DE2253914C3 - Chromon-3-acrylsaeuren, verfahren zu ihrer herstellung sowie diese verbindung enthaltende arzneimittel - Google Patents
Chromon-3-acrylsaeuren, verfahren zu ihrer herstellung sowie diese verbindung enthaltende arzneimittelInfo
- Publication number
- DE2253914C3 DE2253914C3 DE19722253914 DE2253914A DE2253914C3 DE 2253914 C3 DE2253914 C3 DE 2253914C3 DE 19722253914 DE19722253914 DE 19722253914 DE 2253914 A DE2253914 A DE 2253914A DE 2253914 C3 DE2253914 C3 DE 2253914C3
- Authority
- DE
- Germany
- Prior art keywords
- parts
- chromone
- trans
- compound
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 title claims description 46
- 238000000034 method Methods 0.000 title claims description 10
- 238000004519 manufacturing process Methods 0.000 title 1
- 229940126601 medicinal product Drugs 0.000 title 1
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- 239000003513 alkali Substances 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 5
- 125000004423 acyloxy group Chemical group 0.000 claims description 4
- 150000001447 alkali salts Chemical class 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 150000003863 ammonium salts Chemical class 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 42
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 35
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 31
- -1 cyano, carboxyl Chemical group 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 23
- 239000000203 mixture Substances 0.000 description 18
- 239000000243 solution Substances 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 241000700159 Rattus Species 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- 238000000354 decomposition reaction Methods 0.000 description 12
- 239000013078 crystal Substances 0.000 description 11
- 238000005187 foaming Methods 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 206010002198 Anaphylactic reaction Diseases 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- 230000036783 anaphylactic response Effects 0.000 description 7
- 208000003455 anaphylaxis Diseases 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 238000001953 recrystallisation Methods 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- JTKDMUFCCJDYLT-UHFFFAOYSA-N 3-(4-oxochromen-3-yl)prop-2-enoic acid Chemical compound C1=CC=C2C(=O)C(C=CC(=O)O)=COC2=C1 JTKDMUFCCJDYLT-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- 208000006673 asthma Diseases 0.000 description 6
- 239000003814 drug Substances 0.000 description 6
- 239000005457 ice water Substances 0.000 description 6
- 208000030603 inherited susceptibility to asthma Diseases 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- JTKDMUFCCJDYLT-AATRIKPKSA-N (e)-3-(4-oxochromen-3-yl)prop-2-enoic acid Chemical compound C1=CC=C2C(=O)C(/C=C/C(=O)O)=COC2=C1 JTKDMUFCCJDYLT-AATRIKPKSA-N 0.000 description 5
- FSMYWBQIMDSGQP-UHFFFAOYSA-N 4-oxochromene-3-carbaldehyde Chemical compound C1=CC=C2C(=O)C(C=O)=COC2=C1 FSMYWBQIMDSGQP-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 230000003266 anti-allergic effect Effects 0.000 description 5
- 150000001733 carboxylic acid esters Chemical class 0.000 description 5
- 239000007924 injection Substances 0.000 description 5
- 238000002347 injection Methods 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 125000005392 carboxamide group Chemical group NC(=O)* 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 238000002329 infrared spectrum Methods 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- FMCGSUUBYTWNDP-ONGXEEELSA-N (1R,2S)-2-(dimethylamino)-1-phenyl-1-propanol Chemical compound CN(C)[C@@H](C)[C@H](O)C1=CC=CC=C1 FMCGSUUBYTWNDP-ONGXEEELSA-N 0.000 description 3
- OVBJOTVZEFISLV-UHFFFAOYSA-N 7-methoxy-4-oxochromene-3-carbaldehyde Chemical compound O1C=C(C=O)C(=O)C=2C1=CC(OC)=CC=2 OVBJOTVZEFISLV-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZVQOOHYFBIDMTQ-UHFFFAOYSA-N [methyl(oxido){1-[6-(trifluoromethyl)pyridin-3-yl]ethyl}-lambda(6)-sulfanylidene]cyanamide Chemical compound N#CN=S(C)(=O)C(C)C1=CC=C(C(F)(F)F)N=C1 ZVQOOHYFBIDMTQ-UHFFFAOYSA-N 0.000 description 3
- OTAFHZMPRISVEM-UHFFFAOYSA-N chromone Chemical group C1=CC=C2C(=O)C=COC2=C1 OTAFHZMPRISVEM-UHFFFAOYSA-N 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 229960001340 histamine Drugs 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 239000002504 physiological saline solution Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 210000002966 serum Anatomy 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- NCOAOCSEOVGTPI-UHFFFAOYSA-N (3-formyl-4-oxochromen-5-yl) acetate Chemical compound O1C=C(C=O)C(=O)C2=C1C=CC=C2OC(=O)C NCOAOCSEOVGTPI-UHFFFAOYSA-N 0.000 description 2
- FREHGEVVMNNOAE-UHFFFAOYSA-N (3-formyl-4-oxochromen-7-yl) acetate Chemical compound O1C=C(C=O)C(=O)C=2C1=CC(OC(=O)C)=CC=2 FREHGEVVMNNOAE-UHFFFAOYSA-N 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- LXBGSDVWAMZHDD-UHFFFAOYSA-N 2-methyl-1h-imidazole Chemical compound CC1=NC=CN1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 description 2
- 244000215068 Acacia senegal Species 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Natural products CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- 241001239379 Calophysus macropterus Species 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 2
- 108010058846 Ovalbumin Proteins 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 206010070834 Sensitisation Diseases 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 230000000172 allergic effect Effects 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 239000000427 antigen Substances 0.000 description 2
- 108091007433 antigens Proteins 0.000 description 2
- 102000036639 antigens Human genes 0.000 description 2
- 229940125715 antihistaminic agent Drugs 0.000 description 2
- 239000000739 antihistaminic agent Substances 0.000 description 2
- 208000010668 atopic eczema Diseases 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 229940124630 bronchodilator Drugs 0.000 description 2
- 239000000168 bronchodilator agent Substances 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229960000265 cromoglicic acid Drugs 0.000 description 2
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical compound OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 2
- VLARUOGDXDTHEH-UHFFFAOYSA-L disodium cromoglycate Chemical compound [Na+].[Na+].O1C(C([O-])=O)=CC(=O)C2=C1C=CC=C2OCC(O)COC1=CC=CC2=C1C(=O)C=C(C([O-])=O)O2 VLARUOGDXDTHEH-UHFFFAOYSA-L 0.000 description 2
- 229940005636 dl- methylephedrine Drugs 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 2
- 229940016286 microcrystalline cellulose Drugs 0.000 description 2
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 2
- 239000008108 microcrystalline cellulose Substances 0.000 description 2
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000028327 secretion Effects 0.000 description 2
- 230000008313 sensitization Effects 0.000 description 2
- 231100000121 skin sensitizing Toxicity 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000012453 sprague-dawley rat model Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 1
- CEWVBDAOFLKYNT-UHFFFAOYSA-N (5-acetyloxy-3-formyl-4-oxochromen-7-yl) acetate Chemical compound C(C)(=O)OC1=C2C(C(=COC2=CC(=C1)OC(C)=O)C=O)=O CEWVBDAOFLKYNT-UHFFFAOYSA-N 0.000 description 1
- SJDIMCIXQFHDEC-UHFFFAOYSA-N (7-acetyloxy-3-formyl-4-oxochromen-6-yl) acetate Chemical compound O1C=C(C=O)C(=O)C2=C1C=C(OC(=O)C)C(OC(C)=O)=C2 SJDIMCIXQFHDEC-UHFFFAOYSA-N 0.000 description 1
- WTIUROISXIWRPE-UHFFFAOYSA-N (7-acetyloxy-4-oxochromen-6-yl) acetate Chemical compound C(C)(=O)OC=1C=C2C(C=COC2=CC=1OC(C)=O)=O WTIUROISXIWRPE-UHFFFAOYSA-N 0.000 description 1
- MUFFGYAUJMJSOM-GQCTYLIASA-N (E)-3-(6-ethyl-4-oxochromen-3-yl)prop-2-enoic acid Chemical compound CCc1ccc2occ(\C=C\C(O)=O)c(=O)c2c1 MUFFGYAUJMJSOM-GQCTYLIASA-N 0.000 description 1
- QFELLHJNFUMHGA-DAFODLJHSA-N (e)-3-(6-nitro-4-oxochromen-3-yl)prop-2-enoic acid Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)C(/C=C/C(=O)O)=COC2=C1 QFELLHJNFUMHGA-DAFODLJHSA-N 0.000 description 1
- CHUIYLKKZQVXKM-DAFODLJHSA-N (e)-3-(7-hydroxy-4-oxochromen-3-yl)prop-2-enoic acid Chemical compound OC1=CC=C2C(=O)C(/C=C/C(=O)O)=COC2=C1 CHUIYLKKZQVXKM-DAFODLJHSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- ULOIAOPTGWSNHU-UHFFFAOYSA-N 2-butyl radical Chemical compound C[CH]CC ULOIAOPTGWSNHU-UHFFFAOYSA-N 0.000 description 1
- IIVWHGMLFGNMOW-UHFFFAOYSA-N 2-methylpropane Chemical compound C[C](C)C IIVWHGMLFGNMOW-UHFFFAOYSA-N 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- PBVZQAXFSQKDKK-UHFFFAOYSA-N 3-Methoxy-3-oxopropanoic acid Chemical compound COC(=O)CC(O)=O PBVZQAXFSQKDKK-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- HGINADPHJQTSKN-UHFFFAOYSA-M 3-ethoxy-3-oxopropanoate Chemical compound CCOC(=O)CC([O-])=O HGINADPHJQTSKN-UHFFFAOYSA-M 0.000 description 1
- OGADYYVJCJCDRQ-UHFFFAOYSA-N 6,7-dihydroxy-4-oxochromene-3-carbaldehyde Chemical compound O1C=C(C=O)C(=O)C2=C1C=C(O)C(O)=C2 OGADYYVJCJCDRQ-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- USBRXKRFIPTWNC-UHFFFAOYSA-N 6-hydroxy-9-methylfuro[2,3-b]quinolin-4-one Chemical compound O=C1C2=CC(O)=CC=C2N(C)C2=C1C=CO2 USBRXKRFIPTWNC-UHFFFAOYSA-N 0.000 description 1
- ZTPHGPLCHXGENO-UHFFFAOYSA-N 7-hydroxy-4-oxochromene-3-carbaldehyde Chemical compound O1C=C(C=O)C(=O)C=2C1=CC(O)=CC=2 ZTPHGPLCHXGENO-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- KYNSBQPICQTCGU-UHFFFAOYSA-N Benzopyrane Chemical group C1=CC=C2C=CCOC2=C1 KYNSBQPICQTCGU-UHFFFAOYSA-N 0.000 description 1
- 101150039167 Bex3 gene Proteins 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241000588832 Bordetella pertussis Species 0.000 description 1
- JRSYJNDTTHTDBT-ONEGZZNKSA-N CC(OC(C=C(C(OC=C1/C=C/C(O)=O)=C2)C1=O)=C2OC(C)=O)=O Chemical compound CC(OC(C=C(C(OC=C1/C=C/C(O)=O)=C2)C1=O)=C2OC(C)=O)=O JRSYJNDTTHTDBT-ONEGZZNKSA-N 0.000 description 1
- RWVSVXASMGQQNB-AATRIKPKSA-N CC(OC1=CC(OC)=CC=C11)=C(/C=C/C(O)=O)C1=O Chemical compound CC(OC1=CC(OC)=CC=C11)=C(/C=C/C(O)=O)C1=O RWVSVXASMGQQNB-AATRIKPKSA-N 0.000 description 1
- COXVTLYNGOIATD-HVMBLDELSA-N CC1=C(C=CC(=C1)C1=CC(C)=C(C=C1)\N=N\C1=C(O)C2=C(N)C(=CC(=C2C=C1)S(O)(=O)=O)S(O)(=O)=O)\N=N\C1=CC=C2C(=CC(=C(N)C2=C1O)S(O)(=O)=O)S(O)(=O)=O Chemical compound CC1=C(C=CC(=C1)C1=CC(C)=C(C=C1)\N=N\C1=C(O)C2=C(N)C(=CC(=C2C=C1)S(O)(=O)=O)S(O)(=O)=O)\N=N\C1=CC=C2C(=CC(=C(N)C2=C1O)S(O)(=O)=O)S(O)(=O)=O COXVTLYNGOIATD-HVMBLDELSA-N 0.000 description 1
- 208000019300 CLIPPERS Diseases 0.000 description 1
- HNUALPPJLMYHDK-UHFFFAOYSA-N C[CH]C Chemical compound C[CH]C HNUALPPJLMYHDK-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 208000001840 Dandruff Diseases 0.000 description 1
- SQUHHTBVTRBESD-UHFFFAOYSA-N Hexa-Ac-myo-Inositol Natural products CC(=O)OC1C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O SQUHHTBVTRBESD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000286819 Malo Species 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- LBMQENKHUXFRTK-AATRIKPKSA-N O=C1C(=COC2=C1C=CC=C2)/C=C/C(=O)N Chemical compound O=C1C(=COC2=C1C=CC=C2)/C=C/C(=O)N LBMQENKHUXFRTK-AATRIKPKSA-N 0.000 description 1
- 206010039085 Rhinitis allergic Diseases 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 208000024780 Urticaria Diseases 0.000 description 1
- GPSBEQXWWLDVBC-UHFFFAOYSA-N [3-(2-hydroxyacetyl)phenyl] acetate Chemical compound CC(=O)OC1=CC=CC(C(=O)CO)=C1 GPSBEQXWWLDVBC-UHFFFAOYSA-N 0.000 description 1
- OCBFFGCSTGGPSQ-UHFFFAOYSA-N [CH2]CC Chemical compound [CH2]CC OCBFFGCSTGGPSQ-UHFFFAOYSA-N 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 201000010105 allergic rhinitis Diseases 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 125000001691 aryl alkyl amino group Chemical group 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 125000006309 butyl amino group Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 229940023913 cation exchange resins Drugs 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 208000021930 chronic lymphocytic inflammation with pontine perivascular enhancement responsive to steroids Diseases 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000950 dibromo group Chemical group Br* 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- RCKMWOKWVGPNJF-UHFFFAOYSA-N diethylcarbamazine Chemical compound CCN(CC)C(=O)N1CCN(C)CC1 RCKMWOKWVGPNJF-UHFFFAOYSA-N 0.000 description 1
- 229960003974 diethylcarbamazine Drugs 0.000 description 1
- 230000000916 dilatatory effect Effects 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 125000004914 dipropylamino group Chemical group C(CC)N(CCC)* 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- FHRBQMBCNVAZFW-BQYQJAHWSA-N ethyl (e)-3-(4-oxochromen-3-yl)prop-2-enoate Chemical compound C1=CC=C2C(=O)C(/C=C/C(=O)OCC)=COC2=C1 FHRBQMBCNVAZFW-BQYQJAHWSA-N 0.000 description 1
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 229960003699 evans blue Drugs 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- VGGRCVDNFAQIKO-UHFFFAOYSA-N formic anhydride Chemical compound O=COC=O VGGRCVDNFAQIKO-UHFFFAOYSA-N 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000002390 heteroarenes Chemical class 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- CDAISMWEOUEBRE-GPIVLXJGSA-N inositol Chemical compound O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@H](O)[C@@H]1O CDAISMWEOUEBRE-GPIVLXJGSA-N 0.000 description 1
- 229960000367 inositol Drugs 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- WHQSYGRFZMUQGQ-UHFFFAOYSA-N n,n-dimethylformamide;hydrate Chemical compound O.CN(C)C=O WHQSYGRFZMUQGQ-UHFFFAOYSA-N 0.000 description 1
- QJFNDBWIWCXXOF-UHFFFAOYSA-N n,n-dimethylformamide;propan-2-one;hydrate Chemical compound O.CC(C)=O.CN(C)C=O QJFNDBWIWCXXOF-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 229940066827 pertussis vaccine Drugs 0.000 description 1
- CDRPUGZCRXZLFL-OWOJBTEDSA-N piceatannol Chemical compound OC1=CC(O)=CC(\C=C\C=2C=C(O)C(O)=CC=2)=C1 CDRPUGZCRXZLFL-OWOJBTEDSA-N 0.000 description 1
- 210000004224 pleura Anatomy 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000006308 propyl amino group Chemical group 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- CDAISMWEOUEBRE-UHFFFAOYSA-N scyllo-inosotol Natural products OC1C(O)C(O)C(O)C(O)C1O CDAISMWEOUEBRE-UHFFFAOYSA-N 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/22—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyrane Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP46087880A JPS50675B2 (enExample) | 1971-11-04 | 1971-11-04 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2253914A1 DE2253914A1 (de) | 1973-05-10 |
| DE2253914B2 DE2253914B2 (de) | 1976-04-15 |
| DE2253914C3 true DE2253914C3 (de) | 1976-11-25 |
Family
ID=13927165
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722253914 Expired DE2253914C3 (de) | 1971-11-04 | 1972-11-03 | Chromon-3-acrylsaeuren, verfahren zu ihrer herstellung sowie diese verbindung enthaltende arzneimittel |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3872108A (enExample) |
| JP (1) | JPS50675B2 (enExample) |
| BE (1) | BE790802A (enExample) |
| CA (1) | CA979910A (enExample) |
| CH (1) | CH575938A5 (enExample) |
| DE (1) | DE2253914C3 (enExample) |
| DK (1) | DK129706B (enExample) |
| FR (1) | FR2158535B1 (enExample) |
| GB (1) | GB1401504A (enExample) |
| HU (1) | HU164527B (enExample) |
| NL (1) | NL7214851A (enExample) |
| SE (1) | SE388857B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4151180A (en) * | 1972-04-12 | 1979-04-24 | Takeda Chemical Industries, Ltd. | Chromone derivatives |
| US4098799A (en) * | 1973-04-18 | 1978-07-04 | Warner-Lambert Company | 3-formylchromones |
| US3993669A (en) * | 1974-06-05 | 1976-11-23 | Syntex (U.S.A.) Inc. | Mono- and disubstituted 1.4-benzopyrone-6-carboxylic acids and derivatives thereof |
| US4033845A (en) * | 1975-11-20 | 1977-07-05 | Warner-Lambert Company | [2-(4-Oxo-4H-1-benzopyran-2-yl)ethenyl]benzonitriles and benzoic acids |
| US4025642A (en) * | 1975-12-03 | 1977-05-24 | Smithkline Corporation | Substituted 2H-pyran-2, 6(3H)-dione derivatives |
| JPS59112878U (ja) * | 1983-07-03 | 1984-07-30 | 沢入 晴之 | 漁船における貯蔵魚の出艙装置 |
| ES2633097T3 (es) * | 2009-06-30 | 2017-09-19 | Bridgestone Corporation | Iniciadores de polimerización aniónica y procesos |
-
0
- BE BE790802D patent/BE790802A/xx unknown
-
1971
- 1971-11-04 JP JP46087880A patent/JPS50675B2/ja not_active Expired
-
1972
- 1972-11-01 US US302652A patent/US3872108A/en not_active Expired - Lifetime
- 1972-11-02 HU HUTA1217A patent/HU164527B/hu unknown
- 1972-11-02 NL NL7214851A patent/NL7214851A/xx not_active Application Discontinuation
- 1972-11-02 SE SE7214223A patent/SE388857B/xx unknown
- 1972-11-03 DE DE19722253914 patent/DE2253914C3/de not_active Expired
- 1972-11-03 FR FR7239071A patent/FR2158535B1/fr not_active Expired
- 1972-11-03 DK DK545072AA patent/DK129706B/da unknown
- 1972-11-03 CA CA155,510A patent/CA979910A/en not_active Expired
- 1972-11-03 CH CH1604772A patent/CH575938A5/xx not_active IP Right Cessation
- 1972-11-06 GB GB5114072A patent/GB1401504A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SE388857B (sv) | 1976-10-18 |
| DE2253914A1 (de) | 1973-05-10 |
| CA979910A (en) | 1975-12-16 |
| US3872108A (en) | 1975-03-18 |
| DK129706C (enExample) | 1975-04-21 |
| FR2158535B1 (enExample) | 1976-04-23 |
| GB1401504A (en) | 1975-07-16 |
| HU164527B (enExample) | 1974-02-28 |
| CH575938A5 (enExample) | 1976-05-31 |
| DK129706B (da) | 1974-11-11 |
| JPS50675B2 (enExample) | 1975-01-10 |
| JPS4852770A (enExample) | 1973-07-24 |
| BE790802A (fr) | 1973-04-30 |
| FR2158535A1 (enExample) | 1973-06-15 |
| NL7214851A (enExample) | 1973-05-08 |
| DE2253914B2 (de) | 1976-04-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2402398B2 (de) | Aromatische Carbonsäureamid-Derivate, Verfahren zu ihrer Herstellung und pharmazeutische Zusammensetzungen | |
| DE1645971C3 (de) | (lndazol-3-yl)-oxyessigsäurederivate, Verfahren zu ihrer Herstellung und Mittel mit entzündungshemmender Wirkung | |
| DE2759927C2 (de) | Spiro-hydantoin-Verbindungen | |
| EP0242851A1 (de) | N-(2'-Aminophenyl)-benzamid-Derivate, Verfahren zu deren Herstellung und deren Verwendung bei der Bekämpfung neoplastischer Erkrankungen | |
| DD235450B1 (de) | Verfahren zur herstellung neuer 1-(2-hydroxyaryl)-alkan-1-on-oxime | |
| DD295363A5 (de) | Verfahren zur herstellung von 1-benzyl-indazol-3-yl-zwischenprodukten | |
| DE2931418C2 (enExample) | ||
| DE3033897C2 (enExample) | ||
| DE2253914C3 (de) | Chromon-3-acrylsaeuren, verfahren zu ihrer herstellung sowie diese verbindung enthaltende arzneimittel | |
| DE2418344A1 (de) | Derivate von 3-nitrocumarinen enthaltende arzneimittel, neue 3-nitrocumarine und verfahren zu ihrer herstellung | |
| DE2425983B2 (de) | Sulfonsaeuresalze von acylcholinen, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische zusammensetzung | |
| DE1965711C3 (de) | l^-Dihydro-133-triazin-Derivate, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE69229501T2 (de) | Benzopyranderivat und dieses als aktives bestandteil enthaltendes antiallergikum | |
| DE1493618A1 (de) | Cumarinderivate und ein Verfahren zu ihrer Herstellung | |
| EP0046554B1 (de) | N-substituierte Brenztraubensäurehydrazone, Verfahren zu ihrer Herstellung und Arzneimittel, die diese Verbindungen enthalten | |
| DE1595870C3 (de) | Verfahren zur Herstellung von 3-(o-Methoxyphenoxy)-1,2-propandiolnicotinaten und deren Säureadditionssalzen | |
| DE2247828A1 (de) | Sulfamoyl-anthranilsaeuren und verfahren zu ihrer herstellung | |
| DE2805485A1 (de) | Alpha-cyano-beta-diketo-verbindungen, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate | |
| DE2536170B2 (enExample) | ||
| DE1620749C3 (de) | Verfahren zur Herstellung von Carbothiamin | |
| AT323161B (de) | Verfahren zur herstellung neuer 2-carboxy-4-oxo-4h, 10h(2)-benzopyrano-(4,3-g)-(1)-benzopyrane und ihrer salze | |
| AT218017B (de) | Verfahren zur Herstellung von Ketonen des 4-Hydroxy-cumarins | |
| CH687001A5 (de) | Pharmazeutisches Praeparat zur Modulierung der Immunreaktion. | |
| DE69415118T2 (de) | Ketonderivate des Indans, ihre Herstellung und ihre therapeutische Anwendung | |
| AT343114B (de) | Verfahren zur herstellung von neuen 5-methylisoxazol-3-carbonsauresalzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8339 | Ceased/non-payment of the annual fee | ||
| 8380 | Miscellaneous part iii |
Free format text: IN HEFT 6/83, SEITE 1106, SP. 3: DIE VEROEFFENTLICHUNG IST ZU STREICHEN |
|
| 8339 | Ceased/non-payment of the annual fee |