DE2260724C3 - Auftragsvorrichtung für ein in einem Behälter untergebrachtes kosmetisches Präparat - Google Patents
Auftragsvorrichtung für ein in einem Behälter untergebrachtes kosmetisches PräparatInfo
- Publication number
- DE2260724C3 DE2260724C3 DE2260724A DE2260724A DE2260724C3 DE 2260724 C3 DE2260724 C3 DE 2260724C3 DE 2260724 A DE2260724 A DE 2260724A DE 2260724 A DE2260724 A DE 2260724A DE 2260724 C3 DE2260724 C3 DE 2260724C3
- Authority
- DE
- Germany
- Prior art keywords
- applicator
- application
- tip
- cosmetic
- container
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002537 cosmetic Substances 0.000 title claims description 47
- 238000002360 preparation method Methods 0.000 title claims description 38
- 239000006260 foam Substances 0.000 claims description 2
- 229920003002 synthetic resin Polymers 0.000 claims description 2
- 239000000057 synthetic resin Substances 0.000 claims description 2
- 239000012528 membrane Substances 0.000 description 8
- 239000007788 liquid Substances 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- 230000002093 peripheral effect Effects 0.000 description 4
- 238000000034 method Methods 0.000 description 3
- 239000011148 porous material Substances 0.000 description 3
- 239000013013 elastic material Substances 0.000 description 2
- 210000000744 eyelid Anatomy 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- -1 polyethylene Polymers 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 229920005830 Polyurethane Foam Polymers 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000008278 cosmetic cream Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- ZINJLDJMHCUBIP-UHFFFAOYSA-N ethametsulfuron-methyl Chemical compound CCOC1=NC(NC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)C(=O)OC)=N1 ZINJLDJMHCUBIP-UHFFFAOYSA-N 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 239000011496 polyurethane foam Substances 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 230000003252 repetitive effect Effects 0.000 description 1
- 239000012858 resilient material Substances 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A45—HAND OR TRAVELLING ARTICLES
- A45D—HAIRDRESSING OR SHAVING EQUIPMENT; EQUIPMENT FOR COSMETICS OR COSMETIC TREATMENTS, e.g. FOR MANICURING OR PEDICURING
- A45D40/00—Casings or accessories specially adapted for storing or handling solid or pasty toiletry or cosmetic substances, e.g. shaving soaps or lipsticks
- A45D40/26—Appliances specially adapted for applying pasty paint, e.g. using roller, using a ball
-
- A—HUMAN NECESSITIES
- A45—HAND OR TRAVELLING ARTICLES
- A45D—HAIRDRESSING OR SHAVING EQUIPMENT; EQUIPMENT FOR COSMETICS OR COSMETIC TREATMENTS, e.g. FOR MANICURING OR PEDICURING
- A45D2200/00—Details not otherwise provided for in A45D
- A45D2200/05—Details of containers
- A45D2200/054—Means for supplying liquid to the outlet of the container
- A45D2200/055—Piston or plunger for supplying the liquid to the applicator
Landscapes
- Coating Apparatus (AREA)
- Cosmetics (AREA)
- Closures For Containers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00277577A US3807881A (en) | 1972-08-03 | 1972-08-03 | Cosmetic applicator |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2260724A1 DE2260724A1 (de) | 1974-02-21 |
| DE2260724B2 DE2260724B2 (de) | 1977-08-25 |
| DE2260724C3 true DE2260724C3 (de) | 1978-04-27 |
Family
ID=23061476
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2260724A Expired DE2260724C3 (de) | 1972-08-03 | 1972-12-12 | Auftragsvorrichtung für ein in einem Behälter untergebrachtes kosmetisches Präparat |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3807881A (OSRAM) |
| JP (1) | JPS4944849A (OSRAM) |
| AU (1) | AU469961B2 (OSRAM) |
| CA (1) | CA998644A (OSRAM) |
| DE (1) | DE2260724C3 (OSRAM) |
| GB (1) | GB1358608A (OSRAM) |
| SE (1) | SE394243B (OSRAM) |
Families Citing this family (50)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4342522A (en) * | 1977-03-10 | 1982-08-03 | Bristol-Myers Company | Roll-on dispenser with a flexible membrane |
| CA1103213A (en) * | 1977-03-10 | 1981-06-16 | Leonard Mackles | Roll-on dispenser with a flexible variable porosity membrane |
| DE2728969A1 (de) * | 1977-06-28 | 1979-01-18 | Peter Weckerle | Stift mit einer einen streichfaehigen koerper enthaltenden huelse, insbesondere kosmetikstift |
| JPS5711612Y2 (OSRAM) * | 1979-08-28 | 1982-03-08 | ||
| EP0100204B1 (en) * | 1982-07-22 | 1990-03-21 | The Mennen Company | Applicator for creams and viscous liquids |
| JPS6080719U (ja) * | 1983-11-10 | 1985-06-05 | 株式会社 小林コ−セ− | ペ−スト状化粧料用容器 |
| DE3430582A1 (de) * | 1984-08-20 | 1986-02-27 | geb. Verges Karin 3052 Bad Nenndorf Dahm | Vorrichtung zur applikation stiftfoermiger kosmetika |
| ZA873937B (en) * | 1986-06-12 | 1987-12-02 | A.H. Robins Company, Incorporated | Lip medication applicator |
| NZ233825A (en) * | 1987-01-29 | 1990-10-26 | Accu Med Corp | Moulded plastic biological sample collection swab |
| US4880326A (en) * | 1988-05-24 | 1989-11-14 | Spiveco, Inc. | Lipstick dispenser |
| US4976562A (en) * | 1988-05-24 | 1990-12-11 | Spiveco, Inc. | Dispenser |
| US4997300A (en) * | 1988-05-24 | 1991-03-05 | Spiveco, Inc. | Product dispenser |
| US4883380A (en) * | 1988-09-26 | 1989-11-28 | Ritterman Paul H | Lotion applicator |
| US4906118A (en) * | 1989-02-16 | 1990-03-06 | Crooks Stuart G | Lotion applicator |
| FR2645724A1 (fr) * | 1989-04-13 | 1990-10-19 | Petit Kenneth | Applicateur telescopique de produit fluide a enduire sur le corps et notamment dans le dos |
| US5018893A (en) * | 1990-03-29 | 1991-05-28 | Holloway Thomas F | Cosmetic stick dispenser |
| DE9407891U1 (de) * | 1994-05-16 | 1995-09-14 | Bramlage GmbH, 49393 Lohne | Lippenstift |
| FR2727608B1 (fr) * | 1994-12-06 | 1997-01-10 | Oreal | Distributeur pour un produit de consistance liquide a pateuse |
| US5573342A (en) * | 1995-06-20 | 1996-11-12 | Patalano; Christine S. | Body lotion applicator system |
| US6231259B1 (en) | 1996-07-26 | 2001-05-15 | The Gillette Company | Viscous product dispenser with porous dome |
| US5851079A (en) * | 1996-10-25 | 1998-12-22 | The Procter & Gamble Company | Simplified undirectional twist-up dispensing device with incremental dosing |
| USD409800S (en) * | 1997-04-29 | 1999-05-11 | Garfield Litton | Mascara container |
| USD408592S (en) * | 1997-10-06 | 1999-04-20 | Revlon Consumer Products Corporation | Cosmetic dispenser |
| DE19858410A1 (de) * | 1998-12-17 | 2000-06-29 | Schwan Stabilo Cosmetics Gmbh | Auftragvorrichtung |
| USD420766S (en) * | 1998-12-30 | 2000-02-15 | Revlon Consumer Products Corporation | Cosmetic container with color chip |
| USD420466S (en) * | 1998-12-30 | 2000-02-08 | Revlon Consumer Products Corporation | Cosmetic container with color chip |
| US6200047B1 (en) | 1999-05-07 | 2001-03-13 | Crown Cork & Seal Technologies Corporation | Sealed lipstick dispenser |
| US6227733B1 (en) | 1999-05-07 | 2001-05-08 | Crown Cork & Seal Technologies Corporation | Lipstick dispenser with functional A-shell |
| US6231254B1 (en) | 1999-05-07 | 2001-05-15 | Crown Cork And Seal Technologies Corporation | Slim dispenser |
| FR2810858B1 (fr) | 2000-06-28 | 2003-01-10 | Oreal | Embout de distribution comportant deux parties assemblees et un revetement de flocage |
| FR2810859B1 (fr) * | 2000-06-28 | 2002-09-06 | Oreal | Dispositif de conditionnement et d'application ayant une surface d'application alimentee de maniere privilegiee en produit |
| GB2380121A (en) * | 2001-02-07 | 2003-04-02 | Caroline Sarah Hardy | Nail polish applicator |
| US6585511B2 (en) * | 2001-07-16 | 2003-07-01 | Centrix, Inc. | Dental material container with porous flow through applicator |
| US20050072442A1 (en) * | 2002-02-20 | 2005-04-07 | Louis Licari | Self-contained hair-coloring system for touch-up, highlighting and less than full treatment applications |
| US20030226573A1 (en) * | 2002-06-10 | 2003-12-11 | Li-Chun Chan | Structure of a lip-stick make-up head |
| US6902335B2 (en) * | 2003-05-08 | 2005-06-07 | R.P. Scherer Technologies, Inc. | Hand held dispensing and application apparatus |
| US7093739B2 (en) * | 2003-06-20 | 2006-08-22 | Young-Kwang Byun | Cosmetics case for liquid cosmetics |
| US20050047848A1 (en) * | 2003-08-19 | 2005-03-03 | Robert Carraher | Tip applicator with Venturi structure |
| USD530857S1 (en) * | 2003-10-23 | 2006-10-24 | Bonne Bell, Inc. | Cosmetic applicator pen |
| DE102004011557A1 (de) * | 2004-03-08 | 2005-09-29 | Henkel Kgaa | Bleichmittel und Applikatoren für die Zähne |
| USD562561S1 (en) * | 2004-06-07 | 2008-02-26 | Hct Limited | Twist up pen type dispenser with brush applicator |
| FR2871664B1 (fr) * | 2004-06-17 | 2006-07-28 | Techpack Int Sa | Applicateur de rouge a levres et distributeur comprenant ledit applicateur |
| FR2897245B1 (fr) | 2006-02-15 | 2008-04-25 | Oreal | Dispositif de conditionnement et d'application. |
| US8215861B2 (en) * | 2006-02-15 | 2012-07-10 | L'oreal | Packaging and applicator device |
| JP4932332B2 (ja) * | 2006-05-31 | 2012-05-16 | 株式会社 資生堂 | 粘性化粧品 |
| USD626592S1 (en) * | 2009-12-31 | 2010-11-02 | Holland Usa, Inc. | Push button for a writing instrument |
| US8506193B1 (en) | 2010-03-25 | 2013-08-13 | Lava Industries, Inc. | Cosmetic fluid dispenser |
| CN103763977B (zh) * | 2011-08-15 | 2016-12-07 | 宝洁公司 | 化妆品施用装置 |
| JP6113994B2 (ja) * | 2012-10-04 | 2017-04-12 | 花王株式会社 | 化粧料容器 |
| US10478567B2 (en) * | 2014-11-11 | 2019-11-19 | Kenneth Anthony Loritz | Child resistant syringe |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1863106A (en) * | 1929-06-17 | 1932-06-14 | Gimonet Alexandre | Lip stick holder |
| US1839548A (en) * | 1929-09-27 | 1932-01-05 | Gimonet Alexandre | Lip stick holder |
| US2442503A (en) * | 1946-02-27 | 1948-06-01 | Melnikoff Zachary | Lip rouge applicator |
| US2853728A (en) * | 1957-04-17 | 1958-09-30 | Nadai Alexander | Dispenser-applicator for liquid containers |
| US3010138A (en) * | 1959-11-06 | 1961-11-28 | Nadai Alexander | Dispenser device for viscous fluids |
-
1972
- 1972-08-03 US US00277577A patent/US3807881A/en not_active Expired - Lifetime
- 1972-11-16 GB GB5289472A patent/GB1358608A/en not_active Expired
- 1972-11-16 CA CA156,611A patent/CA998644A/en not_active Expired
- 1972-11-22 JP JP47117654A patent/JPS4944849A/ja active Pending
- 1972-12-12 DE DE2260724A patent/DE2260724C3/de not_active Expired
- 1972-12-19 AU AU50277/72A patent/AU469961B2/en not_active Expired
- 1972-12-28 SE SE7217039A patent/SE394243B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2260724A1 (de) | 1974-02-21 |
| SE394243B (sv) | 1977-06-20 |
| DE2260724B2 (de) | 1977-08-25 |
| JPS4944849A (OSRAM) | 1974-04-27 |
| AU5027772A (en) | 1974-06-20 |
| GB1358608A (en) | 1974-07-03 |
| AU469961B2 (en) | 1974-06-20 |
| US3807881A (en) | 1974-04-30 |
| CA998644A (en) | 1976-10-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2260724C3 (de) | Auftragsvorrichtung für ein in einem Behälter untergebrachtes kosmetisches Präparat | |
| DE69807038T2 (de) | Verpackungs-und Auftrageinheit für ein pulverförmiges, flüssiges oder pastenförmiges Produkt, die einen Kolben aufweist | |
| EP0790790B1 (de) | Behälter für kosmetika | |
| DE69820144T2 (de) | Einheit zum Verpacken und zum Auftragen eines fluiden Produkts | |
| DE69507543T2 (de) | Mit einem perforierten Kolben versehene Auftragsvorrichtung für ein Produkt, insbesondere ein Schmink- oder Pflegeprodukt | |
| DE3854090T2 (de) | Flüssigkeitsauftragegerät. | |
| DE955898C (de) | Geraet zur Nagelpflege | |
| WO1987000404A1 (en) | Fluid matter dispenser | |
| EP0237487B1 (de) | Applikator mit Vorratsbehälter zum Auftragen von Harz- und Lacksubstanzen, insbesondere Nagellack | |
| DE2550256B2 (de) | Abstreifer fuer einen kosmetischen stift mit applikator | |
| EP0191832B1 (de) | Stiftförmige vorrichtung zur applikation kosmetischer massen | |
| DE1181873B (de) | Vorrichtung zur Abgabe von fluessigen Medien, insbesondere Schuhpflegemittel | |
| EP0154231A2 (de) | Applikator für flüssige, pastöse und pulverförmige Medien, insbesondere für Kosmetika | |
| DE2944336C2 (de) | Behälter für Farbe mit Auftragpinsel | |
| DE1807236A1 (de) | Mechanischer Rasierapparat | |
| DE3009587C2 (de) | Körperpflegegerät zum Auftragen von flüssigen aufschäumbaren Körperpflegemitteln, insbesondere Duschgels | |
| DE337676C (de) | Vorrichtung zum Auftragen dickfluessiger oder breiiger Stoffe mittels eines Pinsels | |
| DE1069353B (OSRAM) | ||
| DE2055159A1 (de) | Druckdose, insbesondere Spraydose | |
| DE816135C (de) | Auftragsvorrichtung fuer fluessige Lippenschminke | |
| DE102004048164B3 (de) | Vorrichtung zum Auftragen von Rasierschaum, Rasiercreme, Rasiergel, Konditionierflüssigkeit oder dergleichen Konditioniermittel auf die Haut,Kartusche dafür, sowie Trockenrasiergerät und Epiliergerät mit einer solchen Vorrichtung | |
| CH209772A (de) | Gerät zur direkten Auftragung von Fett, Öl etc. auf die Kopfhaut. | |
| DE610353C (de) | Maschine zum Auftragen von Klebstoff auf Schuhboeden | |
| DE2401066C3 (de) | Vorratsbehälter mit zwei Auftragskissen | |
| AT241748B (de) | Schuhcremebehälter und Verfahren zur Füllung eines solchen Behälters |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |