DE2345303C2 - Sich selbst regulierender elektrischer Widerstandskörper und Verfahren zu dessen Herstellung - Google Patents
Sich selbst regulierender elektrischer Widerstandskörper und Verfahren zu dessen HerstellungInfo
- Publication number
- DE2345303C2 DE2345303C2 DE2345303A DE2345303A DE2345303C2 DE 2345303 C2 DE2345303 C2 DE 2345303C2 DE 2345303 A DE2345303 A DE 2345303A DE 2345303 A DE2345303 A DE 2345303A DE 2345303 C2 DE2345303 C2 DE 2345303C2
- Authority
- DE
- Germany
- Prior art keywords
- carbon black
- conductive
- resistance
- temperature
- self
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000004519 manufacturing process Methods 0.000 title description 10
- 238000000034 method Methods 0.000 title description 10
- 239000000203 mixture Substances 0.000 claims description 51
- 239000006229 carbon black Substances 0.000 claims description 35
- 238000010438 heat treatment Methods 0.000 claims description 29
- 229920001940 conductive polymer Polymers 0.000 claims description 16
- 229920001169 thermoplastic Polymers 0.000 claims description 11
- 238000002844 melting Methods 0.000 claims description 9
- 230000008018 melting Effects 0.000 claims description 9
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 claims description 9
- 238000002441 X-ray diffraction Methods 0.000 claims description 5
- 235000019241 carbon black Nutrition 0.000 description 34
- 239000000463 material Substances 0.000 description 23
- -1 polyethylene Polymers 0.000 description 16
- 229920000642 polymer Polymers 0.000 description 15
- 239000004071 soot Substances 0.000 description 15
- 239000004698 Polyethylene Substances 0.000 description 13
- 229920000573 polyethylene Polymers 0.000 description 13
- 229920001577 copolymer Polymers 0.000 description 12
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 9
- 239000005977 Ethylene Substances 0.000 description 9
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 7
- 238000001125 extrusion Methods 0.000 description 7
- 229920001971 elastomer Polymers 0.000 description 6
- 239000000806 elastomer Substances 0.000 description 6
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 6
- 230000002528 anti-freeze Effects 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 229920002959 polymer blend Polymers 0.000 description 4
- 108010053481 Antifreeze Proteins Proteins 0.000 description 3
- 239000002033 PVDF binder Substances 0.000 description 3
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 3
- 239000002131 composite material Substances 0.000 description 3
- 239000000470 constituent Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 230000007423 decrease Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229920001038 ethylene copolymer Polymers 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 229920002981 polyvinylidene fluoride Polymers 0.000 description 3
- 239000004416 thermosoftening plastic Substances 0.000 description 3
- 239000001993 wax Substances 0.000 description 3
- BQCIDUSAKPWEOX-UHFFFAOYSA-N 1,1-Difluoroethene Chemical compound FC(F)=C BQCIDUSAKPWEOX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 229920002635 polyurethane Polymers 0.000 description 2
- 239000004814 polyurethane Substances 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 238000010894 electron beam technology Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- NBVXSUQYWXRMNV-UHFFFAOYSA-N fluoromethane Chemical compound FC NBVXSUQYWXRMNV-UHFFFAOYSA-N 0.000 description 1
- 229920002313 fluoropolymer Polymers 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000012943 hotmelt Substances 0.000 description 1
- 230000005865 ionizing radiation Effects 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229920001179 medium density polyethylene Polymers 0.000 description 1
- 239000004701 medium-density polyethylene Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- CYIDZMCFTVVTJO-UHFFFAOYSA-N pyromellityc acid Natural products OC(=O)C1=CC(C(O)=O)=C(C(O)=O)C=C1C(O)=O CYIDZMCFTVVTJO-UHFFFAOYSA-N 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01C—RESISTORS
- H01C7/00—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material
- H01C7/02—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material having positive temperature coefficient
- H01C7/027—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material having positive temperature coefficient consisting of conducting or semi-conducting material dispersed in a non-conductive organic material
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10T—TECHNICAL SUBJECTS COVERED BY FORMER US CLASSIFICATION
- Y10T29/00—Metal working
- Y10T29/49—Method of mechanical manufacture
- Y10T29/49002—Electrical device making
- Y10T29/49082—Resistor making
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10T—TECHNICAL SUBJECTS COVERED BY FORMER US CLASSIFICATION
- Y10T29/00—Metal working
- Y10T29/49—Method of mechanical manufacture
- Y10T29/49002—Electrical device making
- Y10T29/49082—Resistor making
- Y10T29/49083—Heater type
Landscapes
- Engineering & Computer Science (AREA)
- Microelectronics & Electronic Packaging (AREA)
- Chemical & Material Sciences (AREA)
- Dispersion Chemistry (AREA)
- Ceramic Engineering (AREA)
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Conductive Materials (AREA)
- Thermistors And Varistors (AREA)
- Apparatuses And Processes For Manufacturing Resistors (AREA)
- Semiconductor Integrated Circuits (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US287444A US3861029A (en) | 1972-09-08 | 1972-09-08 | Method of making heater cable |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2345303A1 DE2345303A1 (de) | 1974-04-18 |
| DE2345303C2 true DE2345303C2 (de) | 1984-09-20 |
Family
ID=23102943
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2345303A Expired DE2345303C2 (de) | 1972-09-08 | 1973-09-07 | Sich selbst regulierender elektrischer Widerstandskörper und Verfahren zu dessen Herstellung |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3861029A (enExample) |
| JP (1) | JPS5818722B2 (enExample) |
| BE (1) | BE804628A (enExample) |
| CA (1) | CA996171A (enExample) |
| DE (1) | DE2345303C2 (enExample) |
| FR (1) | FR2199175B1 (enExample) |
| GB (1) | GB1449262A (enExample) |
| HK (1) | HK1482A (enExample) |
| NL (1) | NL7312393A (enExample) |
| NO (1) | NO141489C (enExample) |
| SE (1) | SE411086B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3922465A1 (de) * | 1988-07-08 | 1990-01-11 | Nippon Basic Technology Lab | Elektrische heizvorrichtung fuer bodenbelaege und dergleichen und bodenbelag mit eingebetteter elektrischer heizvorrichtung |
| DE4024268A1 (de) * | 1990-07-31 | 1992-02-06 | Lehmann & Voss & Co | Elektrisch leitfaehiges kunststoffelement und seine verwendung |
| DE2760471C2 (de) * | 1976-12-13 | 1996-04-04 | Raychem Corp | Verfahren zur Herstellung einer aus einer Elektrode und einer elektrisch leitfähigen Polymermasse bestehenden elektrischen Vorrichtung |
Families Citing this family (126)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4954695A (en) * | 1972-09-08 | 1990-09-04 | Raychem Corporation | Self-limiting conductive extrudates and methods therefor |
| US3972821A (en) * | 1973-04-30 | 1976-08-03 | Amchem Products, Inc. | Heat transfer composition and method of making |
| US4033028A (en) * | 1974-06-21 | 1977-07-05 | Pyrotenax Of Canada Limited | Method of making heating cables |
| GB1507675A (en) * | 1974-06-21 | 1978-04-19 | Pyrotenax Of Ca Ltd | Heating cables and manufacture thereof |
| JPS5113991A (en) * | 1974-07-23 | 1976-02-03 | Matsushita Electric Industrial Co Ltd | Teikotai |
| GB1521460A (en) * | 1974-08-30 | 1978-08-16 | Raychem Corp | Self-limiting electrically resistive article and process for its manufacture |
| US4286376A (en) * | 1975-01-20 | 1981-09-01 | Raychem Corporation | Method of making heater cable of self-limiting conductive extrudates |
| ZA761096B (en) * | 1975-03-03 | 1977-02-23 | Ici Ltd | Fibres |
| US4560498A (en) * | 1975-08-04 | 1985-12-24 | Raychem Corporation | Positive temperature coefficient of resistance compositions |
| US4188276A (en) * | 1975-08-04 | 1980-02-12 | Raychem Corporation | Voltage stable positive temperature coefficient of resistance crosslinked compositions |
| US4421582A (en) * | 1975-08-04 | 1983-12-20 | Raychem Corporation | Self-heating article with deformable electrodes |
| GB1600257A (en) * | 1976-12-13 | 1981-10-14 | Raychem Corp | Strip heaters comprising conductive polymer compositions |
| US4876440A (en) * | 1976-12-13 | 1989-10-24 | Raychem Corporation | Electrical devices comprising conductive polymer compositions |
| DE2760408C2 (de) * | 1976-12-13 | 1996-04-04 | Raychem Corp | Heizstreifen und Verfahren zu seiner Herstellung |
| US4866253A (en) * | 1976-12-13 | 1989-09-12 | Raychem Corporation | Electrical devices comprising conductive polymer compositions |
| FR2533396B1 (fr) * | 1976-12-13 | 1988-08-05 | Raychem Corp | Dispositifs electriques comprenant une electrode en contact avec une composition polymere |
| US4764664A (en) * | 1976-12-13 | 1988-08-16 | Raychem Corporation | Electrical devices comprising conductive polymer compositions |
| US4426339B1 (en) | 1976-12-13 | 1993-12-21 | Raychem Corp. | Method of making electrical devices comprising conductive polymer compositions |
| US4388607A (en) * | 1976-12-16 | 1983-06-14 | Raychem Corporation | Conductive polymer compositions, and to devices comprising such compositions |
| GB1597007A (en) * | 1976-12-16 | 1981-09-03 | Raychem Corp | Conductive polymer compositions and devices |
| DE2919436A1 (de) * | 1978-05-18 | 1979-11-22 | Hotfoil Ltd | Gegenstand aus einem polymeren elektrischen widerstandsmaterial |
| DE2923495A1 (de) * | 1978-06-15 | 1980-01-03 | Hotfoil Ltd | Heizband |
| US4200973A (en) * | 1978-08-10 | 1980-05-06 | Samuel Moore And Company | Method of making self-temperature regulating electrical heating cable |
| US4237441A (en) * | 1978-12-01 | 1980-12-02 | Raychem Corporation | Low resistivity PTC compositions |
| US4242573A (en) * | 1979-01-24 | 1980-12-30 | Raychem Corporation | Water immersible heater |
| US4277673A (en) * | 1979-03-26 | 1981-07-07 | E-B Industries, Inc. | Electrically conductive self-regulating article |
| NZ193661A (en) * | 1979-05-10 | 1983-06-17 | Sunbeam Corp | Heating element conductive and ptc material |
| US5178797A (en) * | 1980-04-21 | 1993-01-12 | Raychem Corporation | Conductive polymer compositions having improved properties under electrical stress |
| US5049850A (en) * | 1980-04-21 | 1991-09-17 | Raychem Corporation | Electrically conductive device having improved properties under electrical stress |
| US4318881A (en) * | 1980-05-19 | 1982-03-09 | Raychem Corporation | Method for annealing PTC compositions |
| CA1168433A (en) * | 1980-05-19 | 1984-06-05 | Umesh K. Sopory | Ptc conductive polymers and devices comprising them |
| US4591700A (en) * | 1980-05-19 | 1986-05-27 | Raychem Corporation | PTC compositions |
| US4309596A (en) * | 1980-06-24 | 1982-01-05 | Sunbeam Corporation | Flexible self-limiting heating cable |
| US4485297A (en) * | 1980-08-28 | 1984-11-27 | Flexwatt Corporation | Electrical resistance heater |
| JPS5784586A (en) * | 1980-11-13 | 1982-05-26 | Hitachi Cable | Self-temperature controllable heater |
| US5227946A (en) * | 1981-04-02 | 1993-07-13 | Raychem Corporation | Electrical device comprising a PTC conductive polymer |
| US4955267A (en) * | 1981-04-02 | 1990-09-11 | Raychem Corporation | Method of making a PTC conductive polymer electrical device |
| US4951382A (en) * | 1981-04-02 | 1990-08-28 | Raychem Corporation | Method of making a PTC conductive polymer electrical device |
| US4845838A (en) * | 1981-04-02 | 1989-07-11 | Raychem Corporation | Method of making a PTC conductive polymer electrical device |
| US5140297A (en) * | 1981-04-02 | 1992-08-18 | Raychem Corporation | PTC conductive polymer compositions |
| US4951384A (en) * | 1981-04-02 | 1990-08-28 | Raychem Corporation | Method of making a PTC conductive polymer electrical device |
| US5195013A (en) * | 1981-04-02 | 1993-03-16 | Raychem Corporation | PTC conductive polymer compositions |
| JPS58164187A (ja) * | 1982-03-25 | 1983-09-29 | 日立電線株式会社 | 自己温度制御性ヒ−タ |
| US4659913A (en) * | 1982-04-16 | 1987-04-21 | Raychem Corporation | Elongate electrical assemblies |
| US4582983A (en) * | 1982-04-16 | 1986-04-15 | Raychem Corporation | Elongate electrical assemblies |
| US4791276A (en) * | 1982-04-16 | 1988-12-13 | Raychem Corporation | Elongate electrical assemblies |
| US4574188A (en) * | 1982-04-16 | 1986-03-04 | Raychem Corporation | Elongate electrical assemblies |
| US4459473A (en) * | 1982-05-21 | 1984-07-10 | Raychem Corporation | Self-regulating heaters |
| JPS59102940A (ja) * | 1982-12-06 | 1984-06-14 | Hitachi Cable Ltd | 自己温度制御性ヒ−タ用樹脂組成物 |
| US4693940A (en) * | 1983-02-14 | 1987-09-15 | Raychem Corporation | Laminate and method of preparing same |
| US4560524A (en) * | 1983-04-15 | 1985-12-24 | Smuckler Jack H | Method of manufacturing a positive temperature coefficient resistive heating element |
| US4471215A (en) * | 1983-08-24 | 1984-09-11 | Eaton Corporation | Self-regulating heating cable having radiation grafted jacket |
| US4719335A (en) * | 1984-01-23 | 1988-01-12 | Raychem Corporation | Devices comprising conductive polymer compositions |
| US4761541A (en) * | 1984-01-23 | 1988-08-02 | Raychem Corporation | Devices comprising conductive polymer compositions |
| US4780598A (en) * | 1984-07-10 | 1988-10-25 | Raychem Corporation | Composite circuit protection devices |
| US5064997A (en) * | 1984-07-10 | 1991-11-12 | Raychem Corporation | Composite circuit protection devices |
| JPS6122590A (ja) * | 1984-07-10 | 1986-01-31 | ダイキン工業株式会社 | 高分子複合発熱体 |
| US5089688A (en) * | 1984-07-10 | 1992-02-18 | Raychem Corporation | Composite circuit protection devices |
| US5148005A (en) * | 1984-07-10 | 1992-09-15 | Raychem Corporation | Composite circuit protection devices |
| US4777351A (en) * | 1984-09-14 | 1988-10-11 | Raychem Corporation | Devices comprising conductive polymer compositions |
| JPS61123665A (ja) * | 1984-11-19 | 1986-06-11 | Matsushita Electric Ind Co Ltd | 導電性樹脂組成物の製造方法 |
| US4857880A (en) * | 1985-03-14 | 1989-08-15 | Raychem Corporation | Electrical devices comprising cross-linked conductive polymers |
| US4724417A (en) * | 1985-03-14 | 1988-02-09 | Raychem Corporation | Electrical devices comprising cross-linked conductive polymers |
| US4698583A (en) * | 1985-03-26 | 1987-10-06 | Raychem Corporation | Method of monitoring a heater for faults |
| US4785163A (en) * | 1985-03-26 | 1988-11-15 | Raychem Corporation | Method for monitoring a heater |
| US4611588A (en) * | 1985-06-05 | 1986-09-16 | Pfizer Hospital Products Group, Inc. | Laser beam resistant material |
| US4668857A (en) * | 1985-08-16 | 1987-05-26 | Belton Corporation | Temperature self-regulating resistive heating element |
| US4689475A (en) * | 1985-10-15 | 1987-08-25 | Raychem Corporation | Electrical devices containing conductive polymers |
| US4818439A (en) * | 1986-01-30 | 1989-04-04 | Sunbeam Corporation | PTC compositions containing low molecular weight polymer molecules for reduced annealing |
| US4849611A (en) * | 1985-12-16 | 1989-07-18 | Raychem Corporation | Self-regulating heater employing reactive components |
| US4801785A (en) * | 1986-01-14 | 1989-01-31 | Raychem Corporation | Electrical devices |
| EP0242029B1 (en) | 1986-02-20 | 1991-12-11 | RAYCHEM CORPORATION (a Delaware corporation) | Method and articles employing ion exchange material |
| JPH0799721B2 (ja) * | 1986-09-13 | 1995-10-25 | 日本メクトロン株式会社 | Ptc組成物の製造法 |
| JPH0777161B2 (ja) * | 1986-10-24 | 1995-08-16 | 日本メクトロン株式会社 | Ptc組成物、その製造法およびptc素子 |
| JPH0710025B2 (ja) * | 1987-05-11 | 1995-02-01 | 日本メクトロン株式会社 | 回路保護機能を有するプリント配線板 |
| US4733059A (en) * | 1987-06-15 | 1988-03-22 | Thermon Manufacturing Company | Elongated parallel, constant wattage heating cable |
| US4924074A (en) * | 1987-09-30 | 1990-05-08 | Raychem Corporation | Electrical device comprising conductive polymers |
| US4907340A (en) * | 1987-09-30 | 1990-03-13 | Raychem Corporation | Electrical device comprising conductive polymers |
| US5166658A (en) * | 1987-09-30 | 1992-11-24 | Raychem Corporation | Electrical device comprising conductive polymers |
| US4889975A (en) * | 1988-03-16 | 1989-12-26 | The Fluorocarbon Company | Self-regulating heater having a heat tape that stops tracking |
| US5066104A (en) * | 1988-03-25 | 1991-11-19 | Raychem Corporation | Liquid crystal electrical fault indicators |
| US4922083A (en) * | 1988-04-22 | 1990-05-01 | Thermon Manufacturing Company | Flexible, elongated positive temperature coefficient heating assembly and method |
| US5057673A (en) * | 1988-05-19 | 1991-10-15 | Fluorocarbon Company | Self-current-limiting devices and method of making same |
| DE3817437A1 (de) * | 1988-05-21 | 1989-11-30 | Asea Brown Boveri | Verfahren zum aufarbeiten von abfallmaterial |
| US5250226A (en) * | 1988-06-03 | 1993-10-05 | Raychem Corporation | Electrical devices comprising conductive polymers |
| US4967057A (en) * | 1988-08-02 | 1990-10-30 | Bayless Ronald E | Snow melting heater mats |
| US5111032A (en) * | 1989-03-13 | 1992-05-05 | Raychem Corporation | Method of making an electrical device comprising a conductive polymer |
| US5052699A (en) * | 1989-07-10 | 1991-10-01 | Raychem Corporation | Grommet |
| US5925276A (en) * | 1989-09-08 | 1999-07-20 | Raychem Corporation | Conductive polymer device with fuse capable of arc suppression |
| US5004432A (en) * | 1989-10-02 | 1991-04-02 | Raychem Corporation | Electrical connector |
| US5002501A (en) * | 1989-10-02 | 1991-03-26 | Raychem Corporation | Electrical plug |
| US5045673A (en) * | 1990-04-04 | 1991-09-03 | General Signal Corporation | PTC devices and their composition |
| US5174924A (en) * | 1990-06-04 | 1992-12-29 | Fujikura Ltd. | Ptc conductive polymer composition containing carbon black having large particle size and high dbp absorption |
| DE69111237T2 (de) * | 1990-05-07 | 1996-02-22 | Raychem Corp., Menlo Park, Calif. | Langgestrecktes widerstandsheizelement. |
| US6111234A (en) * | 1991-05-07 | 2000-08-29 | Batliwalla; Neville S. | Electrical device |
| US5185594A (en) * | 1991-05-20 | 1993-02-09 | Furon Company | Temperature sensing cable device and method of making same |
| US5558794A (en) * | 1991-08-02 | 1996-09-24 | Jansens; Peter J. | Coaxial heating cable with ground shield |
| US5317061A (en) * | 1993-02-24 | 1994-05-31 | Raychem Corporation | Fluoropolymer compositions |
| US5582770A (en) * | 1994-06-08 | 1996-12-10 | Raychem Corporation | Conductive polymer composition |
| US5552199A (en) * | 1994-09-02 | 1996-09-03 | Minnesota Mining And Manufacturing Company | Melt-processable electroconductive fluoroplastic |
| US5756972A (en) * | 1994-10-25 | 1998-05-26 | Raychem Corporation | Hinged connector for heating cables of various sizes |
| US5550350A (en) * | 1994-11-17 | 1996-08-27 | Donald W. Barnes | Heated ice-melting blocks for steps |
| US5622642A (en) * | 1995-02-06 | 1997-04-22 | Raychem Corporation | Sealing apparatus for elongate cables having movable insert with gripping members |
| DE953992T1 (de) * | 1995-08-15 | 2000-04-20 | Bourns, Multifuse (Hong Kong) Ltd. | Oberflächenmontierte leitfähige Polymer-Bauelemente und Verfahren zur Herstellung derselben |
| TW309619B (enExample) * | 1995-08-15 | 1997-07-01 | Mourns Multifuse Hong Kong Ltd | |
| US5792987A (en) * | 1995-08-28 | 1998-08-11 | Raychem Corporation | Sealing device |
| DE19548741A1 (de) | 1995-12-23 | 1997-06-26 | Abb Research Ltd | Verfahren zur Herstellung eines Materials für PTC-Widerstände |
| US5718600A (en) * | 1996-01-17 | 1998-02-17 | Raychem Corporation | Electrical plug |
| US5814264A (en) * | 1996-04-12 | 1998-09-29 | Littelfuse, Inc. | Continuous manufacturing methods for positive temperature coefficient materials |
| US6005232A (en) * | 1996-06-28 | 1999-12-21 | Raychem Corporation | Heating cable |
| US5767448A (en) * | 1996-09-30 | 1998-06-16 | Raychem Corporation | Sealing device |
| US6020808A (en) * | 1997-09-03 | 2000-02-01 | Bourns Multifuse (Hong Kong) Ltd. | Multilayer conductive polymer positive temperature coefficent device |
| US6303866B1 (en) | 1997-12-08 | 2001-10-16 | Acome Societe Cooperative Detravailleurs | Self-adjusting cables and method for making same |
| US6109878A (en) * | 1998-04-13 | 2000-08-29 | Micropump, Inc. | System and a method for velocity modulation for pulseless operation of a pump |
| US5993990A (en) * | 1998-05-15 | 1999-11-30 | Moltech Corporation | PTC current limiting header assembly |
| KR20010079908A (ko) | 1998-09-25 | 2001-08-22 | 추후보정 | 정의 온도 계수 폴리머 재료 제조 방법 |
| DE69928274T2 (de) | 1998-10-15 | 2006-06-01 | Tyco Electronics Corp., Menlo Park | Verbinder für ein elektrisches kabel |
| US6564011B1 (en) * | 2000-08-23 | 2003-05-13 | Fmc Technologies, Inc. | Self-regulating heat source for subsea equipment |
| US6597551B2 (en) | 2000-12-13 | 2003-07-22 | Huladyne Corporation | Polymer current limiting device and method of manufacture |
| US7176421B2 (en) * | 2004-03-05 | 2007-02-13 | Transdigm Inc. | Straight ribbon heater |
| US7322415B2 (en) * | 2004-07-29 | 2008-01-29 | Tyco Thermal Controls Llc | Subterranean electro-thermal heating system and method |
| US7568526B2 (en) * | 2004-07-29 | 2009-08-04 | Tyco Thermal Controls Llc | Subterranean electro-thermal heating system and method |
| US9603196B2 (en) * | 2012-12-14 | 2017-03-21 | Tech Design Llc | Self-regulating semi-conductive flexible heating element |
| JP6756692B2 (ja) * | 2017-11-07 | 2020-09-16 | 日立金属株式会社 | 絶縁電線 |
| JP6795481B2 (ja) | 2017-11-07 | 2020-12-02 | 日立金属株式会社 | 絶縁電線 |
| AR123444A1 (es) | 2021-09-07 | 2022-11-30 | Di Ciommo Jose Antonio | Cable para distribución de energía eléctrica que previene el conexionado indeseado no autorizado al mismo |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE562035A (enExample) * | ||||
| US2282832A (en) * | 1939-11-24 | 1942-05-12 | Gen Electric | Semiconducting tape |
| US2905919A (en) * | 1956-01-17 | 1959-09-22 | British Insulated Callenders | Electric heating cables |
| FR1305140A (fr) * | 1961-11-09 | 1962-09-28 | Montedison Spa | Mélanges à base de polyoléfines cristallines et éléments électriques de conductance variable formés de tels mélanges |
| US3155631A (en) * | 1962-02-19 | 1964-11-03 | Du Pont | Semi-conductor, containing ethylene/ethyl acrylate copolymer, petroleum wax and carbon black |
| US3243753A (en) * | 1962-11-13 | 1966-03-29 | Kohler Fred | Resistance element |
| SE331504B (enExample) * | 1963-03-05 | 1971-01-04 | Elofol Ag | |
| US3308528A (en) * | 1963-11-06 | 1967-03-14 | Ibm | Fabrication of cermet film resistors to close tolerances |
| US3277419A (en) * | 1963-11-20 | 1966-10-04 | Du Pont | Laminated heating unit |
| US3351882A (en) * | 1964-10-09 | 1967-11-07 | Polyelectric Corp | Plastic resistance elements and methods for making same |
| US3410984A (en) * | 1966-05-03 | 1968-11-12 | Gen Electric | Flexible electrically heated personal warming device |
| US3435401A (en) * | 1966-10-05 | 1969-03-25 | Texas Instruments Inc | Insulated electrical conductors |
| GB1201166A (en) * | 1967-12-04 | 1970-08-05 | Ici Ltd | Conducting plastic articles |
| US3591526A (en) * | 1968-01-25 | 1971-07-06 | Polyelectric Corp | Method of manufacturing a temperature sensitive,electrical resistor material |
| US3629154A (en) * | 1969-10-30 | 1971-12-21 | Esb Inc | Thin electrically conductive nonporous polymeric film |
| CA949637A (en) * | 1970-08-03 | 1974-06-18 | Henry J. Stinger | Process for making electrically conductive heating elements |
-
1972
- 1972-09-08 US US287444A patent/US3861029A/en not_active Expired - Lifetime
-
1973
- 1973-09-07 NL NL7312393A patent/NL7312393A/xx not_active Application Discontinuation
- 1973-09-07 GB GB4214073A patent/GB1449262A/en not_active Expired
- 1973-09-07 DE DE2345303A patent/DE2345303C2/de not_active Expired
- 1973-09-07 CA CA180,537A patent/CA996171A/en not_active Expired
- 1973-09-07 JP JP48101001A patent/JPS5818722B2/ja not_active Expired
- 1973-09-07 NO NO3500/73A patent/NO141489C/no unknown
- 1973-09-07 BE BE135466A patent/BE804628A/xx not_active IP Right Cessation
- 1973-09-07 FR FR7332300A patent/FR2199175B1/fr not_active Expired
- 1973-09-07 SE SE7312196A patent/SE411086B/xx unknown
-
1982
- 1982-01-14 HK HK14/82A patent/HK1482A/xx unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2760471C2 (de) * | 1976-12-13 | 1996-04-04 | Raychem Corp | Verfahren zur Herstellung einer aus einer Elektrode und einer elektrisch leitfähigen Polymermasse bestehenden elektrischen Vorrichtung |
| DE3922465A1 (de) * | 1988-07-08 | 1990-01-11 | Nippon Basic Technology Lab | Elektrische heizvorrichtung fuer bodenbelaege und dergleichen und bodenbelag mit eingebetteter elektrischer heizvorrichtung |
| DE4024268A1 (de) * | 1990-07-31 | 1992-02-06 | Lehmann & Voss & Co | Elektrisch leitfaehiges kunststoffelement und seine verwendung |
Also Published As
| Publication number | Publication date |
|---|---|
| CA996171A (en) | 1976-08-31 |
| NL7312393A (enExample) | 1974-03-12 |
| FR2199175A1 (enExample) | 1974-04-05 |
| HK1482A (en) | 1982-01-22 |
| GB1449262A (en) | 1976-09-15 |
| NO141489C (no) | 1980-03-19 |
| JPS4968296A (enExample) | 1974-07-02 |
| SE411086B (sv) | 1979-11-26 |
| DE2345303A1 (de) | 1974-04-18 |
| JPS5818722B2 (ja) | 1983-04-14 |
| NO141489B (no) | 1979-12-10 |
| AU6016873A (en) | 1975-03-13 |
| BE804628A (fr) | 1974-03-07 |
| US3861029A (en) | 1975-01-21 |
| FR2199175B1 (enExample) | 1977-09-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2345303C2 (de) | Sich selbst regulierender elektrischer Widerstandskörper und Verfahren zu dessen Herstellung | |
| DE2345320C2 (de) | Verfahren zur Herstellung eines sich selbst regulierenden elektrischen Widerstandskörpers | |
| DE69606316T2 (de) | Verbesserte polymer ptc-zusammensetzungen | |
| DE2402475A1 (de) | Elektrischer widerstandskoerper mit verminderter schwankung des widerstandswertes und verfahren zu dessen herstellung | |
| DE2364947C2 (de) | Elektrischer Heizwiderstand | |
| DE2634931C2 (de) | Formmasse und unter Verwendung dieser Formmasse hergestellter elektrischer Widerstandskörper mit PTC-Verhalten | |
| DE2948350C2 (enExample) | ||
| DE7527288U (de) | Selbstbegrenzender elektrischer widerstand | |
| DE3050761C2 (de) | Elektrisch leitfähiger, selbstregelnder Gegenstand mit positiven Temperaturkoeffizienten des elektrischen Widerstandes, sowie Verfahren zu seiner Herstellung | |
| DE3707503C2 (de) | PTC-Zusammensetzung | |
| DE2344067C2 (de) | Stoffzusammensetzungen mit nicht-linearer elektrischer Widerstandscharakteristik | |
| DE2543314C2 (de) | Selbstregelnde elektrische Vorrichtung | |
| DE3701814A1 (de) | Elektrisch leitende polymerzusammensetzung mit positivem temperaturkoeffizienten sowie verfahren zu ihrer herstellung | |
| DE69416128T2 (de) | Vorrichtung zum schutz elektrischer leiter | |
| DE2103319C3 (de) | Elektrisches Heizelement aus einem Polymer mit elektrisch leitenden Teilchen | |
| DE69027113T2 (de) | Elektrische heizanordnung und verfahren zu derer herstellung | |
| DE3789325T2 (de) | Leitfähige Polymerzusammensetzung. | |
| DE69233426T2 (de) | Verfahren zur Herstellung leitfähiger Polymerzusammensetzungen | |
| EP1274102B1 (de) | Polymercompound mit nichtlinearer Strom-Spannungs-Kennlinie und Verfahren zur Herstellung eines Polymercompounds | |
| DE10196757B4 (de) | Leitfähige Polymerzusammensetzungen, die N,N-m-Phenylendimaleinimid enthalten, und Vorrichtungen | |
| DE602004000449T2 (de) | Kunstoffthermistor mit positiven Temperaturkoeffizienten und Verfahren zu seiner Herstellung | |
| DE2948281A1 (de) | Elektrische schaltung und schaltungsschutzeinrichtung | |
| DE68917472T2 (de) | Verfahren zur herstellung einer leitenden polymer-folie. | |
| DE3889177T2 (de) | Leitfähige Kunststoffzusammensetzung. | |
| DE7737676U1 (de) | Selbstregulierende elektrische Heizvorrichtung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |