DE2265437C2 - Informationsspeicherplatte mit einer spiralenformigen Rille - Google Patents
Informationsspeicherplatte mit einer spiralenformigen RilleInfo
- Publication number
- DE2265437C2 DE2265437C2 DE2265437A DE2265437A DE2265437C2 DE 2265437 C2 DE2265437 C2 DE 2265437C2 DE 2265437 A DE2265437 A DE 2265437A DE 2265437 A DE2265437 A DE 2265437A DE 2265437 C2 DE2265437 C2 DE 2265437C2
- Authority
- DE
- Germany
- Prior art keywords
- groove
- signal
- information
- scanner
- areas
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000003860 storage Methods 0.000 title claims description 15
- 230000000295 complement effect Effects 0.000 claims description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 59
- 239000010410 layer Substances 0.000 description 51
- 229910052759 nickel Inorganic materials 0.000 description 30
- 238000010894 electron beam technology Methods 0.000 description 22
- 229910052751 metal Inorganic materials 0.000 description 21
- 239000002184 metal Substances 0.000 description 21
- 229920002120 photoresistant polymer Polymers 0.000 description 19
- 238000000034 method Methods 0.000 description 17
- 229910052782 aluminium Inorganic materials 0.000 description 16
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 16
- 230000003287 optical effect Effects 0.000 description 10
- 239000011248 coating agent Substances 0.000 description 9
- 238000000576 coating method Methods 0.000 description 9
- 239000004922 lacquer Substances 0.000 description 9
- 238000004519 manufacturing process Methods 0.000 description 8
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 7
- 229910052594 sapphire Inorganic materials 0.000 description 7
- 239000010980 sapphire Substances 0.000 description 7
- 229910052709 silver Inorganic materials 0.000 description 7
- 239000004332 silver Substances 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- 238000005520 cutting process Methods 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 229920000915 polyvinyl chloride Polymers 0.000 description 6
- 239000004593 Epoxy Substances 0.000 description 5
- 239000004793 Polystyrene Substances 0.000 description 5
- 230000033001 locomotion Effects 0.000 description 5
- 230000006870 function Effects 0.000 description 4
- 229920002223 polystyrene Polymers 0.000 description 4
- 238000012545 processing Methods 0.000 description 4
- 229910052715 tantalum Inorganic materials 0.000 description 3
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 3
- 229920002160 Celluloid Polymers 0.000 description 2
- 239000004642 Polyimide Substances 0.000 description 2
- 241001422033 Thestylus Species 0.000 description 2
- 238000002679 ablation Methods 0.000 description 2
- 239000004020 conductor Substances 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 230000007547 defect Effects 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 239000002985 plastic film Substances 0.000 description 2
- 229920001721 polyimide Polymers 0.000 description 2
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- 238000005070 sampling Methods 0.000 description 2
- 238000007738 vacuum evaporation Methods 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000003990 capacitor Substances 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000009713 electroplating Methods 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 238000005286 illumination Methods 0.000 description 1
- 238000007689 inspection Methods 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 238000003754 machining Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000001465 metallisation Methods 0.000 description 1
- 150000002815 nickel Chemical class 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000002123 temporal effect Effects 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
- 238000007514 turning Methods 0.000 description 1
- 238000005019 vapor deposition process Methods 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04N—PICTORIAL COMMUNICATION, e.g. TELEVISION
- H04N5/00—Details of television systems
- H04N5/76—Television signal recording
- H04N5/7605—Television signal recording on discs or drums
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B11/00—Recording on or reproducing from the same record carrier wherein for these two operations the methods are covered by different main groups of groups G11B3/00 - G11B7/00 or by different subgroups of group G11B9/00; Record carriers therefor
- G11B11/03—Recording on or reproducing from the same record carrier wherein for these two operations the methods are covered by different main groups of groups G11B3/00 - G11B7/00 or by different subgroups of group G11B9/00; Record carriers therefor using recording by deforming with non-mechanical means, e.g. laser, beam of particles
- G11B11/05—Recording on or reproducing from the same record carrier wherein for these two operations the methods are covered by different main groups of groups G11B3/00 - G11B7/00 or by different subgroups of group G11B9/00; Record carriers therefor using recording by deforming with non-mechanical means, e.g. laser, beam of particles with reproducing by capacitive means
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B9/00—Recording or reproducing using a method not covered by one of the main groups G11B3/00 - G11B7/00; Record carriers therefor
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B9/00—Recording or reproducing using a method not covered by one of the main groups G11B3/00 - G11B7/00; Record carriers therefor
- G11B9/06—Recording or reproducing using a method not covered by one of the main groups G11B3/00 - G11B7/00; Record carriers therefor using record carriers having variable electrical capacitance; Record carriers therefor
- G11B9/061—Record carriers characterised by their structure or form or by the selection of the material; Apparatus or processes specially adapted for the manufacture of record carriers
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04N—PICTORIAL COMMUNICATION, e.g. TELEVISION
- H04N5/00—Details of television systems
- H04N5/76—Television signal recording
- H04N5/903—Television signal recording using variable electrical capacitive recording
Landscapes
- Engineering & Computer Science (AREA)
- Multimedia (AREA)
- Signal Processing (AREA)
- Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Optical Recording Or Reproduction (AREA)
- Manufacturing Optical Record Carriers (AREA)
- Magnetic Record Carriers (AREA)
- Casting Or Compression Moulding Of Plastics Or The Like (AREA)
- Treatment And Processing Of Natural Fur Or Leather (AREA)
- Moving Of The Head To Find And Align With The Track (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00126772A US3842194A (en) | 1971-03-22 | 1971-03-22 | Information records and recording/playback systems therefor |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2265437C2 true DE2265437C2 (de) | 1982-04-29 |
Family
ID=22426573
Family Applications (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2265436A Expired DE2265436C2 (de) | 1971-03-22 | 1972-03-22 | Abtaster fuer scheibenfoermige Aufzeichnungstraeger |
| DE2265676A Expired DE2265676C2 (de) | 1971-03-22 | 1972-03-22 | Anordnung zur Wiedergabe von informationen von einem scheibenfoermigen Aufzeichnungstraeger |
| DE2213920A Expired DE2213920C2 (de) | 1971-03-22 | 1972-03-22 | Informationstraegerplatte, insbesondere Bildplatte |
| DE2265437A Expired DE2265437C2 (de) | 1971-03-22 | 1972-03-22 | Informationsspeicherplatte mit einer spiralenformigen Rille |
Family Applications Before (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2265436A Expired DE2265436C2 (de) | 1971-03-22 | 1972-03-22 | Abtaster fuer scheibenfoermige Aufzeichnungstraeger |
| DE2265676A Expired DE2265676C2 (de) | 1971-03-22 | 1972-03-22 | Anordnung zur Wiedergabe von informationen von einem scheibenfoermigen Aufzeichnungstraeger |
| DE2213920A Expired DE2213920C2 (de) | 1971-03-22 | 1972-03-22 | Informationstraegerplatte, insbesondere Bildplatte |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3842194A (enExample) |
| JP (4) | JPS53694B1 (enExample) |
| AT (5) | AT365813B (enExample) |
| AU (1) | AU471890B2 (enExample) |
| CA (4) | CA1011875A (enExample) |
| DE (4) | DE2265436C2 (enExample) |
| ES (1) | ES401079A1 (enExample) |
| FR (1) | FR2130505A1 (enExample) |
| GB (4) | GB1392202A (enExample) |
| HK (4) | HK31976A (enExample) |
| IT (1) | IT950432B (enExample) |
| MY (4) | MY7600167A (enExample) |
| NL (1) | NL7203748A (enExample) |
| SE (4) | SE385164B (enExample) |
| SU (1) | SU559666A3 (enExample) |
Families Citing this family (156)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3833408A (en) * | 1972-04-19 | 1974-09-03 | Rca Corp | Video discs having a methyl alkyl silicone coating |
| US3843399A (en) * | 1972-04-19 | 1974-10-22 | Rca Corp | Metallized video disc having an insulating layer thereon |
| US3775555A (en) * | 1972-08-31 | 1973-11-27 | Modulator system | |
| US3972064A (en) * | 1973-03-20 | 1976-07-27 | Rca Corporation | Apparatus and methods for playback of color picture/sound records |
| US4027330A (en) * | 1973-03-27 | 1977-05-31 | Ted-Bildplatten Aktiengesellschaft, Aeg-Telefunken, Teldec | Disc recording |
| NL164688C (nl) * | 1973-10-15 | 1981-01-15 | Mca Disco Vision | Werkwijze voor de vervaardiging van een videoschijf waarbij uitgaande van een moedermatrijs eerst een vorm wordt vervaardigd. |
| US3901994A (en) * | 1974-02-04 | 1975-08-26 | Rca Corp | Metallized video disc having a dielectric coating thereon |
| US4164754A (en) * | 1974-07-16 | 1979-08-14 | Thomson-Brandt | Method of manufacturing a die designed to duplicate a video frequency signal recording |
| US4001493A (en) * | 1974-09-03 | 1977-01-04 | Nihon Denshi Kabushiki Kaisha | Single lens, multi-beam system and method for high resolution recording of information on a moving recording medium and article |
| US3969756A (en) * | 1974-11-12 | 1976-07-13 | Rca Corporation | Color-picture/multichannel-sound record and recording/playback apparatus and methods therefor |
| US4018984A (en) * | 1974-11-12 | 1977-04-19 | Rca Corporation | Video disc record having spirally aligned sync storage locations |
| US3930117A (en) * | 1974-11-14 | 1975-12-30 | Rca Corp | Video capacitive disc playback apparatus and stylus with dielectric coating therefor |
| US3930653A (en) * | 1975-01-30 | 1976-01-06 | Rca Corporation | Lid latch mechanism for a disc record player |
| GB1527124A (en) * | 1975-03-07 | 1978-10-04 | Emi Ltd | Modulated groove records |
| US4013830A (en) * | 1975-05-19 | 1977-03-22 | Rca Corporation | Video disc stylus |
| US3982066A (en) * | 1975-07-25 | 1976-09-21 | Rca Corporation | Metal coating for video discs |
| US4004080A (en) * | 1975-07-25 | 1977-01-18 | Rca Corporation | Metal coating for video discs |
| US3984907A (en) * | 1975-07-25 | 1976-10-12 | Rca Corporation | Adherence of metal films to polymeric materials |
| JPS5254411A (en) * | 1975-10-30 | 1977-05-02 | Victor Co Of Japan Ltd | Static capacitance type pick-up stylus and production of same |
| DE2615605C2 (de) * | 1976-04-09 | 1978-06-01 | Polygram Gmbh, 2000 Hamburg | Scheibenförmiger Informationsträger und Verfahren zu seiner Herstellung |
| US4030835A (en) * | 1976-05-28 | 1977-06-21 | Rca Corporation | Defect detection system |
| US4074313A (en) * | 1976-06-14 | 1978-02-14 | Rca Corporation | Electron beam disc recorder |
| US4110784A (en) * | 1976-08-30 | 1978-08-29 | Rca Corporation | Noise reduction apparatus |
| GB1592361A (en) * | 1976-09-13 | 1981-07-08 | Rca Corp | Stylus manufacture |
| US4124866A (en) * | 1976-12-06 | 1978-11-07 | Rca Corporation | Video disc insertion/extraction system for a video disc player |
| CA1114947A (en) * | 1976-12-20 | 1981-12-22 | Ralph Destephanis | Record support and alignment apparatus for a video disc player |
| US4106107A (en) * | 1977-02-03 | 1978-08-08 | Rca Corporation | MIS readout device with dielectric storage medium |
| DE2810367C2 (de) * | 1977-03-15 | 1984-12-20 | Rca Corp., New York, N.Y. | Informationsspeicherplatte |
| GB1574595A (en) * | 1977-03-15 | 1980-09-10 | Rca Corp | Video disc |
| US4151132A (en) * | 1977-07-25 | 1979-04-24 | Rca Corporation | Molding composition |
| US4104832A (en) * | 1977-03-25 | 1978-08-08 | Rca Corporation | Method for forming keel-tipped stylus for video disc systems |
| JPS6051166B2 (ja) * | 1977-03-28 | 1985-11-12 | 日本ビクター株式会社 | 静電容量型記録媒体 |
| US4098030A (en) * | 1977-03-28 | 1978-07-04 | Rca Corporation | Method for forming a narrowed-electrode pickup stylus for video disc systems |
| US4124867A (en) * | 1977-03-28 | 1978-11-07 | Rca Corporation | Narrowed-electrode pickup stylus for video disc systems |
| GB1599052A (en) * | 1977-04-19 | 1981-09-30 | Rca Corp | Pickup cartridge for record disc players |
| US4077051A (en) * | 1977-05-04 | 1978-02-28 | Rca Corporation | Video disc with a conductive layer having an oxygen content gradient |
| US4072985A (en) * | 1977-05-04 | 1978-02-07 | Rca Corporation | Video disc with a dielectric layer formed from styrene and nitrogen |
| US4077052A (en) * | 1977-05-04 | 1978-02-28 | Rca Corporation | Video disc capacitive recording means with a conductive bilayer |
| JPS5821322B2 (ja) * | 1977-05-07 | 1983-04-28 | 株式会社富士通ゼネラル | デジタル信号の変調方法 |
| US4180830A (en) * | 1977-06-28 | 1979-12-25 | Rca Corporation | Depth estimation system using diffractive effects of the grooves and signal elements in the grooves |
| US4129536A (en) * | 1977-07-25 | 1978-12-12 | Rca Corporation | Vinyl chloride based injection molding composition |
| US4137550A (en) * | 1977-11-18 | 1979-01-30 | Rca Corporation | Video disc with a dielectric layer formed from acetylene and nitrogen |
| US4136940A (en) * | 1977-12-19 | 1979-01-30 | Rca Corporation | Resist development control system |
| US4152641A (en) * | 1978-02-27 | 1979-05-01 | Rca Corporation | Method and apparatus for the determination of signal pickup qualities of a stylus of a capacitive disc video player |
| US4183059A (en) * | 1978-05-22 | 1980-01-08 | Rca Corporation | Track skipper for a video disc player |
| US4203134A (en) * | 1978-10-02 | 1980-05-13 | Rca Corporation | FM Signal demodulator with defect detection |
| US4241120A (en) * | 1978-11-13 | 1980-12-23 | Rca Corporation | Video discs and molding compositions therefor |
| US4228050A (en) * | 1979-01-15 | 1980-10-14 | Rca Corporation | Conductive molding composition |
| US4216970A (en) * | 1979-03-05 | 1980-08-12 | Rca Corporation | Video disc lubricants |
| JPS5938655B2 (ja) * | 1979-05-14 | 1984-09-18 | 日本放送協会 | 半導体デイスクメモリ装置 |
| US4280941A (en) * | 1979-07-20 | 1981-07-28 | Rca Corporation | Video discs and molding compositions therefor |
| US4310913A (en) * | 1979-07-26 | 1982-01-12 | Rca Corporation | Stylus tracking aid using two bimorph elements longitudinally aligned |
| US4262875A (en) * | 1979-08-17 | 1981-04-21 | Rca Corporation | Information record stampers |
| US4280024A (en) * | 1979-08-22 | 1981-07-21 | Rca Corporation | Selectively damped video disc stylus assembly |
| US4282311A (en) * | 1979-10-03 | 1981-08-04 | Rca Corporation | Method for fabricating flyleads for video disc styli |
| US4285056A (en) * | 1979-10-17 | 1981-08-18 | Rca Corporation | Replicable optical recording medium |
| US4300227A (en) * | 1979-10-17 | 1981-11-10 | Rca Corporation | Replicable optical recording medium |
| US4278846A (en) * | 1979-10-29 | 1981-07-14 | Rca Corporation | Video disc locked groove clearance system |
| US4287689A (en) * | 1979-10-30 | 1981-09-08 | Rca Corporation | Method for improving the quality of low frequency output of a video disc pickup stylus |
| US4472337A (en) * | 1979-11-07 | 1984-09-18 | Rca Corporation | Video disc processing |
| US4275100A (en) * | 1980-01-04 | 1981-06-23 | Rca Corporation | Video disc processing |
| US4297312A (en) * | 1980-02-04 | 1981-10-27 | Rca Corporation | Method for preparing stylus lapping discs |
| JPS56117341A (en) * | 1980-02-18 | 1981-09-14 | Toshiba Corp | Optical disk and its manufacture |
| US4306013A (en) * | 1980-03-10 | 1981-12-15 | Rca Corporation | Asymmetrical radiation exposure of spin coated photoresist to obtain uniform thickness coating used to replicate spiral grooves in plastic substrate |
| US4308337A (en) * | 1980-03-10 | 1981-12-29 | Rca Corporation | Uniform light exposure of positive photoresist for replicating spiral groove in plastic substrate |
| US4296371A (en) * | 1980-03-17 | 1981-10-20 | Rca Corporation | System for measuring stylus shoe length |
| US4292511A (en) * | 1980-04-21 | 1981-09-29 | Rca Corporation | Apparatus and method for reading an identifying label on an information record |
| IT1138258B (it) * | 1980-04-21 | 1986-09-17 | Rca Corp | Etichetta codificata a solchi per videodischi |
| US4315358A (en) * | 1980-04-21 | 1982-02-16 | Rca Corporation | Method for the manufacture of capacitive pickup styli |
| US4296144A (en) * | 1980-04-23 | 1981-10-20 | Rca Corporation | Ion implanted stylus |
| US4299736A (en) * | 1980-05-19 | 1981-11-10 | Rca Corporation | Conductive molding composition and discs therefrom |
| US4309722A (en) * | 1980-05-27 | 1982-01-05 | Rca Corporation | Video disc player noise reduction circuit |
| US4295216A (en) * | 1980-05-30 | 1981-10-13 | Rca Corporation | Apparatus for measuring the characteristics of a wideband electromechanical recording system having a transformer |
| US4352564A (en) * | 1980-05-30 | 1982-10-05 | Rca Corporation | Missing order defect detection apparatus |
| US4330882A (en) * | 1980-05-30 | 1982-05-18 | Rca Corporation | Apparatus for monitoring a wideband electromechanical recording system |
| US4370739A (en) * | 1980-06-09 | 1983-01-25 | Rca Corporation | Spinel video disc playback stylus |
| US4320567A (en) * | 1980-06-30 | 1982-03-23 | Rca Corporation | Optical inspection method for determining machinability |
| US4383961A (en) * | 1980-07-07 | 1983-05-17 | Rca Corporation | Drying process for video discs |
| US4284712A (en) * | 1980-07-11 | 1981-08-18 | Rca Corporation | Fabrication of video disc flyleads |
| US4378310A (en) * | 1980-07-28 | 1983-03-29 | Rca Corporation | Conductive molding composition |
| US4320491A (en) * | 1980-09-19 | 1982-03-16 | Rca Corporation | Apparatus for video disc stylus electrode reconditioning |
| US4363118A (en) * | 1980-09-22 | 1982-12-07 | Rca Corporation | Sound carrier amplitude measurement system |
| US4519065A (en) * | 1980-09-22 | 1985-05-21 | Minnesota Mining And Manufacturing Company | Metallized information carrying discs |
| US4386375A (en) * | 1980-09-24 | 1983-05-31 | Rca Corporation | Video disc player with multiple signal recovery transducers |
| US4365447A (en) * | 1980-09-25 | 1982-12-28 | Rca Corporation | Apparatus and method for sharpening a cutting stylus |
| JPS5764344A (en) * | 1980-10-07 | 1982-04-19 | Toshiba Corp | Manufacture of master for record or recording disk |
| US4325134A (en) * | 1980-10-15 | 1982-04-13 | Rca Corporation | Video disc defect detector |
| US4349902A (en) * | 1980-10-27 | 1982-09-14 | Rca Corporation | Piezoelectric transducer for recording video information |
| IT1139503B (it) * | 1980-10-27 | 1986-09-24 | Rca Corp | Dischi di supporto di informazioni ad elevata densita' |
| US4371961A (en) * | 1980-11-21 | 1983-02-01 | Rca Corporation | Capacitive information system |
| JPS57100637A (en) * | 1980-12-15 | 1982-06-22 | Toshiba Corp | Manufacture of master for sound disk or recording disk |
| US4376303A (en) * | 1980-12-19 | 1983-03-08 | Rca Corporation | Quasi-zoom lens optical focus sensor |
| US4355382A (en) * | 1980-12-24 | 1982-10-19 | Rca Corporation | Apparatus for sharpening a cutting stylus |
| US4375095A (en) * | 1981-01-05 | 1983-02-22 | Rca Corporation | Method and apparatus for testing styli |
| US4327048A (en) * | 1981-01-14 | 1982-04-27 | Rca Corporation | High density information disc processing |
| US4361595A (en) * | 1981-01-28 | 1982-11-30 | Rca Corporation | Method for preparing an abrasive lapping disc |
| US4465617A (en) * | 1981-02-04 | 1984-08-14 | Rca Corporation | Method for preparing a molding composition |
| US4465616A (en) * | 1981-02-04 | 1984-08-14 | Rca Corporation | Formulation of electrically conductive plastics |
| US4391720A (en) * | 1981-02-05 | 1983-07-05 | Rca Corporation | Bis(hydroxylkyl)disiloxanes and lubricant compositions thereof |
| US4355062A (en) * | 1981-02-05 | 1982-10-19 | Rca Corporation | Bis(hydroxyalkyl)disiloxanes and lubricant compositions thereof |
| US4369604A (en) * | 1981-02-27 | 1983-01-25 | Rca Corporation | Method for mechanically preparing stylus lapping discs |
| US4366563A (en) * | 1981-02-27 | 1982-12-28 | Rca Corporation | Video disc stylus suspension apparatus |
| US4429678A (en) | 1981-02-27 | 1984-02-07 | Rca Corporation | Cutting stylus for mechanically cutting masters for keel-lapping |
| GB2097169B (en) * | 1981-02-27 | 1985-03-27 | Rca Corp | Method and apparatus for mechanically preparing stylus lapping discs |
| US4375096A (en) * | 1981-03-10 | 1983-02-22 | Rca Corporation | Multi-bandwidth optical playback apparatus with elongated read spot |
| US4386319A (en) * | 1981-04-03 | 1983-05-31 | Rca Corporation | ESR Analysis of conductive video disc components |
| US4472336A (en) * | 1981-04-17 | 1984-09-18 | Matsushita Electric Industrial Co., Ltd. | Method of manufacturing video disc |
| US4395122A (en) * | 1981-04-29 | 1983-07-26 | Rca Corporation | Defect detection system |
| US4402072A (en) * | 1981-04-29 | 1983-08-30 | Rca Corporation | Video disc mastering using gimballed air puck |
| US4417332A (en) * | 1981-06-15 | 1983-11-22 | Rca Corporation | Turntable speed control |
| US4418405A (en) * | 1981-06-29 | 1983-11-29 | Rca Corporation | Lens positioning controller for optical playback apparatus |
| US4450550A (en) * | 1981-09-30 | 1984-05-22 | Rca Corporation | Pickup circuit for video disc including dual-gate FET with injected RF |
| USRE32457E (en) * | 1981-09-30 | 1987-07-07 | Rca Corporation | Scanning capacitance microscope |
| US4481616A (en) * | 1981-09-30 | 1984-11-06 | Rca Corporation | Scanning capacitance microscope |
| US4416807A (en) * | 1981-10-14 | 1983-11-22 | Rca Corporation | Conductive video discs |
| US4399061A (en) * | 1981-10-14 | 1983-08-16 | Rca Corporation | Preparation of video disc molding composition |
| US4398281A (en) * | 1981-10-16 | 1983-08-09 | Rca Corporation | Caddy loading video disc player |
| US4472295A (en) * | 1981-11-17 | 1984-09-18 | Rca Corporation | Conductive molding composition and discs therefrom |
| US4418407A (en) * | 1981-12-03 | 1983-11-29 | Rca Corporation | Video disc pickup stylus |
| US4433407A (en) * | 1981-12-14 | 1984-02-21 | Rca Corporation | Method and apparatus for recording video signals into a metal substrate |
| US4424630A (en) | 1981-12-29 | 1984-01-10 | Rca Corporation | Apparatus for measuring the dimensions of delicate parts |
| US4389441A (en) * | 1982-02-01 | 1983-06-21 | Rca Corporation | High density information record lubricants |
| US4410748A (en) * | 1982-02-01 | 1983-10-18 | Rca Corporation | High density information disc lubricants |
| US4477891A (en) * | 1982-03-12 | 1984-10-16 | Rca Corporation | Multi-bandwidth optical playback apparatus having minimum baseband distortion |
| US4455633A (en) * | 1982-04-21 | 1984-06-19 | Rca Corporation | Method for evaluating distortions in video disc recordings |
| US4390579A (en) * | 1982-06-17 | 1983-06-28 | Rca Corporation | Doped polyphenylene ether lubricant for high density information discs |
| US4453242A (en) * | 1982-07-13 | 1984-06-05 | Rca Corporation | Surface acoustic wave cutterhead for disc recording having a circular transducer |
| US4434481A (en) | 1982-07-13 | 1984-02-28 | Rca Corporation | Traveling wave surface acoustic wave transducer |
| US4477892A (en) * | 1982-07-13 | 1984-10-16 | Rca Corporation | Surface acoustic wave device having a pyramid shaped tip for recording video information on a substrate |
| US4490945A (en) * | 1983-03-23 | 1985-01-01 | Rca Corporation | Stylus manufacturing apparatus and method |
| US4602359A (en) * | 1983-07-29 | 1986-07-22 | Rca Corporation | Method for determining variations from flatness in the topography of a disc surface |
| US4515830A (en) * | 1983-11-29 | 1985-05-07 | Rca Corporation | Solvent-cast capacitive high density information disc |
| US4597646A (en) * | 1983-12-01 | 1986-07-01 | Rca Corporation | Apparatus for positioning a stylus |
| US4574306A (en) * | 1984-01-27 | 1986-03-04 | Rca Corporation | Apparatus and method for automatically measuring the shoe-length of a video disc stylus |
| US4536238A (en) * | 1984-02-29 | 1985-08-20 | Rca Corporation | Method and apparatus for aligning a chuck for holding an information containing disc stylus |
| US4575838A (en) * | 1984-02-29 | 1986-03-11 | Rca Corporation | Sandwich-type capacitive electronic discs |
| US4648087A (en) * | 1984-06-28 | 1987-03-03 | International Business Machines Corporation | Capacitive sensing employing thin film inductors |
| US4597700A (en) * | 1985-01-11 | 1986-07-01 | Mattel, Inc. | Record engraving apparatus |
| JPS61196029U (enExample) * | 1985-04-19 | 1986-12-06 | ||
| US4814691A (en) * | 1985-08-09 | 1989-03-21 | Washington Research Foundation | Fringe field capacitive sensor for measuring profile of a surface |
| US4935700A (en) * | 1985-08-09 | 1990-06-19 | Washington Research Foundation | Fringe field capacitive sensor for measuring the size of an opening |
| NL8601884A (nl) * | 1986-07-21 | 1988-02-16 | Philips Nv | Plaatcassette. |
| US4802156A (en) * | 1987-07-29 | 1989-01-31 | Industrial Technology Research Institute | Cutting machine for pits on CD master |
| JP3223325B2 (ja) * | 1991-12-25 | 2001-10-29 | 財団法人リバーフロント整備センター | 法面工法 |
| JP3245794B2 (ja) * | 1992-01-08 | 2002-01-15 | 財団法人リバーフロント整備センター | 法面構造体 |
| JP2002510836A (ja) * | 1998-04-06 | 2002-04-09 | イメイション・コーポレイション | データ記憶ディスク用リバース光マスタリング |
| US7294294B1 (en) | 2000-10-17 | 2007-11-13 | Seagate Technology Llc | Surface modified stamper for imprint lithography |
| US20050128927A1 (en) * | 2003-12-15 | 2005-06-16 | Hewlett-Packard Development Co., L.P. | Electrostatic actuator for contact probe storage device |
| US7423954B2 (en) * | 2003-12-17 | 2008-09-09 | Hewlett-Packard Development Company, L.P. | Contact probe storage sensor pod |
| US7436753B2 (en) | 2003-12-17 | 2008-10-14 | Mejia Robert G | Contact probe storage FET sensor |
| US7212487B2 (en) * | 2004-01-07 | 2007-05-01 | Hewlett-Packard Development Company, L.P. | Data readout arrangement |
| US7212488B2 (en) | 2005-03-21 | 2007-05-01 | Hewlett-Packard Development Company, L.P. | Method and device enabling capacitive probe-based data storage readout |
| US20100148813A1 (en) | 2006-07-18 | 2010-06-17 | Multiprobe, Inc. | Apparatus and method for combined micro-scale and nano-scale c-v, q-v, and i-v testing of semiconductor materials |
| EP2031124A1 (en) * | 2007-08-27 | 2009-03-04 | Nederlandse Organisatie voor Toegepast-Natuuurwetenschappelijk Onderzoek TNO | Coating having low friction characteristics |
| CN104330925A (zh) * | 2014-12-01 | 2015-02-04 | 合肥鑫晟光电科技有限公司 | 一种显示面板及其制备方法、显示装置 |
| US11083251B2 (en) * | 2016-01-23 | 2021-08-10 | Fidlock Gmbh | Closure device for detachably connecting two parts |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US964221A (en) * | 1907-01-03 | 1910-07-12 | New Jersey Patent Co | Sound-record. |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB153300A (en) * | 1919-11-01 | 1922-02-01 | Emil Waltz | Improvements in the recording and reproduction of sounds by means of a sound succession relief |
| DE556908C (de) * | 1930-04-08 | 1932-08-16 | Archibald Montgomery Low | Verfahren zur elektrischen Abtastung von Rillentonaufzeichnungen in Berliner-Schrift |
| US2477640A (en) * | 1944-06-27 | 1949-08-02 | Homer R Montague | Sound recording method and apparatus |
| FR54742E (fr) * | 1946-04-30 | 1950-07-28 | Procédé et dispositifs pour la gravure de pistes sonores sur un support magnétique et pour la reproduction des sons par exploration desdites pistes | |
| US2493466A (en) * | 1946-07-10 | 1950-01-03 | Rca Corp | Phonograph system and stylus therefor |
| US2654810A (en) * | 1949-11-15 | 1953-10-06 | Miessner Inventions Inc | Photoelectric translating system |
| DE1181275B (de) * | 1962-09-19 | 1964-11-12 | Grammophon Ges Mit Beschraenkt | Anordnung zur Abtastung von Aufzeichnungen auf band- oder plattenfoermigen Aufzeich-nungstraegern |
| US3378645A (en) * | 1964-09-29 | 1968-04-16 | Belock Instr Corp | Recorded dielectric medium and recording and playback methods and apparatuses |
| DE1285508C2 (de) * | 1966-09-21 | 1969-08-14 | Deutsche Grammophon Gmbh | Verfahren zur Aufzeichnung von Fernsehbildern auf einem rotierenden, plattenfoermigen Aufzeichnungstraeger |
| DE1549080A1 (de) * | 1967-02-07 | 1971-03-04 | Telefunken Patent | Traeger mit wenigstens zwei in einer gemeinsamen Rille aufgezeichneten Signalen |
| US3457641A (en) * | 1967-05-24 | 1969-07-29 | Bendix Corp | Method of manufacturing a tape for providing coded electrical signals |
| US3519802A (en) * | 1968-11-27 | 1970-07-07 | Securadyne Ltd | Cards employing capacitor sensing of encoded data |
| DE2048431B2 (de) * | 1970-08-05 | 1974-01-10 | Ted Bildplatten Ag Aeg-Telefunkenteldec, Zug (Schweiz) | Verfahren zum Aufzeichnen von Informationen, vorzugsweise von solchen großer Bandbreite im Bereich von mehreren MHz, auf einem Träger |
-
1971
- 1971-03-22 US US00126772A patent/US3842194A/en not_active Expired - Lifetime
-
1972
- 1972-03-07 AU AU39708/72A patent/AU471890B2/en not_active Expired
- 1972-03-09 CA CA136,718A patent/CA1011875A/en not_active Expired
- 1972-03-15 SE SE7203292A patent/SE385164B/xx unknown
- 1972-03-21 GB GB1307572A patent/GB1392202A/en not_active Expired
- 1972-03-21 NL NL7203748A patent/NL7203748A/xx not_active Application Discontinuation
- 1972-03-21 GB GB5220774A patent/GB1392206A/en not_active Expired
- 1972-03-21 SU SU1761918A patent/SU559666A3/ru active
- 1972-03-21 GB GB4866474A patent/GB1392203A/en not_active Expired
- 1972-03-21 FR FR7209847A patent/FR2130505A1/fr active Granted
- 1972-03-21 GB GB5220674A patent/GB1392205A/en not_active Expired
- 1972-03-21 IT IT22175/72A patent/IT950432B/it active
- 1972-03-22 AT AT0322477A patent/AT365813B/de not_active IP Right Cessation
- 1972-03-22 AT AT322377A patent/AT360771B/de not_active IP Right Cessation
- 1972-03-22 DE DE2265436A patent/DE2265436C2/de not_active Expired
- 1972-03-22 JP JP2934772A patent/JPS53694B1/ja active Pending
- 1972-03-22 AT AT0322677A patent/AT371280B/de not_active IP Right Cessation
- 1972-03-22 DE DE2265676A patent/DE2265676C2/de not_active Expired
- 1972-03-22 AT AT248772A patent/AT346090B/de not_active IP Right Cessation
- 1972-03-22 AT AT0322577A patent/AT371279B/de not_active IP Right Cessation
- 1972-03-22 DE DE2213920A patent/DE2213920C2/de not_active Expired
- 1972-03-22 DE DE2265437A patent/DE2265437C2/de not_active Expired
- 1972-03-22 ES ES401079A patent/ES401079A1/es not_active Expired
-
1975
- 1975-05-21 SE SE7505778A patent/SE408601B/xx unknown
- 1975-05-21 SE SE7505779A patent/SE409062B/xx unknown
- 1975-05-21 SE SE7505780A patent/SE409063B/xx unknown
-
1976
- 1976-06-03 HK HK319/76*UA patent/HK31976A/xx unknown
- 1976-06-03 HK HK318/76*UA patent/HK31876A/xx unknown
- 1976-06-03 HK HK320/76*UA patent/HK32076A/xx unknown
- 1976-06-03 HK HK317/76*UA patent/HK31776A/xx unknown
- 1976-11-03 CA CA264,814A patent/CA1019833A/en not_active Expired
- 1976-11-03 CA CA264,815A patent/CA1019065A/en not_active Expired
- 1976-11-03 CA CA264,813A patent/CA1031863A/en not_active Expired
- 1976-11-12 JP JP13680876A patent/JPS5282211A/ja active Granted
- 1976-11-12 JP JP13680776A patent/JPS5282210A/ja active Granted
- 1976-11-12 JP JP51136806A patent/JPS5267316A/ja active Granted
- 1976-12-30 MY MY167/76A patent/MY7600167A/xx unknown
- 1976-12-30 MY MY164/76A patent/MY7600164A/xx unknown
- 1976-12-30 MY MY165/76A patent/MY7600165A/xx unknown
- 1976-12-30 MY MY166/76A patent/MY7600166A/xx unknown
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US964221A (en) * | 1907-01-03 | 1910-07-12 | New Jersey Patent Co | Sound-record. |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2265437C2 (de) | Informationsspeicherplatte mit einer spiralenformigen Rille | |
| DE2412811C3 (enExample) | ||
| DE69510961T2 (de) | Dünnfilm-schreibkopf mit niedrigen profil | |
| DE3123230C2 (enExample) | ||
| DE2412811B2 (de) | Verfahren und vorrichtung zur aufzeichnung und wiedergabe von videosignalen | |
| DE2222665A1 (de) | Verfahren und Vorrichtung zum Ausrichten von Elektronenprojektionssystemen | |
| DE2362605A1 (de) | Dreidimensionale elektro-optische wiedergabeeinrichtung | |
| DE4029984A1 (de) | Vorrichtung zur herstellung duenner schichten mit hochfrequenzenergie und spannungsversorgungseinheit dafuer | |
| DE2550872C3 (de) | Verfahren und Einrichtung betreffend die Herstellung und Wiedergabe von Bild/Ton-Plattenaufzeichnungen | |
| DE1437771B2 (de) | Vorrichtung zum Aufzeichnen zusammengesetzter, Synchronimpulse aufweisender Videosignale | |
| DE2741162A1 (de) | Abnehmer-vorrichtung fuer bildplattenspieler | |
| DE938351C (de) | Verfahren zur Herstellung gerasterter Druckformen durch lichtelektrische UEbertragung von Bildvorlagen | |
| DE2805323C2 (de) | Drehbarer Informationssignal-Aufzeichnungsträger und Aufzeichnungsanordnung für den Aufzeichnungsträger | |
| DE3337582C2 (de) | Verfahren zum Abtasten und Wiedergeben eines Bildes | |
| DE3104539A1 (de) | Drehbarer aufzeichnungstraeger und geraet zur wiedergabe des aufzeichnungstraegers | |
| EP0219897B1 (de) | Anordnung zum Erzeugen von Röntgenaufnahmen mittels eines Fotoleiters | |
| EP0135642A1 (de) | Sensorsystem für Fernsehbildröhren | |
| DE2366229B1 (de) | Informationswiedergabeanordnung | |
| DE1099244B (de) | Verfahren und Anordnung zur Regelung des Kontrasts und der Empfindlichkeit bei lichtelektrischen Abtastgeraeten | |
| DE2521695C3 (de) | Signalaufzeichnungsvorrichtung | |
| DE2805322C2 (de) | Drehbarer Informationssignal-Aufzeichnungsträger und Aufzeichnungsanordnung zur Herstellung des Informationssignal-Aufzeichnungsträgers | |
| DE3346001C2 (enExample) | ||
| DE1424369B1 (de) | Vorrichtung zur Ablesung eines thermoplastischen,Informationen in Linienschrift tragenden bewegten Speichers | |
| DE2324823A1 (de) | Elektronisches graviersystem | |
| DE2140990A1 (de) | Elektronenstrahlaufzeichnungsanordnung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OI | Miscellaneous see part 1 | ||
| OI | Miscellaneous see part 1 | ||
| OD | Request for examination | ||
| Q176 | The application caused the suspense of an application |
Ref document number: 2317850 Country of ref document: DE |
|
| 8126 | Change of the secondary classification |
Ipc: H04N 5/76 |
|
| AC | Divided out of |
Ref country code: DE Ref document number: 2213920 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8339 | Ceased/non-payment of the annual fee |