DE2355397A1 - Trockenzylindergruppe in einem mehrzylindertrockner fuer eine materialbahn, insbesondere fuer papier - Google Patents
Trockenzylindergruppe in einem mehrzylindertrockner fuer eine materialbahn, insbesondere fuer papierInfo
- Publication number
- DE2355397A1 DE2355397A1 DE19732355397 DE2355397A DE2355397A1 DE 2355397 A1 DE2355397 A1 DE 2355397A1 DE 19732355397 DE19732355397 DE 19732355397 DE 2355397 A DE2355397 A DE 2355397A DE 2355397 A1 DE2355397 A1 DE 2355397A1
- Authority
- DE
- Germany
- Prior art keywords
- drying
- cylinder
- cylinders
- web
- felt
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000001035 drying Methods 0.000 title claims description 129
- 239000000463 material Substances 0.000 title claims description 3
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 239000002699 waste material Substances 0.000 description 5
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 4
- 239000004744 fabric Substances 0.000 description 4
- 238000005192 partition Methods 0.000 description 3
- 238000009423 ventilation Methods 0.000 description 3
- 239000007789 gas Substances 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 241000233866 Fungi Species 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- YSGSDAIMSCVPHG-UHFFFAOYSA-N valyl-methionine Chemical compound CSCCC(C(O)=O)NC(=O)C(N)C(C)C YSGSDAIMSCVPHG-UHFFFAOYSA-N 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F26—DRYING
- F26B—DRYING SOLID MATERIALS OR OBJECTS BY REMOVING LIQUID THEREFROM
- F26B13/00—Machines and apparatus for drying fabrics, fibres, yarns, or other materials in long lengths, with progressive movement
- F26B13/10—Arrangements for feeding, heating or supporting materials; Controlling movement, tension or position of materials
- F26B13/14—Rollers, drums, cylinders; Arrangement of drives, supports, bearings, cleaning
- F26B13/16—Rollers, drums, cylinders; Arrangement of drives, supports, bearings, cleaning perforated in combination with hot air blowing or suction devices, e.g. sieve drum dryers
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21F—PAPER-MAKING MACHINES; METHODS OF PRODUCING PAPER THEREON
- D21F5/00—Dryer section of machines for making continuous webs of paper
- D21F5/02—Drying on cylinders
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F26—DRYING
- F26B—DRYING SOLID MATERIALS OR OBJECTS BY REMOVING LIQUID THEREFROM
- F26B13/00—Machines and apparatus for drying fabrics, fibres, yarns, or other materials in long lengths, with progressive movement
- F26B13/06—Machines and apparatus for drying fabrics, fibres, yarns, or other materials in long lengths, with progressive movement with movement in a sinuous or zig-zag path
- F26B13/08—Machines and apparatus for drying fabrics, fibres, yarns, or other materials in long lengths, with progressive movement with movement in a sinuous or zig-zag path using rollers
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Mechanical Engineering (AREA)
- General Engineering & Computer Science (AREA)
- Paper (AREA)
- Drying Of Solid Materials (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FI3174/72A FI53333C (fi) | 1972-11-13 | 1972-11-13 | Torkningscylindergrupp i en flercylindertork foer en materialbana i synnerhet foer papper |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2355397A1 true DE2355397A1 (de) | 1974-06-12 |
Family
ID=8508103
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732355397 Pending DE2355397A1 (de) | 1972-11-13 | 1973-11-06 | Trockenzylindergruppe in einem mehrzylindertrockner fuer eine materialbahn, insbesondere fuer papier |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3868780A (enExample) |
| CA (1) | CA1015154A (enExample) |
| DE (1) | DE2355397A1 (enExample) |
| FI (1) | FI53333C (enExample) |
| GB (1) | GB1426067A (enExample) |
| IT (1) | IT1001739B (enExample) |
| PL (1) | PL91256B1 (enExample) |
| SU (1) | SU712044A3 (enExample) |
Cited By (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1981003351A1 (en) * | 1980-05-13 | 1981-11-26 | Valmet Oy | Cylinder dryer for paper machine or equivalent |
| WO1988004206A2 (en) | 1986-12-02 | 1988-06-16 | Beloit Corporation | Apparatus for sequentially drying both sides of a paper web |
| FR2628518A1 (fr) * | 1988-03-10 | 1989-09-15 | Voith Gmbh | Procede pour le sechage d'une nappe de matiere et dispositif pour la mise en oeuvre de ce procede |
| EP0427218A3 (en) * | 1989-11-10 | 1991-10-23 | Sulzer-Escher Wyss Gmbh | Drying system |
| EP0427217A3 (en) * | 1989-11-10 | 1991-11-06 | Sulzer-Escher Wyss Gmbh | Drying system |
| US5065529A (en) * | 1987-02-13 | 1991-11-19 | Beloit Corporation | Apparatus for drying a web |
| US5144758A (en) * | 1987-02-13 | 1992-09-08 | Borgeir Skaugen | Apparatus for drying a web |
| US5175945A (en) * | 1987-02-13 | 1993-01-05 | Beloit Corporation | Apparatus for drying a web |
| EP0517286A3 (en) * | 1987-02-13 | 1993-02-24 | Beloit Corporation | Apparatus for drying a web |
| US5249372A (en) * | 1987-02-13 | 1993-10-05 | Beloit Technologies, Inc. | Apparatus for drying a web |
| US5279049A (en) * | 1987-02-13 | 1994-01-18 | Beloit Technologies, Inc. | Process for the restrained drying of a paper web |
| US5404653A (en) * | 1987-02-13 | 1995-04-11 | Beloit Technologies, Inc. | Apparatus for drying a web |
| US5636448A (en) | 1987-02-13 | 1997-06-10 | Beloit Technologies, Inc. | Web drying apparatus |
| EP0687768A3 (en) * | 1994-06-14 | 1998-01-07 | Valmet Paper Machinery Inc. | Dryer section for a paper machine |
| DE19638783A1 (de) * | 1996-09-21 | 1998-03-26 | Voith Sulzer Papiermasch Gmbh | Maschine und Verfahren zur Herstellung einer Materialbahn |
| DE19651191A1 (de) * | 1996-12-10 | 1998-06-18 | Voith Sulzer Papiermasch Gmbh | Trockenpartie einer Maschine zur Herstellung einer Materialbahn |
| US5884415A (en) * | 1992-04-24 | 1999-03-23 | Beloit Technologies, Inc. | Paper making machine providing curl control |
| US6049999A (en) | 1987-02-13 | 2000-04-18 | Beloit Technologies, Inc. | Machine and process for the restrained drying of a paper web |
| DE3943864B4 (de) * | 1988-01-22 | 2006-05-11 | Metso Paper, Inc. | Trockenpartie in einer Papier- bzw. Kartonmaschine und Verfahren zur Führung einer Papierbahn hierin |
Families Citing this family (51)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4483083A (en) * | 1982-08-18 | 1984-11-20 | Beloit Corporation | Drying and runnability for high speed paper machines |
| DE3336319A1 (de) * | 1983-10-06 | 1985-04-18 | H. Krantz Gmbh & Co, 5100 Aachen | Vorrichtung zur waermebehandlung |
| DE3520070A1 (de) * | 1984-06-06 | 1985-12-12 | Valmet Oy, Helsinki | Papierbahntrockenverfahren und -trockenpartien |
| CA1250744A (en) * | 1984-12-20 | 1989-03-07 | Ralph J. Futcher | Drier felting arrangement |
| DE3529000A1 (de) * | 1985-02-19 | 1986-08-21 | Babcock-BSH AG vormals Büttner-Schilde-Haas AG, 4150 Krefeld | Furniertrockner fuer messerfurniere |
| WO1987006635A1 (en) * | 1986-04-21 | 1987-11-05 | Beloit Corporation | Dryer felt run |
| DE3614742A1 (de) * | 1986-04-30 | 1987-11-05 | Heidelberger Druckmasch Ag | Einrichtung zur nachbehandlung einer beschichteten oder bedruckten gutbahn |
| US4815220A (en) * | 1986-07-18 | 1989-03-28 | Beloit Corporation | Web transfer apparatus |
| FI75890C (fi) * | 1987-01-23 | 1988-08-08 | Valmet Paperikoneet Oy | Foerfarande och anordning i presspartiet i en pappersmaskin foer loesgoering av banan fraon ytan av en pressvals. |
| US4807371A (en) * | 1987-02-13 | 1989-02-28 | Beloit Corporation | Apparatus for maintaining the edges of a web in conformity with a dryer felt |
| US4876803A (en) * | 1987-02-13 | 1989-10-31 | Beloit Corporation | Dryer apparatus for drying a web |
| US5101577A (en) * | 1987-02-13 | 1992-04-07 | Beloit Corporation | Web transfer apparatus |
| US5241760A (en) * | 1987-02-13 | 1993-09-07 | Beloit Technologies, Inc. | Dryer apparatus |
| US4882854A (en) * | 1987-05-26 | 1989-11-28 | Beloit Corporation | Guide roll apparatus for a dryer of a paper machine drying section |
| GB8717387D0 (en) * | 1987-07-23 | 1987-08-26 | Beloit Corp | Dryer section apparatus |
| US5062216A (en) * | 1987-08-14 | 1991-11-05 | Champion International Corporation | Single tiered multi-cylinder paper dryer apparatus |
| FI82096C (fi) * | 1988-01-22 | 1991-12-05 | Tampella Oy Ab | Torkparti i en pappers- eller kartongmaskin och metod foer att leda en bana daeri. |
| DE418317T1 (de) * | 1988-06-02 | 1992-01-16 | Beloit Corp., Beloit, Wis. | Verfahren zur schrumpflosen trocknung einer papierbahn. |
| FI82097C (fi) * | 1989-02-17 | 1991-01-10 | Valmet Paper Machinery Inc | Maongcylindertork i en pappersmaskin. |
| JPH02235411A (ja) * | 1989-03-08 | 1990-09-18 | Matsushita Electric Ind Co Ltd | 電圧制御発振器 |
| DE8906273U1 (de) * | 1989-05-20 | 1990-06-13 | J.M. Voith Gmbh, 7920 Heidenheim | Trockenpartie für eine Maschine zur Herstellung von Faserstoffbahnen |
| EP0428768A1 (de) * | 1989-11-20 | 1991-05-29 | J.M. Voith GmbH | Trockenpartie für eine Maschine zur Herstellung von Faserstoffbahnen |
| US5184408A (en) * | 1990-01-19 | 1993-02-09 | J. M. Voith Gmbh | Dryer section |
| USD321269S (en) | 1990-06-19 | 1991-10-29 | Beloit Corporation | Web drying section |
| US5397438A (en) * | 1990-07-06 | 1995-03-14 | Valmet Paper Machinery, Inc. | Method and device for reduction and equalization of transverse shrinkage of paper in single-wire draw in a drying section |
| DE9110134U1 (de) * | 1991-08-16 | 1991-09-26 | J.M. Voith Gmbh, 7920 Heidenheim | Anordnung zum Überführen einer laufenden Bahn |
| USD333710S (en) | 1991-10-29 | 1993-03-02 | Beloit Technologies, Inc. | Web drying section |
| USD340325S (en) | 1991-11-25 | 1993-10-12 | Beloit Technologies, Inc. | Web drying section |
| DE4142524A1 (de) * | 1991-12-21 | 1993-06-24 | Voith Gmbh J M | Trockenpartie |
| US5542193A (en) * | 1992-04-24 | 1996-08-06 | Beloit Technologies, Inc. | Dryer group for curl control |
| DE4220682C1 (de) * | 1992-06-24 | 1993-12-23 | Voith Gmbh J M | Vorrichtung zum Überführen einer Faserstoffbahn |
| FI100013B (fi) * | 1993-03-22 | 1997-08-15 | Valmet Paper Machinery Inc | Kuivatusmenetelmä ja kuivatusmoduli sekä niitä soveltavat kuivatusosat etenkin nopeakäyntiseen paperikoneeseen |
| US5600897A (en) * | 1993-08-06 | 1997-02-11 | J.M. Voith Gmbh | Mixed dryer section including single-tier and double-tier drying groups with automatic ropeless threading |
| FI103820B1 (fi) * | 1993-11-30 | 1999-09-30 | Valmet Paper Machinery Inc | Menetelmät paperirainan kuivatuksessa sekä paperikoneen kuivatusosat |
| US5661911A (en) * | 1994-02-17 | 1997-09-02 | Valmet Corporation | Dryer section of a paper machine |
| FI93875C (fi) * | 1994-02-17 | 1995-06-12 | Valmet Paper Machinery Inc | Menetelmä paperirainan kuivatuksessa sekä paperikoneen kuivatusosa |
| FI95060C (fi) * | 1994-06-28 | 1995-12-11 | Valmet Paper Machinery Inc | Paperikoneen kuivatusosa |
| US6126787A (en) * | 1995-02-01 | 2000-10-03 | Valmet Corporation | Dry end of a paper machine |
| FI98387C (fi) | 1995-02-01 | 1997-06-10 | Valmet Corp | Menetelmä pintakäsiteltävän paperin, etenkin hienopaperin, valmistamiseksi sekä paperikoneen kuivapää |
| EP0726355B1 (de) * | 1995-02-09 | 2002-06-05 | Voith Paper Patent GmbH | Verfahren zum Transfer eines Papierstreifens von einer ersten zu einer zweiten Bearbeitungsstation in einer Papiermaschine |
| DE19509581A1 (de) * | 1995-03-16 | 1996-09-19 | Voith Sulzer Papiermasch Gmbh | Trockenpartie |
| FI102623B (fi) * | 1995-10-04 | 1999-01-15 | Valmet Corp | Menetelmä ja laite paperikoneessa |
| US6004430A (en) * | 1995-10-04 | 1999-12-21 | Ilvespaa; Heikki | Method and device for enhancing the run of a paper web in a paper machine |
| CA2193554A1 (en) * | 1995-12-22 | 1997-06-23 | Werner Leitenberger | Dryer section for an apparatus for the production of a paper web |
| US5729913A (en) * | 1996-08-21 | 1998-03-24 | Boise Cascade Corporation | Dryer for paper machine |
| FI105574B (fi) * | 1997-09-18 | 2000-09-15 | Valmet Corp | Menetelmä ja laite paperikoneen kuivatusosan loppupäässä |
| DE19927672A1 (de) * | 1999-06-17 | 2000-12-28 | Asten Ag Eupen | Verfahren zum verbesserten Trocknen einer Papierbahn und Einrichtung für die Trockengruppe von Papiermaschinen |
| US6440273B1 (en) * | 1999-12-16 | 2002-08-27 | Metso Paper Karlstad Aktiebolag (Ab) | Compact multilevel paper making machine for manufacturing a web of paper |
| DE102007008501A1 (de) | 2007-02-21 | 2008-08-28 | Voith Patent Gmbh | Trocknungsanordnung |
| DE102015012404A1 (de) * | 2015-01-27 | 2016-07-28 | Herbert Kannegiesser Gmbh | Verfahren und Vorrichtung zum Mangeln von Wäschestücken |
| JP6844194B2 (ja) * | 2015-12-02 | 2021-03-17 | 株式会社リコー | 乾燥装置、搬送システム |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US571787A (en) * | 1896-11-24 | Andrew g | ||
| US2899264A (en) * | 1959-08-11 | Printing of fabrics | ||
| US409615A (en) * | 1889-08-20 | Machine for drying fabrics | ||
| US1178556A (en) * | 1908-05-25 | 1916-04-11 | John D Tompkins | Process of drying paper. |
| US1595238A (en) * | 1922-02-07 | 1926-08-10 | Minton Ogden | Vacuum seal, method and apparatus |
| US1689743A (en) * | 1927-05-02 | 1928-10-30 | Thomas J Mullen | Laundry drier |
| GB977956A (en) * | 1962-09-26 | 1964-12-16 | Abitibi Power & Paper Co | Drier section of paper making machine |
| GB1074529A (en) * | 1964-05-20 | 1967-07-05 | Fleissner Gmbh | Sieve drum drier |
-
1972
- 1972-11-13 FI FI3174/72A patent/FI53333C/fi active
-
1973
- 1973-10-29 GB GB5028073A patent/GB1426067A/en not_active Expired
- 1973-11-02 US US412463A patent/US3868780A/en not_active Expired - Lifetime
- 1973-11-06 DE DE19732355397 patent/DE2355397A1/de active Pending
- 1973-11-09 CA CA185,433A patent/CA1015154A/en not_active Expired
- 1973-11-12 SU SU731970916A patent/SU712044A3/ru active
- 1973-11-12 PL PL1973166493A patent/PL91256B1/pl unknown
- 1973-11-13 IT IT31235/73A patent/IT1001739B/it active
Cited By (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1981003351A1 (en) * | 1980-05-13 | 1981-11-26 | Valmet Oy | Cylinder dryer for paper machine or equivalent |
| US4513517A (en) * | 1980-05-13 | 1985-04-30 | Valmet Oy | Cylinder dryer for paper machine or equivalent |
| WO1988004206A2 (en) | 1986-12-02 | 1988-06-16 | Beloit Corporation | Apparatus for sequentially drying both sides of a paper web |
| WO1988004206A3 (en) * | 1986-12-02 | 1988-06-30 | Beloit Corp | Apparatus for sequentially drying both sides of a paper web |
| EP0334899B2 (en) † | 1986-12-02 | 1999-08-25 | Beloit Technologies, Inc. | Apparatus for sequentially drying both sides of a paper web |
| US5249372A (en) * | 1987-02-13 | 1993-10-05 | Beloit Technologies, Inc. | Apparatus for drying a web |
| US5636448A (en) | 1987-02-13 | 1997-06-10 | Beloit Technologies, Inc. | Web drying apparatus |
| US5065529A (en) * | 1987-02-13 | 1991-11-19 | Beloit Corporation | Apparatus for drying a web |
| US5144758A (en) * | 1987-02-13 | 1992-09-08 | Borgeir Skaugen | Apparatus for drying a web |
| US6049999A (en) | 1987-02-13 | 2000-04-18 | Beloit Technologies, Inc. | Machine and process for the restrained drying of a paper web |
| US5175945A (en) * | 1987-02-13 | 1993-01-05 | Beloit Corporation | Apparatus for drying a web |
| EP0517286A3 (en) * | 1987-02-13 | 1993-02-24 | Beloit Corporation | Apparatus for drying a web |
| US5832625A (en) | 1987-02-13 | 1998-11-10 | Beloit Technologies, Inc. | Apparatus for drying a web |
| US5279049A (en) * | 1987-02-13 | 1994-01-18 | Beloit Technologies, Inc. | Process for the restrained drying of a paper web |
| US5404653A (en) * | 1987-02-13 | 1995-04-11 | Beloit Technologies, Inc. | Apparatus for drying a web |
| EP0733737A3 (en) * | 1987-02-13 | 1997-09-03 | Beloit Corp | Device for drying a web |
| DE3943864B4 (de) * | 1988-01-22 | 2006-05-11 | Metso Paper, Inc. | Trockenpartie in einer Papier- bzw. Kartonmaschine und Verfahren zur Führung einer Papierbahn hierin |
| AT395447B (de) * | 1988-03-10 | 1992-12-28 | Voith Gmbh J M | Verfahren zum trocknen einer materialbahn und vorrichtung zur durchfuehrung dieses verfahrens |
| FR2628518A1 (fr) * | 1988-03-10 | 1989-09-15 | Voith Gmbh | Procede pour le sechage d'une nappe de matiere et dispositif pour la mise en oeuvre de ce procede |
| EP0427217A3 (en) * | 1989-11-10 | 1991-11-06 | Sulzer-Escher Wyss Gmbh | Drying system |
| EP0427218A3 (en) * | 1989-11-10 | 1991-10-23 | Sulzer-Escher Wyss Gmbh | Drying system |
| US5884415A (en) * | 1992-04-24 | 1999-03-23 | Beloit Technologies, Inc. | Paper making machine providing curl control |
| EP0687768A3 (en) * | 1994-06-14 | 1998-01-07 | Valmet Paper Machinery Inc. | Dryer section for a paper machine |
| DE19638783A1 (de) * | 1996-09-21 | 1998-03-26 | Voith Sulzer Papiermasch Gmbh | Maschine und Verfahren zur Herstellung einer Materialbahn |
| DE19651191A1 (de) * | 1996-12-10 | 1998-06-18 | Voith Sulzer Papiermasch Gmbh | Trockenpartie einer Maschine zur Herstellung einer Materialbahn |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1426067A (en) | 1976-02-25 |
| IT1001739B (it) | 1976-04-30 |
| US3868780A (en) | 1975-03-04 |
| SU712044A3 (ru) | 1980-01-25 |
| PL91256B1 (enExample) | 1977-02-28 |
| FI53333B (enExample) | 1977-12-30 |
| CA1015154A (en) | 1977-08-09 |
| FI53333C (fi) | 1978-04-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2355397A1 (de) | Trockenzylindergruppe in einem mehrzylindertrockner fuer eine materialbahn, insbesondere fuer papier | |
| AT392991B (de) | Trockenpartie fuer eine maschine zur herstellung oder verarbeitung von faserbahnen, insbesondere papierbahnen | |
| DE3403642C2 (enExample) | ||
| DE1813462A1 (de) | Methode und Einrichtung zum Trocknen von Papierbahnmaterial | |
| DE8817274U1 (de) | Vorrichtung zum Trocknen einer Bahn | |
| EP0787854A1 (de) | Vorrichtung zum Führen einer Faserstoffbahn in einer einreihigen Trockenpartie | |
| DE3344217C2 (enExample) | ||
| DE69822171T2 (de) | Papier- oder kartonmaschine mit mindestens einer trockeneinheit zum trocknen einer papier- oder kartonbahn | |
| AT394870B (de) | Trocknungsvorrichtung | |
| AT394063B (de) | Trocknungsvorrichtung | |
| DE2918833C2 (de) | Vorrichtung zum Trocknen und Krumpfen von textiler Maschenware | |
| DE4139708B4 (de) | Blas- und Lüftungsvorrichtung für eine umgekehrte Zylindergruppe einer Papiermaschinentrockenpartie | |
| DE4009287B4 (de) | Verfahren und Vorrichtung zum Trocknen einer feuchten Papierbahn in einer Papiermaschinen-Trockenpartie | |
| DE3220076A1 (de) | Luftblaskasten fuer die trockenpartie einer papiermaschine | |
| DE4035985A1 (de) | Verfahren und vorrichtung in einer papiermaschine | |
| EP0472513B1 (de) | Verfahren und Vorrichtung in einem Papiermaschinen-Zylindertrockner | |
| AT400728B (de) | Verfahren und vorrichtung an einem papiermaschinenzylindertrockner mit zweisiebführung | |
| DE29521501U1 (de) | Trockenpartie | |
| DE19613339C2 (de) | Vorrichtung und Verfahren zum Trocknen einer Materialbahn | |
| DE3922361C2 (enExample) | ||
| AT525833B1 (de) | Luftgestützter Pulpetrockner mit Querrichtungsblaskästen | |
| DE4012421A1 (de) | Trockenpartie einer papiermaschine | |
| EP1741828B1 (de) | Maschine zur Herstellung einer Materialbahn | |
| AT236771B (de) | Trockner für Zellstoffbahnen | |
| DE3335232A1 (de) | Vorrichtung zum schrumpffreimachen von schlauchfoermigem textilgut |