DE2163115A1 - Neue Cyclopentanheptansäure-Derivate - Google Patents
Neue Cyclopentanheptansäure-DerivateInfo
- Publication number
- DE2163115A1 DE2163115A1 DE19712163115 DE2163115A DE2163115A1 DE 2163115 A1 DE2163115 A1 DE 2163115A1 DE 19712163115 DE19712163115 DE 19712163115 DE 2163115 A DE2163115 A DE 2163115A DE 2163115 A1 DE2163115 A1 DE 2163115A1
- Authority
- DE
- Germany
- Prior art keywords
- hydroxy
- parts
- acid
- oxocyclopent
- solution
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- YPKDXXUBAYLACD-UHFFFAOYSA-N 7-cyclopentylheptanoic acid Chemical class OC(=O)CCCCCCC1CCCC1 YPKDXXUBAYLACD-UHFFFAOYSA-N 0.000 title description 3
- 239000002253 acid Substances 0.000 claims description 22
- 150000001875 compounds Chemical class 0.000 claims description 20
- -1 (3R) -3-hydroxy-1-octynyl Chemical group 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 39
- 239000000243 solution Substances 0.000 description 34
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 33
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- 239000000203 mixture Substances 0.000 description 24
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 22
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 15
- 238000000034 method Methods 0.000 description 14
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- 241001465754 Metazoa Species 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- 239000010410 layer Substances 0.000 description 9
- 230000003287 optical effect Effects 0.000 description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- 238000010521 absorption reaction Methods 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 6
- 230000008033 biological extinction Effects 0.000 description 6
- 230000008602 contraction Effects 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- OMIHGPLIXGGMJB-UHFFFAOYSA-N 7-oxabicyclo[4.1.0]hepta-1,3,5-triene Chemical compound C1=CC=C2OC2=C1 OMIHGPLIXGGMJB-UHFFFAOYSA-N 0.000 description 5
- 239000012044 organic layer Substances 0.000 description 5
- 210000001519 tissue Anatomy 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 208000025865 Ulcer Diseases 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 150000003180 prostaglandins Chemical class 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- HEWZVZIVELJPQZ-UHFFFAOYSA-N 2,2-dimethoxypropane Chemical compound COC(C)(C)OC HEWZVZIVELJPQZ-UHFFFAOYSA-N 0.000 description 3
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000036772 blood pressure Effects 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000008246 gaseous mixture Substances 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- VUGRNZHKYVHZSN-UHFFFAOYSA-N oct-1-yn-3-ol Chemical compound CCCCCC(O)C#C VUGRNZHKYVHZSN-UHFFFAOYSA-N 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 231100000397 ulcer Toxicity 0.000 description 3
- YNXXIKVLODBVEE-UHFFFAOYSA-N 7-(2,3,5-trioxocyclopentyl)heptanoic acid Chemical compound OC(=O)CCCCCCC1C(=O)CC(=O)C1=O YNXXIKVLODBVEE-UHFFFAOYSA-N 0.000 description 2
- ASUMHSZQZHAHEA-UHFFFAOYSA-N 7-(3-hydroxy-2,5-dioxocyclopentyl)heptanoic acid Chemical compound OC1CC(=O)C(CCCCCCC(O)=O)C1=O ASUMHSZQZHAHEA-UHFFFAOYSA-N 0.000 description 2
- LVXPDCZDLYJCST-UHFFFAOYSA-N 7-(4-hydroxy-2-methoxy-5-oxocyclopenten-1-yl)heptanoic acid Chemical compound COC1=C(CCCCCCC(O)=O)C(=O)C(O)C1 LVXPDCZDLYJCST-UHFFFAOYSA-N 0.000 description 2
- KJVGRMSHFZTJRL-UHFFFAOYSA-N 7-[3-hydroxy-2-(3-hydroxyoct-1-ynyl)-5-oxocyclopenten-1-yl]heptanoic acid Chemical compound OC1C(=C(C(C1)=O)CCCCCCC(=O)O)C#CC(CCCCC)O KJVGRMSHFZTJRL-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- BYFKKNYEIXWOQO-UHFFFAOYSA-N 9-oxo capric acid Chemical compound CC(=O)CCCCCCCC(O)=O BYFKKNYEIXWOQO-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- 241001631457 Cannula Species 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- XJUZRXYOEPSWMB-UHFFFAOYSA-N Chloromethyl methyl ether Chemical compound COCCl XJUZRXYOEPSWMB-UHFFFAOYSA-N 0.000 description 2
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 239000007818 Grignard reagent Substances 0.000 description 2
- LOMVENUNSWAXEN-UHFFFAOYSA-N Methyl oxalate Chemical compound COC(=O)C(=O)OC LOMVENUNSWAXEN-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 230000000026 anti-ulcerogenic effect Effects 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 229940061627 chloromethyl methyl ether Drugs 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000002178 crystalline material Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000003255 drug test Methods 0.000 description 2
- 230000006870 function Effects 0.000 description 2
- 150000004795 grignard reagents Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- ZFGMDIBRIDKWMY-PASTXAENSA-N heparin Chemical compound CC(O)=N[C@@H]1[C@@H](O)[C@H](O)[C@@H](COS(O)(=O)=O)O[C@@H]1O[C@@H]1[C@@H](C(O)=O)O[C@@H](O[C@H]2[C@@H]([C@@H](OS(O)(=O)=O)[C@@H](O[C@@H]3[C@@H](OC(O)[C@H](OS(O)(=O)=O)[C@H]3O)C(O)=O)O[C@@H]2O)CS(O)(=O)=O)[C@H](O)[C@H]1O ZFGMDIBRIDKWMY-PASTXAENSA-N 0.000 description 2
- 229920000669 heparin Polymers 0.000 description 2
- 229960001008 heparin sodium Drugs 0.000 description 2
- MNWFXJYAOYHMED-UHFFFAOYSA-N heptanoic acid Chemical compound CCCCCCC(O)=O MNWFXJYAOYHMED-UHFFFAOYSA-N 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- OTCKOJUMXQWKQG-UHFFFAOYSA-L magnesium bromide Chemical compound [Mg+2].[Br-].[Br-] OTCKOJUMXQWKQG-UHFFFAOYSA-L 0.000 description 2
- 229910001623 magnesium bromide Inorganic materials 0.000 description 2
- GWJWJDLPXYCVTI-UHFFFAOYSA-N methyl 7-(4-hydroxy-2-methoxy-5-oxocyclopenten-1-yl)heptanoate Chemical compound COC(=O)CCCCCCC1=C(OC)CC(O)C1=O GWJWJDLPXYCVTI-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 210000002784 stomach Anatomy 0.000 description 2
- 239000007929 subcutaneous injection Substances 0.000 description 2
- 238000010254 subcutaneous injection Methods 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- ONPOCZGFSGZXEQ-UHFFFAOYSA-N (1z)-1-diazohexane Chemical compound CCCCCC=[N+]=[N-] ONPOCZGFSGZXEQ-UHFFFAOYSA-N 0.000 description 1
- VUGRNZHKYVHZSN-MRVPVSSYSA-N (3s)-oct-1-yn-3-ol Chemical compound CCCCC[C@H](O)C#C VUGRNZHKYVHZSN-MRVPVSSYSA-N 0.000 description 1
- SDTMFDGELKWGFT-UHFFFAOYSA-N 2-methylpropan-2-olate Chemical compound CC(C)(C)[O-] SDTMFDGELKWGFT-UHFFFAOYSA-N 0.000 description 1
- IXOFUWJRSYPKSX-UHFFFAOYSA-N 7-(3-hydroxy-5-oxocyclopenten-1-yl)heptanoic acid Chemical compound OC1CC(=O)C(CCCCCCC(O)=O)=C1 IXOFUWJRSYPKSX-UHFFFAOYSA-N 0.000 description 1
- VXOUZNCTJGLWBZ-UHFFFAOYSA-N 7-[2-methoxy-4-(methoxymethoxy)-5-oxocyclopenten-1-yl]heptanoic acid Chemical compound COCOC1CC(OC)=C(CCCCCCC(O)=O)C1=O VXOUZNCTJGLWBZ-UHFFFAOYSA-N 0.000 description 1
- 101100439253 Arabidopsis thaliana CHI3 gene Proteins 0.000 description 1
- 241000566113 Branta sandvicensis Species 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 241000274177 Juniperus sabina Species 0.000 description 1
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 206010070834 Sensitisation Diseases 0.000 description 1
- HOBWAPHTEJGALG-JKCMADFCSA-N [(1r,5s)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate;sulfate Chemical compound [O-]S([O-])(=O)=O.C([C@H]1CC[C@@H](C2)[NH+]1C)C2OC(=O)C(CO)C1=CC=CC=C1.C([C@H]1CC[C@@H](C2)[NH+]1C)C2OC(=O)C(CO)C1=CC=CC=C1 HOBWAPHTEJGALG-JKCMADFCSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229960002028 atropine sulfate Drugs 0.000 description 1
- 238000004166 bioassay Methods 0.000 description 1
- HRQGCQVOJVTVLU-UHFFFAOYSA-N bis(chloromethyl) ether Chemical compound ClCOCCl HRQGCQVOJVTVLU-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- WLXALCKAKGDNAT-UHFFFAOYSA-N diazoethane Chemical compound CC=[N+]=[N-] WLXALCKAKGDNAT-UHFFFAOYSA-N 0.000 description 1
- 230000027046 diestrus Effects 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- XEYBRNLFEZDVAW-ARSRFYASSA-N dinoprostone Chemical compound CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]1C\C=C/CCCC(O)=O XEYBRNLFEZDVAW-ARSRFYASSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 210000001198 duodenum Anatomy 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 210000003191 femoral vein Anatomy 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 210000003405 ileum Anatomy 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 229910001425 magnesium ion Inorganic materials 0.000 description 1
- ZWTFZHTWWSBTAB-UHFFFAOYSA-N methyl 7-(3-hydroxy-2-methoxy-5-oxocyclopenten-1-yl)heptanoate Chemical compound COC(=O)CCCCCCC1=C(OC)C(O)CC1=O ZWTFZHTWWSBTAB-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000001254 nonsecretory effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000002611 ovarian Effects 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- HSMKTIKKPMTUQH-WBPXWQEISA-L pentolinium tartrate Chemical compound OC(=O)[C@H](O)[C@@H](O)C([O-])=O.OC(=O)[C@H](O)[C@@H](O)C([O-])=O.C1CCC[N+]1(C)CCCCC[N+]1(C)CCCC1 HSMKTIKKPMTUQH-WBPXWQEISA-L 0.000 description 1
- 229950008637 pentolonium Drugs 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- PRFXRIUZNKLRHM-OSJNIVAESA-N prostaglandin b2 Chemical compound CCCCC[C@H](O)\C=C\C1=C(C\C=C\CCCC(O)=O)C(=O)CC1 PRFXRIUZNKLRHM-OSJNIVAESA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 230000008313 sensitization Effects 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 210000002460 smooth muscle Anatomy 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 210000003437 trachea Anatomy 0.000 description 1
- 230000036269 ulceration Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US10042070A | 1970-12-21 | 1970-12-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2163115A1 true DE2163115A1 (de) | 1972-07-13 |
Family
ID=22279681
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712163115 Pending DE2163115A1 (de) | 1970-12-21 | 1971-12-20 | Neue Cyclopentanheptansäure-Derivate |
Country Status (7)
| Country | Link |
|---|---|
| AT (1) | AT322748B (enExample) |
| AU (1) | AU3709571A (enExample) |
| BE (1) | BE777022A (enExample) |
| DE (1) | DE2163115A1 (enExample) |
| FR (1) | FR2118953B1 (enExample) |
| GB (1) | GB1341780A (enExample) |
| ZA (1) | ZA718548B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2415765A1 (de) * | 1973-03-30 | 1974-10-10 | Searle & Co | 3-hydroxy-5-oxo-2-substituierte cyclopentanalkensaeuren |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA983486A (en) * | 1972-06-12 | 1976-02-10 | G.D. Searle And Co. Of Canada | 2-(3-hydroxy-3-optionally alkylated-1-alkynyl)-3-hydroxy-5-oxo-1-cyclopentene-1-alkanoic acids, derivatives thereof and process |
