DE2211397B2 - 1,6-Dünethyl-lO a-methoxy-ergoline, ihre Herstellung und diese enthaltende Arzneimittel - Google Patents
1,6-Dünethyl-lO a-methoxy-ergoline, ihre Herstellung und diese enthaltende ArzneimittelInfo
- Publication number
- DE2211397B2 DE2211397B2 DE2211397A DE2211397A DE2211397B2 DE 2211397 B2 DE2211397 B2 DE 2211397B2 DE 2211397 A DE2211397 A DE 2211397A DE 2211397 A DE2211397 A DE 2211397A DE 2211397 B2 DE2211397 B2 DE 2211397B2
- Authority
- DE
- Germany
- Prior art keywords
- dimethyl
- methoxyergoline
- pyrroyl
- methyl
- oxymethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000004519 manufacturing process Methods 0.000 title description 3
- 229940126601 medicinal product Drugs 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- -1 alkyl sulfonic acid Chemical compound 0.000 description 6
- 230000000694 effects Effects 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- UCTWMZQNUQWSLP-UHFFFAOYSA-N adrenaline Chemical compound CNCC(O)C1=CC=C(O)C(O)=C1 UCTWMZQNUQWSLP-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- HESHRHUZIWVEAJ-JGRZULCMSA-N dihydroergotamine Chemical compound C([C@H]1C(=O)N2CCC[C@H]2[C@]2(O)O[C@@](C(N21)=O)(C)NC(=O)[C@H]1CN([C@H]2[C@@H](C3=CC=CC4=NC=C([C]34)C2)C1)C)C1=CC=CC=C1 HESHRHUZIWVEAJ-JGRZULCMSA-N 0.000 description 3
- 229960004704 dihydroergotamine Drugs 0.000 description 3
- 239000006260 foam Substances 0.000 description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 235000005985 organic acids Nutrition 0.000 description 3
- YYROPELSRYBVMQ-UHFFFAOYSA-N p-toluenesulfonyl chloride Substances CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- AWFDCTXCTHGORH-HGHGUNKESA-N 6-[4-[(6ar,9r,10ar)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carbonyl]piperazin-1-yl]-1-methylpyridin-2-one Chemical compound O=C([C@H]1CN([C@H]2[C@@H](C=3C=CC=C4NC(Br)=C(C=34)C2)C1)C)N(CC1)CCN1C1=CC=CC(=O)N1C AWFDCTXCTHGORH-HGHGUNKESA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000003880 polar aprotic solvent Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- WRHZVMBBRYBTKZ-UHFFFAOYSA-N pyrrole-2-carboxylic acid Chemical compound OC(=O)C1=CC=CN1 WRHZVMBBRYBTKZ-UHFFFAOYSA-N 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- KDYMOUGNHJDZKT-UHFFFAOYSA-N 1-butylpyrrole-2-carboxylic acid Chemical compound CCCCN1C=CC=C1C(O)=O KDYMOUGNHJDZKT-UHFFFAOYSA-N 0.000 description 1
- XCOJUFQICAEQEP-UHFFFAOYSA-N 1-ethylpyrrole-2-carboxylic acid Chemical compound CCN1C=CC=C1C(O)=O XCOJUFQICAEQEP-UHFFFAOYSA-N 0.000 description 1
- ILAOVOOZLVGAJF-UHFFFAOYSA-N 1-methylpyrrole-2-carboxylic acid Chemical compound CN1C=CC=C1C(O)=O ILAOVOOZLVGAJF-UHFFFAOYSA-N 0.000 description 1
- KAESVJOAVNADME-UHFFFAOYSA-N 1H-pyrrole Natural products C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 1
- WTMJHBZSSSDBFQ-UHFFFAOYSA-N 2,3,4-trimethyl-1h-pyrrole Chemical compound CC1=CNC(C)=C1C WTMJHBZSSSDBFQ-UHFFFAOYSA-N 0.000 description 1
- YBJBJOLFTYIFKP-UHFFFAOYSA-N 2-methyl-1h-pyrrole-3-carboxylic acid Chemical compound CC=1NC=CC=1C(O)=O YBJBJOLFTYIFKP-UHFFFAOYSA-N 0.000 description 1
- XQGVQRPSTODODM-UHFFFAOYSA-N 3,5-dimethyl-1h-pyrrole-2-carboxylic acid Chemical compound CC1=CC(C)=C(C(O)=O)N1 XQGVQRPSTODODM-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 208000001953 Hypotension Diseases 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000002908 adrenolytic effect Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 150000001804 chlorine Chemical class 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000004042 decolorization Methods 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- OFKDAAIKGIBASY-VFGNJEKYSA-N ergotamine Chemical compound C([C@H]1C(=O)N2CCC[C@H]2[C@]2(O)O[C@@](C(N21)=O)(C)NC(=O)[C@H]1CN([C@H]2C(C3=CC=CC4=NC=C([C]34)C2)=C1)C)C1=CC=CC=C1 OFKDAAIKGIBASY-VFGNJEKYSA-N 0.000 description 1
- 229960004943 ergotamine Drugs 0.000 description 1
- XCGSFFUVFURLIX-UHFFFAOYSA-N ergotaminine Natural products C1=C(C=2C=CC=C3NC=C(C=23)C2)C2N(C)CC1C(=O)NC(C(N12)=O)(C)OC1(O)C1CCCN1C(=O)C2CC1=CC=CC=C1 XCGSFFUVFURLIX-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 208000021822 hypotensive Diseases 0.000 description 1
- 230000001077 hypotensive effect Effects 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- BBFCIBZLAVOLCF-UHFFFAOYSA-N pyridin-1-ium;bromide Chemical compound Br.C1=CC=NC=C1 BBFCIBZLAVOLCF-UHFFFAOYSA-N 0.000 description 1
- DOYOPBSXEIZLRE-UHFFFAOYSA-N pyrrole-3-carboxylic acid Natural products OC(=O)C=1C=CNC=1 DOYOPBSXEIZLRE-UHFFFAOYSA-N 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 210000001625 seminal vesicle Anatomy 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 230000003033 spasmogenic effect Effects 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
- 201000010653 vesiculitis Diseases 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/02—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hydrocarbon or substituted hydrocarbon radicals, attached in position 8
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT2171371 | 1971-03-13 | ||
| IT3105971A IT1045256B (it) | 1971-11-13 | 1971-11-13 | Derivati del lumilisergolo |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2211397A1 DE2211397A1 (de) | 1972-09-21 |
| DE2211397B2 true DE2211397B2 (de) | 1978-03-16 |
| DE2211397C3 DE2211397C3 (show.php) | 1978-11-09 |
Family
ID=26327977
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2211397A Granted DE2211397B2 (de) | 1971-03-13 | 1972-03-09 | 1,6-Dünethyl-lO a-methoxy-ergoline, ihre Herstellung und diese enthaltende Arzneimittel |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3966739A (show.php) |
| JP (1) | JPS5133920B1 (show.php) |
| AT (1) | AT322119B (show.php) |
| AU (1) | AU461957B2 (show.php) |
| BE (1) | BE780473A (show.php) |
| CA (1) | CA967958A (show.php) |
| CH (1) | CH567505A5 (show.php) |
| DE (1) | DE2211397B2 (show.php) |
| DK (1) | DK140479B (show.php) |
| ES (1) | ES400683A1 (show.php) |
| FR (1) | FR2130140B1 (show.php) |
| GB (1) | GB1333024A (show.php) |
| HU (1) | HU163400B (show.php) |
| IE (1) | IE36207B1 (show.php) |
| IL (1) | IL38936A (show.php) |
| NL (1) | NL159384B (show.php) |
| NO (1) | NO127920B (show.php) |
| SE (1) | SE394281B (show.php) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2610864A1 (de) * | 1975-03-14 | 1976-09-30 | Siphar Sa | Carbamate von 2-halogenergolinen und 2-halogenergolenen und verfahren zu ihrer herstellung |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7400790A (show.php) * | 1973-02-02 | 1974-08-06 | ||
| JPS5316315U (show.php) * | 1976-07-22 | 1978-02-10 | ||
| YU40004B (en) * | 1977-07-21 | 1985-06-30 | Lek Tovarna Farmacevtskih | Praocess for preparing n-substituted esters of 9,10-dihydrlysergic acid |
| IT1094965B (it) * | 1978-04-05 | 1985-08-10 | Corvi Mora E | Procedimento di preparazione di derivati del lisergolo |
| JPS5823990U (ja) * | 1981-08-10 | 1983-02-15 | アイカ工業株式会社 | ドア用パネル板の構造 |
| EP2832233A1 (en) * | 2013-07-30 | 2015-02-04 | IMAX Discovery GmbH | 1H-pyrrole-2,4-dicarbonyl-derivatives and their use as flavoring agents |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3155667A (en) * | 1964-11-03 | Process for the preparation of | ||
| US3228943A (en) * | 1962-06-11 | 1966-01-11 | Lumilysergol derivatives | |
| GB1053507A (show.php) * | 1964-04-14 | |||
| US3418360A (en) * | 1964-12-14 | 1968-12-24 | Gulf Research Development Co | Esterification in the presence of alkanoic acid amides |
| FR1439953A (fr) * | 1965-01-28 | 1966-05-27 | Sandoz Sa | Nouveaux dérivés de l'ergolène et leur préparation |
| US3341575A (en) * | 1965-03-19 | 1967-09-12 | Union Oil Co | Preparation of esters from alkyl chlorides and carboxylic acid salts in the presenceof amide solvent and a soluble iodide compound |
| US3461156A (en) * | 1965-09-24 | 1969-08-12 | Union Oil Co | Process of preparating esters |
| US3551571A (en) * | 1967-05-19 | 1970-12-29 | Endo Lab | Methods for reducing pain,reducing fever and alleviating inflammatory syndromes with heteroaromatic pyrrol-3-yl ketones |
| DE1936410A1 (de) * | 1969-07-17 | 1971-02-11 | Hoechst Ag | O-Acyl-lysergole und Verfahren zu ihrer Herstellung |
-
1972
- 1972-03-03 NL NL7202845.A patent/NL159384B/xx not_active IP Right Cessation
- 1972-03-07 US US05/232,605 patent/US3966739A/en not_active Expired - Lifetime
- 1972-03-08 IL IL38936A patent/IL38936A/xx unknown
- 1972-03-08 IE IE293/72A patent/IE36207B1/xx unknown
- 1972-03-08 CA CA136,871A patent/CA967958A/en not_active Expired
- 1972-03-08 GB GB1069872A patent/GB1333024A/en not_active Expired
- 1972-03-09 DE DE2211397A patent/DE2211397B2/de active Granted
- 1972-03-09 FR FR7208204A patent/FR2130140B1/fr not_active Expired
- 1972-03-10 DK DK111172AA patent/DK140479B/da unknown
- 1972-03-10 AT AT202072A patent/AT322119B/de not_active IP Right Cessation
- 1972-03-10 CH CH358172A patent/CH567505A5/xx not_active IP Right Cessation
- 1972-03-10 NO NO00773/72*[A patent/NO127920B/no unknown
- 1972-03-10 BE BE780473A patent/BE780473A/xx not_active IP Right Cessation
- 1972-03-10 SE SE7203051A patent/SE394281B/xx unknown
- 1972-03-10 AU AU39871/72A patent/AU461957B2/en not_active Expired
- 1972-03-11 ES ES400683A patent/ES400683A1/es not_active Expired
- 1972-03-11 HU HUFA905A patent/HU163400B/hu unknown
- 1972-03-11 JP JP47024431A patent/JPS5133920B1/ja active Pending
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2610864A1 (de) * | 1975-03-14 | 1976-09-30 | Siphar Sa | Carbamate von 2-halogenergolinen und 2-halogenergolenen und verfahren zu ihrer herstellung |
Also Published As
| Publication number | Publication date |
|---|---|
| AU461957B2 (en) | 1975-06-12 |
| NL159384B (nl) | 1979-02-15 |
| SE394281B (sv) | 1977-06-20 |
| DK140479B (da) | 1979-09-10 |
| US3966739A (en) | 1976-06-29 |
| AT322119B (de) | 1975-05-12 |
| ES400683A1 (es) | 1975-07-16 |
| BE780473A (fr) | 1972-09-11 |
| CA967958A (en) | 1975-05-20 |
| IE36207B1 (en) | 1976-09-15 |
| FR2130140B1 (show.php) | 1975-08-01 |
| DE2211397A1 (de) | 1972-09-21 |
| FR2130140A1 (show.php) | 1972-11-03 |
| IL38936A0 (en) | 1972-05-30 |
| GB1333024A (en) | 1973-10-10 |
| DK140479C (show.php) | 1980-03-17 |
| NO127920B (show.php) | 1973-09-03 |
| NL7202845A (show.php) | 1972-09-15 |
| IL38936A (en) | 1975-04-25 |
| AU3987172A (en) | 1973-09-13 |
| JPS5133920B1 (show.php) | 1976-09-22 |
| CH567505A5 (show.php) | 1975-10-15 |
| IE36207L (en) | 1972-09-13 |
| HU163400B (show.php) | 1973-08-28 |
| DE2211397C3 (show.php) | 1978-11-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1620262A1 (de) | Verfahren zur Herstellung von neuen Spiro[4,5]decanderivaten | |
| DE2444322C3 (de) | 3,6,8-Substituierte s-Triazolo[4,3-b]pyridazine und Verfahren zu deren Herstellung | |
| DE1670048B2 (de) | Neue Norscopolaminderivate | |
| DE2854308A1 (de) | Anticholinergische substanzen mit antisekretorischer wirkung, ihre herstellung und verwendung | |
| DE2211397C3 (show.php) | ||
| AT391316B (de) | Neue thienyloxy-alkylamin-derivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE3223877C2 (show.php) | ||
| DE3025804C2 (de) | 1-S-Alkyl-2-0-acyl-3-phosphocholin-1-mercapto-2,3-propandiole, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel | |
| DE2425767A1 (de) | 3-alkyl-9-aminoalkyl-1,2,3,4-tetrahydrocarbazole und ihre verwendung in arzneimitteln | |
| DE2427272C3 (de) | 1-(2-(β-Naphthyloxy)-äthyl)-3-methyl -pyrazolon-(5), Verfahren sowie Verwendung als Antithrombotikum | |
| DE3689702T2 (de) | Dihydrolysergsäureester. | |
| DE2636866A1 (de) | Neue phenothiazinderivate und deren herstellung | |
| DE2221808C2 (de) | Hydrazinopyridazin-Derivate, deren Säureadditionssalze, Verfahren zu deren Herstellung und Heilmittel | |
| DE2611162C2 (show.php) | ||
| DE2165121C2 (de) | Cholin-Derivat, Verfahren zur Herstellung und Verwendung desselben | |
| DE2404924A1 (de) | Ergolinderivate | |
| DE69113901T2 (de) | Pyrazolo(1,5-a)pyridine, deren Herstellung und Verwendung. | |
| DE1695580C (de) | Quaternare Verbindungen des Benzil saure beta piperidino athylesters und ein Verfahren zu ihrer Herstellung | |
| AT369649B (de) | Verfahren zur bekaempfung von helminthenbefall bei haus- oder zuchttieren | |
| DE2134820A1 (de) | Verfahren zur Herstellung neuer heterocychscher Verbindungen | |
| DE2344510C3 (de) | Glycyrrhetinsäure-Derivate, Verfahren zu deren Herstellung und diese Verbindungen enthaltende pharmazeutische Zusammensetzungen | |
| DE1795740C2 (de) | 7-Chlor-7-deoxy-lincomycinderivate und pharmazeutischen Zusammensetzungen aus diesen Verbindungen und üblichen Trägerstoffen | |
| DE1543673C3 (de) | Basisch substituierte Benzofuranderivate und deren pharmazeutisch verträgliche Säureadditionssalze sowie Verfahren zu deren Herstellung und Arzneimittel mit einem Gehalt dieser Verbindungen | |
| DE2418805B2 (show.php) | ||
| DE1163845B (de) | Verfahren zur Herstellung von p-Alkylbenzyl-tropiniumderivaten. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |