DE2166657C2 - - Google Patents
Info
- Publication number
- DE2166657C2 DE2166657C2 DE2166657A DE2166657A DE2166657C2 DE 2166657 C2 DE2166657 C2 DE 2166657C2 DE 2166657 A DE2166657 A DE 2166657A DE 2166657 A DE2166657 A DE 2166657A DE 2166657 C2 DE2166657 C2 DE 2166657C2
- Authority
- DE
- Germany
- Prior art keywords
- parts
- general formula
- benzodiazepine
- chloro
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 239000011630 iodine Substances 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- CQTKONQMSBMSLG-UHFFFAOYSA-N 1-(bromomethyl)-8-chloro-6-phenyl-4h-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine Chemical compound C=1C(Cl)=CC=C(N2C(CBr)=NN=C2CN=2)C=1C=2C1=CC=CC=C1 CQTKONQMSBMSLG-UHFFFAOYSA-N 0.000 claims 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- -1 C1-C3 alkyl radical Chemical group 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- GUJAGMICFDYKNR-UHFFFAOYSA-N 1,4-benzodiazepine Chemical compound N1C=CN=CC2=CC=CC=C12 GUJAGMICFDYKNR-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 235000019441 ethanol Nutrition 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000003377 acid catalyst Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- KYTREVLPRJOBEM-UHFFFAOYSA-N triazolo[4,5-i][1,2]benzodiazepine Chemical class C1=CC2=CC=CN=NC2=C2C1=NN=N2 KYTREVLPRJOBEM-UHFFFAOYSA-N 0.000 description 2
- LGNWUMGEJQAWQD-UHFFFAOYSA-N 1h-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine Chemical class N1=CC2=CC=CC=C2N2CN=NC2=C1 LGNWUMGEJQAWQD-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229940125681 anticonvulsant agent Drugs 0.000 description 1
- 239000001961 anticonvulsive agent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229940049706 benzodiazepine Drugs 0.000 description 1
- 150000001557 benzodiazepines Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000004970 halomethyl group Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000003326 hypnotic agent Substances 0.000 description 1
- 230000000147 hypnotic effect Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 229940125723 sedative agent Drugs 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000003204 tranquilizing agent Substances 0.000 description 1
- 230000002936 tranquilizing effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP45110716A JPS4932874B1 (enExample) | 1970-12-11 | 1970-12-11 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2166657A1 DE2166657A1 (de) | 1975-01-23 |
| DE2166657C2 true DE2166657C2 (enExample) | 1988-10-20 |
Family
ID=14542652
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712166657 Granted DE2166657A1 (de) | 1970-12-11 | 1971-11-30 | Neue triazolbenzodiazepinderivate und verfahren zu ihrer herstellung |
| DE19712159242 Granted DE2159242A1 (de) | 1970-12-11 | 1971-11-30 | Neue Triazolbenzodiazepinderivate und Verfahren zu ihrer Herstellung |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712159242 Granted DE2159242A1 (de) | 1970-12-11 | 1971-11-30 | Neue Triazolbenzodiazepinderivate und Verfahren zu ihrer Herstellung |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4235775A (enExample) |
| JP (1) | JPS4932874B1 (enExample) |
| AT (2) | AT315858B (enExample) |
| AU (1) | AU453008B2 (enExample) |
| BE (1) | BE776514A (enExample) |
| CA (1) | CA975363A (enExample) |
| CH (2) | CH569735A5 (enExample) |
| DE (2) | DE2166657A1 (enExample) |
| DK (1) | DK141996B (enExample) |
| ES (1) | ES397845A1 (enExample) |
| FI (1) | FI53128C (enExample) |
| FR (1) | FR2118028B1 (enExample) |
| GB (2) | GB1374470A (enExample) |
| HU (1) | HU164524B (enExample) |
| NL (1) | NL173523C (enExample) |
| NO (1) | NO132933C (enExample) |
| PH (1) | PH10822A (enExample) |
| YU (1) | YU35141B (enExample) |
| ZA (1) | ZA718044B (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4141902A (en) * | 1971-04-28 | 1979-02-27 | The Upjohn Company | 1-Halomethyl-6-phenyl-4H-s-[4,3-a][1,4]benzodiazepines |
| GB1331015A (en) * | 1971-04-28 | 1973-09-19 | Upjohn Co | 1-substituted-6-phenyl-4h-s-triazolo-4,3-a-1,4-benzodiazepines |
| GB1377230A (en) * | 1971-09-13 | 1974-12-11 | Upjohn Co | 4h-s-triazolo -4,3-a- 1,4-benzodiazepines |
| US3842090A (en) * | 1973-02-14 | 1974-10-15 | Upjohn Co | Certain 1-aminomethyl-6-phenyl 4h-s-triazolo(4,3-a)(1,4)benzodiazepines |
| US3894025A (en) * | 1974-03-21 | 1975-07-08 | Upjohn Co | 1-Piperazino-6-phenyl-4H-s-triazolo{8 4,3-a{9 {8 1,4{9 -benzodiazepine compounds |
| CA1055490A (en) * | 1974-06-19 | 1979-05-29 | Upjohn Company (The) | Process for preparing triazolobenzodiazepines |
| ZA755418B (en) * | 1974-09-11 | 1977-06-29 | Hoffmann La Roche | Diazepine derivatives |
| US4021441A (en) * | 1975-04-07 | 1977-05-03 | The Upjohn Company | 1-[(Allylamino)-methyl]-6-phenyl-4H-s-triazolo[4,3-a][1,4]benzodiazepines |
| SE422580B (sv) * | 1975-08-07 | 1982-03-15 | Hoffmann La Roche | Analogiforfarande for framstellning av imidazo (1,5-a)(1,4)diazepin-foreningar |
| US4009175A (en) * | 1976-03-15 | 1977-02-22 | The Upjohn Company | 1-[(Aminooxy)-methyl]-6-substituted-4H-s-triazolo[4,3-a][1,4] benzodiazepines |
| US4510141A (en) * | 1982-09-13 | 1985-04-09 | Ciba-Geigy Corporation | Tricyclic polyazaheterocycles for treating depression or anxiety |
| US4663454A (en) * | 1985-04-17 | 1987-05-05 | The Upjohn Company | Process to prepare α-chloroalprazolam |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI50981C (fi) * | 1968-11-05 | 1976-09-10 | Takeda Chemical Industries Ltd | Menetelmä unilääkkeinä ja rauhoittavina lääkkeinä vaikuttavien s-triat solo-(4,3-a)(1,4)-bentsodiatsepiinien valmistamiseksi. |
| FR2022598A1 (en) * | 1969-11-04 | 1970-07-31 | Pakeda Chemical Ind | Sedative chloro-phenyl-triazolobenzodiazepines |
| US3681343A (en) * | 1971-05-11 | 1972-08-01 | Upjohn Co | 6-phenyl-s-triazolo{8 4,3-a{9 {8 1,4{9 {0 benzodiazepines |
-
1970
- 1970-12-11 JP JP45110716A patent/JPS4932874B1/ja active Pending
-
1971
- 1971-11-29 NO NO4384/71A patent/NO132933C/no unknown
- 1971-11-30 DE DE19712166657 patent/DE2166657A1/de active Granted
- 1971-11-30 DE DE19712159242 patent/DE2159242A1/de active Granted
- 1971-11-30 ZA ZA718044A patent/ZA718044B/xx unknown
- 1971-12-06 PH PH13074A patent/PH10822A/en unknown
- 1971-12-08 NL NLAANVRAGE7116874,A patent/NL173523C/xx not_active IP Right Cessation
- 1971-12-09 FI FI3513/71A patent/FI53128C/fi active
- 1971-12-09 CH CH1796171A patent/CH569735A5/xx not_active IP Right Cessation
- 1971-12-09 YU YU3094/71A patent/YU35141B/xx unknown
- 1971-12-09 GB GB2027774A patent/GB1374470A/en not_active Expired
- 1971-12-09 GB GB5719171A patent/GB1374469A/en not_active Expired
- 1971-12-09 CH CH1552974A patent/CH567022A5/xx not_active IP Right Cessation
- 1971-12-10 DK DK603471AA patent/DK141996B/da not_active IP Right Cessation
- 1971-12-10 FR FR7144501A patent/FR2118028B1/fr not_active Expired
- 1971-12-10 CA CA129,850A patent/CA975363A/en not_active Expired
- 1971-12-10 AT AT481273A patent/AT315858B/de not_active IP Right Cessation
- 1971-12-10 BE BE776514A patent/BE776514A/xx not_active IP Right Cessation
- 1971-12-10 ES ES397845A patent/ES397845A1/es not_active Expired
- 1971-12-10 AT AT1064071A patent/AT315181B/de not_active IP Right Cessation
- 1971-12-11 HU HUTA1154A patent/HU164524B/hu unknown
- 1971-12-13 AU AU36802/71A patent/AU453008B2/en not_active Expired
-
1979
- 1979-06-15 US US06/049,055 patent/US4235775A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| ES397845A1 (es) | 1975-05-16 |
| PH10822A (en) | 1977-09-08 |
| NL173523B (nl) | 1983-09-01 |
| DK141996B (da) | 1980-08-04 |
| AT315181B (de) | 1974-05-10 |
| DE2159242C2 (enExample) | 1988-01-28 |
| FR2118028B1 (enExample) | 1975-06-13 |
| DK141996C (enExample) | 1980-12-15 |
| NL7116874A (enExample) | 1972-06-13 |
| AU3680271A (en) | 1973-06-14 |
| YU309471A (en) | 1980-03-15 |
| GB1374469A (en) | 1974-11-20 |
| ZA718044B (en) | 1972-08-30 |
| FI53128C (enExample) | 1978-02-10 |
| US4235775A (en) | 1980-11-25 |
| NO132933C (enExample) | 1976-02-04 |
| CA975363A (en) | 1975-09-30 |
| DE2166657A1 (de) | 1975-01-23 |
| GB1374470A (en) | 1974-11-20 |
| CH567022A5 (enExample) | 1975-09-30 |
| FR2118028A1 (enExample) | 1972-07-28 |
| YU35141B (en) | 1980-09-25 |
| CH569735A5 (enExample) | 1975-11-28 |
| NL173523C (nl) | 1984-02-01 |
| DE2159242A1 (de) | 1972-12-07 |
| AT315858B (de) | 1974-06-10 |
| FI53128B (enExample) | 1977-10-31 |
| BE776514A (fr) | 1972-04-04 |
| JPS4932874B1 (enExample) | 1974-09-03 |
| NO132933B (enExample) | 1975-10-27 |
| HU164524B (enExample) | 1974-02-28 |
| AU453008B2 (en) | 1974-09-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2166657C2 (enExample) | ||
| DE2147023A1 (de) | Verfahren zur herstellung von 1htetrazol-verbindungen | |
| CH532065A (de) | Verfahren zur Herstellung von Benzodiazepinderivaten | |
| CH520680A (de) | Verfahren zur Herstellung neuer Mutterkornpeptidalkaloide | |
| DE2308305A1 (de) | Verfahren zur herstellung von 4-hydroxy-3-(5-methyl-3-isoxazolylcarbamoyl)2-methyl-2h-1,2-benzothiazin-1,1-dioxid | |
| DE69216143T2 (de) | Prozess und 2-(Cyanoimino)-Quinazlin-Zwischenprodukte zur Herstellung von 6,7-Di(Chloro)-1,5-Di(Hydro)-Imidazo-[2,1-b]Quinazolin-2[3H]-on sowie Prozess zur Darstellung der 2-(Cyanoimino)Quinazolin | |
| DE2934746A1 (de) | Oxoimidazolinalkansaeuren, deren salze und ester sowie verfahren zu ihrer herstellung und diese enthaltende arzneimittel | |
| CH497436A (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| DD228811A1 (de) | Verfahren zur herstellung von neuen triazolopyrimidinen | |
| EP0472166A1 (de) | Tricyclische Pyridonderivate | |
| DE1944404C3 (de) | Verfahren zur Herstellung von 5-Phenyl-l,3-dihydro-2H-l,4-benzodiazepin-2-on-derivaten | |
| DE2521326A1 (de) | Neue thienodiazepinderivate, verfahren zur herstellung derselben und diese enthaltende pharmazeutische mittel | |
| DE1695554C3 (de) | Verfahren zur Herstellung kondensierter Piperazinonderivate | |
| DE2438077A1 (de) | Verfahren zur herstellung von propanolaminderivaten und nach dem verfahren hergestellte propanolaminderivate | |
| EP0152598A1 (de) | Cyanomethyl-(2-cyano-ethyl)-(3-hydroxy-propyl)-amin, seine Verwendung zur Herstellung von 1-(3-Hydroxy-propyl)-1,4-diazepan und 1,4 Bis-[3-(3,4,5-trimethoxy-benzoyloxy)-propyl]-diazepan | |
| US3221050A (en) | 2-cycloalkylcarbonylamido-5-halobenzophenones | |
| DE2406490A1 (de) | 1,4-dihydro-3(2h)-isochinolinonverbindungen und ihre salze sowie ihre verwendung und verfahren zur herstellung derselben | |
| AT270630B (de) | Verfahren zur Herstellung von neuen Pyrrolinderivaten und ihren Salzen | |
| AT261620B (de) | Verfahren zur Herstellung von neuen 4,1-Benzothiazepinverbindungen sowie von deren Säureadditionssalzen | |
| AT371445B (de) | Verfahren zur herstellung von neuen cis-4a-phenyl-isochinolinderivaten und ihren saeureadditionssalzen | |
| AT384221B (de) | Verfahren zur herstellung von neuen 3-substituierten tetrahydro-pyrrolo(1,2-a) pyrimidin-derivaten sowie von deren saeureadditions- und quaternaeren salzen | |
| AT266838B (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| AT332876B (de) | Verfahren zur herstellung von neuen benzodiazepin-derivaten | |
| CH632254A5 (de) | Verfahren zur herstellung von neuen benzodiazepinderivaten. | |
| CH615435A5 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| Q176 | The application caused the suspense of an application |
Ref document number: 2220612 Country of ref document: DE |
|
| AC | Divided out of |
Ref country code: DE Ref document number: 2159242 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |