DE2351294A1 - Azopigmente - Google Patents
AzopigmenteInfo
- Publication number
- DE2351294A1 DE2351294A1 DE19732351294 DE2351294A DE2351294A1 DE 2351294 A1 DE2351294 A1 DE 2351294A1 DE 19732351294 DE19732351294 DE 19732351294 DE 2351294 A DE2351294 A DE 2351294A DE 2351294 A1 DE2351294 A1 DE 2351294A1
- Authority
- DE
- Germany
- Prior art keywords
- amino
- formula
- azo pigments
- methoxy
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- -1 cyanamino Chemical group 0.000 claims description 30
- 239000000049 pigment Substances 0.000 claims description 21
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 9
- 230000008878 coupling Effects 0.000 claims description 9
- 238000010168 coupling process Methods 0.000 claims description 9
- 238000005859 coupling reaction Methods 0.000 claims description 9
- 239000000460 chlorine Substances 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 5
- 125000005521 carbonamide group Chemical group 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 4
- 125000004442 acylamino group Chemical group 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 claims description 4
- 239000003086 colorant Substances 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- 239000004922 lacquer Substances 0.000 claims description 4
- 239000003973 paint Substances 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- 239000011230 binding agent Substances 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 238000004043 dyeing Methods 0.000 claims description 3
- 239000003292 glue Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 3
- 230000000485 pigmenting effect Effects 0.000 claims description 3
- JXPDNDHCMMOJPC-UHFFFAOYSA-N 2-hydroxybutanedinitrile Chemical compound N#CC(O)CC#N JXPDNDHCMMOJPC-UHFFFAOYSA-N 0.000 claims description 2
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 claims description 2
- 150000001266 acyl halides Chemical class 0.000 claims description 2
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 claims description 2
- 150000004056 anthraquinones Chemical class 0.000 claims description 2
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 229920002521 macromolecule Polymers 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- HVZWVEKIQMJYIK-UHFFFAOYSA-N nitryl chloride Chemical compound [O-][N+](Cl)=O HVZWVEKIQMJYIK-UHFFFAOYSA-N 0.000 claims description 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000000565 sulfonamide group Chemical group 0.000 claims description 2
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 claims 2
- MLIREBYILWEBDM-UHFFFAOYSA-M 2-cyanoacetate Chemical compound [O-]C(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-M 0.000 claims 1
- 125000003830 C1- C4 alkylcarbonylamino group Chemical group 0.000 claims 1
- 239000004744 fabric Substances 0.000 claims 1
- 125000000623 heterocyclic group Chemical group 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- 239000000203 mixture Substances 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- VAMXMNNIEUEQDV-UHFFFAOYSA-N methyl anthranilate Chemical compound COC(=O)C1=CC=CC=C1N VAMXMNNIEUEQDV-UHFFFAOYSA-N 0.000 description 10
- CXNVOWPRHWWCQR-UHFFFAOYSA-N 4-Chloro-ortho-toluidine Chemical compound CC1=CC(Cl)=CC=C1N CXNVOWPRHWWCQR-UHFFFAOYSA-N 0.000 description 8
- WOXLPNAOCCIZGP-UHFFFAOYSA-N 4-chloro-2-methoxyaniline Chemical compound COC1=CC(Cl)=CC=C1N WOXLPNAOCCIZGP-UHFFFAOYSA-N 0.000 description 7
- 239000000975 dye Substances 0.000 description 7
- JQZJMILBKZUKLV-UHFFFAOYSA-N (6-amino-4-oxo-1h-pyrimidin-2-yl)cyanamide Chemical compound NC1=CC(=O)N=C(NC#N)N1 JQZJMILBKZUKLV-UHFFFAOYSA-N 0.000 description 6
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- UZHALXIAWJOLLR-UHFFFAOYSA-N 2-amino-4-chlorobenzonitrile Chemical compound NC1=CC(Cl)=CC=C1C#N UZHALXIAWJOLLR-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 150000008052 alkyl sulfonates Chemical class 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 150000001989 diazonium salts Chemical class 0.000 description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 239000001632 sodium acetate Substances 0.000 description 4
- 235000017281 sodium acetate Nutrition 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- MSKNUZSVGYXUBM-UHFFFAOYSA-N 1-aminocyclohexa-3,5-diene-1,2-dicarboxylic acid Chemical compound OC(=O)C1(N)C=CC=CC1C(O)=O MSKNUZSVGYXUBM-UHFFFAOYSA-N 0.000 description 3
- ASHSUTJPOOXZIL-UHFFFAOYSA-N 2-amino-9,10-dioxoanthracene-1-carboxylic acid Chemical compound C1=CC=C2C(=O)C3=C(C(O)=O)C(N)=CC=C3C(=O)C2=C1 ASHSUTJPOOXZIL-UHFFFAOYSA-N 0.000 description 3
- CXOWHCCVISNMIX-UHFFFAOYSA-N 2-aminonaphthalene-1-carboxylic acid Chemical compound C1=CC=CC2=C(C(O)=O)C(N)=CC=C21 CXOWHCCVISNMIX-UHFFFAOYSA-N 0.000 description 3
- QHMDKGRWJVOUFU-UHFFFAOYSA-N 3-amino-4-chlorobenzamide Chemical compound NC(=O)C1=CC=C(Cl)C(N)=C1 QHMDKGRWJVOUFU-UHFFFAOYSA-N 0.000 description 3
- VYBKAZXQKUFAHG-UHFFFAOYSA-N 3-amino-4-methylbenzamide Chemical compound CC1=CC=C(C(N)=O)C=C1N VYBKAZXQKUFAHG-UHFFFAOYSA-N 0.000 description 3