-
1971
- 1971-12-20 GB GB5910971A patent/GB1341780A/en not_active Expired
- 1971-12-20 AT AT1091871A patent/AT322748B/de not_active IP Right Cessation
- 1971-12-20 DE DE19712163115 patent/DE2163115A1/de active Pending
- 1971-12-20 FR FR7145762A patent/FR2118953B1/fr not_active Expired
- 1971-12-20 AU AU37095/71A patent/AU3709571A/en not_active Expired
- 1971-12-21 ZA ZA718548A patent/ZA718548B/xx unknown
- 1971-12-21 BE BE777022A patent/BE777022A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2415765A1 (de) * | 1973-03-30 | 1974-10-10 | Searle & Co | 3-hydroxy-5-oxo-2-substituierte cyclopentanalkensaeuren |
Also Published As
| Publication number | Publication date |
|---|---|
| AU3709571A (en) | 1973-06-28 |
| ZA718548B (en) | 1973-02-28 |
| FR2118953B1 (enExample) | 1975-06-13 |
| AT322748B (de) | 1975-06-10 |
| GB1341780A (en) | 1973-12-25 |
| FR2118953A1 (enExample) | 1972-08-04 |
| BE777022A (fr) | 1972-06-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2702553C2 (de) | 9-Desoxy-6,9-epoxy-Δ↑5↑-PGF↓1↓↓α↓-derivate und Verfahren zu ihrer Herstellung | |
| DE3219244A1 (de) | Sulfonatderivate, verfahren zu ihrer herstellung und diese derivate enthaltende arzneimittel | |
| DE2313868A1 (de) | 11-deoxyprostaglandinderivate und deren herstellungsverfahren | |
| DE2244324C2 (de) | 3-Benzoylpropionsäuren mit dreifach substituiertem Benzylrest, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE2126236A1 (de) | Neue Cyclopentanderivate | |
| DE2317019A1 (de) | Neue 4,5-didehydro-prostaglandine | |
| AT390054B (de) | Verfahren zur herstellung von neuen benzoylderivaten von aliphatischen carbonsaeuren | |
| DE2755759A1 (de) | 4-(4-acyl-3-hydroxy-8-methyltridecyl)- benzoesaeuren | |
| DE2831761A1 (de) | 2,3,6-substituierte-4-pyronderivate und ihre verwendung | |
| EP0007490A2 (de) | Neue Prostaglandinderivate der Delta-2,4-11-Desoxy-PGE-Reihe, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| DE2850304A1 (de) | Prostacyclinzwischenprodukte und -analoge | |
| DE2735433A1 (de) | Neue phenylnitromethanverbindungen und verfahren zu ihrer herstellung | |
| DE2539116C2 (de) | ω-Nor-cycloalkyl-13,14-dehydro-prostaglandine, Verfahren zu ihrer Herstellung sowie sie enthaltende pharmazeutische Mittel | |
| CH634831A5 (en) | Process for the preparation of optically active or racemic prostaglandins. | |
| DE2163115A1 (de) | Neue Cyclopentanheptansäure-Derivate | |
| CH517066A (de) | Verfahren zur Herstellung von neuen Aryloxy- und Arylthioessigsäuren und ihren Alkali- und Erdalkalimetallsalzen | |
| DE2330905A1 (de) | Verfahren zur herstellung von neuen 11-deoxyprostaglandinen der e- und freihen | |
| DE2945781A1 (de) | Prostacyclinzwischenprodukte und protacyclinanaloge | |
| DE2739277A1 (de) | 11-deoxy-11-oxaprostaglandinverbindungen | |
| CH646935A5 (de) | 2-(4-dimethylvinylphenyl)-propionsaeure. | |
| DE2647969A1 (de) | Cyclische amide, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate | |
| DE2253914A1 (de) | Neue chromonderivate und verfahren zu ihrer herstellung | |
| DE3879489T2 (de) | Pharmazeutische kompositionen zum behandeln von adrenoleukodystrophie. | |
| DE2542686A1 (de) | 2a,2b-dihomo-15-methyl- und -15- aethyl-pgf-und pge-verbindungen und verfahren zu deren herstellung | |
| DE2038836A1 (de) | Arzneimittel |