DE2204842C2 - Rieselfähige nichtionogene Vormischung und ihre Verwendung in Grobwaschmitteln - Google Patents
Rieselfähige nichtionogene Vormischung und ihre Verwendung in GrobwaschmittelnInfo
- Publication number
- DE2204842C2 DE2204842C2 DE2204842A DE2204842A DE2204842C2 DE 2204842 C2 DE2204842 C2 DE 2204842C2 DE 2204842 A DE2204842 A DE 2204842A DE 2204842 A DE2204842 A DE 2204842A DE 2204842 C2 DE2204842 C2 DE 2204842C2
- Authority
- DE
- Germany
- Prior art keywords
- weight
- premix according
- sodium
- premix
- nonionic surfactant
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003599 detergent Substances 0.000 title claims description 42
- 239000002736 nonionic surfactant Substances 0.000 claims description 74
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 53
- 239000000203 mixture Substances 0.000 claims description 29
- 239000007788 liquid Substances 0.000 claims description 23
- 239000000126 substance Substances 0.000 claims description 14
- 159000000000 sodium salts Chemical class 0.000 claims description 13
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 claims description 12
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical class [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 12
- 229910021485 fumed silica Inorganic materials 0.000 claims description 8
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical class OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 claims description 8
- 238000002156 mixing Methods 0.000 claims description 7
- 239000001509 sodium citrate Substances 0.000 claims description 7
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 claims description 7
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 6
- 239000004471 Glycine Substances 0.000 claims description 6
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 claims description 6
- NBZBKCUXIYYUSX-UHFFFAOYSA-N iminodiacetic acid Chemical compound OC(=O)CNCC(O)=O NBZBKCUXIYYUSX-UHFFFAOYSA-N 0.000 claims description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 6
- 229940023144 sodium glycolate Drugs 0.000 claims description 6
- JEJAMASKDTUEBZ-UHFFFAOYSA-N tris(1,1,3-tribromo-2,2-dimethylpropyl) phosphate Chemical compound BrCC(C)(C)C(Br)(Br)OP(=O)(OC(Br)(Br)C(C)(C)CBr)OC(Br)(Br)C(C)(C)CBr JEJAMASKDTUEBZ-UHFFFAOYSA-N 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 239000005909 Kieselgur Substances 0.000 claims description 4
- 229920000877 Melamine resin Polymers 0.000 claims description 3
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 claims description 3
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 3
- LJCNRYVRMXRIQR-OLXYHTOASA-L potassium sodium L-tartrate Chemical compound [Na+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O LJCNRYVRMXRIQR-OLXYHTOASA-L 0.000 claims description 3
- 229940074439 potassium sodium tartrate Drugs 0.000 claims description 3
- 235000011006 sodium potassium tartrate Nutrition 0.000 claims description 3
- XSVSPKKXQGNHMD-UHFFFAOYSA-N 5-bromo-3-methyl-1,2-thiazole Chemical group CC=1C=C(Br)SN=1 XSVSPKKXQGNHMD-UHFFFAOYSA-N 0.000 claims description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 claims description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 claims description 2
- 150000001298 alcohols Chemical class 0.000 claims description 2
- 239000000600 sorbitol Substances 0.000 claims description 2
- 239000000843 powder Substances 0.000 description 23
- 239000000377 silicon dioxide Substances 0.000 description 15
- 229910004298 SiO 2 Inorganic materials 0.000 description 14
- 229910019142 PO4 Inorganic materials 0.000 description 13
- 235000021317 phosphate Nutrition 0.000 description 13
- 239000004094 surface-active agent Substances 0.000 description 11
- 239000000654 additive Substances 0.000 description 10
- 239000000969 carrier Substances 0.000 description 10
- 238000005406 washing Methods 0.000 description 10
- 238000000034 method Methods 0.000 description 9
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 9
- 239000010452 phosphate Substances 0.000 description 9
- 230000000996 additive effect Effects 0.000 description 7
- 235000012239 silicon dioxide Nutrition 0.000 description 6
- 238000007792 addition Methods 0.000 description 5
- 238000011068 loading method Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000000440 bentonite Substances 0.000 description 4
- 229910000278 bentonite Inorganic materials 0.000 description 4
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 4
- 239000007844 bleaching agent Substances 0.000 description 4
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 238000007711 solidification Methods 0.000 description 4
- 230000008023 solidification Effects 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 3
- 239000003945 anionic surfactant Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000012851 eutrophication Methods 0.000 description 3
- 229910021536 Zeolite Inorganic materials 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 230000001698 pyrogenic effect Effects 0.000 description 2
- 238000001694 spray drying Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 239000003643 water by type Substances 0.000 description 2
- 239000010457 zeolite Substances 0.000 description 2
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 description 1
- 229910002012 Aerosil® Inorganic materials 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 102000016462 Phosphate Transport Proteins Human genes 0.000 description 1
- 108091007643 Phosphate carriers Proteins 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 238000003915 air pollution Methods 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 229960004275 glycolic acid Drugs 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- -1 nitrogen-containing organic compounds Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 125000001477 organic nitrogen group Chemical group 0.000 description 1
- 239000011236 particulate material Substances 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 125000005624 silicic acid group Chemical class 0.000 description 1
- 239000005049 silicon tetrachloride Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- DZCAZXAJPZCSCU-UHFFFAOYSA-K sodium nitrilotriacetate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CC([O-])=O DZCAZXAJPZCSCU-UHFFFAOYSA-K 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000013042 solid detergent Substances 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 229960002920 sorbitol Drugs 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D11/00—Special methods for preparing compositions containing mixtures of detergents
- C11D11/0082—Special methods for preparing compositions containing mixtures of detergents one or more of the detergent ingredients being in a liquefied state, e.g. slurry, paste or melt, and the process resulting in solid detergent particles such as granules, powders or beads
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/66—Non-ionic compounds
- C11D1/72—Ethers of polyoxyalkylene glycols
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/124—Silicon containing, e.g. silica, silex, quartz or glass beads
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US11407371A | 1971-02-09 | 1971-02-09 | |
| US335873A US3915878A (en) | 1971-02-09 | 1973-02-26 | Free flowing nonionic surfactants |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2204842A1 DE2204842A1 (de) | 1972-08-24 |
| DE2204842C2 true DE2204842C2 (de) | 1987-11-12 |
Family
ID=26811801
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2204842A Expired DE2204842C2 (de) | 1971-02-09 | 1972-02-02 | Rieselfähige nichtionogene Vormischung und ihre Verwendung in Grobwaschmitteln |
Country Status (9)
| Country | Link |
|---|---|
| US (2) | US3769222A (enExample) |
| AT (1) | AT335026B (enExample) |
| AU (1) | AU464206B2 (enExample) |
| CA (1) | CA971071A (enExample) |
| CH (1) | CH567569A5 (enExample) |
| DE (1) | DE2204842C2 (enExample) |
| FR (1) | FR2124523B1 (enExample) |
| GB (1) | GB1369352A (enExample) |
| NL (1) | NL178263B (enExample) |
Families Citing this family (80)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3769222A (en) * | 1971-02-09 | 1973-10-30 | Colgate Palmolive Co | Free flowing nonionic surfactants |
| US3996149A (en) * | 1971-09-27 | 1976-12-07 | Burke Oliver W Jun | Detergent compositions and detergent adjuvant combinations thereof, and processes for forming the same |
| US4174291A (en) * | 1972-04-28 | 1979-11-13 | The Procter & Gamble Company | Crystallization seed-containing composition |
| JPS5147164B2 (enExample) * | 1972-07-17 | 1976-12-13 | ||
| US4049558A (en) * | 1972-07-25 | 1977-09-20 | Colgate-Palmolive Co. | Free flowing phosphate ester compositions for post addition to detergents |
| AT330930B (de) * | 1973-04-13 | 1976-07-26 | Henkel & Cie Gmbh | Verfahren zur herstellung von festen, schuttfahigen wasch- oder reinigungsmitteln mit einem gehalt an calcium bindenden substanzen |
| GB1485371A (en) * | 1973-10-01 | 1977-09-08 | Unilever Ltd | Detergent compositions |
| PH14036A (en) * | 1973-10-15 | 1980-12-12 | Procter & Gamble | Detergent composition and process |
| US4166039A (en) * | 1973-10-15 | 1979-08-28 | The Proctor & Gamble Company | Detergent composition and process |
| BE807132A (fr) * | 1973-11-09 | 1974-05-09 | Solvay | Premelanges destines a etre ajoutes par post-addition a des poudres detergentes |
| AT335030B (de) * | 1974-01-14 | 1977-02-25 | Henkel & Cie Gmbh | Verfahren zum waschen von textilien, sowie mittel zur durchfuhrung des verfahrens |
| AT373276B (de) * | 1974-02-25 | 1984-01-10 | Henkel Kgaa | Nichtionische tenside enthaltende schuettfaehige wasch- und reinigungsmittel |
| US4136051A (en) * | 1974-02-25 | 1979-01-23 | Henkel Kommanditgesellschaft Auf Aktien (Henkel Kgaa) | Pourable washing compositions containing a luminosilicates and non-ionics and method for their preparation |
| ES437284A1 (es) * | 1974-05-07 | 1977-07-01 | Colgate Palmolive Co | Un procedimiento mejorado para preparar composiciones deter-gentes secadas por pulverizacion que contienen silicatos de aluminio. |
| DE2431529C2 (de) * | 1974-07-01 | 1982-11-18 | Henkel KGaA, 4000 Düsseldorf | Verfahren zur Herstellung sprühgetrockneter, nichtionische Tenside enthaltender Waschmittel |
| US4055505A (en) * | 1974-07-12 | 1977-10-25 | Colgate-Palmolive Company | Activated percompound bleaching compositions |
| FR2281979A1 (fr) * | 1974-08-12 | 1976-03-12 | Sifrance Ste Silicates Speciau | Nouvelle composition detergente sous forme pulverulente et procede d'obtention |
| DE2538680A1 (de) * | 1974-09-06 | 1976-03-18 | Colgate Palmolive Co | Freifliessende waschmittelpulver |
| DE2540510A1 (de) * | 1974-09-13 | 1976-03-25 | Colgate Palmolive Co | Grobwaschmittel |
| DE2463384C3 (de) * | 1974-10-02 | 1987-12-03 | Degussa Ag, 6000 Frankfurt | Verwendung eines kristallinen Zeolithpulvers des Typs A als Phosphatersatz in Wasch- und Reinigungsmitteln |
| AT334491B (de) * | 1974-10-03 | 1976-01-25 | Henkel & Cie Gmbh | Schuttfahiges geruststoff-agglomerat fur wasch- und reinigungsmittel und verfahren zu dessen herstellung |
| ATA800274A (de) * | 1974-10-04 | 1983-12-15 | Henkel Kgaa | Verfahren zum waschen bzw. bleichen von textilien sowie mittel dazu |
| AT375394B (de) * | 1974-10-04 | 1984-07-25 | Henkel Kgaa | Verfahren zum waschen bzw. bleichen von textilien sowie mittel dazu |
| AT338948B (de) * | 1974-10-10 | 1977-09-26 | Henkel & Cie Gmbh | Pulverformige wasch- und reinigungsmittel und verfahren zu ihrer herstellung |
| US4056355A (en) * | 1974-12-23 | 1977-11-01 | Texaco Inc. | Detergent formulations and their use |
| JPS51126974A (en) * | 1975-04-30 | 1976-11-05 | Kao Corp | A process for producing granules containing viscous substances at high concentration |
| US4347152A (en) * | 1976-12-02 | 1982-08-31 | Colgate-Palmolive Company | Phosphate-free concentrated particulate heavy duty laundry detergent |
| US4666740A (en) * | 1976-12-02 | 1987-05-19 | The Colgate-Palmolive Co. | Phosphate-free concentrated particulate heavy duty laundry detergent |
| US4248911A (en) * | 1976-12-02 | 1981-02-03 | Colgate-Palmolive Company | Concentrated heavy duty particulate laundry detergent |
| US4411809A (en) * | 1976-12-02 | 1983-10-25 | Colgate Palmolive Company | Concentrated heavy duty particulate laundry detergent |
| US4260651A (en) * | 1976-12-02 | 1981-04-07 | Colgate-Palmolive Company | Phosphate-free concentrated particulate heavy duty laundry detergent |
| US4339335A (en) * | 1976-12-02 | 1982-07-13 | Colgate Palmolive Co. | Free flowing high bulk density particulate detergent-softener |
| US4663194A (en) * | 1976-12-02 | 1987-05-05 | The Colgate-Palmolive Co. | Phosphate-free concentrated particulate heavy duty laundry detergent |
| US4397777A (en) * | 1977-02-08 | 1983-08-09 | Colgate Palmolive Company | Heavy duty laundry detergent |
| JPS544908A (en) * | 1977-06-14 | 1979-01-16 | Kao Corp | Granular or powdery detergent composition with good fluidity |
| NZ188209A (en) * | 1977-09-12 | 1980-04-28 | Colgate Palmolive Co | Free-flowing, phosphate-free, particulate, heavy-duty laundry detergent |
| DE2753680C2 (de) * | 1977-12-02 | 1986-06-26 | Henkel KGaA, 4000 Düsseldorf | Verfahren zur Herstellung pulverförmiger, organische Siliciumpolymere enthaltender Waschmittel mit verbesserten Lösungseigenschaften |
| US4664817A (en) * | 1980-03-27 | 1987-05-12 | The Colgate-Palmolive Co. | Free flowing high bulk density particulate detergent-softener |
| US4666738A (en) * | 1980-09-02 | 1987-05-19 | The Colgate-Palmolive Co. | Method for making a phosphate containing concentrated heavy duty particulate laundry detergent |
| US4664950A (en) * | 1980-09-02 | 1987-05-12 | The Colgate Palmolive Co. | Concentrated heavy duty particulate laundry detergent |
| US4473485A (en) * | 1982-11-05 | 1984-09-25 | Lever Brothers Company | Free-flowing detergent powders |
| GB8322905D0 (en) * | 1983-08-25 | 1983-09-28 | Unilever Plc | Fabric-softening detergent compositions |
| GB8329880D0 (en) * | 1983-11-09 | 1983-12-14 | Unilever Plc | Particulate adjuncts |
| US5362413A (en) * | 1984-03-23 | 1994-11-08 | The Clorox Company | Low-temperature-effective detergent compositions and delivery systems therefor |
| US4741851A (en) * | 1984-04-02 | 1988-05-03 | Colgate Palmolive Co. | Non-caking bleaching detergent composition containing a lower hydrate of sodium perborate |
| GB8415302D0 (en) * | 1984-06-15 | 1984-07-18 | Unilever Plc | Fabric washing process |
| DE3424987A1 (de) * | 1984-07-06 | 1986-02-06 | Unilever N.V., Rotterdam | Verfahren zur herstellung eines pulverfoermigen waschmittels mit erhoehtem schuettgewicht |
| ES8607378A1 (es) * | 1984-08-06 | 1986-05-16 | Kao Corp | Una composicion detergente en polvo de gran densidad |
| GB2174712B (en) * | 1985-05-10 | 1988-10-19 | Unilever Plc | Detergent granules |
| US4661358A (en) * | 1985-08-23 | 1987-04-28 | Quali Tech, Inc. | Wort-sequestered divalent metal salts |
| GB2182051A (en) * | 1985-09-10 | 1987-05-07 | Interox Chemicals Ltd | Stabilisation of peroxyacids in detergent compositions containing nonionic surfactant |
| US4857223A (en) * | 1985-10-03 | 1989-08-15 | Colgate-Palmolive Company | Non-caking bleaching detergent composition containing a lower hydrate of sodium perborate |
| US4719181A (en) * | 1985-12-20 | 1988-01-12 | Warner-Lambert Company | Free flowing granular indicator material for peroxidase-like activity |
| EP0229671B1 (en) * | 1986-01-17 | 1991-03-13 | Kao Corporation | High-density granular detergent composition |
| US4960452A (en) * | 1988-04-22 | 1990-10-02 | Quali Tech, Inc. | Method of supplying nutrients to plants |
| US4919847A (en) * | 1988-06-03 | 1990-04-24 | Colgate Palmolive Co. | Process for manufacturing particulate detergent composition directly from in situ produced anionic detergent salt |
| GB8823008D0 (en) * | 1988-09-30 | 1988-11-09 | Unilever Plc | Composition for softening fabrics |
| DE3835918A1 (de) * | 1988-10-21 | 1990-04-26 | Henkel Kgaa | Verfahren zur herstellung von tensidhaltigen granulaten |
| FR2652818B1 (fr) * | 1989-10-09 | 1994-04-01 | Rhone Poulenc Chimie | Suspension de zeolite comprenant une resine silicone. |
| DE69112970T2 (de) * | 1990-09-28 | 1996-03-21 | Kao Corp | Nichtionische pulverförmige Detergentzusammensetzung. |
| GB9113675D0 (en) * | 1991-06-25 | 1991-08-14 | Unilever Plc | Particulate detergent composition or component |
| DE4127323A1 (de) * | 1991-08-20 | 1993-02-25 | Henkel Kgaa | Verfahren zur herstellung von tensidgranulaten |
| TW240243B (enExample) * | 1992-03-12 | 1995-02-11 | Kao Corp | |
| US5458799A (en) * | 1993-08-03 | 1995-10-17 | Amway Corporation | Mix process for formulating detergents |
| US5496486A (en) * | 1994-06-30 | 1996-03-05 | Amway Corporation | Process for increasing liquid surfactant loading in free flowing powder detergents |
| JP3810847B2 (ja) * | 1996-01-22 | 2006-08-16 | 花王株式会社 | 高密度粉末洗剤組成物 |
| US5714451A (en) * | 1996-03-15 | 1998-02-03 | Amway Corporation | Powder detergent composition and method of making |
| WO1997033957A1 (en) * | 1996-03-15 | 1997-09-18 | Amway Corporation | Powder detergent composition having improved solubility |
| AU2075097A (en) * | 1996-03-15 | 1997-10-01 | Amway Corporation | Discrete whitening agent particles, method of making, and powder detergent containing same |
| US5714450A (en) * | 1996-03-15 | 1998-02-03 | Amway Corporation | Detergent composition containing discrete whitening agent particles |
| US6177397B1 (en) | 1997-03-10 | 2001-01-23 | Amway Corporation | Free-flowing agglomerated nonionic surfactant detergent composition and process for making same |
| GB9711356D0 (en) † | 1997-05-30 | 1997-07-30 | Unilever Plc | Particulate detergent composition |
| GB9826105D0 (en) † | 1998-11-27 | 1999-01-20 | Unilever Plc | Detergent compositions |
| DE10105801B4 (de) * | 2001-02-07 | 2004-07-08 | Henkel Kgaa | Wasch- und Reinigungsmittel umfassend feine Mikropartikel mit Reinigungsmittelbestandteilen |
| DE102005018925A1 (de) * | 2005-04-22 | 2006-10-26 | Henkel Kgaa | Wasch- oder Reinigungsmittel |
| DE102007034540A1 (de) * | 2007-07-20 | 2009-01-22 | Henkel Ag & Co. Kgaa | Bügel-Pad mit fester Fleckbehandlungszusammensetzung |
| AU2019211453B2 (en) | 2018-01-26 | 2021-10-14 | Ecolab Usa Inc. | Solidifying liquid amine oxide, betaine, and/or sultaine surfactants with a binder and optional carrier |
| US11214763B2 (en) | 2018-01-26 | 2022-01-04 | Ecolab Usa Inc. | Solidifying liquid amine oxide, betaine, and/or sultaine surfactants with a carrier |
| CN111655830A (zh) | 2018-01-26 | 2020-09-11 | 埃科莱布美国股份有限公司 | 固化液体阴离子表面活性剂 |
| CN114245821A (zh) | 2019-09-06 | 2022-03-25 | 巴斯夫欧洲公司 | 固体表面活性剂组合物 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE744810C (de) * | 1942-08-01 | 1944-06-10 | Henkel & Cie Gmbh | Streufaehige wasserloesliche Mischungen aus in reiner Form nicht streufaehigen kapillaraktiven Verbindungen |
| GB807640A (en) * | 1956-03-29 | 1959-01-21 | Degussa | Detergent in powder form with a base of non-ionic detergent components |
| DE1098132B (de) * | 1959-01-14 | 1961-01-26 | Budenheim Rud A Oetker Chemie | Verfahren zur Herstellung von Wasch-, Reinigungs-, Spuel- und Entfettungsmitteln in Plverform |
| DE1107870B (de) * | 1959-01-22 | 1961-05-31 | Budenheim Rud A Oetker Chemie | Verfahren zur Herstellung von nicht staeubenden Wasch-, Reinigungs-, Spuel- und Entfettungsmitteln |
| US3337463A (en) * | 1963-10-18 | 1967-08-22 | Wyandotte Chemicals Corp | Foaming detergent compositions |
| GB1211228A (en) * | 1967-06-24 | 1970-11-04 | Ici Ltd | Sodium perborate compositions |
| DE1812352C3 (de) * | 1968-12-03 | 1974-07-04 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Überführung flüssiger Antioxidantien in Pulverform |
| US3562171A (en) * | 1968-12-31 | 1971-02-09 | Procter & Gamble | Oxygen carrier for detergent compositions |
| US3666670A (en) * | 1969-08-01 | 1972-05-30 | Vulcan Materials Co | Pulverulent drain cleaning composition |
| US3769222A (en) * | 1971-02-09 | 1973-10-30 | Colgate Palmolive Co | Free flowing nonionic surfactants |
-
1971
- 1971-02-09 US US00114073A patent/US3769222A/en not_active Expired - Lifetime
-
1972
- 1972-01-31 GB GB442272A patent/GB1369352A/en not_active Expired
- 1972-02-02 DE DE2204842A patent/DE2204842C2/de not_active Expired
- 1972-02-02 CA CA133,787A patent/CA971071A/en not_active Expired
- 1972-02-07 FR FR7203954A patent/FR2124523B1/fr not_active Expired
- 1972-02-07 CH CH171472A patent/CH567569A5/xx not_active IP Right Cessation
- 1972-02-07 AU AU38759/72A patent/AU464206B2/en not_active Expired
- 1972-02-08 AT AT99672*#A patent/AT335026B/de not_active IP Right Cessation
- 1972-02-09 NL NLAANVRAGE7201725,A patent/NL178263B/xx not_active Application Discontinuation
-
1973
- 1973-02-26 US US335873A patent/US3915878A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE2204842A1 (de) | 1972-08-24 |
| AU3875972A (en) | 1973-08-09 |
| AU464206B2 (en) | 1975-08-01 |
| NL7201725A (enExample) | 1972-08-11 |
| FR2124523A1 (enExample) | 1972-09-22 |
| FR2124523B1 (enExample) | 1976-07-30 |
| US3915878A (en) | 1975-10-28 |
| CA971071A (en) | 1975-07-15 |
| NL178263B (nl) | 1985-09-16 |
| US3769222A (en) | 1973-10-30 |
| AT335026B (de) | 1977-02-25 |
| GB1369352A (en) | 1974-10-02 |
| CH567569A5 (enExample) | 1975-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2204842C2 (de) | Rieselfähige nichtionogene Vormischung und ihre Verwendung in Grobwaschmitteln | |
| DE2820990C2 (enExample) | ||
| EP0536110B1 (de) | Verfahren zur herstellung von oberflächenaktive mittel enthaltenden granulaten | |
| DE2753026C2 (enExample) | ||
| DE2549337C2 (de) | Verfahren zur Herstellung von Alumosilikat enthaltenden Waschmittelgranulaten | |
| DE1280456B (de) | Pulverfoermiges Reinigungs- und/oder Scheuermittel und Verfahren zu seiner Herstellung | |
| DE2439541A1 (de) | Koernige waschmittelzusammensetzung | |
| DE3141066C2 (enExample) | ||
| DE2736903C2 (de) | Unlösliche Waschmittel-Gerüststoffe in Form leicht zerfallender Agglomeratteilchen sowie diese enthaltende Waschmittel | |
| DE2234903A1 (de) | Freifliessende waschmittelmischung | |
| DE2843390C2 (enExample) | ||
| DE3036325C2 (enExample) | ||
| DE2535792B2 (de) | Reinigungs- und Waschmittel | |
| DE3531755A1 (de) | Verfahren zum stabilisieren von schmutzloesungsfoerdernden polymeren | |
| EP0185660B1 (de) | Stabilisierte, wässrige zeolith-suspension | |
| DE1074187B (de) | Thixotropes, flüssiges Reinigungsmittel | |
| DE2907791A1 (de) | Reinigungsmittel und verfahren zu ihrer herstellung | |
| CH631949A5 (de) | Kristallines zeolithpulver des typs a. | |
| CH631948A5 (de) | Kristallines zeolithpulver des typs a. | |
| DE3720277C2 (enExample) | ||
| DE2161699B2 (de) | Wasch- und Reinigungsmittel | |
| DE4038476A1 (de) | Feste waschmittel | |
| WO1992017565A1 (de) | Niederalkalische, chlor- und phosphatfreie maschinengeschirrspülmittel in form von schwerpulvern und -granulaten | |
| DE2536594A1 (de) | Traegerkoerner fuer nichtionische detergentien | |
| DE2451835A1 (de) | Vormischungen fuer die nachtraegliche zugabe zu reinigungsmittelpulvern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8366 | Restricted maintained after opposition proceedings | ||
| 8305 | Restricted maintenance of patent after opposition | ||
| D4 | Patent maintained restricted | ||
| 8339 | Ceased/non-payment of the annual fee |