DE2229312A1 - Aus thermoplastischem Kunststoff bestehende Flasche mit nicht heraustretendem Boden - Google Patents
Aus thermoplastischem Kunststoff bestehende Flasche mit nicht heraustretendem BodenInfo
- Publication number
- DE2229312A1 DE2229312A1 DE19722229312 DE2229312A DE2229312A1 DE 2229312 A1 DE2229312 A1 DE 2229312A1 DE 19722229312 DE19722229312 DE 19722229312 DE 2229312 A DE2229312 A DE 2229312A DE 2229312 A1 DE2229312 A1 DE 2229312A1
- Authority
- DE
- Germany
- Prior art keywords
- bottle
- projections
- cylinder
- web
- radius
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920001169 thermoplastic Polymers 0.000 title claims description 14
- 239000004416 thermosoftening plastic Substances 0.000 title claims description 10
- 239000011324 bead Substances 0.000 claims description 21
- 229920000642 polymer Polymers 0.000 claims description 19
- -1 polyethylene terephthalate Polymers 0.000 claims description 13
- 239000012815 thermoplastic material Substances 0.000 claims description 11
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 9
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 9
- 230000007704 transition Effects 0.000 claims description 9
- 239000000463 material Substances 0.000 claims description 6
- 230000002787 reinforcement Effects 0.000 claims description 5
- 229920003023 plastic Polymers 0.000 description 14
- 239000004033 plastic Substances 0.000 description 14
- 239000007788 liquid Substances 0.000 description 11
- 230000003014 reinforcing effect Effects 0.000 description 9
- 229920001577 copolymer Polymers 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- 235000013405 beer Nutrition 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- 238000013461 design Methods 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 239000012530 fluid Substances 0.000 description 3
- 230000009477 glass transition Effects 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- LLLVZDVNHNWSDS-UHFFFAOYSA-N 4-methylidene-3,5-dioxabicyclo[5.2.2]undeca-1(9),7,10-triene-2,6-dione Chemical compound C1(C2=CC=C(C(=O)OC(=C)O1)C=C2)=O LLLVZDVNHNWSDS-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 230000006750 UV protection Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000013361 beverage Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- GWZCCUDJHOGOSO-UHFFFAOYSA-N diphenic acid Chemical compound OC(=O)C1=CC=CC=C1C1=CC=CC=C1C(O)=O GWZCCUDJHOGOSO-UHFFFAOYSA-N 0.000 description 1
- TVIDDXQYHWJXFK-UHFFFAOYSA-N dodecanedioic acid Chemical compound OC(=O)CCCCCCCCCCC(O)=O TVIDDXQYHWJXFK-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 229920006225 ethylene-methyl acrylate Polymers 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000001595 flow curve Methods 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- DMCTVRQBJMBEDT-UHFFFAOYSA-N phenol;1,1,1,2-tetrachloroethane Chemical compound ClCC(Cl)(Cl)Cl.OC1=CC=CC=C1 DMCTVRQBJMBEDT-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920002492 poly(sulfone) Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 230000004224 protection Effects 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B65—CONVEYING; PACKING; STORING; HANDLING THIN OR FILAMENTARY MATERIAL
- B65D—CONTAINERS FOR STORAGE OR TRANSPORT OF ARTICLES OR MATERIALS, e.g. BAGS, BARRELS, BOTTLES, BOXES, CANS, CARTONS, CRATES, DRUMS, JARS, TANKS, HOPPERS, FORWARDING CONTAINERS; ACCESSORIES, CLOSURES, OR FITTINGS THEREFOR; PACKAGING ELEMENTS; PACKAGES
- B65D1/00—Rigid or semi-rigid containers having bodies formed in one piece, e.g. by casting metallic material, by moulding plastics, by blowing vitreous material, by throwing ceramic material, by moulding pulped fibrous material or by deep-drawing operations performed on sheet material
- B65D1/02—Bottles or similar containers with necks or like restricted apertures, designed for pouring contents
- B65D1/0223—Bottles or similar containers with necks or like restricted apertures, designed for pouring contents characterised by shape
- B65D1/0261—Bottom construction
- B65D1/0284—Bottom construction having a discontinuous contact surface, e.g. discrete feet
Landscapes
- Engineering & Computer Science (AREA)
- Ceramic Engineering (AREA)
- Mechanical Engineering (AREA)
- Containers Having Bodies Formed In One Piece (AREA)
- Laminated Bodies (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US15326871A | 1971-06-15 | 1971-06-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2229312A1 true DE2229312A1 (de) | 1972-12-28 |
Family
ID=22546474
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722229312 Pending DE2229312A1 (de) | 1971-06-15 | 1972-06-15 | Aus thermoplastischem Kunststoff bestehende Flasche mit nicht heraustretendem Boden |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3727783A (enExample) |
| AU (1) | AU460886B2 (enExample) |
| BE (1) | BE784888A (enExample) |
| CA (1) | CA949472A (enExample) |
| DE (1) | DE2229312A1 (enExample) |
| FR (1) | FR2141963B1 (enExample) |
| GB (1) | GB1360107A (enExample) |
| IT (1) | IT956483B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2950242A1 (de) * | 1979-01-10 | 1980-07-17 | Yoshino Kogyosho Co Ltd | Duennwandige kunststoff-flasche |
| DE3000785A1 (de) * | 1979-01-25 | 1980-07-31 | Yoshino Kogyosho Co Ltd | Duennwandige kunststoff-flasche |
| DE102017006510A1 (de) * | 2017-07-10 | 2018-09-06 | Michael Baumann | Kunststoffflasche |
Families Citing this family (119)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4037752A (en) * | 1975-11-13 | 1977-07-26 | Coors Container Company | Container with outwardly flexible bottom end wall having integral support means and method and apparatus for manufacturing thereof |
| JPS6128736Y2 (enExample) * | 1978-07-10 | 1986-08-26 | ||
| JPS5541319U (enExample) * | 1978-09-08 | 1980-03-17 | ||
| GB2034663B (en) * | 1978-11-07 | 1983-09-01 | Yoshino Kogyosho Co Ltd | Synthetic resin thin-walled bottle |
| JPS5821374Y2 (ja) * | 1979-01-10 | 1983-05-06 | 株式会社吉野工業所 | 二軸延伸させた合成樹脂製肉薄壜 |
| JPS5821373Y2 (ja) * | 1979-01-10 | 1983-05-06 | 株式会社吉野工業所 | 二軸延伸させた合成樹脂製肉薄壜 |
| JPS55110415U (enExample) * | 1979-01-26 | 1980-08-02 | ||
| US4335821A (en) * | 1979-07-03 | 1982-06-22 | The Continental Group, Inc. | Blow molded plastic material bottle bottom |
| US4249667A (en) * | 1979-10-25 | 1981-02-10 | The Continental Group, Inc. | Plastic container with a generally hemispherical bottom wall having hollow legs projecting therefrom |
| US4525401A (en) * | 1979-11-30 | 1985-06-25 | The Continental Group, Inc. | Plastic container with internal rib reinforced bottom |
| US4294366A (en) * | 1980-03-17 | 1981-10-13 | Owens-Illinois, Inc. | Free-standing plastic bottle |
| US4318489A (en) * | 1980-07-31 | 1982-03-09 | Pepsico, Inc. | Plastic bottle |
| US4368825A (en) * | 1980-11-28 | 1983-01-18 | Standard Oil Company (Indiana) | Self-standing bottle structure |
| USD272418S (en) | 1981-06-05 | 1984-01-31 | The Continental Group, Inc. | Can |
| US4997692A (en) * | 1982-01-29 | 1991-03-05 | Yoshino Kogyosho Co., Ltd. | Synthetic resin made thin-walled bottle |
| US4520936A (en) * | 1982-05-20 | 1985-06-04 | Polybottle | Blow moulded plastic containers |
| JPS6076613U (ja) * | 1983-10-31 | 1985-05-29 | 日精エー・エス・ビー機械株式会社 | 耐熱性合成樹脂びん |
| US5222615A (en) * | 1985-07-30 | 1993-06-29 | Yoshino Kogyosho Co., Ltd. | Container having support structure in its bottom section |
| USRE36639E (en) * | 1986-02-14 | 2000-04-04 | North American Container, Inc. | Plastic container |
| US5072841A (en) * | 1986-02-14 | 1991-12-17 | Norderney Investments Limited | Plastic containers |
| GB2189214B (en) * | 1986-04-21 | 1988-11-23 | Fibrenyle Ltd | Blow-moulded containers |
| US4865206A (en) * | 1988-06-17 | 1989-09-12 | Hoover Universal, Inc. | Blow molded one-piece bottle |
| US4867323A (en) * | 1988-07-15 | 1989-09-19 | Hoover Universal, Inc. | Blow molded bottle with improved self supporting base |
| US4892205A (en) * | 1988-07-15 | 1990-01-09 | Hoover Universal, Inc. | Concentric ribbed preform and bottle made from same |
| US4949861A (en) * | 1988-11-14 | 1990-08-21 | American National Can Company | Rectangular plastic container with panel support |
| GB8904417D0 (en) * | 1989-02-27 | 1989-04-12 | Mendle Limited | A plastics bottle |
| US4978015A (en) * | 1990-01-10 | 1990-12-18 | North American Container, Inc. | Plastic container for pressurized fluids |
| US5024340A (en) * | 1990-07-23 | 1991-06-18 | Sewell Plastics, Inc. | Wide stance footed bottle |
| US5615790A (en) | 1990-11-15 | 1997-04-01 | Plastipak Packaging, Inc. | Plastic blow molded freestanding container |
| US5139162A (en) * | 1990-11-15 | 1992-08-18 | Plastipak Packaging, Inc. | Plastic blow molded freestanding container |
| US5064080A (en) * | 1990-11-15 | 1991-11-12 | Plastipak Packaging, Inc. | Plastic blow molded freestanding container |
| US5287978A (en) * | 1990-11-15 | 1994-02-22 | Plastipak Packaging, Inc. | Plastic blow molded freestanding container |
| US5071015A (en) * | 1990-12-11 | 1991-12-10 | Hoover Universal, Inc. | Blow molded PET container with ribbed base structure |
| US5242085A (en) * | 1990-12-17 | 1993-09-07 | The Coca-Cola Company | Liquid container system |
| US5381927A (en) * | 1990-12-17 | 1995-01-17 | The Coca-Cola Company | Method of dispensing from a liquid container system |
| US5344045A (en) * | 1990-12-17 | 1994-09-06 | The Coca-Cola Company | Liquid container system |
| US5133468A (en) * | 1991-06-14 | 1992-07-28 | Constar Plastics Inc. | Footed hot-fill container |
| GB2258209A (en) * | 1991-07-30 | 1993-02-03 | Sipa Spa | Plastic bottle for containing either carbonated or non-carbonated beverages |
| EP0534012A1 (en) * | 1991-09-27 | 1993-03-31 | The Procter & Gamble Company | Container of thermoplastic material for containing liquids |
| US5427258A (en) * | 1992-04-09 | 1995-06-27 | Continental Pet Technologies, Inc. | Freestanding container with improved combination of properties |
| US5452815A (en) * | 1992-06-08 | 1995-09-26 | Yuan Fang Limited | Base configuration for biaxial stretched blow molded pet containers |
| US5320230A (en) * | 1992-06-08 | 1994-06-14 | Yuan Fang Limited | Base configuration for biaxial stretched blow molded pet containers |
| AU688306B2 (en) * | 1993-05-05 | 1998-03-12 | Graham Packaging Pet Technologies Inc. | Improved plastics bottle |
| CA2122500C (en) * | 1993-05-05 | 2005-07-12 | Roger William Clark | Improved plastics bottle |
| US5549210A (en) * | 1993-12-13 | 1996-08-27 | Brunswick Container Corporation | Wide stance footed bottle with radially non-uniform circumference footprint |
| US5529196A (en) * | 1994-09-09 | 1996-06-25 | Hoover Universal, Inc. | Carbonated beverage container with footed base structure |
| US5664695A (en) * | 1995-01-06 | 1997-09-09 | Plastipak Packaging, Inc. | Plastic blow molded freestanding container |
| USD380383S (en) * | 1996-05-01 | 1997-07-01 | Anheuser-Busch Incorporated | Container bottom |
| USD398528S (en) | 1997-03-11 | 1998-09-22 | Anheuser-Busch, Incorporated | Container bottom |
| US6179142B1 (en) | 1998-04-13 | 2001-01-30 | The Coca-Cola Company | Wire-frame bottle and method of manufacturing same |
| US6085924A (en) * | 1998-09-22 | 2000-07-11 | Ball Corporation | Plastic container for carbonated beverages |
| US20040173565A1 (en) * | 1999-12-01 | 2004-09-09 | Frank Semersky | Pasteurizable wide-mouth container |
| US7900425B2 (en) | 2005-10-14 | 2011-03-08 | Graham Packaging Company, L.P. | Method for handling a hot-filled container having a moveable portion to reduce a portion of a vacuum created therein |
| US8584879B2 (en) * | 2000-08-31 | 2013-11-19 | Co2Pac Limited | Plastic container having a deep-set invertible base and related methods |
| US10435223B2 (en) | 2000-08-31 | 2019-10-08 | Co2Pac Limited | Method of handling a plastic container having a moveable base |
| TWI228476B (en) * | 2000-08-31 | 2005-03-01 | Co2 Pac Ltd | Semi-rigid collapsible container |
| NZ521694A (en) * | 2002-09-30 | 2005-05-27 | Co2 Pac Ltd | Container structure for removal of vacuum pressure |
| US8381940B2 (en) | 2002-09-30 | 2013-02-26 | Co2 Pac Limited | Pressure reinforced plastic container having a moveable pressure panel and related method of processing a plastic container |
| US7543713B2 (en) * | 2001-04-19 | 2009-06-09 | Graham Packaging Company L.P. | Multi-functional base for a plastic, wide-mouth, blow-molded container |
| US20030196926A1 (en) * | 2001-04-19 | 2003-10-23 | Tobias John W. | Multi-functional base for a plastic, wide-mouth, blow-molded container |
| US8127955B2 (en) * | 2000-08-31 | 2012-03-06 | John Denner | Container structure for removal of vacuum pressure |
| US10246238B2 (en) | 2000-08-31 | 2019-04-02 | Co2Pac Limited | Plastic container having a deep-set invertible base and related methods |
| WO2002085755A1 (en) | 2001-04-19 | 2002-10-31 | Graham Packaging Company, L.P. | Multi-functional base for a plastic wide-mouth, blow-molded container |
| US6409374B1 (en) | 2001-04-30 | 2002-06-25 | Boyd I. Willat | Beverage tasting vessel with aerating ridges and agitating ribs |
| USD459946S1 (en) | 2001-04-30 | 2002-07-09 | Boyd I. Willat | Beverage tasting vessel |
| US6644539B2 (en) | 2001-10-12 | 2003-11-11 | Tetra Laval Holdings & Finance, Sa | Package with bottom panel stand-offs |
| US9969517B2 (en) | 2002-09-30 | 2018-05-15 | Co2Pac Limited | Systems and methods for handling plastic containers having a deep-set invertible base |
| USD502870S1 (en) * | 2003-02-28 | 2005-03-15 | Harold Bennett | Container |
| NZ545528A (en) * | 2003-07-30 | 2008-11-28 | Graham Packaging Co | Container handling system for plastic containers with projections extending from the bottom, filled with hot liquids |
| US8567635B2 (en) * | 2003-11-05 | 2013-10-29 | By The Glass, Llc | Wine glass |
| AU2004289219B2 (en) * | 2003-11-05 | 2010-02-04 | Govino, Llc | Wine glass |
| US9089233B2 (en) | 2003-11-05 | 2015-07-28 | Govino, Llc | Wine glass |
| US20070119726A1 (en) * | 2004-11-01 | 2007-05-31 | Willat | Wine glass |
| US7886924B2 (en) | 2003-11-05 | 2011-02-15 | By The Glass, Llc | Wine glass |
| WO2005087628A1 (en) * | 2004-03-11 | 2005-09-22 | Philip Sheets | A process and a device for conveying odd-shaped containers |
| US10611544B2 (en) | 2004-07-30 | 2020-04-07 | Co2Pac Limited | Method of handling a plastic container having a moveable base |
| US8017065B2 (en) * | 2006-04-07 | 2011-09-13 | Graham Packaging Company L.P. | System and method for forming a container having a grip region |
| US8075833B2 (en) * | 2005-04-15 | 2011-12-13 | Graham Packaging Company L.P. | Method and apparatus for manufacturing blow molded containers |
| US7461756B2 (en) * | 2005-08-08 | 2008-12-09 | Plastipak Packaging, Inc. | Plastic container having a freestanding, self-supporting base |
| WO2007105173A1 (en) * | 2006-03-13 | 2007-09-20 | The Iams Company | Container for pet products |
| US7799264B2 (en) | 2006-03-15 | 2010-09-21 | Graham Packaging Company, L.P. | Container and method for blowmolding a base in a partial vacuum pressure reduction setup |
| US8747727B2 (en) | 2006-04-07 | 2014-06-10 | Graham Packaging Company L.P. | Method of forming container |
| US9707711B2 (en) | 2006-04-07 | 2017-07-18 | Graham Packaging Company, L.P. | Container having outwardly blown, invertible deep-set grips |
| USD561583S1 (en) * | 2007-01-23 | 2008-02-12 | Conopco, Inc. | Part of container |
| USD561582S1 (en) * | 2007-01-23 | 2008-02-12 | Conpco, Inc. | Part of container |
| US11897656B2 (en) | 2007-02-09 | 2024-02-13 | Co2Pac Limited | Plastic container having a movable base |
| US11731823B2 (en) | 2007-02-09 | 2023-08-22 | Co2Pac Limited | Method of handling a plastic container having a moveable base |
| US20080308522A1 (en) * | 2007-05-11 | 2008-12-18 | Alcan Global Pharmaceutical Packaging Inc. | Easy grip bottle |
| US7891513B2 (en) * | 2007-06-08 | 2011-02-22 | Amcor Limited | Container base with feet |
| JP5024168B2 (ja) * | 2008-03-25 | 2012-09-12 | 東洋製罐株式会社 | 合成樹脂製容器 |
| US8627944B2 (en) * | 2008-07-23 | 2014-01-14 | Graham Packaging Company L.P. | System, apparatus, and method for conveying a plurality of containers |
| DE102008047450A1 (de) * | 2008-09-15 | 2010-04-15 | Krones Ag | Kunststoffbehältnis |
| US8636944B2 (en) | 2008-12-08 | 2014-01-28 | Graham Packaging Company L.P. | Method of making plastic container having a deep-inset base |
| USD649461S1 (en) * | 2008-12-19 | 2011-11-29 | Bright Solutions International Llc | Fluid injector container |
| US7926243B2 (en) | 2009-01-06 | 2011-04-19 | Graham Packaging Company, L.P. | Method and system for handling containers |
| USD645288S1 (en) | 2009-10-30 | 2011-09-20 | Anheuser-Busch, Inc. | Personal draught appliance |
| USD623471S1 (en) | 2009-10-30 | 2010-09-14 | Anheuser-Busch, Inc. | Personal draught appliance |
| USD623464S1 (en) | 2009-10-30 | 2010-09-14 | Anheuser-Busch, Inc. | Personal draught appliance |
| USD645287S1 (en) | 2009-10-30 | 2011-09-20 | Anheuser-Busch, Inc. | Personal draught appliance |
| USD623887S1 (en) | 2009-10-30 | 2010-09-21 | Anheuser-Busch, Inc. | Personal draught appliance |
| USD645694S1 (en) | 2009-10-30 | 2011-09-27 | Anheuser-Busch, Inc. | Personal draught appliance |
| US20110174827A1 (en) * | 2010-01-18 | 2011-07-21 | Graham Packaging Company, L.P. | Plastic Aerosol Container With Footed Base |
| US8962114B2 (en) | 2010-10-30 | 2015-02-24 | Graham Packaging Company, L.P. | Compression molded preform for forming invertible base hot-fill container, and systems and methods thereof |
| US9133006B2 (en) | 2010-10-31 | 2015-09-15 | Graham Packaging Company, L.P. | Systems, methods, and apparatuses for cooling hot-filled containers |
| US9150320B2 (en) | 2011-08-15 | 2015-10-06 | Graham Packaging Company, L.P. | Plastic containers having base configurations with up-stand walls having a plurality of rings, and systems, methods, and base molds thereof |
| US9994378B2 (en) | 2011-08-15 | 2018-06-12 | Graham Packaging Company, L.P. | Plastic containers, base configurations for plastic containers, and systems, methods, and base molds thereof |
| US9617029B2 (en) * | 2011-08-31 | 2017-04-11 | Amcor Limited | Lightweight container base |
| US10532848B2 (en) | 2011-08-31 | 2020-01-14 | Amcor Rigid Plastics Usa, Llc | Lightweight container base |
| US10538357B2 (en) | 2011-08-31 | 2020-01-21 | Amcor Rigid Plastics Usa, Llc | Lightweight container base |
| US8919587B2 (en) | 2011-10-03 | 2014-12-30 | Graham Packaging Company, L.P. | Plastic container with angular vacuum panel and method of same |
| USD720226S1 (en) | 2012-06-29 | 2014-12-30 | Krones Ag | Bottle neck |
| DE102012105778A1 (de) | 2012-06-29 | 2014-03-20 | Krones Ag | Kunststoffbehältnis mit geradlinigen Mündungsbereichen |
| USD740124S1 (en) | 2012-10-17 | 2015-10-06 | Krones Ag | Bottle |
| USD705068S1 (en) | 2012-10-17 | 2014-05-20 | Krones Ag | Bottle bottom |
| USD705658S1 (en) | 2012-10-22 | 2014-05-27 | Krones Ag | Bottle bottom |
| US9022776B2 (en) | 2013-03-15 | 2015-05-05 | Graham Packaging Company, L.P. | Deep grip mechanism within blow mold hanger and related methods and bottles |
| US9254937B2 (en) | 2013-03-15 | 2016-02-09 | Graham Packaging Company, L.P. | Deep grip mechanism for blow mold and related methods and bottles |
| US20160137346A1 (en) * | 2014-11-18 | 2016-05-19 | Brandeis University | Drip free glass bottles and methods of making such bottles |
| WO2017035489A1 (en) * | 2015-08-27 | 2017-03-02 | Plastipak Packaging, Inc. | Plastic container and base portion for plastic container |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2541065A (en) * | 1944-12-30 | 1951-02-13 | Specialties Dev Corp | High-pressure container |
| US3038627A (en) * | 1960-05-31 | 1962-06-12 | Specialties Dev Corp | High-pressure container safety means |
| US3043461A (en) * | 1961-05-26 | 1962-07-10 | Purex Corp | Flexible plastic bottles |
| CH449446A (it) * | 1965-12-10 | 1967-12-31 | L M P Lavorazione Materie Plas | Bottiglia soffiata di materia plastica flessibile per liquidi sviluppanti una pressione interna |
| US3468443A (en) * | 1967-10-06 | 1969-09-23 | Apl Corp | Base of plastic container for storing fluids under pressure |
| US3598270A (en) * | 1969-04-14 | 1971-08-10 | Continental Can Co | Bottom end structure for plastic containers |
| US3643829A (en) * | 1969-08-22 | 1972-02-22 | Lever Brothers Ltd | Pressure-resistant plastics bottle |
-
1971
- 1971-06-15 US US00153268A patent/US3727783A/en not_active Expired - Lifetime
-
1972
- 1972-06-05 CA CA143,930A patent/CA949472A/en not_active Expired
- 1972-06-07 AU AU43205/72A patent/AU460886B2/en not_active Expired
- 1972-06-12 IT IT25573/72A patent/IT956483B/it active
- 1972-06-14 GB GB2781672A patent/GB1360107A/en not_active Expired
- 1972-06-14 BE BE784888A patent/BE784888A/xx not_active IP Right Cessation
- 1972-06-15 FR FR7221601A patent/FR2141963B1/fr not_active Expired
- 1972-06-15 DE DE19722229312 patent/DE2229312A1/de active Pending
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2950242A1 (de) * | 1979-01-10 | 1980-07-17 | Yoshino Kogyosho Co Ltd | Duennwandige kunststoff-flasche |
| DE3000785A1 (de) * | 1979-01-25 | 1980-07-31 | Yoshino Kogyosho Co Ltd | Duennwandige kunststoff-flasche |
| DE102017006510A1 (de) * | 2017-07-10 | 2018-09-06 | Michael Baumann | Kunststoffflasche |
Also Published As
| Publication number | Publication date |
|---|---|
| US3727783A (en) | 1973-04-17 |
| AU460886B2 (en) | 1975-04-21 |
| FR2141963B1 (enExample) | 1977-12-23 |
| IT956483B (it) | 1973-10-10 |
| FR2141963A1 (enExample) | 1973-01-26 |
| GB1360107A (en) | 1974-07-17 |
| AU4320572A (en) | 1973-12-13 |
| BE784888A (fr) | 1972-12-14 |
| CA949472A (en) | 1974-06-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2229312A1 (de) | Aus thermoplastischem Kunststoff bestehende Flasche mit nicht heraustretendem Boden | |
| DE2253448A1 (de) | Flasche aus thermoplastischem kunststoff mit einem sich nicht nach aussen vorwoelbenden boden | |
| DE3854903T2 (de) | Einteiliger, selbst-stehender, blasgeformter Kunststoffbehälter | |
| DE60217785T2 (de) | Flasche und Verfahren zur Herstellung derselben | |
| DE2252622A1 (de) | Flasche aus thermoplastischem kunststoff mit einem sich nicht nach aussen vorwoelbenden boden | |
| DE69500307T2 (de) | Geformte Flasche aus Kunststoff und Formwerkzeug dafür | |
| DE2817572C2 (de) | Verfahren zum Herstellen eines Behälters aus Polyäthylenterephthalat | |
| DE69925331T2 (de) | Kunststoffbehälter | |
| DE69404790T2 (de) | In axialer Richtung zerdrückbare Flasche aus Kunststoff und Werkzeug zur Herstellung einer solchen Flasche | |
| DE69023111T2 (de) | Flaschenrumpf aus kunststoff. | |
| DE69516506T2 (de) | Gerippter Kunststoffbehälter | |
| DE3223258A1 (de) | Druckfeste kunststoffflasche und verfahren zu ihrer herstellung | |
| DE2100053C2 (de) | Einstückig geformte Metalldose für unter Überdruck stehende Güter | |
| DE69825632T2 (de) | Blasgeformter freistehender behälter aus kunststoff | |
| AT510506B1 (de) | Bodenkonstruktion für eine kunststoffflasche | |
| DE69407609T2 (de) | Vorform mit verschluss | |
| DE2944160A1 (de) | Duennwandige flasche aus synthetischem harz und verfahren zu ihrer herstellung | |
| DE2551244A1 (de) | Kombinationsanordnung aus einer thermoplastischen flasche und einem haltenapf | |
| DD283978A5 (de) | Kunststoffflasche | |
| DE2807185A1 (de) | Hohlkoerper aus thermoplastischem kunststoff | |
| DE2009917B2 (de) | Behälter aus Kunststoff für unter erhöhtem Druck stehendes Füllgut, insb. Flasche | |
| CH660867A5 (de) | Behaelter sowie verfahren und vorrichtung zur herstellung desselben. | |
| CH707262A2 (de) | Kunststoffbehälter. | |
| EP3770073A1 (de) | Kunststoffbehältnis mit zugbandgeometrie am bodenbereich | |
| DE69004033T2 (de) | Eigenstabiler Boden für Druckflaschen. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHA | Expiration of time for request for examination |