- OMUPQCXITFAUCB-UHFFFAOYSA-N 4,5-dichloro-2-methoxyaniline Chemical compound COC1=CC(Cl)=C(Cl)C=C1N OMUPQCXITFAUCB-UHFFFAOYSA-N 0.000 description 3
- WRZOMWDJOLIVQP-UHFFFAOYSA-N 5-Chloro-ortho-toluidine Chemical compound CC1=CC=C(Cl)C=C1N WRZOMWDJOLIVQP-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 238000004040 coloring Methods 0.000 description 3
- 239000012954 diazonium Substances 0.000 description 3
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 3
- 150000004702 methyl esters Chemical class 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 150000003230 pyrimidines Chemical class 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000001052 yellow pigment Substances 0.000 description 3
- KHCCJWUQBFVECB-UHFFFAOYSA-N (4,6-diaminopyrimidin-2-yl)cyanamide Chemical compound NC1=CC(N)=NC(NC#N)=N1 KHCCJWUQBFVECB-UHFFFAOYSA-N 0.000 description 2
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 2
- GUMCAKKKNKYFEB-UHFFFAOYSA-N 2,4,5-trichloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C=C1Cl GUMCAKKKNKYFEB-UHFFFAOYSA-N 0.000 description 2
- GEQNZVKIDIPGCO-UHFFFAOYSA-N 2,4-dimethoxyaniline Chemical compound COC1=CC=C(N)C(OC)=C1 GEQNZVKIDIPGCO-UHFFFAOYSA-N 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 2
- XQCZBXHVTFVIFE-UHFFFAOYSA-N 2-amino-4-hydroxypyrimidine Chemical compound NC1=NC=CC(O)=N1 XQCZBXHVTFVIFE-UHFFFAOYSA-N 0.000 description 2
- VKTTYIXIDXWHKW-UHFFFAOYSA-N 2-chloro-5-(trifluoromethyl)aniline Chemical compound NC1=CC(C(F)(F)F)=CC=C1Cl VKTTYIXIDXWHKW-UHFFFAOYSA-N 0.000 description 2
- FQBAMYDJEQUGNV-UHFFFAOYSA-N 2-methoxybenzenesulfonic acid Chemical compound COC1=CC=CC=C1S(O)(=O)=O FQBAMYDJEQUGNV-UHFFFAOYSA-N 0.000 description 2
- DLURHXYXQYMPLT-UHFFFAOYSA-N 2-nitro-p-toluidine Chemical compound CC1=CC=C(N)C([N+]([O-])=O)=C1 DLURHXYXQYMPLT-UHFFFAOYSA-N 0.000 description 2
- SDYWXFYBZPNOFX-UHFFFAOYSA-N 3,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C(Cl)=C1 SDYWXFYBZPNOFX-UHFFFAOYSA-N 0.000 description 2
- QIKYZXDTTPVVAC-UHFFFAOYSA-N 4-Aminobenzamide Chemical compound NC(=O)C1=CC=C(N)C=C1 QIKYZXDTTPVVAC-UHFFFAOYSA-N 0.000 description 2
- CVINWVPRKDIGLL-UHFFFAOYSA-N 4-chloro-2-(trifluoromethyl)aniline Chemical compound NC1=CC=C(Cl)C=C1C(F)(F)F CVINWVPRKDIGLL-UHFFFAOYSA-N 0.000 description 2
- XBAPOWUMJRIKAV-UHFFFAOYSA-N 4-chloro-2-methoxy-5-methylaniline Chemical compound COC1=CC(Cl)=C(C)C=C1N XBAPOWUMJRIKAV-UHFFFAOYSA-N 0.000 description 2
- PBGKNXWGYQPUJK-UHFFFAOYSA-N 4-chloro-2-nitroaniline Chemical compound NC1=CC=C(Cl)C=C1[N+]([O-])=O PBGKNXWGYQPUJK-UHFFFAOYSA-N 0.000 description 2
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 2
- QFMJFXFXQAFGBO-UHFFFAOYSA-N 4-methoxy-2-nitroaniline Chemical compound COC1=CC=C(N)C([N+]([O-])=O)=C1 QFMJFXFXQAFGBO-UHFFFAOYSA-N 0.000 description 2
- XTTHAADPPZNOBT-UHFFFAOYSA-N 5-benzylsulfonyl-2-methoxyaniline Chemical compound C1=C(N)C(OC)=CC=C1S(=O)(=O)CC1=CC=CC=C1 XTTHAADPPZNOBT-UHFFFAOYSA-N 0.000 description 2
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 2
- OLCMNCWEUMBNIS-UHFFFAOYSA-N 5-chloro-2,4-dimethoxyaniline Chemical compound COC1=CC(OC)=C(Cl)C=C1N OLCMNCWEUMBNIS-UHFFFAOYSA-N 0.000 description 2
- XDLWNEUYUGKDTC-UHFFFAOYSA-N 5-ethylsulfonyl-2-methoxyaniline Chemical compound CCS(=O)(=O)C1=CC=C(OC)C(N)=C1 XDLWNEUYUGKDTC-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 125000004658 aryl carbonyl amino group Chemical group 0.000 description 2
- 125000004657 aryl sulfonyl amino group Chemical group 0.000 description 2
- 239000000987 azo dye Substances 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 235000019864 coconut oil Nutrition 0.000 description 2
- 239000003240 coconut oil Substances 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- CDGNLUSBENXDGG-UHFFFAOYSA-N meta-Cresidine Chemical compound COC1=CC=C(N)C(C)=C1 CDGNLUSBENXDGG-UHFFFAOYSA-N 0.000 description 2
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 2
- VGURYVWLCVIMTF-UHFFFAOYSA-N methyl 2-amino-4-nitrobenzoate Chemical compound COC(=O)C1=CC=C([N+]([O-])=O)C=C1N VGURYVWLCVIMTF-UHFFFAOYSA-N 0.000 description 2
- MGJXBDMLVWIYOQ-UHFFFAOYSA-N methylazanide Chemical compound [NH-]C MGJXBDMLVWIYOQ-UHFFFAOYSA-N 0.000 description 2
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 2
- OITOSTVMHWDZDZ-UHFFFAOYSA-N n-(6-amino-4-oxo-1h-pyrimidin-2-yl)acetamide Chemical compound CC(=O)NC1=NC(N)=CC(O)=N1 OITOSTVMHWDZDZ-UHFFFAOYSA-N 0.000 description 2
- 229940055577 oleyl alcohol Drugs 0.000 description 2
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical compound C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- 239000002966 varnish Substances 0.000 description 2
- OXYZQTOFWJLWDE-UHFFFAOYSA-N (4,6-diamino-4-hydroxy-1h-pyrimidin-2-yl)urea Chemical compound NC(=O)NC1=NC(N)(O)C=C(N)N1 OXYZQTOFWJLWDE-UHFFFAOYSA-N 0.000 description 1
- GNEVRRGHIFAWTJ-UHFFFAOYSA-N (4-amino-4-hydroxy-1h-pyrimidin-2-yl)urea Chemical compound NC(=O)NC1=NC(N)(O)C=CN1 GNEVRRGHIFAWTJ-UHFFFAOYSA-N 0.000 description 1
- SPAJGBOXQITFMS-UHFFFAOYSA-N (4-hydroxy-6-oxo-1h-pyrimidin-2-yl)cyanamide Chemical compound OC1=CC(=O)NC(NC#N)=N1 SPAJGBOXQITFMS-UHFFFAOYSA-N 0.000 description 1
- MANYVBUGTRHKES-UHFFFAOYSA-N (4-hydroxy-6-oxo-1h-pyrimidin-2-yl)urea Chemical compound NC(=O)NC1=NC(O)=CC(O)=N1 MANYVBUGTRHKES-UHFFFAOYSA-N 0.000 description 1
- FBUMQNRGTRCEKL-UHFFFAOYSA-N (4-nitrophenyl) 4-amino-3-methoxybenzenesulfonate Chemical compound C1=C(N)C(OC)=CC(S(=O)(=O)OC=2C=CC(=CC=2)[N+]([O-])=O)=C1 FBUMQNRGTRCEKL-UHFFFAOYSA-N 0.000 description 1
- TTZATBWMASCNQU-UHFFFAOYSA-N (6-amino-4-oxo-1h-pyrimidin-2-yl)urea Chemical compound NC(=O)NC1=NC(N)=CC(O)=N1 TTZATBWMASCNQU-UHFFFAOYSA-N 0.000 description 1
- PPKPKFIWDXDAGC-IHWYPQMZSA-N (z)-1,2-dichloroprop-1-ene Chemical compound C\C(Cl)=C\Cl PPKPKFIWDXDAGC-IHWYPQMZSA-N 0.000 description 1
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 1
- KBPLFHHGFOOTCA-UHFFFAOYSA-N 1-Octanol Chemical compound CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 description 1
- NATVSFWWYVJTAZ-UHFFFAOYSA-N 2,4,6-trichloroaniline Chemical compound NC1=C(Cl)C=C(Cl)C=C1Cl NATVSFWWYVJTAZ-UHFFFAOYSA-N 0.000 description 1
- KMWDXUMOFMAQRI-UHFFFAOYSA-N 2,4-dichloro-5-ethylaniline Chemical compound CCC1=CC(N)=C(Cl)C=C1Cl KMWDXUMOFMAQRI-UHFFFAOYSA-N 0.000 description 1
- AJROJTARXSATEB-UHFFFAOYSA-N 2,4-dichloro-5-methoxyaniline Chemical compound COC1=CC(N)=C(Cl)C=C1Cl AJROJTARXSATEB-UHFFFAOYSA-N 0.000 description 1
- KQCMTOWTPBNWDB-UHFFFAOYSA-N 2,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C=C1Cl KQCMTOWTPBNWDB-UHFFFAOYSA-N 0.000 description 1
- LXQOQPGNCGEELI-UHFFFAOYSA-N 2,4-dinitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O LXQOQPGNCGEELI-UHFFFAOYSA-N 0.000 description 1
- PLVBBUUBVVJOIB-UHFFFAOYSA-N 2,5-dichloro-4-methylaniline Chemical compound CC1=CC(Cl)=C(N)C=C1Cl PLVBBUUBVVJOIB-UHFFFAOYSA-N 0.000 description 1
- AVYGCQXNNJPXSS-UHFFFAOYSA-N 2,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC=C1Cl AVYGCQXNNJPXSS-UHFFFAOYSA-N 0.000 description 1
- XPKFTIYOZUJAGA-UHFFFAOYSA-N 2,5-diethoxyaniline Chemical compound CCOC1=CC=C(OCC)C(N)=C1 XPKFTIYOZUJAGA-UHFFFAOYSA-N 0.000 description 1
- NAZDVUBIEPVUKE-UHFFFAOYSA-N 2,5-dimethoxyaniline Chemical compound COC1=CC=C(OC)C(N)=C1 NAZDVUBIEPVUKE-UHFFFAOYSA-N 0.000 description 1
- JDMFXJULNGEPOI-UHFFFAOYSA-N 2,6-dichloroaniline Chemical compound NC1=C(Cl)C=CC=C1Cl JDMFXJULNGEPOI-UHFFFAOYSA-N 0.000 description 1
- HBDOIAFHLHZMCF-UHFFFAOYSA-N 2-(4,6-diaminopyrimidin-2-yl)guanidine Chemical compound NC(=N)NC1=NC(N)=CC(N)=N1 HBDOIAFHLHZMCF-UHFFFAOYSA-N 0.000 description 1
- NHKQFLAKTUCGQX-UHFFFAOYSA-N 2-(4-hydroxy-6-oxo-1h-pyrimidin-2-yl)guanidine Chemical compound NC(=N)NC1=NC(O)=CC(O)=N1 NHKQFLAKTUCGQX-UHFFFAOYSA-N 0.000 description 1
- SGCCOSHUSKMIKV-UHFFFAOYSA-N 2-(6-amino-4-oxo-1h-pyrimidin-2-yl)guanidine Chemical compound NC(=N)NC1=NC(N)=CC(O)=N1 SGCCOSHUSKMIKV-UHFFFAOYSA-N 0.000 description 1
- AUFJTVGCSJNQIF-UHFFFAOYSA-N 2-Amino-4,6-dihydroxypyrimidine Chemical compound NC1=NC(O)=CC(=O)N1 AUFJTVGCSJNQIF-UHFFFAOYSA-N 0.000 description 1
- MIHADVKEHAFNPG-UHFFFAOYSA-N 2-Amino-5-nitrothiazole Chemical compound NC1=NC=C([N+]([O-])=O)S1 MIHADVKEHAFNPG-UHFFFAOYSA-N 0.000 description 1
- ILCLJQFCMRCPNM-UHFFFAOYSA-N 2-Methylpropyl 2-aminobenzoate Chemical compound CC(C)COC(=O)C1=CC=CC=C1N ILCLJQFCMRCPNM-UHFFFAOYSA-N 0.000 description 1
- VMOJFUJVEWWUAV-UHFFFAOYSA-N 2-amino-3-chloroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=C(N)C(Cl)=C2 VMOJFUJVEWWUAV-UHFFFAOYSA-N 0.000 description 1
- MGCGMYPNXAFGFA-UHFFFAOYSA-N 2-amino-5-nitrobenzonitrile Chemical compound NC1=CC=C([N+]([O-])=O)C=C1C#N MGCGMYPNXAFGFA-UHFFFAOYSA-N 0.000 description 1
- 229940018167 2-amino-5-nitrothiazole Drugs 0.000 description 1
- DVJPMCANMMJVQH-UHFFFAOYSA-N 2-amino-n,n,4-trimethyl-1,3-thiazole-5-carboxamide Chemical compound CN(C)C(=O)C=1SC(N)=NC=1C DVJPMCANMMJVQH-UHFFFAOYSA-N 0.000 description 1
- UHGULLIUJBCTEF-UHFFFAOYSA-N 2-aminobenzothiazole Chemical compound C1=CC=C2SC(N)=NC2=C1 UHGULLIUJBCTEF-UHFFFAOYSA-N 0.000 description 1
- CGPPWNTVTNCHDO-UHFFFAOYSA-N 2-bromo-4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1Br CGPPWNTVTNCHDO-UHFFFAOYSA-N 0.000 description 1
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 description 1
- VLMRGLCBIFWPGL-UHFFFAOYSA-N 2-chloro-4-methylsulfonylaniline Chemical compound CS(=O)(=O)C1=CC=C(N)C(Cl)=C1 VLMRGLCBIFWPGL-UHFFFAOYSA-N 0.000 description 1
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 1
- UWIWGZCNYRBVJL-UHFFFAOYSA-N 2-chloronaphthalen-1-amine Chemical compound C1=CC=C2C(N)=C(Cl)C=CC2=C1 UWIWGZCNYRBVJL-UHFFFAOYSA-N 0.000 description 1
- PRIUALOJYOZZOJ-UHFFFAOYSA-L 2-ethylhexyl 2-[dibutyl-[2-(2-ethylhexoxy)-2-oxoethyl]sulfanylstannyl]sulfanylacetate Chemical compound CCCCC(CC)COC(=O)CS[Sn](CCCC)(CCCC)SCC(=O)OCC(CC)CCCC PRIUALOJYOZZOJ-UHFFFAOYSA-L 0.000 description 1
- GVBHRNIWBGTNQA-UHFFFAOYSA-N 2-methoxy-4-nitroaniline Chemical compound COC1=CC([N+]([O-])=O)=CC=C1N GVBHRNIWBGTNQA-UHFFFAOYSA-N 0.000 description 1
- XTTIQGSLJBWVIV-UHFFFAOYSA-N 2-methyl-4-nitroaniline Chemical compound CC1=CC([N+]([O-])=O)=CC=C1N XTTIQGSLJBWVIV-UHFFFAOYSA-N 0.000 description 1
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical compound NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 1
- RMZNXRYIFGTWPF-UHFFFAOYSA-N 2-nitrosoacetic acid Chemical compound OC(=O)CN=O RMZNXRYIFGTWPF-UHFFFAOYSA-N 0.000 description 1
- UQRLKWGPEVNVHT-UHFFFAOYSA-N 3,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC(Cl)=C1 UQRLKWGPEVNVHT-UHFFFAOYSA-N 0.000 description 1
- LHMQDVIHBXWNII-UHFFFAOYSA-N 3-amino-4-methoxy-n-phenylbenzamide Chemical compound C1=C(N)C(OC)=CC=C1C(=O)NC1=CC=CC=C1 LHMQDVIHBXWNII-UHFFFAOYSA-N 0.000 description 1
- INCJNDAQNPWMPZ-UHFFFAOYSA-N 3-amino-4-methoxybenzamide Chemical compound COC1=CC=C(C(N)=O)C=C1N INCJNDAQNPWMPZ-UHFFFAOYSA-N 0.000 description 1
- QKOKLMFCKLEFDV-UHFFFAOYSA-N 3-amino-4-methoxycarbonylbenzoic acid Chemical compound COC(=O)C1=CC=C(C(O)=O)C=C1N QKOKLMFCKLEFDV-UHFFFAOYSA-N 0.000 description 1
- XJCVRTZCHMZPBD-UHFFFAOYSA-N 3-nitroaniline Chemical compound NC1=CC=CC([N+]([O-])=O)=C1 XJCVRTZCHMZPBD-UHFFFAOYSA-N 0.000 description 1
- OKSVBJJXPDBPKN-UHFFFAOYSA-N 4,6-diamino-1h-pyrimidin-2-one Chemical compound NC=1C=C(N)NC(=O)N=1 OKSVBJJXPDBPKN-UHFFFAOYSA-N 0.000 description 1
- SIXWIUJQBBANGK-UHFFFAOYSA-N 4-(4-fluorophenyl)-1h-pyrazol-5-amine Chemical compound N1N=CC(C=2C=CC(F)=CC=2)=C1N SIXWIUJQBBANGK-UHFFFAOYSA-N 0.000 description 1
- XRTJYEIMLZALBD-UHFFFAOYSA-N 4-(6-methyl-1,3-benzothiazol-2-yl)aniline Chemical compound S1C2=CC(C)=CC=C2N=C1C1=CC=C(N)C=C1 XRTJYEIMLZALBD-UHFFFAOYSA-N 0.000 description 1
- CISVVDNATRQDNU-UHFFFAOYSA-N 4-amino-2,5-dimethoxy-n-methylbenzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC(OC)=C(N)C=C1OC CISVVDNATRQDNU-UHFFFAOYSA-N 0.000 description 1
- CUJSSIOATYIWKA-UHFFFAOYSA-N 4-amino-3-methylbenzamide Chemical compound CC1=CC(C(N)=O)=CC=C1N CUJSSIOATYIWKA-UHFFFAOYSA-N 0.000 description 1
- GWSQAGVGSHXRJK-UHFFFAOYSA-N 4-amino-5-methoxy-n,2-dimethylbenzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC(OC)=C(N)C=C1C GWSQAGVGSHXRJK-UHFFFAOYSA-N 0.000 description 1
- YGUFQYGSBVXPMC-UHFFFAOYSA-N 4-chloro-2,5-dimethoxyaniline Chemical compound COC1=CC(Cl)=C(OC)C=C1N YGUFQYGSBVXPMC-UHFFFAOYSA-N 0.000 description 1
- MOJMJIHMADVVCQ-UHFFFAOYSA-N 4-chloro-2-ethoxyaniline Chemical compound CCOC1=CC(Cl)=CC=C1N MOJMJIHMADVVCQ-UHFFFAOYSA-N 0.000 description 1
- NAELBNIEPRXPCO-UHFFFAOYSA-N 4-ethylsulfonyl-2-nitroaniline Chemical compound CCS(=O)(=O)C1=CC=C(N)C([N+]([O-])=O)=C1 NAELBNIEPRXPCO-UHFFFAOYSA-N 0.000 description 1
- IETLXQKNZFHVRQ-UHFFFAOYSA-N 4-methoxy-2h-1,3-benzoxazol-3-amine Chemical compound COC1=CC=CC2=C1N(N)CO2 IETLXQKNZFHVRQ-UHFFFAOYSA-N 0.000 description 1
- OUQMXTJYCAJLGO-UHFFFAOYSA-N 4-methyl-1,3-thiazol-2-amine Chemical compound CC1=CSC(N)=N1 OUQMXTJYCAJLGO-UHFFFAOYSA-N 0.000 description 1
- NDZFWKZHVAUUTN-UHFFFAOYSA-N 4-methylsulfonyl-2-nitroaniline Chemical compound CS(=O)(=O)C1=CC=C(N)C([N+]([O-])=O)=C1 NDZFWKZHVAUUTN-UHFFFAOYSA-N 0.000 description 1
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 1
- BVPJPRYNQHAOPQ-UHFFFAOYSA-N 4-nitronaphthalen-1-amine Chemical compound C1=CC=C2C(N)=CC=C([N+]([O-])=O)C2=C1 BVPJPRYNQHAOPQ-UHFFFAOYSA-N 0.000 description 1
- HTPYOPCOLFDNIM-UHFFFAOYSA-N 5-(benzenesulfonyl)-2-methoxyaniline Chemical compound C1=C(N)C(OC)=CC=C1S(=O)(=O)C1=CC=CC=C1 HTPYOPCOLFDNIM-UHFFFAOYSA-N 0.000 description 1
- APRTXLXKTLCGKJ-UHFFFAOYSA-N 5-amino-2,4-dichlorobenzamide Chemical compound NC(=O)C1=CC(N)=C(Cl)C=C1Cl APRTXLXKTLCGKJ-UHFFFAOYSA-N 0.000 description 1
- SWQWTDAWUSBMGA-UHFFFAOYSA-N 5-chloro-1,3-thiazol-2-amine Chemical compound NC1=NC=C(Cl)S1 SWQWTDAWUSBMGA-UHFFFAOYSA-N 0.000 description 1
- WLJSUJOESWTGEX-UHFFFAOYSA-N 5-chloro-2-(4-chlorophenoxy)aniline Chemical compound NC1=CC(Cl)=CC=C1OC1=CC=C(Cl)C=C1 WLJSUJOESWTGEX-UHFFFAOYSA-N 0.000 description 1
- UZEGGYTUIIXOIX-UHFFFAOYSA-N 5-chloro-2-ethoxyaniline Chemical compound CCOC1=CC=C(Cl)C=C1N UZEGGYTUIIXOIX-UHFFFAOYSA-N 0.000 description 1
- POKAEVPBUOLQIY-UHFFFAOYSA-N 5-chloro-2-methoxy-4-nitroaniline Chemical compound COC1=CC([N+]([O-])=O)=C(Cl)C=C1N POKAEVPBUOLQIY-UHFFFAOYSA-N 0.000 description 1
- WBSMIPLNPSCJFS-UHFFFAOYSA-N 5-chloro-2-methoxyaniline Chemical compound COC1=CC=C(Cl)C=C1N WBSMIPLNPSCJFS-UHFFFAOYSA-N 0.000 description 1
- OMIHQJBWAPWLBO-UHFFFAOYSA-N 5-methoxy-1,3-benzothiazol-2-amine Chemical compound COC1=CC=C2SC(N)=NC2=C1 OMIHQJBWAPWLBO-UHFFFAOYSA-N 0.000 description 1
- DSBIJCMXAIKKKI-UHFFFAOYSA-N 5-nitro-o-toluidine Chemical compound CC1=CC=C([N+]([O-])=O)C=C1N DSBIJCMXAIKKKI-UHFFFAOYSA-N 0.000 description 1
- PPYFMWXMDIAZSV-UHFFFAOYSA-N 5-nitronaphthalen-2-amine Chemical compound [O-][N+](=O)C1=CC=CC2=CC(N)=CC=C21 PPYFMWXMDIAZSV-UHFFFAOYSA-N 0.000 description 1
- SDUUYVWJDAEWSE-UHFFFAOYSA-N 6-amino-1h-quinazoline-2,4-dione Chemical compound N1C(=O)NC(=O)C2=CC(N)=CC=C21 SDUUYVWJDAEWSE-UHFFFAOYSA-N 0.000 description 1
- LNDZXOWGUAIUBG-UHFFFAOYSA-N 6-aminouracil Chemical compound NC1=CC(=O)NC(=O)N1 LNDZXOWGUAIUBG-UHFFFAOYSA-N 0.000 description 1
- KZHGPDSVHSDCMX-UHFFFAOYSA-N 6-methoxy-1,3-benzothiazol-2-amine Chemical compound COC1=CC=C2N=C(N)SC2=C1 KZHGPDSVHSDCMX-UHFFFAOYSA-N 0.000 description 1
- DZWTXWPRWRLHIL-UHFFFAOYSA-N 6-methyl-1,3-benzothiazol-2-amine Chemical compound CC1=CC=C2N=C(N)SC2=C1 DZWTXWPRWRLHIL-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 102100022404 E3 ubiquitin-protein ligase Midline-1 Human genes 0.000 description 1
- 101710102210 E3 ubiquitin-protein ligase Midline-1 Proteins 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- 239000004640 Melamine resin Substances 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 description 1
- 125000004471 alkyl aminosulfonyl group Chemical group 0.000 description 1
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000005140 aralkylsulfonyl group Chemical group 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000005126 aryl alkyl carbonyl amino group Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000004826 dibenzofurans Chemical class 0.000 description 1
- DSSKDXUDARIMTR-UHFFFAOYSA-N dimethyl 2-aminobenzene-1,4-dicarboxylate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C(N)=C1 DSSKDXUDARIMTR-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- UHDNIMBKAKKJPM-UHFFFAOYSA-N ethyl 2-amino-4-methoxybenzoate Chemical compound CCOC(=O)C1=CC=C(OC)C=C1N UHDNIMBKAKKJPM-UHFFFAOYSA-N 0.000 description 1
- ZIUSEGSNTOUIPT-UHFFFAOYSA-N ethyl 2-cyanoacetate Chemical compound CCOC(=O)CC#N ZIUSEGSNTOUIPT-UHFFFAOYSA-N 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 235000021388 linseed oil Nutrition 0.000 description 1
- 239000000944 linseed oil Substances 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Natural products OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 1
- HPOHZHUZBACNRH-UHFFFAOYSA-N methyl 2-amino-4,6-dichlorobenzoate Chemical compound COC(=O)C1=C(N)C=C(Cl)C=C1Cl HPOHZHUZBACNRH-UHFFFAOYSA-N 0.000 description 1
- DZICUHOFOOPVFM-UHFFFAOYSA-N methyl 2-amino-4-(trifluoromethyl)benzoate Chemical compound COC(=O)C1=CC=C(C(F)(F)F)C=C1N DZICUHOFOOPVFM-UHFFFAOYSA-N 0.000 description 1
- PDWBHZYCNIOXCB-UHFFFAOYSA-N methyl 2-amino-4-[(2,5-dichlorobenzoyl)amino]benzoate Chemical compound C1=C(N)C(C(=O)OC)=CC=C1NC(=O)C1=CC(Cl)=CC=C1Cl PDWBHZYCNIOXCB-UHFFFAOYSA-N 0.000 description 1
- OVKVABNNRULENY-UHFFFAOYSA-N methyl 2-amino-4-benzamidobenzoate Chemical compound C1=C(N)C(C(=O)OC)=CC=C1NC(=O)C1=CC=CC=C1 OVKVABNNRULENY-UHFFFAOYSA-N 0.000 description 1
- FUPUSAFEUIFSEY-UHFFFAOYSA-N methyl 2-amino-4-carbamoylbenzoate Chemical compound COC(=O)C1=CC=C(C(N)=O)C=C1N FUPUSAFEUIFSEY-UHFFFAOYSA-N 0.000 description 1
- CEKCJQBZVNIMLD-UHFFFAOYSA-N methyl 2-amino-4-methoxybenzoate Chemical compound COC(=O)C1=CC=C(OC)C=C1N CEKCJQBZVNIMLD-UHFFFAOYSA-N 0.000 description 1
- VAQBJVZNPBNHGC-UHFFFAOYSA-N methyl 2-amino-4-methylbenzoate Chemical compound COC(=O)C1=CC=C(C)C=C1N VAQBJVZNPBNHGC-UHFFFAOYSA-N 0.000 description 1
- WFAWRPHNQAVIPL-UHFFFAOYSA-N methyl 2-amino-4-sulfamoylbenzoate Chemical compound COC(=O)C1=CC=C(S(N)(=O)=O)C=C1N WFAWRPHNQAVIPL-UHFFFAOYSA-N 0.000 description 1
- QVNYNHCNNGKULA-UHFFFAOYSA-N methyl 2-amino-5-bromobenzoate Chemical compound COC(=O)C1=CC(Br)=CC=C1N QVNYNHCNNGKULA-UHFFFAOYSA-N 0.000 description 1
- IGHVUURTQGBABT-UHFFFAOYSA-N methyl 2-amino-5-chlorobenzoate Chemical compound COC(=O)C1=CC(Cl)=CC=C1N IGHVUURTQGBABT-UHFFFAOYSA-N 0.000 description 1
- MDHYFUPTSWXVIA-UHFFFAOYSA-N methyl 2-amino-5-methylbenzoate Chemical compound COC(=O)C1=CC(C)=CC=C1N MDHYFUPTSWXVIA-UHFFFAOYSA-N 0.000 description 1
- VOQBLPBLKSXCDB-UHFFFAOYSA-N methyl 2-amino-5-nitrobenzoate Chemical compound COC(=O)C1=CC([N+]([O-])=O)=CC=C1N VOQBLPBLKSXCDB-UHFFFAOYSA-N 0.000 description 1
- BXRYSXCIRIKKJV-UHFFFAOYSA-N methyl 2-amino-6-chlorobenzoate Chemical compound COC(=O)C1=C(N)C=CC=C1Cl BXRYSXCIRIKKJV-UHFFFAOYSA-N 0.000 description 1
- HCLLOQLXKCCWLJ-UHFFFAOYSA-N methyl 2-amino-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1N HCLLOQLXKCCWLJ-UHFFFAOYSA-N 0.000 description 1
- YEPWCJHMSVABPQ-UHFFFAOYSA-N methyl 3-amino-4-methylbenzoate Chemical compound COC(=O)C1=CC=C(C)C(N)=C1 YEPWCJHMSVABPQ-UHFFFAOYSA-N 0.000 description 1
- PQCRYYPXTWBAKP-UHFFFAOYSA-N methyl 4-acetamido-2-aminobenzoate Chemical compound COC(=O)C1=CC=C(NC(C)=O)C=C1N PQCRYYPXTWBAKP-UHFFFAOYSA-N 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- DSEYJTPEKOUONE-UHFFFAOYSA-N n-(3-amino-4-chloro-1-methylcyclohexa-2,4-dien-1-yl)acetamide Chemical compound CC(=O)NC1(C)CC=C(Cl)C(N)=C1 DSEYJTPEKOUONE-UHFFFAOYSA-N 0.000 description 1
- CPWKRSWUPXTENQ-UHFFFAOYSA-N n-(3-amino-4-chlorophenyl)benzamide Chemical compound C1=C(Cl)C(N)=CC(NC(=O)C=2C=CC=CC=2)=C1 CPWKRSWUPXTENQ-UHFFFAOYSA-N 0.000 description 1
- GUHZWZZDULRGIC-UHFFFAOYSA-N n-(3-amino-4-nitrophenyl)acetamide Chemical compound CC(=O)NC1=CC=C([N+]([O-])=O)C(N)=C1 GUHZWZZDULRGIC-UHFFFAOYSA-N 0.000 description 1
- OZKZCPIOKWGJAE-UHFFFAOYSA-N n-(4,6-diaminopyrimidin-2-yl)acetamide Chemical compound CC(=O)NC1=NC(N)=CC(N)=N1 OZKZCPIOKWGJAE-UHFFFAOYSA-N 0.000 description 1
- LWHFINDEQMCUHA-UHFFFAOYSA-N n-(4,6-diaminopyrimidin-2-yl)benzamide Chemical compound NC1=CC(N)=NC(NC(=O)C=2C=CC=CC=2)=N1 LWHFINDEQMCUHA-UHFFFAOYSA-N 0.000 description 1
- MYODITRKVPBVDT-UHFFFAOYSA-N n-(4,6-diaminopyrimidin-2-yl)benzenesulfonamide Chemical compound NC1=CC(N)=NC(NS(=O)(=O)C=2C=CC=CC=2)=N1 MYODITRKVPBVDT-UHFFFAOYSA-N 0.000 description 1
- MBBUABACCGYFFJ-UHFFFAOYSA-N n-(4,6-diaminopyrimidin-2-yl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=NC(N)=CC(N)=N1 MBBUABACCGYFFJ-UHFFFAOYSA-N 0.000 description 1
- ROKKABNPZRSHHY-UHFFFAOYSA-N n-(4-amino-2,5-dichlorophenyl)acetamide Chemical compound CC(=O)NC1=CC(Cl)=C(N)C=C1Cl ROKKABNPZRSHHY-UHFFFAOYSA-N 0.000 description 1
- VIUTVHGOAOMQHY-UHFFFAOYSA-N n-(4-amino-5-chloro-2-methoxyphenyl)benzamide Chemical compound COC1=CC(N)=C(Cl)C=C1NC(=O)C1=CC=CC=C1 VIUTVHGOAOMQHY-UHFFFAOYSA-N 0.000 description 1
- OEQGMPSQZNJJBM-UHFFFAOYSA-N n-(4-hydroxy-6-oxo-1h-pyrimidin-2-yl)acetamide Chemical compound CC(=O)NC1=NC(O)=CC(O)=N1 OEQGMPSQZNJJBM-UHFFFAOYSA-N 0.000 description 1
- RGMOFCUIALYERN-UHFFFAOYSA-N n-(4-hydroxy-6-oxo-1h-pyrimidin-2-yl)benzamide Chemical compound OC1=CC(O)=NC(NC(=O)C=2C=CC=CC=2)=N1 RGMOFCUIALYERN-UHFFFAOYSA-N 0.000 description 1
- ZAKMOHYYFMKCTR-UHFFFAOYSA-N n-(4-hydroxy-6-oxo-1h-pyrimidin-2-yl)benzenesulfonamide Chemical compound OC1=CC(O)=NC(NS(=O)(=O)C=2C=CC=CC=2)=N1 ZAKMOHYYFMKCTR-UHFFFAOYSA-N 0.000 description 1
- ZKCUZHITSHCPES-UHFFFAOYSA-N n-(4-hydroxy-6-oxo-1h-pyrimidin-2-yl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=NC(O)=CC(O)=N1 ZKCUZHITSHCPES-UHFFFAOYSA-N 0.000 description 1
- GMSLLLSAHFXIDD-UHFFFAOYSA-N n-(6-amino-4-oxo-1h-pyrimidin-2-yl)benzamide Chemical compound NC1=CC(O)=NC(NC(=O)C=2C=CC=CC=2)=N1 GMSLLLSAHFXIDD-UHFFFAOYSA-N 0.000 description 1
- CLUYXMSQAANAAG-UHFFFAOYSA-N n-(6-amino-4-oxo-1h-pyrimidin-2-yl)benzenesulfonamide Chemical compound N1C(N)=CC(=O)N=C1NS(=O)(=O)C1=CC=CC=C1 CLUYXMSQAANAAG-UHFFFAOYSA-N 0.000 description 1
- XUFWZWDPFYUBQG-UHFFFAOYSA-N n-(6-amino-4-oxo-1h-pyrimidin-2-yl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=NC(N)=CC(O)=N1 XUFWZWDPFYUBQG-UHFFFAOYSA-N 0.000 description 1
- NSBIQPJIWUJBBX-UHFFFAOYSA-N n-methoxyaniline Chemical compound CONC1=CC=CC=C1 NSBIQPJIWUJBBX-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 229910017464 nitrogen compound Inorganic materials 0.000 description 1
- 150000002830 nitrogen compounds Chemical group 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- WXWCDTXEKCVRRO-UHFFFAOYSA-N para-Cresidine Chemical compound COC1=CC=C(C)C=C1N WXWCDTXEKCVRRO-UHFFFAOYSA-N 0.000 description 1
- VNBATQCVJRLUOW-UHFFFAOYSA-N phenyl 3-amino-4-methoxybenzoate Chemical compound C1=C(N)C(OC)=CC=C1C(=O)OC1=CC=CC=C1 VNBATQCVJRLUOW-UHFFFAOYSA-N 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- VTGOHKSTWXHQJK-UHFFFAOYSA-N pyrimidin-2-ol Chemical compound OC1=NC=CC=N1 VTGOHKSTWXHQJK-UHFFFAOYSA-N 0.000 description 1
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000001054 red pigment Substances 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 125000006296 sulfonyl amino group Chemical group [H]N(*)S(*)(=O)=O 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/34—Monoazo dyes prepared by diazotising and coupling from other coupling components
- C09B29/36—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds
- C09B29/3604—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom
- C09B29/3665—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic ring with two nitrogen atoms
- C09B29/3669—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic ring with two nitrogen atoms from a pyrimidine ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inks, Pencil-Leads, Or Crayons (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Coloring (AREA)
- Paints Or Removers (AREA)
Priority Applications (15)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732351294 DE2351294A1 (de) | 1973-10-12 | 1973-10-12 | Azopigmente |
| IN2093/CAL/74A IN142399B (enExample) | 1973-10-12 | 1974-09-20 | |
| BE149333A BE820842A (fr) | 1973-10-12 | 1974-10-09 | Pigments azoiques |
| JP49115736A JPS5067324A (enExample) | 1973-10-12 | 1974-10-09 | |
| US05/513,486 US4014863A (en) | 1973-10-12 | 1974-10-09 | Water-insoluble azo-pyrimidine pigments |
| NL7413295A NL7413295A (nl) | 1973-10-12 | 1974-10-09 | Azopigmenten. |
| CH1366774A CH606299A5 (enExample) | 1973-10-12 | 1974-10-10 | |
| IT28296/74A IT1022772B (it) | 1973-10-12 | 1974-10-10 | Pigmenti azoici |
| CA211,136A CA1060000A (en) | 1973-10-12 | 1974-10-10 | Azo pigments |
| ES430944A ES430944A1 (es) | 1973-10-12 | 1974-10-11 | Procedimiento para la obtencion de pigmentos azoicos. |
| GB4417174A GB1430905A (en) | 1973-10-12 | 1974-10-11 | Azo pigments |
| FR7434315A FR2247511B1 (enExample) | 1973-10-12 | 1974-10-11 | |
| BR8503/74A BR7408503D0 (pt) | 1973-10-12 | 1974-10-11 | Processo para preparacao de pigemntos azoicos |
| DK535174A DK143944C (da) | 1973-10-12 | 1974-10-11 | Pyrimidingruppeholdige monoazopigmenter |
| US05/866,538 US4421601A (en) | 1973-10-12 | 1978-01-03 | Water-insoluble azo-purimidine pigments and their use in coloring substrates |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732351294 DE2351294A1 (de) | 1973-10-12 | 1973-10-12 | Azopigmente |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2351294A1 true DE2351294A1 (de) | 1975-04-24 |
Family
ID=5895263
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732351294 Withdrawn DE2351294A1 (de) | 1973-10-12 | 1973-10-12 | Azopigmente |
Country Status (14)
| Country | Link |
|---|---|
| US (2) | US4014863A (enExample) |
| JP (1) | JPS5067324A (enExample) |
| BE (1) | BE820842A (enExample) |
| BR (1) | BR7408503D0 (enExample) |
| CA (1) | CA1060000A (enExample) |
| CH (1) | CH606299A5 (enExample) |
| DE (1) | DE2351294A1 (enExample) |
| DK (1) | DK143944C (enExample) |
| ES (1) | ES430944A1 (enExample) |
| FR (1) | FR2247511B1 (enExample) |
| GB (1) | GB1430905A (enExample) |
| IN (1) | IN142399B (enExample) |
| IT (1) | IT1022772B (enExample) |
| NL (1) | NL7413295A (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0058866A1 (de) * | 1981-02-20 | 1982-09-01 | Bayer Ag | Anthrachinonazoverbindungen, Verfahren zu ihrer Herstellung sowie ihre Verwendung |
| EP0761764A1 (de) * | 1995-08-09 | 1997-03-12 | Hoechst Aktiengesellschaft | Wasserunlösliche Azofarbmittel auf Basis von Aminochinazolindionen |
| WO2008049744A1 (en) | 2006-10-25 | 2008-05-02 | Ciba Holding Inc. | Monoazo colorants for mass-colouring of polymers |
| US8013045B2 (en) | 2006-10-25 | 2011-09-06 | BASF SE Ludwigshafen | Monoazo colorants for mass-colouring of polymers |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4536184A (en) * | 1983-12-12 | 1985-08-20 | Formulabs Industrial Inks, Inc. | Overprinting of dye colored poly(vinyl chloride) resins |
| DE4417718A1 (de) * | 1994-05-20 | 1995-11-23 | Hoechst Ag | Reaktivfarbstoffe für den Tintenstrahldruck |
| US5891231A (en) * | 1997-05-13 | 1999-04-06 | Lexmark International Inc. | Process for preparing pigment dispersions used in inks |
Family Cites Families (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2140536A (en) * | 1936-08-20 | 1938-12-20 | Eastman Kodak Co | Azo compounds and process for dyeing therewith |
| US2140537A (en) * | 1937-01-14 | 1938-12-20 | Eastman Kodak Co | Azo compounds and process for coloring therewith |
| US2140538A (en) * | 1937-01-14 | 1938-12-20 | Eastman Kodak Co | Coloration of organic derivatives of cellulose |
| US2140539A (en) * | 1937-01-23 | 1938-12-20 | Eastman Kodak Co | Azo compounds and process for coloring therewith |
| US2746951A (en) * | 1951-05-07 | 1956-05-22 | Bayer Ag | Pyrimidine azo dyestuffs |
| US2692263A (en) * | 1951-07-06 | 1954-10-19 | Bayer Ag | Yellow substantive azo and azoxy dyestuffs |
| US2675375A (en) * | 1951-07-14 | 1954-04-13 | American Cyanamid Co | Arylazopyrimidine compounds and methods of making the same |
| GB837338A (en) * | 1957-10-15 | 1960-06-09 | Takeda Pharmaceutical | Pyrimidinylazobenzene derivatives and their production |
| DE1445982A1 (de) * | 1963-10-08 | 1969-03-20 | Kyowa Hakko Kogyo Kk | Verfahren fuer die Herstellung von 4-Amin-5-Arylazopyrimidin-Derivaten |
| JPS4826037B1 (enExample) * | 1963-11-26 | 1973-08-03 | ||
| DE1544372B1 (de) * | 1965-02-23 | 1970-05-14 | Basf Ag | Verfahren zur Herstellung von Pigmentfarbstoffen der Anthrachinonazoreihe |
| DE1644259C3 (de) * | 1965-08-02 | 1978-03-23 | Ciba-Geigy Ag, Basel (Schweiz) | In Wasser schwerlösliche Azofarbstoffe, Verfahren zu deren Herstellung und ihre Verwendung zum Färben |
| US3481918A (en) * | 1967-02-16 | 1969-12-02 | Eastman Kodak Co | Quaternized phenylazo-pyrimidine dyes |
| CH481986A (de) * | 1967-05-24 | 1969-11-30 | Geigy Ag J R | Verfahren zur Herstellung von wasserlöslichen Farbsalzen von Azopyrimidinfarbstoffen |
| DE1644239A1 (de) * | 1967-12-16 | 1971-04-15 | Hoechst Ag | Basische Azofarbstoffe und Verfahren zu ihrer Herstellung |
| US3726851A (en) * | 1970-09-23 | 1973-04-10 | Allied Chem | Water-soluble benzothiazolylphenylazo-barbituric acid dyestuffs |
| CA918643A (en) * | 1970-10-19 | 1973-01-09 | Blackwell John | Green-yellow monazo paper dyes derived from barbituric acid |
| US3862116A (en) * | 1972-01-03 | 1975-01-21 | Du Pont | Dehydrothio-p-toluidinesulfonic acid azo-hexahydro-4,6-dioxopyrimidineurea or cyanamide direct dyes for paper |
| BE794270A (fr) * | 1972-01-21 | 1973-07-19 | Basf Ag | Pigments organosolubles derives de la pyrimidine |
| US4028322A (en) * | 1972-07-13 | 1977-06-07 | Ciba-Geigy Corporation | 6-Methylbenzimidazolonylazobarbituric acid pigment |
| US4113720A (en) * | 1972-11-13 | 1978-09-12 | Basf Aktiengesellschaft | Disperse azo dye with diaminopyrimidine coupling component |
| CH580141A5 (enExample) * | 1973-05-03 | 1976-09-30 | Ciba Geigy Ag | |
| US4031073A (en) * | 1973-07-27 | 1977-06-21 | Ciba-Geigy Corporation | Monoazo pigments containing barbituric acid or thio- or imino-derivatives thereof |
| DE2424538A1 (de) * | 1974-05-21 | 1975-12-11 | Basf Ag | Azofarbstoffe mit einem phthalazonrest |
| US4062836A (en) * | 1975-02-03 | 1977-12-13 | Ciba-Geigy Corporation | Disperse phenylazophenylazobarbituric acid dyestuffs |
| US4092314A (en) * | 1975-07-07 | 1978-05-30 | Merck & Co., Inc. | Preparation of 4,6-diamino-5-arylazopyrimidines and adenine compounds |
| US4083841A (en) * | 1976-10-13 | 1978-04-11 | Shaw University | 2,4-Diamino-6-methyl-5-(halophenylazo) pyrimidines |
-
1973
- 1973-10-12 DE DE19732351294 patent/DE2351294A1/de not_active Withdrawn
-
1974
- 1974-09-20 IN IN2093/CAL/74A patent/IN142399B/en unknown
- 1974-10-09 NL NL7413295A patent/NL7413295A/xx not_active Application Discontinuation
- 1974-10-09 BE BE149333A patent/BE820842A/xx unknown
- 1974-10-09 JP JP49115736A patent/JPS5067324A/ja active Pending
- 1974-10-09 US US05/513,486 patent/US4014863A/en not_active Expired - Lifetime
- 1974-10-10 IT IT28296/74A patent/IT1022772B/it active
- 1974-10-10 CA CA211,136A patent/CA1060000A/en not_active Expired
- 1974-10-10 CH CH1366774A patent/CH606299A5/xx not_active IP Right Cessation
- 1974-10-11 ES ES430944A patent/ES430944A1/es not_active Expired
- 1974-10-11 FR FR7434315A patent/FR2247511B1/fr not_active Expired
- 1974-10-11 BR BR8503/74A patent/BR7408503D0/pt unknown
- 1974-10-11 GB GB4417174A patent/GB1430905A/en not_active Expired
- 1974-10-11 DK DK535174A patent/DK143944C/da active
-
1978
- 1978-01-03 US US05/866,538 patent/US4421601A/en not_active Expired - Lifetime
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0058866A1 (de) * | 1981-02-20 | 1982-09-01 | Bayer Ag | Anthrachinonazoverbindungen, Verfahren zu ihrer Herstellung sowie ihre Verwendung |
| EP0761764A1 (de) * | 1995-08-09 | 1997-03-12 | Hoechst Aktiengesellschaft | Wasserunlösliche Azofarbmittel auf Basis von Aminochinazolindionen |
| US5747566A (en) * | 1995-08-09 | 1998-05-05 | Hoechst Aktiengesellschaft | Water-insoluble azo colorants based on aminoquinazolinediones |
| WO2008049744A1 (en) | 2006-10-25 | 2008-05-02 | Ciba Holding Inc. | Monoazo colorants for mass-colouring of polymers |
| US8013045B2 (en) | 2006-10-25 | 2011-09-06 | BASF SE Ludwigshafen | Monoazo colorants for mass-colouring of polymers |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2247511B1 (enExample) | 1978-07-07 |
| BR7408503D0 (pt) | 1975-07-29 |
| DK143944B (da) | 1981-11-02 |
| FR2247511A1 (enExample) | 1975-05-09 |
| IN142399B (enExample) | 1977-07-02 |
| BE820842A (fr) | 1975-04-09 |
| CH606299A5 (enExample) | 1978-10-31 |
| CA1060000A (en) | 1979-08-07 |
| DK535174A (enExample) | 1975-06-09 |
| JPS5067324A (enExample) | 1975-06-06 |
| US4421601A (en) | 1983-12-20 |
| US4014863A (en) | 1977-03-29 |
| GB1430905A (en) | 1976-04-07 |
| ES430944A1 (es) | 1976-10-16 |
| IT1022772B (it) | 1978-04-20 |
| DK143944C (da) | 1982-04-19 |
| NL7413295A (nl) | 1975-04-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2139311A1 (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| CH617714A5 (enExample) | ||
| DE2644265A1 (de) | Heterocyclische verbindungen | |
| DE2351294A1 (de) | Azopigmente | |
| DE1955808A1 (de) | Neue wasserunloesliche Monoazofarbstoffe und Verfahren zu ihrer Herstellung | |
| US4288362A (en) | Monoazo pigments containing a quinazo linonylacetoacetanilide coupling component | |
| DE2749734A1 (de) | Monoazopigmente, verfahren zu deren herstellung und verwendung | |
| EP0218206B1 (de) | Disazopigmente mit einem Piperazin-Brückenglied | |
| DE2457687B2 (de) | Azofarbstoffe, deren Herstellung und Verwendung zum Farben von Lacken, Druckfarben oder Kunststoffen | |
| DE2244035C3 (de) | Disazopigmente, Verfahren zu deren Herstellung und ihre Verwendung zum Pigmentieren von hochmolekularem organischen Material | |
| US3923774A (en) | Quinazolone containing phenyl-azo-pyridine compounds | |
| DE2202820A1 (de) | Pyrimidin-dispersionsfarbstoffe | |
| DE2145422C3 (de) | Neue Disazopigmente | |
| DE2307169A1 (de) | Azofarbstoffe | |
| DE2544568C3 (de) | Sulfonsäuregruppenfreie Azofarbstoffe, Verfahren zu ihrer Herstellung und deren Verwendung als Pigmente in Lacken, Druckfarben oder Kunststoffen | |
| DE1944344A1 (de) | Neue wasserunloesliche Azoverbindungen und Verfahren zu deren Herstellung | |
| DE2812255A1 (de) | Azomethin-pigmente | |
| DE1923256A1 (de) | Wasserunloesliche Monoazofarbstoffe und ein Verfahren zu ihrer Herstellung | |
| DE2417217C3 (de) | Pigmentfarbstoffe mit Oxidazolylresten, Verfahren zu deren Herstellung und ihre Verwendung | |
| DE2424538A1 (de) | Azofarbstoffe mit einem phthalazonrest | |
| DE1811180A1 (de) | ?Case 6329/E/E Neue Azofarbstoffpigmente und Verfahren zu deren Herstellung | |
| DE2351951A1 (de) | Disperse azofarbstoffe | |
| DE3738542A1 (de) | Wasserunloesliche azofarbmittel, ihre herstellung und verwendung | |
| DE1644226C3 (de) | Wasserunlösliche Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Pigmente | |
| DE2259684A1 (de) | Azofarbstoffe mit 2,6-diaminopyridinen als kupplungskomponenten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8130 | Withdrawal |