DE2312467A1 - Pesticide mittel - Google Patents
Pesticide mittelInfo
- Publication number
- DE2312467A1 DE2312467A1 DE19732312467 DE2312467A DE2312467A1 DE 2312467 A1 DE2312467 A1 DE 2312467A1 DE 19732312467 DE19732312467 DE 19732312467 DE 2312467 A DE2312467 A DE 2312467A DE 2312467 A1 DE2312467 A1 DE 2312467A1
- Authority
- DE
- Germany
- Prior art keywords
- block
- means according
- block copolymer
- blocks
- polymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000003795 chemical substances by application Substances 0.000 title claims description 26
- 239000000575 pesticide Substances 0.000 title description 3
- -1 phosphorus compound Chemical class 0.000 claims description 16
- 239000000203 mixture Substances 0.000 claims description 14
- 229920001400 block copolymer Polymers 0.000 claims description 12
- 229920000642 polymer Polymers 0.000 claims description 10
- OEBRKCOSUFCWJD-UHFFFAOYSA-N dichlorvos Chemical compound COP(=O)(OC)OC=C(Cl)Cl OEBRKCOSUFCWJD-UHFFFAOYSA-N 0.000 claims description 9
- 230000000361 pesticidal effect Effects 0.000 claims description 8
- 239000003381 stabilizer Substances 0.000 claims description 8
- 239000004793 Polystyrene Substances 0.000 claims description 7
- 229920002223 polystyrene Polymers 0.000 claims description 7
- 239000004800 polyvinyl chloride Substances 0.000 claims description 7
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 7
- 150000002903 organophosphorus compounds Chemical class 0.000 claims description 6
- 229920001223 polyethylene glycol Polymers 0.000 claims description 6
- 239000007787 solid Substances 0.000 claims description 6
- 239000004698 Polyethylene Substances 0.000 claims description 5
- 229910052698 phosphorus Inorganic materials 0.000 claims description 5
- 239000011574 phosphorus Substances 0.000 claims description 5
- 229920000573 polyethylene Polymers 0.000 claims description 5
- 239000005038 ethylene vinyl acetate Substances 0.000 claims description 4
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 claims description 4
- 229920001515 polyalkylene glycol Polymers 0.000 claims description 4
- 241000238421 Arthropoda Species 0.000 claims description 3
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 claims description 3
- 239000002202 Polyethylene glycol Substances 0.000 claims description 3
- 241000607479 Yersinia pestis Species 0.000 claims description 3
- 239000001863 hydroxypropyl cellulose Substances 0.000 claims description 3
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 claims description 3
- UDGKZGLPXCRRAM-UHFFFAOYSA-N 1,2,5-thiadiazole Chemical compound C=1C=NSN=1 UDGKZGLPXCRRAM-UHFFFAOYSA-N 0.000 claims description 2
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- JKFAIQOWCVVSKC-UHFFFAOYSA-N furazan Chemical group C=1C=NON=1 JKFAIQOWCVVSKC-UHFFFAOYSA-N 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229920000233 poly(alkylene oxides) Polymers 0.000 claims description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 claims description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 claims description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 239000012815 thermoplastic material Substances 0.000 claims description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 2
- 229920002554 vinyl polymer Polymers 0.000 claims description 2
- 239000004709 Chlorinated polyethylene Substances 0.000 claims 1
- 238000007598 dipping method Methods 0.000 claims 1
- 239000002917 insecticide Substances 0.000 description 9
- 229920001577 copolymer Polymers 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 4
- 239000000969 carrier Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 229920001169 thermoplastic Polymers 0.000 description 3
- 239000004416 thermosoftening plastic Substances 0.000 description 3
- 239000008118 PEG 6000 Substances 0.000 description 2
- 229920002584 Polyethylene Glycol 6000 Polymers 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 2
- 239000004926 polymethyl methacrylate Substances 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 229920000298 Cellophane Polymers 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- 229920001744 Polyaldehyde Polymers 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 229920001030 Polyethylene Glycol 4000 Polymers 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- ZFMQKOWCDKKBIF-UHFFFAOYSA-N bis(3,5-difluorophenyl)phosphane Chemical compound FC1=CC(F)=CC(PC=2C=C(F)C=C(F)C=2)=C1 ZFMQKOWCDKKBIF-UHFFFAOYSA-N 0.000 description 1
- 239000011111 cardboard Substances 0.000 description 1
- 230000002498 deadly effect Effects 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 244000144972 livestock Species 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 239000005033 polyvinylidene chloride Substances 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
Landscapes
- Agricultural Chemicals And Associated Chemicals (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1198672A GB1415001A (en) | 1972-03-15 | 1972-03-15 | Pesticidal compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2312467A1 true DE2312467A1 (de) | 1973-10-04 |
Family
ID=9996330
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732312467 Pending DE2312467A1 (de) | 1972-03-15 | 1973-03-13 | Pesticide mittel |
Country Status (11)
| Country | Link |
|---|---|
| JP (1) | JPS49437A (enExample) |
| AT (1) | AT324044B (enExample) |
| BE (1) | BE796665A (enExample) |
| CH (1) | CH570767A5 (enExample) |
| DE (1) | DE2312467A1 (enExample) |
| FR (1) | FR2175964B1 (enExample) |
| GB (1) | GB1415001A (enExample) |
| IT (1) | IT981276B (enExample) |
| NL (1) | NL7303476A (enExample) |
| PL (1) | PL87036B1 (enExample) |
| SU (1) | SU472490A3 (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5119023B2 (enExample) * | 1972-05-17 | 1976-06-14 | ||
| US5521176A (en) * | 1989-11-28 | 1996-05-28 | Nihon Bayer Agrochem K.K. | Agrochemical compositions containing certain N-heterocycligs, compounds and stabilizer |
| US5260312A (en) * | 1989-11-28 | 1993-11-09 | Nihon Bayer Agrochem K.K. | Stabilized agrochemical compositions |
| JPH03167106A (ja) * | 1989-11-28 | 1991-07-19 | Nippon Tokushu Noyaku Seizo Kk | 安定化された農薬組成物 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2135700A1 (de) * | 1971-07-16 | 1973-02-01 | Globus Werke Fritz Schulzjun 8 | Vorrichtung zur vertilgung von insekten |
-
1972
- 1972-03-15 GB GB1198672A patent/GB1415001A/en not_active Expired
-
1973
- 1973-03-09 IT IT2141873A patent/IT981276B/it active
- 1973-03-13 BE BE1004884A patent/BE796665A/xx unknown
- 1973-03-13 PL PL16123973A patent/PL87036B1/pl unknown
- 1973-03-13 AT AT220373A patent/AT324044B/de not_active IP Right Cessation
- 1973-03-13 FR FR7308868A patent/FR2175964B1/fr not_active Expired
- 1973-03-13 DE DE19732312467 patent/DE2312467A1/de active Pending
- 1973-03-13 JP JP2862573A patent/JPS49437A/ja active Pending
- 1973-03-13 NL NL7303476A patent/NL7303476A/xx not_active Application Discontinuation
- 1973-03-13 CH CH364373A patent/CH570767A5/xx not_active IP Right Cessation
- 1973-03-14 SU SU1890162A patent/SU472490A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| FR2175964A1 (enExample) | 1973-10-26 |
| CH570767A5 (enExample) | 1975-12-31 |
| JPS49437A (enExample) | 1974-01-05 |
| FR2175964B1 (enExample) | 1975-10-31 |
| AT324044B (de) | 1975-08-11 |
| PL87036B1 (enExample) | 1976-06-30 |
| BE796665A (nl) | 1973-09-13 |
| NL7303476A (enExample) | 1973-09-18 |
| SU472490A3 (ru) | 1975-05-30 |
| GB1415001A (en) | 1975-11-26 |
| IT981276B (it) | 1974-10-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP2309848B1 (de) | Mit insektiziden imprägnierte netze und deren verwendung zum schutz vor schädlingen | |
| DE2356155A1 (de) | Fertigungsgegenstand fuer die gesteuerte abgabe von schaedlingsbekaempfungsmitteln und verfahren zur bekaempfung von schaedlingen damit | |
| DE3337592A1 (de) | Traeger aus organischem material mit integrierten wirkstoffen | |
| DE1932959B2 (de) | Biozide elastomere Mischungen | |
| DE2654014A1 (de) | Biozide masse, deren verwendung und die dabei erhaltenen produkte | |
| DE1954807C3 (de) | Larvizide elastomere Mischungen, enthaltend ein vulkanisiertes organisches Elastomeres | |
| DE3586542T2 (de) | Akarizide. | |
| DE69703414T3 (de) | Harzförderband für Lebensmittel | |
| DE2629192C2 (de) | Pestizide Polyvinylchlorid-Masse | |
| DE1046391B (de) | Schaedlingsbekaempfungsmittel | |
| DE1280001C2 (de) | Verwendung phenolischer Stabilisatoren fuer Vinylphosphate enthaltende Schaedlings-bekaempfungsmittel | |
| DE2312467A1 (de) | Pesticide mittel | |
| DE69122964T2 (de) | Pestizide produkte | |
| DE3017638A1 (de) | Zusammensetzung zur bekaempfung von rinderzecken | |
| DE1230259B (de) | Geformte Massen mit langdauernder insektizider Wirkung | |
| DE2501808A1 (de) | Zubereitung fuer die kontrollierte abgabe einer wirksamen menge eines biologisch aktiven materials an die umgebung und deren verwendung | |
| DE2318824C2 (enExample) | ||
| DE3783728T2 (de) | Sichere pestizide harzzusammensetzungen zur bekaempfung von bodenbuertigen krankheiten und verfahren zu deren herstellung. | |
| DE1929086A1 (de) | Schaedlingsbekaempfungsmittel | |
| DD209376A5 (de) | Langsamloesende pestizidzusammensetzung | |
| DE3027167A1 (de) | Systemische insektizidzusammensetzungen mit kontrollierter diffusion, verfahren zu deren herstellung und deren verwendung | |
| DE60301421T2 (de) | Zusammensetzung zur Insektenbekämpfung | |
| DE2159325C3 (de) | Kunststoffmassen | |
| DE1954501A1 (de) | Insektizide Mittel und Praeparate | |
| DE3850136T2 (de) | Zusammensetzung und Verfahren zur Stabilisierung von 0-Halopyridylphosphorsäureestern. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHA | Expiration of time for request for examination |