DE2212694A1 - 1,2,3-triazolderivate und verfahren zu ihrer herstellung - Google Patents
1,2,3-triazolderivate und verfahren zu ihrer herstellungInfo
- Publication number
- DE2212694A1 DE2212694A1 DE19722212694 DE2212694A DE2212694A1 DE 2212694 A1 DE2212694 A1 DE 2212694A1 DE 19722212694 DE19722212694 DE 19722212694 DE 2212694 A DE2212694 A DE 2212694A DE 2212694 A1 DE2212694 A1 DE 2212694A1
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- atoms
- radical
- formula
- mmol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 9
- 150000000177 1,2,3-triazoles Chemical class 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 37
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 125000004442 acylamino group Chemical group 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims 4
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 125000001624 naphthyl group Chemical group 0.000 claims 1
- 125000005504 styryl group Chemical group 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 89
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 40
- 238000002844 melting Methods 0.000 description 23
- 230000008018 melting Effects 0.000 description 23
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- -1 5- (4-butoxyphenyl) -1,3,4-oxdiazole Chemical compound 0.000 description 15
- 238000003756 stirring Methods 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- 239000000460 chlorine Substances 0.000 description 10
- SYOANZBNGDEJFH-UHFFFAOYSA-N 2,5-dihydro-1h-triazole Chemical compound C1NNN=C1 SYOANZBNGDEJFH-UHFFFAOYSA-N 0.000 description 9
- 239000007795 chemical reaction product Substances 0.000 description 9
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 7
- 239000004744 fabric Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 6
- 238000006722 reduction reaction Methods 0.000 description 5
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 3
- 229910052759 nickel Inorganic materials 0.000 description 3
- 150000003852 triazoles Chemical class 0.000 description 3
- UBIAVBGIRDRQLD-UHFFFAOYSA-N 5-methyl-1,3-benzoxazole Chemical compound CC1=CC=C2OC=NC2=C1 UBIAVBGIRDRQLD-UHFFFAOYSA-N 0.000 description 2
- SZWNDAUMBWLYOQ-UHFFFAOYSA-N 6-methylbenzoxazole Chemical compound CC1=CC=C2N=COC2=C1 SZWNDAUMBWLYOQ-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- FKASFBLJDCHBNZ-UHFFFAOYSA-N 1,3,4-oxadiazole Chemical class C1=NN=CO1 FKASFBLJDCHBNZ-UHFFFAOYSA-N 0.000 description 1
- IAWQUHCVFXQBMC-UHFFFAOYSA-N 1,3-benzoxazol-5-amine Chemical compound NC1=CC=C2OC=NC2=C1 IAWQUHCVFXQBMC-UHFFFAOYSA-N 0.000 description 1
- ZJYIRVSPPOOPCL-UHFFFAOYSA-N 1,3-benzoxazol-6-amine Chemical compound NC1=CC=C2N=COC2=C1 ZJYIRVSPPOOPCL-UHFFFAOYSA-N 0.000 description 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- 150000000183 1,3-benzoxazoles Chemical class 0.000 description 1
- NJAVWPFYDSIIJM-UHFFFAOYSA-N 2-(2-methylphenyl)-1,3,4-oxadiazole Chemical compound CC1=CC=CC=C1C1=NN=CO1 NJAVWPFYDSIIJM-UHFFFAOYSA-N 0.000 description 1
- JQMHKLIYLYQITD-UHFFFAOYSA-N 2-(2-phenylethenyl)-1,3,4-oxadiazole Chemical compound N=1N=COC=1C=CC1=CC=CC=C1 JQMHKLIYLYQITD-UHFFFAOYSA-N 0.000 description 1
- PPPRLXXCIJKANA-UHFFFAOYSA-N 2-(3-chlorophenyl)-1,3,4-oxadiazole Chemical compound ClC1=CC=CC(C=2OC=NN=2)=C1 PPPRLXXCIJKANA-UHFFFAOYSA-N 0.000 description 1
- HNLLIIVZVPRWMQ-UHFFFAOYSA-N 2-(3-methoxyphenyl)-1,3,4-oxadiazole Chemical compound COC1=CC=CC(C=2OC=NN=2)=C1 HNLLIIVZVPRWMQ-UHFFFAOYSA-N 0.000 description 1
- UOBGZAIUFCZQFK-UHFFFAOYSA-N 2-(4-butylphenyl)-1,3,4-oxadiazole Chemical compound C1=CC(CCCC)=CC=C1C1=NN=CO1 UOBGZAIUFCZQFK-UHFFFAOYSA-N 0.000 description 1
- VMZKCSLEWSRRPN-UHFFFAOYSA-N 2-(4-ethoxyphenyl)-1,3,4-oxadiazole Chemical compound C1=CC(OCC)=CC=C1C1=NN=CO1 VMZKCSLEWSRRPN-UHFFFAOYSA-N 0.000 description 1
- QBXCAUWVKMECDN-UHFFFAOYSA-N 2-benzyl-1,3,4-oxadiazole Chemical compound C=1C=CC=CC=1CC1=NN=CO1 QBXCAUWVKMECDN-UHFFFAOYSA-N 0.000 description 1
- XHCHMADWQJKRLU-UHFFFAOYSA-N 2-butyl-1,3,4-oxadiazole Chemical compound CCCCC1=NN=CO1 XHCHMADWQJKRLU-UHFFFAOYSA-N 0.000 description 1
- DHNLWBALDJWTTH-UHFFFAOYSA-N 2-ethyl-1,3,4-oxadiazole Chemical compound CCC1=NN=CO1 DHNLWBALDJWTTH-UHFFFAOYSA-N 0.000 description 1
- ZMSIFDIKIXVLDF-UHFFFAOYSA-N 2-methyl-1,3,4-oxadiazole Chemical compound CC1=NN=CO1 ZMSIFDIKIXVLDF-UHFFFAOYSA-N 0.000 description 1
- JVDYWBQJOUXQBB-UHFFFAOYSA-N 2-nitro-1,3-benzoxazole Chemical compound C1=CC=C2OC([N+](=O)[O-])=NC2=C1 JVDYWBQJOUXQBB-UHFFFAOYSA-N 0.000 description 1
- ZEOMRHKTIYBETG-UHFFFAOYSA-N 2-phenyl-1,3,4-oxadiazole Chemical compound O1C=NN=C1C1=CC=CC=C1 ZEOMRHKTIYBETG-UHFFFAOYSA-N 0.000 description 1
- MBCRKINHIPMKHM-UHFFFAOYSA-N 5,6-diethyl-1,3-benzoxazole Chemical compound C1=C(CC)C(CC)=CC2=C1OC=N2 MBCRKINHIPMKHM-UHFFFAOYSA-N 0.000 description 1
- RWNMLYACWNIEIG-UHFFFAOYSA-N 5,6-dimethyl-1,3-benzoxazole Chemical compound C1=C(C)C(C)=CC2=C1OC=N2 RWNMLYACWNIEIG-UHFFFAOYSA-N 0.000 description 1
- LMZHSPFHCFMDRS-UHFFFAOYSA-N 5,7-dichloro-1,3-benzoxazole Chemical compound ClC1=CC(Cl)=C2OC=NC2=C1 LMZHSPFHCFMDRS-UHFFFAOYSA-N 0.000 description 1
- RKIWXFUQQLZKQH-UHFFFAOYSA-N 5-butyl-1,3-benzoxazole Chemical compound CCCCC1=CC=C2OC=NC2=C1 RKIWXFUQQLZKQH-UHFFFAOYSA-N 0.000 description 1
- KNEAFDRPEPJZOM-UHFFFAOYSA-N 5-chloro-7-nitro-1,3-benzoxazole Chemical compound [O-][N+](=O)C1=CC(Cl)=CC2=C1OC=N2 KNEAFDRPEPJZOM-UHFFFAOYSA-N 0.000 description 1
- YJJIVWWQMUDIFT-UHFFFAOYSA-N 6-ethyl-1,3-benzoxazole Chemical compound CCC1=CC=C2N=COC2=C1 YJJIVWWQMUDIFT-UHFFFAOYSA-N 0.000 description 1
- NNESGHWUVLNAML-UHFFFAOYSA-N 6-nitro-1,3-benzoxazole Chemical compound [O-][N+](=O)C1=CC=C2N=COC2=C1 NNESGHWUVLNAML-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- NAQXNIZTQJAFIJ-UHFFFAOYSA-N N-(1,3-benzoxazol-5-yl)acetamide Chemical compound C(C)(=O)NC=1C=CC2=C(N=CO2)C1 NAQXNIZTQJAFIJ-UHFFFAOYSA-N 0.000 description 1
- QHMFGKGQZVTCQB-UHFFFAOYSA-N N-(1,3-benzoxazol-6-yl)acetamide Chemical compound CC(=O)NC1=CC=C2N=COC2=C1 QHMFGKGQZVTCQB-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- WMUIZUWOEIQJEH-UHFFFAOYSA-N benzo[e][1,3]benzoxazole Chemical compound C1=CC=C2C(N=CO3)=C3C=CC2=C1 WMUIZUWOEIQJEH-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- NYONLFVSTRIQFN-UHFFFAOYSA-N ethyl 1,3-benzoxazole-5-carboxylate Chemical compound CCOC(=O)C1=CC=C2OC=NC2=C1 NYONLFVSTRIQFN-UHFFFAOYSA-N 0.000 description 1
- VHLBJWCXFIGALN-UHFFFAOYSA-N methyl 1,3-benzoxazole-5-carboxylate Chemical compound COC(=O)C1=CC=C2OC=NC2=C1 VHLBJWCXFIGALN-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- CHLCPTJLUJHDBO-UHFFFAOYSA-M sodium;benzenesulfinate Chemical compound [Na+].[O-]S(=O)C1=CC=CC=C1 CHLCPTJLUJHDBO-UHFFFAOYSA-M 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/04—Ortho- or ortho- and peri-condensed systems containing three rings
- C07C2603/22—Ortho- or ortho- and peri-condensed systems containing three rings containing only six-membered rings
- C07C2603/24—Anthracenes; Hydrogenated anthracenes
Landscapes
- Polyamides (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722212694 DE2212694A1 (de) | 1972-03-16 | 1972-03-16 | 1,2,3-triazolderivate und verfahren zu ihrer herstellung |
| NL7303356A NL7303356A (https=) | 1972-03-16 | 1973-03-09 | |
| JP48029124A JPS494720A (https=) | 1972-03-16 | 1973-03-14 | |
| IT21610/73A IT1045614B (it) | 1972-03-16 | 1973-03-14 | Derivati 1 2 3 triazolici e procediment per la loro preparazione |
| CA166,225A CA1000704A (en) | 1972-03-16 | 1973-03-15 | 1,2,3-triazole derivatives and process for preparing them |
| CH381773A CH603625A5 (https=) | 1972-03-16 | 1973-03-15 | |
| BE128914A BE796913R (fr) | 1972-03-16 | 1973-03-16 | 1,2,3-triazoles et leur preparation |
| FR7309487A FR2176145B2 (https=) | 1972-03-16 | 1973-03-16 | |
| GB1278073A GB1422047A (en) | 1972-03-16 | 1973-03-16 | 1,2,3-triazole compounds |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722212694 DE2212694A1 (de) | 1972-03-16 | 1972-03-16 | 1,2,3-triazolderivate und verfahren zu ihrer herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2212694A1 true DE2212694A1 (de) | 1973-09-20 |
Family
ID=5839084
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722212694 Withdrawn DE2212694A1 (de) | 1972-03-16 | 1972-03-16 | 1,2,3-triazolderivate und verfahren zu ihrer herstellung |
Country Status (9)
| Country | Link |
|---|---|
| JP (1) | JPS494720A (https=) |
| BE (1) | BE796913R (https=) |
| CA (1) | CA1000704A (https=) |
| CH (1) | CH603625A5 (https=) |
| DE (1) | DE2212694A1 (https=) |
| FR (1) | FR2176145B2 (https=) |
| GB (1) | GB1422047A (https=) |
| IT (1) | IT1045614B (https=) |
| NL (1) | NL7303356A (https=) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6727364B2 (en) * | 2001-04-30 | 2004-04-27 | The Procter & Gamble Company | Triazole compounds useful in treating diseases associated with unwanted cytokine activity |
| US6787555B2 (en) | 2001-04-30 | 2004-09-07 | The Procter & Gamble Company | Triazole compounds useful in treating diseases associated with unwanted cytokine activity |
-
1972
- 1972-03-16 DE DE19722212694 patent/DE2212694A1/de not_active Withdrawn
-
1973
- 1973-03-09 NL NL7303356A patent/NL7303356A/xx not_active Application Discontinuation
- 1973-03-14 JP JP48029124A patent/JPS494720A/ja active Pending
- 1973-03-14 IT IT21610/73A patent/IT1045614B/it active
- 1973-03-15 CH CH381773A patent/CH603625A5/xx not_active IP Right Cessation
- 1973-03-15 CA CA166,225A patent/CA1000704A/en not_active Expired
- 1973-03-16 FR FR7309487A patent/FR2176145B2/fr not_active Expired
- 1973-03-16 BE BE128914A patent/BE796913R/xx active
- 1973-03-16 GB GB1278073A patent/GB1422047A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IT1045614B (it) | 1980-06-10 |
| NL7303356A (https=) | 1973-09-18 |
| FR2176145A2 (https=) | 1973-10-26 |
| CH603625A5 (https=) | 1978-08-31 |
| JPS494720A (https=) | 1974-01-16 |
| CA1000704A (en) | 1976-11-30 |
| BE796913R (fr) | 1973-09-17 |
| FR2176145B2 (https=) | 1976-09-10 |
| GB1422047A (en) | 1976-01-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1924770C2 (de) | Basische Azoverbindungen, deren Herstellung und Verwendung | |
| DE1670394A1 (de) | Verfahren zur Herstellung heterocyclischer,Aethylendoppelbindungen enthaltender Verbindungen | |
| US4167628A (en) | Novel benzoxazole compounds | |
| DE1469227A1 (de) | Furanverbindungen | |
| EP0136259B1 (de) | 4-Heterocyclylvinyl-4'-styryl-biphenyle | |
| DE2212694A1 (de) | 1,2,3-triazolderivate und verfahren zu ihrer herstellung | |
| DE2749902A1 (de) | V-triazolyl- eckige klammer auf 4,5-d eckige klammer zu -pyrimidine | |
| US4482496A (en) | Stilbene compounds | |
| EP0027897A1 (de) | Quaternierte, verbrückte Benzimidazolyl-benzimidazole, Verfahren zu deren Herstellung und deren Verwendung | |
| EP0000346B1 (de) | Chinoxalinverbindungen, Verfahren zu deren Herstellung, deren Verwendung zum Weisstönen organischer Materialien und damit weissgetönte Materialien | |
| DE2525684A1 (de) | Neue stilbenverbindungen | |
| EP0020298B1 (de) | Benzoxazolyl-Stilbene, Verfahren zu ihrer Herstellung und ihre Verwendung zum optischen Aufhellen von organischen Materialien | |
| EP0002042A1 (de) | Diamino-1,3,5-triazinylstilbenverbindungen, Verfahren zu deren Herstellung und ihre Verwendung als optische Aufheller | |
| DE2535612A1 (de) | Neue stilbenverbindungen | |
| DE2712686A1 (de) | Fluoreszenz-farbstoffe | |
| DE1470242B2 (de) | 7-arenotriazolyl-3-phenyl-cumarine, deren herstellung und verwendung | |
| DE2331444A1 (de) | Neue styryl-benzoxazole, verfahren zu deren herstellung und ihre verwendung als optische aufhellungsmittel | |
| DE1670980A1 (de) | 1,3-Diphenylpyrazoline | |
| DE2300488A1 (de) | Vic-triazolverbindungen | |
| DE1942926A1 (de) | 4-Chlorpyrazolyl-Verbindungen | |
| DE2525683A1 (de) | Sulfogruppenhaltige heterocyclen | |
| DE2160780A1 (de) | Pyridino-pyrazole | |
| DE2833470A1 (de) | 1,3,4-oxadiazolon(2)-verbindungen und verfahren zu deren herstellung | |
| US4009994A (en) | Process and product of optical brightening with quaternized benzofuranyl-benzimidazoles | |
| DE2503439A1 (de) | Cumarinderivate, verfahren zu ihrer herstellung und ihre verwendung als optische aufheller |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| AF | Is addition to no. |
Ref country code: DE Ref document number: 2126839 Format of ref document f/p: P |
|
| 8130 | Withdrawal |