DE2317962A1 - Terpenische sulfone mit einem 3-oxo2,6,6-trimethyl-cyclohexenylrest - Google Patents
Terpenische sulfone mit einem 3-oxo2,6,6-trimethyl-cyclohexenylrestInfo
- Publication number
- DE2317962A1 DE2317962A1 DE2317962A DE2317962A DE2317962A1 DE 2317962 A1 DE2317962 A1 DE 2317962A1 DE 2317962 A DE2317962 A DE 2317962A DE 2317962 A DE2317962 A DE 2317962A DE 2317962 A1 DE2317962 A1 DE 2317962A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- trimethyl
- phenyl
- sulfones
- given above
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 3-OXO2,6,6-TRIMETHYL-CYCLOHEXENYL RESIDUE Chemical group 0.000 title claims description 13
- 150000003457 sulfones Chemical class 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 150000003254 radicals Chemical class 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000002950 monocyclic group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 150000005840 aryl radicals Chemical class 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Chemical group CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 claims description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical group CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 150000007942 carboxylates Chemical class 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 230000000737 periodic effect Effects 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000003944 tolyl group Chemical group 0.000 claims description 2
- 125000005023 xylyl group Chemical group 0.000 claims description 2
- KHIWWQKSHDUIBK-UHFFFAOYSA-M periodate Chemical compound [O-]I(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-M 0.000 claims 2
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 239000003701 inert diluent Substances 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- FDSDTBUPSURDBL-LOFNIBRQSA-N canthaxanthin Chemical compound CC=1C(=O)CCC(C)(C)C=1/C=C/C(/C)=C/C=C/C(/C)=C/C=C/C=C(C)C=CC=C(C)C=CC1=C(C)C(=O)CCC1(C)C FDSDTBUPSURDBL-LOFNIBRQSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 229910044991 metal oxide Inorganic materials 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- OOUTWVMJGMVRQF-DOYZGLONSA-N Phoenicoxanthin Natural products CC(=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C(=O)C(O)CC1(C)C)C=CC=C(/C)C=CC2=C(C)C(=O)CCC2(C)C OOUTWVMJGMVRQF-DOYZGLONSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 230000001174 ascending effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229940008033 canthaxanthin Drugs 0.000 description 1
- 235000012682 canthaxanthin Nutrition 0.000 description 1
- 239000001659 canthaxanthin Substances 0.000 description 1
- 235000021466 carotenoid Nutrition 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical compound OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- DOUHZFSGSXMPIE-UHFFFAOYSA-N hydroxidooxidosulfur(.) Chemical compound [O]SO DOUHZFSGSXMPIE-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- CHLCPTJLUJHDBO-UHFFFAOYSA-M sodium;benzenesulfinate Chemical compound [Na+].[O-]S(=O)C1=CC=CC=C1 CHLCPTJLUJHDBO-UHFFFAOYSA-M 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 150000003722 vitamin derivatives Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C403/00—Derivatives of cyclohexane or of a cyclohexene or of cyclohexadiene, having a side-chain containing an acyclic unsaturated part of at least four carbon atoms, this part being directly attached to the cyclohexane or cyclohexene or cyclohexadiene rings, e.g. vitamin A, beta-carotene, beta-ionone
- C07C403/22—Derivatives of cyclohexane or of a cyclohexene or of cyclohexadiene, having a side-chain containing an acyclic unsaturated part of at least four carbon atoms, this part being directly attached to the cyclohexane or cyclohexene or cyclohexadiene rings, e.g. vitamin A, beta-carotene, beta-ionone having side-chains substituted by sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/16—Systems containing only non-condensed rings with a six-membered ring the ring being unsaturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7212476A FR2179500B1 (enExample) | 1972-04-10 | 1972-04-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2317962A1 true DE2317962A1 (de) | 1973-10-31 |
Family
ID=9096581
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2317962A Pending DE2317962A1 (de) | 1972-04-10 | 1973-04-10 | Terpenische sulfone mit einem 3-oxo2,6,6-trimethyl-cyclohexenylrest |
Country Status (12)
| Country | Link |
|---|---|
| JP (2) | JPS497253A (enExample) |
| BE (1) | BE797966A (enExample) |
| CA (1) | CA977356A (enExample) |
| CH (1) | CH563970A5 (enExample) |
| DD (1) | DD108078A5 (enExample) |
| DE (1) | DE2317962A1 (enExample) |
| FR (1) | FR2179500B1 (enExample) |
| GB (1) | GB1384980A (enExample) |
| HU (1) | HU167162B (enExample) |
| IT (1) | IT981917B (enExample) |
| NL (1) | NL146491B (enExample) |
| SU (1) | SU486509A3 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN110272368A (zh) * | 2019-05-29 | 2019-09-24 | 南京瑞鼎生物医药有限公司 | 一种c15砜的制备方法 |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5079733U (enExample) * | 1973-11-28 | 1975-07-10 | ||
| US5107010A (en) * | 1990-12-12 | 1992-04-21 | Neurosearch A/S | Astaxanthin intermediates |
| CH694126A5 (de) | 1998-06-18 | 2004-07-30 | Sumitomo Chemical Co | Ketosulfonderivate und Verfahren zu deren Herstellung. |
-
1972
- 1972-04-10 FR FR7212476A patent/FR2179500B1/fr not_active Expired
-
1973
- 1973-04-02 NL NL737304569A patent/NL146491B/xx not_active IP Right Cessation
- 1973-04-06 JP JP48038862A patent/JPS497253A/ja active Pending
- 1973-04-06 DD DD169997A patent/DD108078A5/xx unknown
- 1973-04-09 GB GB1693673A patent/GB1384980A/en not_active Expired
- 1973-04-09 BE BE129816A patent/BE797966A/xx not_active IP Right Cessation
- 1973-04-09 SU SU1899481A patent/SU486509A3/ru active
- 1973-04-09 HU HURO721A patent/HU167162B/hu unknown
- 1973-04-09 CH CH507873A patent/CH563970A5/xx not_active IP Right Cessation
- 1973-04-09 CA CA168,199A patent/CA977356A/en not_active Expired
- 1973-04-10 IT IT22816/73A patent/IT981917B/it active
- 1973-04-10 JP JP48040074A patent/JPS5221502B2/ja not_active Expired
- 1973-04-10 DE DE2317962A patent/DE2317962A1/de active Pending
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN110272368A (zh) * | 2019-05-29 | 2019-09-24 | 南京瑞鼎生物医药有限公司 | 一种c15砜的制备方法 |
| CN110272368B (zh) * | 2019-05-29 | 2021-06-18 | 南京瑞鼎生物医药有限公司 | 一种c15砜的制备方法 |
Also Published As
| Publication number | Publication date |
|---|---|
| CH563970A5 (enExample) | 1975-07-15 |
| NL7304569A (enExample) | 1973-10-12 |
| JPS497253A (enExample) | 1974-01-22 |
| JPS5221502B2 (enExample) | 1977-06-10 |
| FR2179500A1 (enExample) | 1973-11-23 |
| JPS4913152A (enExample) | 1974-02-05 |
| HU167162B (enExample) | 1975-08-28 |
| NL146491B (nl) | 1975-07-15 |
| IT981917B (it) | 1974-10-10 |
| BE797966A (fr) | 1973-10-09 |
| CA977356A (en) | 1975-11-04 |
| SU486509A3 (ru) | 1975-09-30 |
| DD108078A5 (enExample) | 1974-09-05 |
| FR2179500B1 (enExample) | 1977-08-05 |
| GB1384980A (en) | 1975-02-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1695753B2 (de) | Verfahren zur Herstellung von 6,6disubstituierten 2,2-Dimethyl-4-oxopiperidinen | |
| US3192258A (en) | Process for oxidizing a primary alchol | |
| DE2317962A1 (de) | Terpenische sulfone mit einem 3-oxo2,6,6-trimethyl-cyclohexenylrest | |
| DE2429562A1 (de) | Benzoxazolinon-derivate | |
| DE2006472A1 (de) | Furan-3-carboxamid-Derivate und Verfahren zu ihrer Herstellung | |
| DE3643403A1 (de) | Benzophenone und verfahren zu ihrer herstellung | |
| DE2318001C3 (de) | Dienische Sulfone | |
| EP0002460B1 (de) | Verfahren zur Herstellung von 3,4-Methylendioxymandelsäure | |
| DE2514759B2 (de) | Verfahren zur Herstellung von 233-TrimethyIindolenin | |
| DE2550934C3 (de) | Reinigung von Caprolactam | |
| DE1668369A1 (de) | Verfahren zum Herstellen von 17alpha-(3'-Hydroxypropyl)-4-androsten-3ss,17ss-diol | |
| DE2503699C2 (de) | Verfahren zur Herstellung von 1,2- Benzisothiazolen | |
| DE3121675A1 (de) | "verfahren zur herstellung von halogen-2-merkaptobenzoxazolen" | |
| DE1117565B (de) | Verfahren zur Herstellung von Salzen von in Nachbarstellung durch zwei Sauerstoffsaeuregruppen des Schwefels substituierten organischen Verbindungen | |
| EP0039795B1 (de) | Verfahren zur Herstellung von 1,2-Benzisothiazolen | |
| DE3126429A1 (de) | Verfahren zur herstellung von diphenylaether-derivaten | |
| DE2127898C3 (de) | Verfahren zur Herstellung von ge gebenenfalls inert substituierten o und p Aminothiophenolen | |
| DE2305235A1 (de) | Neue isoprenische sulfone | |
| DE2361144C3 (de) | SuIfon-Alkohole und deren Ester und Verfahren zu ihrer Herstellung | |
| DE2112778A1 (de) | Verfahren zur Herstellung von 2-Cyan-3,4,5,6-tetrahalogenbenzoesaeurealkylestern | |
| DE2724361A1 (de) | Reinigung von caprolactam | |
| DE10029413A1 (de) | Verfahren zur Herstellung von 2,3,4,6-Tetramethylmandelsäure und 2,3,4,6-Tetramethylmandelsäureacetat | |
| DE2460292C3 (de) | Verfahren zur Herstellung von 5-Fluor-2-methyl-1 -(p-methyl-sulfinylbenzyliden)-inden-3-essigsäure oder deren Salzen | |
| DE2711363A1 (de) | Verfahren zur herstellung von sulfonierten benzofuran-derivaten | |
| DE1470018C (de) | 6 Chlor 7 sulfamyl 4 methoxy spiro eckige Klammer auf 2H 3,4 dihydro 1,2,4 benzothiadiazm 3,1 cyclohexan eckige Klam mer zu 1,1 dioxyd |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHW | Rejection |