVURQ-IXWMQOLASA-N 0.000 description 1
- 229960004488 linolenic acid Drugs 0.000 description 1
- KQQKGWQCNNTQJW-UHFFFAOYSA-N linolenic acid Natural products CC=CCCC=CCC=CCCCCCCCC(O)=O KQQKGWQCNNTQJW-UHFFFAOYSA-N 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 125000002960 margaryl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000012768 molten material Substances 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- KYTZHLUVELPASH-UHFFFAOYSA-N naphthalene-1,2-dicarboxylic acid Chemical compound C1=CC=CC2=C(C(O)=O)C(C(=O)O)=CC=C21 KYTZHLUVELPASH-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910052755 nonmetal Inorganic materials 0.000 description 1
- 150000002843 nonmetals Chemical class 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000003605 opacifier Substances 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 235000014366 other mixer Nutrition 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 125000005498 phthalate group Chemical class 0.000 description 1
- 229920001281 polyalkylene Polymers 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- VCWHRHVZWITKNJ-UHFFFAOYSA-N propane-1,2,3-triol;terephthalic acid Chemical compound OCC(O)CO.OC(=O)C1=CC=C(C(O)=O)C=C1 VCWHRHVZWITKNJ-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000003813 safflower oil Substances 0.000 description 1
- 235000005713 safflower oil Nutrition 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 238000009757 thermoplastic moulding Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IVIIAEVMQHEPAY-UHFFFAOYSA-N tridodecyl phosphite Chemical compound CCCCCCCCCCCCOP(OCCCCCCCCCCCC)OCCCCCCCCCCCC IVIIAEVMQHEPAY-UHFFFAOYSA-N 0.000 description 1
- QUTZUATVZPXUJR-UHFFFAOYSA-N trinonyl phosphite Chemical compound CCCCCCCCCOP(OCCCCCCCCC)OCCCCCCCCC QUTZUATVZPXUJR-UHFFFAOYSA-N 0.000 description 1
- DECPGQLXYYCNEZ-UHFFFAOYSA-N tris(6-methylheptyl) phosphite Chemical compound CC(C)CCCCCOP(OCCCCCC(C)C)OCCCCCC(C)C DECPGQLXYYCNEZ-UHFFFAOYSA-N 0.000 description 1
- QQBLOZGVRHAYGT-UHFFFAOYSA-N tris-decyl phosphite Chemical compound CCCCCCCCCCOP(OCCCCCCCCCC)OCCCCCCCCCC QQBLOZGVRHAYGT-UHFFFAOYSA-N 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L67/00—Compositions of polyesters obtained by reactions forming a carboxylic ester link in the main chain; Compositions of derivatives of such polymers
- C08L67/02—Polyesters derived from dicarboxylic acids and dihydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US321267A US3886104A (en) | 1973-01-05 | 1973-01-05 | Stabilized polyester compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2400098A1 true DE2400098A1 (de) | 1974-07-18 |
Family
ID=23249894
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2400098A Withdrawn DE2400098A1 (de) | 1973-01-05 | 1974-01-03 | Thermoplastische massen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3886104A (enExample) |
| JP (1) | JPS5853019B2 (enExample) |
| CA (1) | CA1019080A (enExample) |
| DE (1) | DE2400098A1 (enExample) |
| FR (1) | FR2213311B1 (enExample) |
| GB (1) | GB1422278A (enExample) |
| IT (1) | IT1006724B (enExample) |
| NL (1) | NL173967C (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2501988A1 (de) * | 1975-01-18 | 1976-07-22 | Basf Ag | Formmassen mit verbesserten eigenschaften |
| FR2552095A1 (fr) * | 1983-09-16 | 1985-03-22 | Bip Chemicals Ltd | Perfectionnement aux compositions de polyester destine au moulage |
| US5760119A (en) * | 1995-10-06 | 1998-06-02 | Fraunhofer-Gesellschaft Zur Forderung Der Angewandten Forschung E.V. | Method of stabilizing a melt of aliphatic and aromatic-aliphatic polyesters |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS558022B2 (enExample) * | 1975-02-10 | 1980-03-01 | ||
| US4066617A (en) * | 1975-12-22 | 1978-01-03 | Mobay Chemical Corporation | Stabilized poly(alkylene terephthalates) |
| US4101601A (en) * | 1975-12-24 | 1978-07-18 | Celanese Corporation | Epoxy-catalyst additive system to produce higher I.V. polybutylene terephthalate from low I.V. polymer |
| JPS53111353A (en) * | 1977-03-11 | 1978-09-28 | Mitsubishi Chem Ind Ltd | Polyester resin composition |
| JPS6017223B2 (ja) * | 1977-05-25 | 1985-05-01 | 帝人株式会社 | ポリエステル組成物 |
| US4115350A (en) * | 1977-07-27 | 1978-09-19 | Allied Chemical Corporation | Production of thermally stabilized polyester |
| US4222928A (en) * | 1977-11-09 | 1980-09-16 | Teijin Limited | Polyester composition |
| JPS5910698B2 (ja) * | 1978-05-18 | 1984-03-10 | 東洋紡績株式会社 | ポリエステル組成物 |
| DE2834032A1 (de) * | 1978-08-03 | 1980-02-28 | Basf Ag | Stabilisierte polyalkylenterephthalat- formmassen |
| US4195134A (en) * | 1978-12-21 | 1980-03-25 | Gaf Corporation | Polyester resin with improved retention of properties |
| US4302382A (en) * | 1980-05-05 | 1981-11-24 | Standard Oil Company (Indiana) | Color stable aromatic polyesters |
| US4525498A (en) * | 1980-10-16 | 1985-06-25 | Union Carbide Corporation | Polyester fiber reinforced molding compounds |
| US4539352A (en) * | 1981-08-21 | 1985-09-03 | Ethyl Corporation | Injection-moldable thermoplastic polyester composition |
| US4486561A (en) * | 1981-08-21 | 1984-12-04 | Ethyl Corporation | Injection-moldable thermoplastic polyester composition |
| WO1983000697A1 (en) * | 1981-08-21 | 1983-03-03 | Ethyl Corp | Polyester composition |
| US4391938A (en) * | 1982-02-16 | 1983-07-05 | Rohm And Haas Company | Polyethylene terephthalate compositions having improved crystallization rate and surface appearance |
| JPS58162654A (ja) * | 1982-03-19 | 1983-09-27 | Toyobo Co Ltd | ポリエステル型ブロツク共重合体組成物 |
| US4385144A (en) * | 1982-07-12 | 1983-05-24 | Ethyl Corporation | Polyester composition |
| JPS58206662A (ja) * | 1982-05-26 | 1983-12-01 | Toyobo Co Ltd | ポリエステルブロツク共重合体組成物 |
| US4533679A (en) * | 1982-06-28 | 1985-08-06 | Mobay Chemical Corporation | Reinforced polyester composition having an improved strength |
| JPS59204656A (ja) * | 1983-05-06 | 1984-11-20 | Kanegafuchi Chem Ind Co Ltd | 熱可塑性ポリエステル系樹脂組成物 |
| CA2065372A1 (en) * | 1989-10-23 | 1991-04-24 | Larry A. Minnick | Poly(1,4-cyclohexylenedimethylene terephthalate) with improved melt stability |
| JP2702801B2 (ja) * | 1990-06-22 | 1998-01-26 | ポリプラスチックス株式会社 | 溶融熱安定性の高い成形用ポリエステル樹脂組成物及びその成形品 |
| AU659196B2 (en) * | 1991-07-18 | 1995-05-11 | General Electric Company | Stabilization of mineral filled polyesters using epoxy compounds |
| AU658436B2 (en) * | 1991-07-18 | 1995-04-13 | General Electric Company | Stabilization of polyesters using epoxy compounds in combination with a catalyst |
| US5290835A (en) * | 1991-10-01 | 1994-03-01 | Teijin Limited | Electrical and electronic parts formed of polybutylene naphthalenedicarboxylate |
| US5354791A (en) * | 1993-10-19 | 1994-10-11 | General Electric Company | Epoxy-functional polyester, polycarbonate with metal phosphate |
| ES2112063T3 (es) * | 1994-05-27 | 1998-03-16 | Ciba Geigy Ag | Mezclas de poliester/policarbonato con propiedades mejoradas. |
| US20050245646A1 (en) * | 2000-12-26 | 2005-11-03 | Yoshihiro Ohtsuka | Thermoplastic polyester resin composition excellent in processing stability and molded articles thereof |
| DE10359763B4 (de) * | 2003-12-19 | 2007-11-22 | Teijin Monofilament Germany Gmbh | Polyesterfasern, Verfahren zu deren Herstellung und deren Verwendung |
| DE102004044325A1 (de) * | 2004-09-10 | 2006-03-16 | Mitsubishi Polyester Film Gmbh | Hydrolysebeständige Folie aus einem Polyester mit Hydrolyseschutzmittel sowie Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE102004044326A1 (de) * | 2004-09-10 | 2006-03-16 | Mitsubishi Polyester Film Gmbh | Hydrolysebeständige Folie aus einem Polyester mit Hydrolyseschutzmittel sowie Verfahren zu ihrer Herstellung und ihre Verwendung |
| US7375167B2 (en) * | 2005-05-09 | 2008-05-20 | Basf Se | Hydrolysis-resistance composition |
| US20080132631A1 (en) * | 2006-12-01 | 2008-06-05 | Natarajan Kavilipalayam M | Hydrolysis-resistant thermoplastic polymer |
| US7956205B2 (en) * | 2006-12-05 | 2011-06-07 | Galata Chemicals, Llc | Peroxide reduction in functionalized vegetable oils |
| EP2980157A4 (en) * | 2013-03-25 | 2016-11-30 | Teijin Ltd | Resin composition |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2963455A (en) * | 1953-07-15 | 1960-12-06 | Rohm & Haas | Resinous compositions containing epoxidized vegetable oils |
| NL105578C (enExample) * | 1955-11-17 | |||
| BE594234A (enExample) * | 1959-08-21 | |||
| US3200131A (en) * | 1962-01-03 | 1965-08-10 | Hooker Chemical Corp | Halogenated phosphinopyranones |
| US3182035A (en) * | 1962-11-23 | 1965-05-04 | Fmc Corp | Vinyl chloride resin plasticized with an epoxidized copolymer of butadiene and xylene |
| DE1720877B2 (de) * | 1967-11-27 | 1976-12-30 | Enka Glanzstoff Ag, 5600 Wuppertal | Spritzgussmassen und verfahren zur herstellung von spritzgussmassen |
| US3558539A (en) * | 1968-02-21 | 1971-01-26 | Monsanto Co | Stabilizer compositions employing fatty acid metal salts,epoxidized material,and organo phosphites |
| DE1769230A1 (de) * | 1968-04-24 | 1972-03-02 | Hoechst Ag | Thermoplastische Polyester enthaltende Formmassen |
| CH524654A (de) * | 1968-08-07 | 1972-06-30 | Ciba Geigy Ag | Neue, heisshärtbare Mischungen aus Polyepoxidverbindungen, Ringe enthaltenden Polyestern und Polycarbonsäureanhydriden |
| US3627867A (en) * | 1968-09-05 | 1971-12-14 | Du Pont | Process of melt-spinning high-molecular-weight ethylene terephthalate polymer |
| US3578620A (en) * | 1969-04-02 | 1971-05-11 | Ppg Industries Inc | Color stabilized unsaturated interpolymers |
| US3660320A (en) * | 1969-06-03 | 1972-05-02 | Flintkote Co | Dry blend polyvinyl chloride foam-forming composition and method |
| US3661825A (en) * | 1970-04-21 | 1972-05-09 | Goodyear Tire & Rubber | Stabilization systems for polymers |
| US3723569A (en) * | 1972-03-20 | 1973-03-27 | Du Pont | Blends of copolyesters with cured epoxy resins |
-
1973
- 1973-01-05 US US321267A patent/US3886104A/en not_active Expired - Lifetime
- 1973-12-11 GB GB5726373A patent/GB1422278A/en not_active Expired
- 1973-12-12 CA CA188,011A patent/CA1019080A/en not_active Expired
- 1973-12-29 JP JP744514A patent/JPS5853019B2/ja not_active Expired
-
1974
- 1974-01-03 NL NLAANVRAGE7400065,A patent/NL173967C/xx not_active IP Right Cessation
- 1974-01-03 DE DE2400098A patent/DE2400098A1/de not_active Withdrawn
- 1974-01-04 FR FR7400266A patent/FR2213311B1/fr not_active Expired
- 1974-01-04 IT IT19076/74A patent/IT1006724B/it active
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2501988A1 (de) * | 1975-01-18 | 1976-07-22 | Basf Ag | Formmassen mit verbesserten eigenschaften |
| FR2552095A1 (fr) * | 1983-09-16 | 1985-03-22 | Bip Chemicals Ltd | Perfectionnement aux compositions de polyester destine au moulage |
| US5760119A (en) * | 1995-10-06 | 1998-06-02 | Fraunhofer-Gesellschaft Zur Forderung Der Angewandten Forschung E.V. | Method of stabilizing a melt of aliphatic and aromatic-aliphatic polyesters |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2213311A1 (enExample) | 1974-08-02 |
| GB1422278A (en) | 1976-01-21 |
| IT1006724B (it) | 1976-10-20 |
| US3886104A (en) | 1975-05-27 |
| NL173967C (nl) | 1984-04-02 |
| NL7400065A (enExample) | 1974-07-09 |
| CA1019080A (en) | 1977-10-11 |
| AU6373873A (en) | 1975-06-19 |
| FR2213311B1 (enExample) | 1979-07-27 |
| JPS5853019B2 (ja) | 1983-11-26 |
| NL173967B (nl) | 1983-11-01 |
| JPS4999743A (enExample) | 1974-09-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2400098A1 (de) | Thermoplastische massen | |
| DE69323632T2 (de) | Thermoplastische biologisch abbaubare harze und verfahren zu deren herstellung | |
| DE2357523A1 (de) | Stabilisierte polyester-zusammensetzungen | |
| DE2524121C2 (de) | Verwendung von Polybutylenterephthalat-Formmassen zur Herstellung von Formteilen durch Spritzguß | |
| DE2459062A1 (de) | Glasfaserverstaerkte, flammwidrige, thermoplastische polyesterformmassen | |
| DE1295186B (de) | Weichmachen von AEthylen-Acrylsaeure-Mischpolymerisaten | |
| CH456142A (de) | Verformbare Masse aus Polycarbonat und Polyalkylen-terephthalat | |
| DE2364318A1 (de) | Hochmolekulare thermoplastische massen | |
| DE2503000A1 (de) | Polymerisation des poly(1,4-butylen- terephthalats) im festen aggregatzustand | |
| DE2707852C2 (enExample) | ||
| DE2400097A1 (de) | Verfahren zur steigerung der schmelzelastizitaet von hochmolekularen linearen polyesterharzen | |
| DE2728865B2 (de) | Stabilisierte Formmassen auf der Basis von Vinylchlorid-Polymerisaten | |
| DE1645554A1 (de) | Verfahren zur Herstellung eines Weichmachers | |
| DE2525513A1 (de) | Stabilisierte polyalkylenharz- gemische | |
| DE3228544A1 (de) | Flammhemmend ausgeruestete polyesterharzmasse | |
| DE2710729A1 (de) | Polymerzusammensetzung und ihr herstellungsverfahren | |
| DE4020483A1 (de) | Mischester und seine verwendung als gleitmittel in kunststoff-formmassen | |
| DE69118039T2 (de) | Polybutylen-Terephthalatharzmasse | |
| DE3040999A1 (de) | Thermoplastische formmassen | |
| EP0007445A1 (de) | Thermoplastische Mischpolyester und ihre Verwendung zur Herstellung von Formkörpern | |
| DE3000660A1 (de) | Nicht-ausbluehende flammhemmende thermoplastische zusammensetzung | |
| DE2904184A1 (de) | Formmasse und die daraus hergestellten spritzguss-formkoerper | |
| DE2755911A1 (de) | Verstaerkte thermoplastische formmassen mit verbesserter durchschlagsfestigkeit | |
| DE2363758C3 (de) | Flammwidrige Polyestermasse | |
| DE2364399A1 (de) | Stabilisierte form- und pressmassen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |