DE2327154C3 - Flammverzögeningsmittel - Google Patents
FlammverzögeningsmittelInfo
- Publication number
- DE2327154C3 DE2327154C3 DE2327154A DE2327154A DE2327154C3 DE 2327154 C3 DE2327154 C3 DE 2327154C3 DE 2327154 A DE2327154 A DE 2327154A DE 2327154 A DE2327154 A DE 2327154A DE 2327154 C3 DE2327154 C3 DE 2327154C3
- Authority
- DE
- Germany
- Prior art keywords
- flame retardant
- component
- flame
- polybrominated
- flame retardants
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003063 flame retardant Substances 0.000 title claims description 40
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims description 27
- 150000001875 compounds Chemical class 0.000 claims description 16
- BIKXLKXABVUSMH-UHFFFAOYSA-N trizinc;diborate Chemical compound [Zn+2].[Zn+2].[Zn+2].[O-]B([O-])[O-].[O-]B([O-])[O-] BIKXLKXABVUSMH-UHFFFAOYSA-N 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 6
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 claims description 5
- 229910019142 PO4 Inorganic materials 0.000 claims description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 5
- 239000010452 phosphate Substances 0.000 claims description 5
- 239000004033 plastic Substances 0.000 claims description 5
- 229920003023 plastic Polymers 0.000 claims description 5
- IIACRCGMVDHOTQ-UHFFFAOYSA-M sulfamate Chemical compound NS([O-])(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-M 0.000 claims description 5
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 239000002245 particle Substances 0.000 claims description 4
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- 150000001336 alkenes Chemical class 0.000 claims description 3
- 239000011248 coating agent Substances 0.000 claims description 3
- 238000000576 coating method Methods 0.000 claims description 3
- 229910052725 zinc Inorganic materials 0.000 claims description 3
- 239000011701 zinc Substances 0.000 claims description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 claims description 2
- 229910052782 aluminium Inorganic materials 0.000 claims description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 2
- 229910052788 barium Inorganic materials 0.000 claims description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 239000011777 magnesium Substances 0.000 claims description 2
- MARCAKLHFUYDJE-UHFFFAOYSA-N 1,2-xylene;hydrate Chemical group O.CC1=CC=CC=C1C MARCAKLHFUYDJE-UHFFFAOYSA-N 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 22
- 239000001301 oxygen Substances 0.000 description 22
- 229910052760 oxygen Inorganic materials 0.000 description 22
- 239000000654 additive Substances 0.000 description 13
- 230000000996 additive effect Effects 0.000 description 10
- 229920005989 resin Polymers 0.000 description 10
- 239000011347 resin Substances 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- 239000000203 mixture Substances 0.000 description 8
- 229920000642 polymer Polymers 0.000 description 8
- QKKSKKMOIOGASY-UHFFFAOYSA-N 2,3-dibromobut-1-ene-1,1-diol Chemical compound CC(Br)C(Br)=C(O)O QKKSKKMOIOGASY-UHFFFAOYSA-N 0.000 description 7
- 239000004793 Polystyrene Substances 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000011888 foil Substances 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- -1 polyethylene Polymers 0.000 description 5
- 229920002223 polystyrene Polymers 0.000 description 5
- 229920003048 styrene butadiene rubber Polymers 0.000 description 5
- 229920001169 thermoplastic Polymers 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 238000001125 extrusion Methods 0.000 description 4
- 229920000126 latex Polymers 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 229920003002 synthetic resin Polymers 0.000 description 4
- 239000000057 synthetic resin Substances 0.000 description 4
- 239000004416 thermosoftening plastic Substances 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical class CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 3
- 239000002174 Styrene-butadiene Substances 0.000 description 3
- 229910000410 antimony oxide Inorganic materials 0.000 description 3
- 238000005266 casting Methods 0.000 description 3
- 238000002485 combustion reaction Methods 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 239000004816 latex Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical class [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 3
- 230000000704 physical effect Effects 0.000 description 3
- 229920000098 polyolefin Polymers 0.000 description 3
- 229920002635 polyurethane Polymers 0.000 description 3
- 239000004814 polyurethane Substances 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 229940058905 antimony compound for treatment of leishmaniasis and trypanosomiasis Drugs 0.000 description 2
- 150000001463 antimony compounds Chemical class 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 229910021538 borax Inorganic materials 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 238000005253 cladding Methods 0.000 description 2
- 150000002009 diols Chemical class 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 150000001451 organic peroxides Chemical class 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 235000013849 propane Nutrition 0.000 description 2
- 238000005096 rolling process Methods 0.000 description 2
- 239000004328 sodium tetraborate Substances 0.000 description 2
- 235000010339 sodium tetraborate Nutrition 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- GMVJKSNPLYBFSO-UHFFFAOYSA-N 1,2,3-tribromobenzene Chemical compound BrC1=CC=CC(Br)=C1Br GMVJKSNPLYBFSO-UHFFFAOYSA-N 0.000 description 1
- SHROKONEDGZYDR-UHFFFAOYSA-N 2,3-dibromobutane-1,1-diol Chemical compound CC(Br)C(Br)C(O)O SHROKONEDGZYDR-UHFFFAOYSA-N 0.000 description 1
- QWVCIORZLNBIIC-UHFFFAOYSA-N 2,3-dibromopropan-1-ol Chemical compound OCC(Br)CBr QWVCIORZLNBIIC-UHFFFAOYSA-N 0.000 description 1
- QKUNKVYPGIOQNP-UHFFFAOYSA-N 4,8,11,14,17,21-hexachlorotetracosane Chemical compound CCCC(Cl)CCCC(Cl)CCC(Cl)CCC(Cl)CCC(Cl)CCCC(Cl)CCC QKUNKVYPGIOQNP-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 240000000491 Corchorus aestuans Species 0.000 description 1
- 235000011777 Corchorus aestuans Nutrition 0.000 description 1
- 235000010862 Corchorus capsularis Nutrition 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229920005601 base polymer Polymers 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000009918 complex formation Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 230000009970 fire resistant effect Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000002309 gasification Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910021389 graphene Inorganic materials 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 229920001684 low density polyethylene Polymers 0.000 description 1
- 239000004702 low-density polyethylene Substances 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 229920001748 polybutylene Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 239000011253 protective coating Substances 0.000 description 1
- 239000005297 pyrex Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 229910052596 spinel Inorganic materials 0.000 description 1
- 239000011029 spinel Substances 0.000 description 1
- 239000011115 styrene butadiene Substances 0.000 description 1
- 210000004243 sweat Anatomy 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 229920005992 thermoplastic resin Polymers 0.000 description 1
- 239000004634 thermosetting polymer Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 230000002087 whitening effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K13/00—Use of mixtures of ingredients not covered by one single of the preceding main groups, each of these compounds being essential
- C08K13/02—Organic and inorganic ingredients
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K9/00—Use of pretreated ingredients
- C08K9/10—Encapsulated ingredients
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Fireproofing Substances (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US263527A US3897346A (en) | 1972-06-16 | 1972-06-16 | Flame retardant agent for synthetic plastics |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2327154A1 DE2327154A1 (de) | 1974-01-03 |
| DE2327154B2 DE2327154B2 (de) | 1978-01-12 |
| DE2327154C3 true DE2327154C3 (de) | 1978-09-14 |
Family
ID=23002127
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2327154A Expired DE2327154C3 (de) | 1972-06-16 | 1973-05-28 | Flammverzögeningsmittel |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3897346A (enExample) |
| JP (1) | JPS523516B2 (enExample) |
| CA (1) | CA1008606A (enExample) |
| CH (1) | CH591552A5 (enExample) |
| DE (1) | DE2327154C3 (enExample) |
| FR (1) | FR2189494B1 (enExample) |
| GB (1) | GB1429552A (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4083789A (en) * | 1974-07-29 | 1978-04-11 | Monsanto Company | Composition containing halogenated polyphosphates |
| US4064298A (en) * | 1976-09-22 | 1977-12-20 | Allied Chemical Corporation | Flame-retardant polyamide fiber for use in carpets |
| US4173561A (en) * | 1977-01-12 | 1979-11-06 | Sumitomo Chemical Company, Limited | Flame retardant polymer composition |
| LU78663A1 (fr) * | 1977-12-09 | 1979-06-13 | Labofina Sa | Compositions de resines styreniques ignifuges et leurs procedes de preparation |
| US4193898A (en) * | 1978-01-19 | 1980-03-18 | Miller Sidney A | Protective covering material for use such as shingles and siding |
| EP0004175A1 (en) * | 1978-03-13 | 1979-09-19 | Uniroyal, Inc. | Smoke retarded polymers and method for preparing them |
| JPS5578081A (en) * | 1978-12-05 | 1980-06-12 | Nissan Chem Ind Ltd | Flame-proofing agent |
| AU543362B2 (en) * | 1980-03-05 | 1985-04-18 | Union Carbide Corporation | Flame retardant alkylene-alkyl acrylate copolymer |
| CA1338392C (en) * | 1987-04-20 | 1996-06-11 | Mitsui Chemicals, Incorporated | Fire-retardant polyamide composition having good heat resistance |
| US6610406B2 (en) | 2000-03-23 | 2003-08-26 | Henkel Locktite Corporation | Flame retardant molding compositions |
| US6432540B1 (en) | 2000-03-23 | 2002-08-13 | Loctite Corporation | Flame retardant molding compositions |
| US20040166241A1 (en) * | 2003-02-20 | 2004-08-26 | Henkel Loctite Corporation | Molding compositions containing quaternary organophosphonium salts |
| JP7410021B2 (ja) * | 2017-10-11 | 2024-01-09 | アイメリーズ ユーエスエー,インコーポレーテッド | エラストマー性物品用の反応性炭酸塩 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2627475A (en) * | 1948-07-31 | 1953-02-03 | Diamond Alkali Co | Fire-retardant paint |
| US3305431A (en) * | 1960-02-15 | 1967-02-21 | Swift & Co | Flameproofing compositon, method and article containing same |
| US3524761A (en) * | 1968-04-25 | 1970-08-18 | Humphrey Chem Corp | Zinc ammonia borate complex |
| US3668155A (en) * | 1968-06-27 | 1972-06-06 | Dow Chemical Co | Self-extinguishing ethylene copolymer foams comprising a ternary mixture of an antimony compound, a halogen-containing compound and a bromine compound |
| BE756046A (fr) * | 1969-09-12 | 1971-03-11 | Monsanto Co | Composition retardatrice de combustion |
-
1972
- 1972-06-16 US US263527A patent/US3897346A/en not_active Expired - Lifetime
-
1973
- 1973-05-15 CA CA171,431A patent/CA1008606A/en not_active Expired
- 1973-05-16 GB GB2343573A patent/GB1429552A/en not_active Expired
- 1973-05-28 CH CH761073A patent/CH591552A5/xx not_active IP Right Cessation
- 1973-05-28 DE DE2327154A patent/DE2327154C3/de not_active Expired
- 1973-06-14 FR FR7321638A patent/FR2189494B1/fr not_active Expired
- 1973-06-15 JP JP48068235A patent/JPS523516B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS523516B2 (enExample) | 1977-01-28 |
| CA1008606A (en) | 1977-04-19 |
| GB1429552A (en) | 1976-03-24 |
| US3897346A (en) | 1975-07-29 |
| DE2327154B2 (de) | 1978-01-12 |
| FR2189494B1 (enExample) | 1976-11-12 |
| JPS4963297A (enExample) | 1974-06-19 |
| CH591552A5 (enExample) | 1977-09-30 |
| FR2189494A1 (enExample) | 1974-01-25 |
| DE2327154A1 (de) | 1974-01-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2221772C2 (de) | Entflammungshemmende, glasfaserverstärkte thermoplastische Polyester-Formmasse | |
| DE68906575T2 (de) | Flammfester thermoplast mit geringer giftigkeit. | |
| DE2327154C3 (de) | Flammverzögeningsmittel | |
| DE2339722A1 (de) | Gummi- oder kunststoffmassen mit flammwidrigem zusatz | |
| DE2263005A1 (de) | Feuerhemmende zubereitungen | |
| DE2812350C3 (de) | Stabilisierte geschäumte Polystyrolmasse und Verfahren zu deren Herstellung | |
| EP0004578B1 (de) | Granulat, enthaltend Styrolpolymerisat und Aluminiumhydroxid, und Verfahren zur Herstellung flammwidriger Styrolpolymerisatschäume | |
| DE1794182C3 (de) | Schwerentflammbare Formmassen aus Styrolpolymerisaten | |
| DE1794072C3 (de) | Schwerbrennbare Formmassen auf der Basis von Polymerisaten des Propylene | |
| DE2162271A1 (de) | Halogen enthaltende Benzolpolycarbonsäureester | |
| DE69029998T2 (de) | Flammhemmende thermoplastische Zusammensetzung enthaltend vinylaromatische Polymere | |
| DE69123400T2 (de) | Flammfeste Polyolefinfasern und Folien | |
| DE2936510A1 (de) | Haftvermittler fuer thermoplastische zusammensetzungen | |
| DE2548088A1 (de) | Selbstverloeschende polyolefinzusammensetzungen | |
| DE2534793B2 (de) | Feuerhemmende Zubereitungen für Polyurethane | |
| US4165309A (en) | Flame retardant polymer composition | |
| DE2363758C3 (de) | Flammwidrige Polyestermasse | |
| DE3004943A1 (de) | Flammhemmende thermoplastische zusammensetzungen mit verminderter ausbluehneigung | |
| DE1669693B2 (de) | Flammverzögerungsmittel | |
| DE2317652B2 (de) | Schlagfeste PVC-Mischungen Bayer AG, 5090 Leverkusen | |
| DE2133557B2 (de) | Schwer entflammbare Zusammensetzung von Olefinpolymeren oder halogenierten Kohlenwasserstoffpolymeren | |
| DE1494983B2 (de) | Flammfeste kunststoffe | |
| DE1794213C3 (de) | Flammhemmung bei halogenhaltigen polymeren Kunststoffen | |
| DE1569021C (de) | Flammschutzmittel fur synthetische organische Polymere | |
| DE2105444A1 (de) | Schwer entzündbare Kunstharzprodukte |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |