DE2149714B2 - Elektrophotographisches Aufzeichnungsmaterial - Google Patents
Elektrophotographisches AufzeichnungsmaterialInfo
- Publication number
- DE2149714B2 DE2149714B2 DE2149714A DE2149714A DE2149714B2 DE 2149714 B2 DE2149714 B2 DE 2149714B2 DE 2149714 A DE2149714 A DE 2149714A DE 2149714 A DE2149714 A DE 2149714A DE 2149714 B2 DE2149714 B2 DE 2149714B2
- Authority
- DE
- Germany
- Prior art keywords
- group
- carbon atoms
- alkyl
- photoconductor
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000000463 material Substances 0.000 title claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 21
- 150000001875 compounds Chemical class 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- 125000005907 alkyl ester group Chemical group 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 6
- 150000002475 indoles Chemical class 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 2
- 238000006116 polymerization reaction Methods 0.000 claims description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 238000000576 coating method Methods 0.000 description 8
- 238000000862 absorption spectrum Methods 0.000 description 7
- 238000000034 method Methods 0.000 description 7
- 150000002605 large molecules Chemical class 0.000 description 5
- 239000004014 plasticizer Substances 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- 238000011282 treatment Methods 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 230000009102 absorption Effects 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 4
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000011248 coating agent Substances 0.000 description 4
- 238000011161 development Methods 0.000 description 4
- 230000005611 electricity Effects 0.000 description 4
- FDVITFMRUUGIBF-UHFFFAOYSA-N 2-methylidene-1,3-dihydroindole Chemical class C1=CC=C2NC(=C)CC2=C1 FDVITFMRUUGIBF-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 230000035945 sensitivity Effects 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 238000006736 Huisgen cycloaddition reaction Methods 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- WDECIBYCCFPHNR-UHFFFAOYSA-N chrysene Chemical compound C1=CC=CC2=CC=C3C4=CC=CC=C4C=CC3=C21 WDECIBYCCFPHNR-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 150000003384 small molecules Chemical class 0.000 description 2
- ZPOXRPZOUICSNA-UHFFFAOYSA-N spiro[1,3-dihydroindole-2,5'-4h-1,2-oxazole] Chemical group C1C=NOC11NC2=CC=CC=C2C1 ZPOXRPZOUICSNA-UHFFFAOYSA-N 0.000 description 2
- KTQVJAPIQPIIPF-IOBHVTPZSA-N (1Z,2Z)-N,N'-dihydroxyethanediimidoyl dichloride Chemical compound O\N=C(/Cl)\C(\Cl)=N\O KTQVJAPIQPIIPF-IOBHVTPZSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- ZUQOHENQXGWDMQ-UHFFFAOYSA-N 3-ethoxybut-1-ene Chemical compound CCOC(C)C=C ZUQOHENQXGWDMQ-UHFFFAOYSA-N 0.000 description 1
- NTBSTKFTGXYBNC-UHFFFAOYSA-N 4-chloro-1,3,3-trimethyl-2-methylideneindole Chemical compound C1=CC=C(Cl)C2=C1N(C)C(=C)C2(C)C NTBSTKFTGXYBNC-UHFFFAOYSA-N 0.000 description 1
- LIBYNMFYSBKVAW-UHFFFAOYSA-N 5'-chloro-1',3',3'-trimethyl-3-phenylspiro[4H-1,2-oxazole-5,2'-indole] Chemical compound CN1C2(C(C3=CC(=CC=C13)Cl)(C)C)CC(=NO2)C2=CC=CC=C2 LIBYNMFYSBKVAW-UHFFFAOYSA-N 0.000 description 1
- 229920000178 Acrylic resin Polymers 0.000 description 1
- 239000004925 Acrylic resin Substances 0.000 description 1
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 1
- 229930192627 Naphthoquinone Natural products 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Natural products C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 229920002433 Vinyl chloride-vinyl acetate copolymer Polymers 0.000 description 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- HFACYLZERDEVSX-UHFFFAOYSA-N benzidine Chemical compound C1=CC(N)=CC=C1C1=CC=C(N)C=C1 HFACYLZERDEVSX-UHFFFAOYSA-N 0.000 description 1
- KGNDCEVUMONOKF-UGPLYTSKSA-N benzyl n-[(2r)-1-[(2s,4r)-2-[[(2s)-6-amino-1-(1,3-benzoxazol-2-yl)-1,1-dihydroxyhexan-2-yl]carbamoyl]-4-[(4-methylphenyl)methoxy]pyrrolidin-1-yl]-1-oxo-4-phenylbutan-2-yl]carbamate Chemical compound C1=CC(C)=CC=C1CO[C@H]1CN(C(=O)[C@@H](CCC=2C=CC=CC=2)NC(=O)OCC=2C=CC=CC=2)[C@H](C(=O)N[C@@H](CCCCN)C(O)(O)C=2OC3=CC=CC=C3N=2)C1 KGNDCEVUMONOKF-UGPLYTSKSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- QHIWVLPBUQWDMQ-UHFFFAOYSA-N butyl prop-2-enoate;methyl 2-methylprop-2-enoate;prop-2-enoic acid Chemical compound OC(=O)C=C.COC(=O)C(C)=C.CCCCOC(=O)C=C QHIWVLPBUQWDMQ-UHFFFAOYSA-N 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000001055 chewing effect Effects 0.000 description 1
- 229940125833 compound 23 Drugs 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- FDZZZRQASAIRJF-UHFFFAOYSA-M malachite green Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1C(C=1C=CC=CC=1)=C1C=CC(=[N+](C)C)C=C1 FDZZZRQASAIRJF-UHFFFAOYSA-M 0.000 description 1
- 229940107698 malachite green Drugs 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- CXKWCBBOMKCUKX-UHFFFAOYSA-M methylene blue Chemical compound [Cl-].C1=CC(N(C)C)=CC2=[S+]C3=CC(N(C)C)=CC=C3N=C21 CXKWCBBOMKCUKX-UHFFFAOYSA-M 0.000 description 1
- 229960000907 methylthioninium chloride Drugs 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 150000002791 naphthoquinones Chemical class 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000005033 polyvinylidene chloride Substances 0.000 description 1
- 230000001850 reproductive effect Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 229920002050 silicone resin Polymers 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 125000003003 spiro group Chemical group 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- NLDYACGHTUPAQU-UHFFFAOYSA-N tetracyanoethylene Chemical group N#CC(C#N)=C(C#N)C#N NLDYACGHTUPAQU-UHFFFAOYSA-N 0.000 description 1
- PCCVSPMFGIFTHU-UHFFFAOYSA-N tetracyanoquinodimethane Chemical compound N#CC(C#N)=C1C=CC(=C(C#N)C#N)C=C1 PCCVSPMFGIFTHU-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0622—Heterocyclic compounds
- G03G5/0644—Heterocyclic compounds containing two or more hetero rings
- G03G5/0661—Heterocyclic compounds containing two or more hetero rings in different ring systems, each system containing at least one hetero ring
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0622—Heterocyclic compounds
- G03G5/0644—Heterocyclic compounds containing two or more hetero rings
- G03G5/0646—Heterocyclic compounds containing two or more hetero rings in the same ring system
- G03G5/065—Heterocyclic compounds containing two or more hetero rings in the same ring system containing three relevant rings
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Photoreceptors In Electrophotography (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP45087788A JPS4917534B1 (cg-RX-API-DMAC7.html) | 1970-10-06 | 1970-10-06 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2149714A1 DE2149714A1 (de) | 1972-04-13 |
| DE2149714B2 true DE2149714B2 (de) | 1974-04-18 |
| DE2149714C3 DE2149714C3 (cg-RX-API-DMAC7.html) | 1974-11-14 |
Family
ID=13924709
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2149714A Granted DE2149714B2 (de) | 1970-10-06 | 1971-10-05 | Elektrophotographisches Aufzeichnungsmaterial |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3850949A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS4917534B1 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2149714B2 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2111006A5 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1368079A (cg-RX-API-DMAC7.html) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3923824A (en) * | 1970-10-01 | 1975-12-02 | Fuji Photo Film Co Ltd | Spiro (indoline-2,5-isoxazoline) compounds |
