DE2150390A1 - 1-Alkyl-9,10-anthrachinone und deren 5,6,7,8-Tetrahydroderivate,sowie Anwendung dieser Derivate zur Herstellung von Wasserstoffperoxid - Google Patents
1-Alkyl-9,10-anthrachinone und deren 5,6,7,8-Tetrahydroderivate,sowie Anwendung dieser Derivate zur Herstellung von WasserstoffperoxidInfo
- Publication number
- DE2150390A1 DE2150390A1 DE19712150390 DE2150390A DE2150390A1 DE 2150390 A1 DE2150390 A1 DE 2150390A1 DE 19712150390 DE19712150390 DE 19712150390 DE 2150390 A DE2150390 A DE 2150390A DE 2150390 A1 DE2150390 A1 DE 2150390A1
- Authority
- DE
- Germany
- Prior art keywords
- anthraquinone
- solution
- hydrogen peroxide
- tetrahydro
- processing
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 title claims description 81
- 238000004519 manufacturing process Methods 0.000 title claims description 16
- 239000002904 solvent Substances 0.000 claims description 61
- 150000004056 anthraquinones Chemical class 0.000 claims description 38
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 claims description 37
- PCFMUWBCZZUMRX-UHFFFAOYSA-N 9,10-Dihydroxyanthracene Chemical group C1=CC=C2C(O)=C(C=CC=C3)C3=C(O)C2=C1 PCFMUWBCZZUMRX-UHFFFAOYSA-N 0.000 claims description 25
- 238000000034 method Methods 0.000 claims description 24
- 238000007254 oxidation reaction Methods 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 125000004122 cyclic group Chemical group 0.000 claims description 8
- 230000003647 oxidation Effects 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 1
- 239000000243 solution Substances 0.000 description 64
- 239000000203 mixture Substances 0.000 description 43
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 39
- 239000003054 catalyst Substances 0.000 description 37
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 30
- 229910052739 hydrogen Inorganic materials 0.000 description 28
- 150000001875 compounds Chemical class 0.000 description 24
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 20
- -1 alkyl anthraquinones Chemical class 0.000 description 20
- 239000001257 hydrogen Substances 0.000 description 20
- 239000000543 intermediate Substances 0.000 description 20
- 239000000047 product Substances 0.000 description 20
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 19
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical compound CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 13
- 238000005984 hydrogenation reaction Methods 0.000 description 13
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- 239000010410 layer Substances 0.000 description 12
- 239000000706 filtrate Substances 0.000 description 11
- 229910052751 metal Inorganic materials 0.000 description 11
- 239000002184 metal Substances 0.000 description 11
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 description 10
- 229910052763 palladium Inorganic materials 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 9
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 9
- 230000015572 biosynthetic process Effects 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 239000008096 xylene Substances 0.000 description 9
- FRASJONUBLZVQX-UHFFFAOYSA-N 1,4-naphthoquinone Chemical compound C1=CC=C2C(=O)C=CC(=O)C2=C1 FRASJONUBLZVQX-UHFFFAOYSA-N 0.000 description 8
- RZVHIXYEVGDQDX-UHFFFAOYSA-N 9,10-anthraquinone Chemical group C1=CC=C2C(=O)C3=CC=CC=C3C(=O)C2=C1 RZVHIXYEVGDQDX-UHFFFAOYSA-N 0.000 description 8
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 8
- 229910000564 Raney nickel Inorganic materials 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- 238000002474 experimental method Methods 0.000 description 7
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 7
- 238000003786 synthesis reaction Methods 0.000 description 7
- FYGHSUNMUKGBRK-UHFFFAOYSA-N 1,2,3-trimethylbenzene Chemical compound CC1=CC=CC(C)=C1C FYGHSUNMUKGBRK-UHFFFAOYSA-N 0.000 description 6
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 6
- HXQPUEQDBSPXTE-UHFFFAOYSA-N Diisobutylcarbinol Chemical compound CC(C)CC(O)CC(C)C HXQPUEQDBSPXTE-UHFFFAOYSA-N 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- 229910052697 platinum Inorganic materials 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000011877 solvent mixture Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- BBMCTIGTTCKYKF-UHFFFAOYSA-N 1-heptanol Chemical compound CCCCCCCO BBMCTIGTTCKYKF-UHFFFAOYSA-N 0.000 description 4
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 4
- 238000005698 Diels-Alder reaction Methods 0.000 description 4
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 4
- 239000007868 Raney catalyst Substances 0.000 description 4
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 239000003480 eluent Substances 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 238000000605 extraction Methods 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- OTBHDFWQZHPNPU-UHFFFAOYSA-N 1,2,3,4-tetrahydroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1CCCC2 OTBHDFWQZHPNPU-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- YEVQZPWSVWZAOB-UHFFFAOYSA-N 2-(bromomethyl)-1-iodo-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(I)C(CBr)=C1 YEVQZPWSVWZAOB-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 125000005917 3-methylpentyl group Chemical group 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 3
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 238000006471 dimerization reaction Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- 229910052741 iridium Inorganic materials 0.000 description 3
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 3
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910052762 osmium Inorganic materials 0.000 description 3
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 229910052703 rhodium Inorganic materials 0.000 description 3
- 239000010948 rhodium Substances 0.000 description 3
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 3
- 229910052707 ruthenium Inorganic materials 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- ZTJHDEXGCKAXRZ-FNORWQNLSA-N (3e)-octa-1,3,7-triene Chemical compound C=CCC\C=C\C=C ZTJHDEXGCKAXRZ-FNORWQNLSA-N 0.000 description 2
- VOIOXCVXXQEVEU-UHFFFAOYSA-N 1-but-3-enylanthracene-9,10-dione Chemical class O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2CCC=C VOIOXCVXXQEVEU-UHFFFAOYSA-N 0.000 description 2
- CGCLLGBAYSYXQN-UHFFFAOYSA-N 3-methyl-1-(3-methylbutyl)anthracene-9,10-dione Chemical compound C(CC(C)C)C1=CC(=CC=2C(C3=CC=CC=C3C(C12)=O)=O)C CGCLLGBAYSYXQN-UHFFFAOYSA-N 0.000 description 2
- 229940076442 9,10-anthraquinone Drugs 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910000323 aluminium silicate Inorganic materials 0.000 description 2
- WUOFAZKBVWWYER-UHFFFAOYSA-N anthracene-9,10-dione;hydrogen peroxide Chemical compound OO.C1=CC=C2C(=O)C3=CC=CC=C3C(=O)C2=C1 WUOFAZKBVWWYER-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 229910001882 dioxygen Inorganic materials 0.000 description 2
- 239000010459 dolomite Substances 0.000 description 2
- 229910000514 dolomite Inorganic materials 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 239000003456 ion exchange resin Substances 0.000 description 2
- 229920003303 ion-exchange polymer Polymers 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- IMXBRVLCKXGWSS-UHFFFAOYSA-N methyl 2-cyclohexylacetate Chemical compound COC(=O)CC1CCCCC1 IMXBRVLCKXGWSS-UHFFFAOYSA-N 0.000 description 2
- 239000012046 mixed solvent Substances 0.000 description 2
- ZTJHDEXGCKAXRZ-UHFFFAOYSA-N octa-1,3,7-triene Chemical class C=CCCC=CC=C ZTJHDEXGCKAXRZ-UHFFFAOYSA-N 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- 238000004448 titration Methods 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 229910052723 transition metal Inorganic materials 0.000 description 2
- 150000003624 transition metals Chemical class 0.000 description 2
- VVDZWMOQABVVHC-UHFFFAOYSA-N (1-methylcyclohexyl) acetate Chemical compound CC(=O)OC1(C)CCCCC1 VVDZWMOQABVVHC-UHFFFAOYSA-N 0.000 description 1
- SBGGDWHDXXZMBR-FNORWQNLSA-N (3e)-2,7-dimethylocta-1,3,7-triene Chemical compound CC(=C)CC\C=C\C(C)=C SBGGDWHDXXZMBR-FNORWQNLSA-N 0.000 description 1
- HOXGZVUCAYFWGR-KQQUZDAGSA-N (3e,5e)-octa-1,3,5-triene Chemical compound CC\C=C\C=C\C=C HOXGZVUCAYFWGR-KQQUZDAGSA-N 0.000 description 1
- NCIGMZODLBFTKN-BSWSSELBSA-N (4E,6E)-2-methylnona-2,4,6-triene Chemical compound CC\C=C\C=C\C=C(C)C NCIGMZODLBFTKN-BSWSSELBSA-N 0.000 description 1
- QNLZIZAQLLYXTC-UHFFFAOYSA-N 1,2-dimethylnaphthalene Chemical class C1=CC=CC2=C(C)C(C)=CC=C21 QNLZIZAQLLYXTC-UHFFFAOYSA-N 0.000 description 1
- ZKKZIPCBLBTIJE-UHFFFAOYSA-N 1,3-diethylanthracene-9,10-dione Chemical compound C1=CC=C2C(=O)C3=CC(CC)=CC(CC)=C3C(=O)C2=C1 ZKKZIPCBLBTIJE-UHFFFAOYSA-N 0.000 description 1
- BVEIKFLZWBDLJG-UHFFFAOYSA-N 1-butylanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2CCCC BVEIKFLZWBDLJG-UHFFFAOYSA-N 0.000 description 1
- IVWMTEDGGZEVNR-UHFFFAOYSA-N 2,6-dimethylheptan-4-ol;1,4-xylene Chemical compound CC1=CC=C(C)C=C1.CC(C)CC(O)CC(C)C IVWMTEDGGZEVNR-UHFFFAOYSA-N 0.000 description 1
- SJEBAWHUJDUKQK-UHFFFAOYSA-N 2-ethylanthraquinone Chemical compound C1=CC=C2C(=O)C3=CC(CC)=CC=C3C(=O)C2=C1 SJEBAWHUJDUKQK-UHFFFAOYSA-N 0.000 description 1
- UMWZLYTVXQBTTE-UHFFFAOYSA-N 2-pentylanthracene-9,10-dione Chemical class C1=CC=C2C(=O)C3=CC(CCCCC)=CC=C3C(=O)C2=C1 UMWZLYTVXQBTTE-UHFFFAOYSA-N 0.000 description 1
- HVPXVHGFBZAHGO-UHFFFAOYSA-N 3,8-dimethylidenedec-4-ene Chemical compound CCC(=C)CCC=CC(=C)CC HVPXVHGFBZAHGO-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- IGLWCQMNTGCUBB-UHFFFAOYSA-N 3-methylidenepent-1-ene Chemical compound CCC(=C)C=C IGLWCQMNTGCUBB-UHFFFAOYSA-N 0.000 description 1
- MQWCXKGKQLNYQG-UHFFFAOYSA-N 4-methylcyclohexan-1-ol Chemical compound CC1CCC(O)CC1 MQWCXKGKQLNYQG-UHFFFAOYSA-N 0.000 description 1
- XLBGYAXSIZICIW-UHFFFAOYSA-N 7-methyl-5-(3-methylbutyl)-1,2,3,4-tetrahydroanthracene-9,10-dione Chemical compound O=C1C=2C(CCC(C)C)=CC(C)=CC=2C(=O)C2=C1CCCC2 XLBGYAXSIZICIW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 102100033070 Histone acetyltransferase KAT6B Human genes 0.000 description 1
- 101000944174 Homo sapiens Histone acetyltransferase KAT6B Proteins 0.000 description 1
- 229930192627 Naphthoquinone Natural products 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- OPSFHNHLRVXGSD-UHFFFAOYSA-L [O-]S([O-])(=O)=O.N.[Ce+6] Chemical compound [O-]S([O-])(=O)=O.N.[Ce+6] OPSFHNHLRVXGSD-UHFFFAOYSA-L 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000000538 analytical sample Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- WIRUZQNBHNAMAB-UHFFFAOYSA-N benzene;cyclohexane Chemical compound C1CCCCC1.C1=CC=CC=C1 WIRUZQNBHNAMAB-UHFFFAOYSA-N 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- XMPZTFVPEKAKFH-UHFFFAOYSA-P ceric ammonium nitrate Chemical compound [NH4+].[NH4+].[Ce+4].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O XMPZTFVPEKAKFH-UHFFFAOYSA-P 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000002035 hexane extract Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 150000002791 naphthoquinones Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- FKHIFSZMMVMEQY-UHFFFAOYSA-N talc Chemical compound [Mg+2].[O-][Si]([O-])=O FKHIFSZMMVMEQY-UHFFFAOYSA-N 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- STCOOQWBFONSKY-UHFFFAOYSA-N tributyl phosphate Chemical compound CCCCOP(=O)(OCCCC)OCCCC STCOOQWBFONSKY-UHFFFAOYSA-N 0.000 description 1
- 150000005691 triesters Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/01—Hydrogen peroxide
- C01B15/022—Preparation from organic compounds
- C01B15/023—Preparation from organic compounds by the alkyl-anthraquinone process
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/04—Ortho- or ortho- and peri-condensed systems containing three rings
- C07C2603/22—Ortho- or ortho- and peri-condensed systems containing three rings containing only six-membered rings
- C07C2603/24—Anthracenes; Hydrogenated anthracenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US7964370A | 1970-10-09 | 1970-10-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2150390A1 true DE2150390A1 (de) | 1972-04-13 |
Family
ID=22151859
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712150390 Pending DE2150390A1 (de) | 1970-10-09 | 1971-10-08 | 1-Alkyl-9,10-anthrachinone und deren 5,6,7,8-Tetrahydroderivate,sowie Anwendung dieser Derivate zur Herstellung von Wasserstoffperoxid |
Country Status (9)
| Country | Link |
|---|---|
| US (2) | US3888890A (enExample) |
| BE (1) | BE773664A (enExample) |
| CA (1) | CA973179A (enExample) |
| DE (1) | DE2150390A1 (enExample) |
| FR (1) | FR2112281B1 (enExample) |
| GB (1) | GB1363713A (enExample) |
| IT (1) | IT945987B (enExample) |
| NL (1) | NL7113830A (enExample) |
| SE (1) | SE364244B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0453949A1 (de) * | 1990-04-25 | 1991-10-30 | SOLVAY INTEROX GmbH | Verfahren zur Herstellung von Alkyltetrahydroanthrahydrochinonlösungen und ihre Verwendung als Arbeitslösung bei der Wasserstoffperoxid-Herstellung nach dem Anthrachinonverfahren |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4110353A (en) * | 1973-11-21 | 1978-08-29 | E. I. Du Pont De Nemours And Company | Process for the production of tetrahydroanthraquinones |
| JPS5129473A (en) * | 1974-09-06 | 1976-03-12 | Mitsui Toatsu Chemicals | Kojundo 55 nitorotetorahidoroantorakinon no seizohoho |
| DE3534014A1 (de) * | 1985-09-24 | 1987-03-26 | Peroxid Chemie Gmbh | Neue herstellung von alkyltetrahydro-anthrachinonen |
| DE3732015A1 (de) * | 1987-09-23 | 1989-04-06 | Basf Ag | 2-neopentylanthrachinon, verfahren zur herstellung von 2-neopentylanthrachinon und dessen verwendung als katalysator bei der h(pfeil abwaerts)2(pfeil abwaerts)o(pfeil abwaerts)2(pfeil abwaerts)-herstellung |
| US5389356A (en) * | 1993-01-05 | 1995-02-14 | Utah State University Foundation | Compounds and methods for generating oxygen free radicals used in general oxidation and reduction reactions |
| US5662878A (en) * | 1996-04-25 | 1997-09-02 | University Of Chicago | Process for the production of hydrogen peroxide |
| US6300378B1 (en) | 1996-09-27 | 2001-10-09 | University Of New Mexico | Tropodegradable bromine-containing halocarbon additives to decrease flammability of refrigerants foam blowing agents solvents aerosol propellants and sterilants |
| DE19816297A1 (de) * | 1998-04-11 | 1999-10-21 | Degussa | Verfahren zur Herstellung von Wasserstoffperoxid und Reaktionsträger zu seiner Durchführung |
| DE60025143T2 (de) * | 1999-11-22 | 2006-07-06 | Akzo Nobel N.V. | Verfahren und Zusammensetzung zur Herstellung von Wasserstoffperoxid |
| TWI443063B (zh) * | 2007-07-11 | 2014-07-01 | Mitsubishi Gas Chemical Co | 用於製造過氧化氫之作用溶液的再生觸媒之製造方法 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA614296A (en) * | 1961-02-07 | Ferri Cesare | Process for making hydrogen peroxide | |
| CA607627A (en) * | 1960-10-25 | Kabisch Gerhard | Process for manufacture of hydrogen peroxide | |
| US2668753A (en) * | 1949-11-05 | 1954-02-09 | Du Pont | Production of hydrogen peroxide |
| US2652408A (en) * | 1951-07-14 | 1953-09-15 | American Cyanamid Co | Preparation of anthraquinone compounds |
| US2871244A (en) * | 1955-06-24 | 1959-01-27 | Reynolds Metals Co | Process for the manufacture of anthraquinone and derivatives thereof |
| US3032560A (en) * | 1959-05-29 | 1962-05-01 | Lynn H Dawsey | Process for preparing amylanthraquinone |
| US3778452A (en) * | 1970-10-09 | 1973-12-11 | Du Pont | 1-alkenyl-9,10-anthraquinones |
| US3767779A (en) * | 1971-07-06 | 1973-10-23 | Oxysynthese | Process for manufacturing hydrogen peroxide |
-
1971
- 1971-10-04 CA CA124,385A patent/CA973179A/en not_active Expired
- 1971-10-08 SE SE12753/71A patent/SE364244B/xx unknown
- 1971-10-08 BE BE773664A patent/BE773664A/xx unknown
- 1971-10-08 NL NL7113830A patent/NL7113830A/xx unknown
- 1971-10-08 FR FR7136376A patent/FR2112281B1/fr not_active Expired
- 1971-10-08 DE DE19712150390 patent/DE2150390A1/de active Pending
- 1971-10-08 IT IT29699/71A patent/IT945987B/it active
- 1971-10-11 GB GB4722771A patent/GB1363713A/en not_active Expired
-
1972
- 1972-08-31 US US285124A patent/US3888890A/en not_active Expired - Lifetime
-
1973
- 1973-01-12 US US323127A patent/US3923967A/en not_active Expired - Lifetime
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0453949A1 (de) * | 1990-04-25 | 1991-10-30 | SOLVAY INTEROX GmbH | Verfahren zur Herstellung von Alkyltetrahydroanthrahydrochinonlösungen und ihre Verwendung als Arbeitslösung bei der Wasserstoffperoxid-Herstellung nach dem Anthrachinonverfahren |
| US5147628A (en) * | 1990-04-25 | 1992-09-15 | Peroxid-Chemie Gmbh | Process for producing alkyltetrahydroanthrahydroquinones and working solutions containing them for producing hydrogen peroxide by the anthraquinone process |
Also Published As
| Publication number | Publication date |
|---|---|
| NL7113830A (enExample) | 1972-04-11 |
| US3923967A (en) | 1975-12-02 |
| GB1363713A (en) | 1974-08-14 |
| BE773664A (fr) | 1972-04-10 |
| IT945987B (it) | 1973-05-10 |
| USB323127I5 (enExample) | 1975-01-28 |
| FR2112281A1 (enExample) | 1972-06-16 |
| US3888890A (en) | 1975-06-10 |
| CA973179A (en) | 1975-08-19 |
| SE364244B (enExample) | 1974-02-18 |
| FR2112281B1 (enExample) | 1978-06-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2150390A1 (de) | 1-Alkyl-9,10-anthrachinone und deren 5,6,7,8-Tetrahydroderivate,sowie Anwendung dieser Derivate zur Herstellung von Wasserstoffperoxid | |
| EP0889019B1 (de) | Verfahren zur Herstellung von Cyclohexanonen durch Hydrierung der entsprechenden Phenole in Gegenwart von Alkanen als Lösungsmittel | |
| DE1443338C3 (de) | Verfahren zur Herstellung von cyclischen 6-Ring-Äthern | |
| DE2331512A1 (de) | 2-alkylsubstituierte 1,2,3,4-tetrahydroanthrachinone | |
| DE2462724C3 (de) | Bicyclo-[2,2,2]-octanderivate und Verfahren zu deren Herstellung | |
| DE1000375C2 (de) | Verfahren zur Herstellung von kristallisierbaren Pentaenaldehydkomplexverbindungen mit Vitamin-A-Aldehydaufbau | |
| DE2447978C2 (de) | Verfahren zur Herstellung einer Tropan-Verbindung | |
| DE1793308B1 (de) | Herstellung von Canthaxanthin | |
| DE2548384C3 (de) | Verfahren zur Herstellung von Hydroxyphenyläthern | |
| DE3108868C2 (de) | Exo- und/oder Endo-tricyclo[5.2.1.0↑2↑↑,↑↑6↑]decan-2-carbonsäureester, Verfahren zu ihrer Herstellung und sie enthaltende Duftstoffzusammensetzungen | |
| CH421079A (de) | Verfahren zur Herstellung eines Diols und von Derivaten desselben | |
| DE1178843B (de) | Verfahren zur Herstellung von Abkoemmlingen des 2, 3-Dimethoxy-5-methyl-1, 4-benzohydro-chinons und -chinons | |
| DE2519819A1 (de) | Verfahren zur herstellung von dicyclohexanolpropan durch hydrierung von diphenolpropan | |
| DE2150337A1 (de) | 1-Alkenyl-9-10-anthrachinone und Verfahren zu deren Herstellung | |
| DE3128790C2 (de) | C-8-substituierte 1,5-Dimethyl-bicyclo[3.2.1]octan-8-ole, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE570952C (de) | Verfahren zur Gewinnung hochmolekularer Alkohole | |
| DE2856721A1 (de) | Verfahren zur herstellung von cyclohex-3-en-1-onen | |
| DE2331544A1 (de) | 1-alkylsubstituierte 1,2,3,4-tetrahydroanthrachinone | |
| DE2953189C1 (de) | Verfahren zur Herstellung von Ketonen | |
| DE69202169T2 (de) | Verfahren zur Herstellung von Irone. | |
| CH378862A (de) | Verfahren zur Herstellung von Wasserstoffperoxyd | |
| AT235827B (de) | Verfahren zur Herstellung von 2, 3-Dimethoxy-5-methyl-benzochinon-Derivaten | |
| AT217050B (de) | Verfahren zur Herstellung von Isozeaxanthin-dialkyläthern | |
| EP0921111A1 (de) | Verfahren zur Herstellung von substituierten Anthrachinonen | |
| AT365584B (de) | Verfahren zur herstellung des neuen 2-methyl-2cyanmethyl-5-isopropyl-tetrahydrofurans |