| US4139274A (en) * | 1974-09-18 | 1979-02-13 | Matsushita Electric Industrial Co., Ltd. | Apparatus for changing color |
| JPS5134885A (en) * | 1974-09-18 | 1976-03-24 | Matsushita Electric Industrial Co Ltd | Henshoku mataha shohatsushokuyozairyo |
| GB8808433D0 (en) * | 1988-04-11 | 1988-05-11 | Merck Sharp & Dohme | Therapeutic agents |
| US5534520A (en) * | 1990-04-10 | 1996-07-09 | Fisher; Abraham | Spiro compounds containing five-membered rings |
| US5852029A (en) * | 1990-04-10 | 1998-12-22 | Israel Institute For Biological Research | Aza spiro compounds acting on the cholinergic system with muscarinic agonist activity |
-
1970
- 1970-10-06 JP JP45087788A patent/JPS4917534B1/ja active Pending
-
1971
- 1971-10-05 GB GB4635671A patent/GB1368079A/en not_active Expired
- 1971-10-05 FR FR7135831A patent/FR2111006A5/fr not_active Expired
- 1971-10-05 DE DE2149714A patent/DE2149714B2/de active Granted
- 1971-10-06 US US00187190A patent/US3850949A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE2149714C3 (cg-RX-API-DMAC7.html) | 1974-11-14 |
| JPS4917534B1 (cg-RX-API-DMAC7.html) | 1974-05-01 |
| DE2149714A1 (de) | 1972-04-13 |
| GB1368079A (en) | 1974-09-25 |
| US3850949A (en) | 1974-11-26 |
| FR2111006A5 (cg-RX-API-DMAC7.html) | 1972-06-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2557398A1 (de) | Photoleitfaehiges aufzeichnungsmaterial | |
| DE2630784A1 (de) | Monomere mit elektronenakzeptorgruppen - herstellungsverfahren und verwendung | |
| DE1254468B (de) | Photoleitfaehige Schicht fuer elektrophotographische Zwecke | |
| DE2238425C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2156886C3 (cg-RX-API-DMAC7.html) | ||
| DE2149714B2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2253931C3 (de) | Elektrophotographisches Aufzeichnungsmaterial, Auskopierverfahren sowie Verfahren zur Herstellung von Bildern | |
| DE2302625C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2040152B2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2137325C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE1180242B (de) | Photoleiterschichten fuer elektrophotographische Zwecke | |
| DE3246250C2 (cg-RX-API-DMAC7.html) | ||
| DE2059540C3 (de) | Elektrophotographisches Aufzeichnungsmaterial mit einer photoleitfähigen Schicht | |
| DE2048135B2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2035664B2 (de) | Elektrophotographisches Aufzeichnungsmaterial mit einer photoleitfähigen Schicht | |
| DE2109626C3 (de) | p- oder m-Xylolderivate und deren Verwendung als fotoleitendes Material für die Elektrofotografie | |
| DE2601822C2 (de) | Elektrofotografisches Aufzeichnungsmaterial | |
| DE2035679B2 (de) | Elektrofotografisches Aufzeichnungsmaterial | |
| DE2043355C3 (de) | Elektrophotographisches Aufzeichungs material | |
| DE2007961C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2064481B2 (de) | Elektrophotographisches Aufzeichungsmaterial mit einer elektrisch leitenden Schicht und einer photoleitfähigen Schicht, die einen polymeren organischen Photoleiter enthält | |
| DE2142611C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2054253B2 (de) | Photoleitfahiges Aufzeichnungsmaterial | |
| DE2509414C3 (de) | Beschichtungsmasse zur Herstellung lichtempfindlicher Schichten von Auskopiermaterialien | |
| DE1522583C (de) | Elektrophotographisches Verfahren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |