DE2137592A1 - 3-Formylcephalosporinsulfoxide und Verfahren zu ihrer Herstellung - Google Patents
3-Formylcephalosporinsulfoxide und Verfahren zu ihrer HerstellungInfo
- Publication number
- DE2137592A1 DE2137592A1 DE19712137592 DE2137592A DE2137592A1 DE 2137592 A1 DE2137592 A1 DE 2137592A1 DE 19712137592 DE19712137592 DE 19712137592 DE 2137592 A DE2137592 A DE 2137592A DE 2137592 A1 DE2137592 A1 DE 2137592A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- delta
- carboxylate
- oxide
- tert
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 238000000034 method Methods 0.000 title claims description 14
- 238000002360 preparation method Methods 0.000 title claims description 3
- 150000003462 sulfoxides Chemical class 0.000 title description 4
- -1 t-butoxycarbonyl group Chemical group 0.000 claims description 29
- 150000001875 compounds Chemical class 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 12
- 239000000126 substance Substances 0.000 claims description 10
- 125000002252 acyl group Chemical group 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 229940117975 chromium trioxide Drugs 0.000 claims description 5
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 claims description 5
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical group [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 239000007800 oxidant agent Substances 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 239000007788 liquid Substances 0.000 claims description 3
- 230000003647 oxidation Effects 0.000 claims description 3
- 238000007254 oxidation reaction Methods 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 150000002081 enamines Chemical class 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 230000008014 freezing Effects 0.000 claims description 2
- 238000007710 freezing Methods 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000006502 nitrobenzyl group Chemical group 0.000 claims description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims 2
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 claims 1
- 229910052740 iodine Inorganic materials 0.000 claims 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 25
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- 229940124587 cephalosporin Drugs 0.000 description 15
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- 229920006395 saturated elastomer Polymers 0.000 description 12
- 239000011780 sodium chloride Substances 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- 150000002148 esters Chemical class 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 229930186147 Cephalosporin Natural products 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- 125000004185 ester group Chemical group 0.000 description 7
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- HOKIDJSKDBPKTQ-GLXFQSAKSA-N cephalosporin C Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CCC[C@@H](N)C(O)=O)[C@@H]12 HOKIDJSKDBPKTQ-GLXFQSAKSA-N 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 5
- 238000002329 infrared spectrum Methods 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 238000002211 ultraviolet spectrum Methods 0.000 description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 239000003810 Jones reagent Substances 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- QHTOIDKCEPKVCM-ZCFIWIBFSA-N cepham Chemical compound S1CCCN2C(=O)C[C@H]21 QHTOIDKCEPKVCM-ZCFIWIBFSA-N 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 239000010410 layer Substances 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 3
- 239000003242 anti bacterial agent Substances 0.000 description 3
- 150000001780 cephalosporins Chemical class 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- DNVRTEUQJBGDLX-UHFFFAOYSA-N 4,5-dichloroquinoline-2,3-dicarbonitrile Chemical compound N#CC1=C(C#N)C(Cl)=C2C(Cl)=CC=CC2=N1 DNVRTEUQJBGDLX-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 230000003115 biocidal effect Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 150000001782 cephems Chemical class 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241001619326 Cephalosporium Species 0.000 description 1
- 108090000371 Esterases Proteins 0.000 description 1
- ATTZFSUZZUNHBP-UHFFFAOYSA-N Piperonyl sulfoxide Chemical compound CCCCCCCCS(=O)C(C)CC1=CC=C2OCOC2=C1 ATTZFSUZZUNHBP-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000006196 deacetylation Effects 0.000 description 1
- 238000003381 deacetylation reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000855 fermentation Methods 0.000 description 1
- 230000004151 fermentation Effects 0.000 description 1
- UHUSDOQQWJGJQS-UHFFFAOYSA-N glycerol 1,2-dioctadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(CO)OC(=O)CCCCCCCCCCCCCCCCC UHUSDOQQWJGJQS-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- UXOUKMQIEVGVLY-UHFFFAOYSA-N morin Natural products OC1=CC(O)=CC(C2=C(C(=O)C3=C(O)C=C(O)C=C3O2)O)=C1 UXOUKMQIEVGVLY-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- FWFGVMYFCODZRD-UHFFFAOYSA-N oxidanium;hydrogen sulfate Chemical compound O.OS(O)(=O)=O FWFGVMYFCODZRD-UHFFFAOYSA-N 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US5867870A | 1970-07-27 | 1970-07-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2137592A1 true DE2137592A1 (de) | 1972-02-10 |
Family
ID=22018238
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712137592 Ceased DE2137592A1 (de) | 1970-07-27 | 1971-07-27 | 3-Formylcephalosporinsulfoxide und Verfahren zu ihrer Herstellung |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3674784A (OSRAM) |
| JP (1) | JPS558991B1 (OSRAM) |
| AT (1) | AT306238B (OSRAM) |
| BE (1) | BE770531A (OSRAM) |
| CA (1) | CA995208A (OSRAM) |
| CH (1) | CH572937A5 (OSRAM) |
| DE (1) | DE2137592A1 (OSRAM) |
| ES (1) | ES393681A1 (OSRAM) |
| FR (1) | FR2103742A5 (OSRAM) |
| GB (1) | GB1341712A (OSRAM) |
| IE (1) | IE35438B1 (OSRAM) |
| IL (1) | IL37279A (OSRAM) |
| NL (1) | NL7110368A (OSRAM) |
| RO (1) | RO57337A (OSRAM) |
| ZA (1) | ZA714387B (OSRAM) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0010667A1 (en) * | 1978-10-17 | 1980-05-14 | Fujisawa Pharmaceutical Co., Ltd. | Cepham compounds, pharmaceutical compositions containing them and processes for the preparation thereof and of known cephem compounds |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4123612A (en) * | 1970-08-10 | 1978-10-31 | Eli Lilly And Company | 7-(5-Amino-5-carboxyvaleramido)-3-(carbamoyoloxymethyl)-3-cephem-4-carboxylic acid |
| US3864338A (en) * | 1970-08-11 | 1975-02-04 | Squibb & Sons Inc | Process for the preparation of {66 {hu 2{b -cephalosporin aldehydes |
| US4065620A (en) * | 1971-06-14 | 1977-12-27 | Eli Lilly And Company | 3-(Substituted) vinyl cephalosporins |
| US3880851A (en) * | 1971-12-24 | 1975-04-29 | Lilly Co Eli | Antibiotic method |
| US4053469A (en) * | 1973-02-28 | 1977-10-11 | Shionogi & Co., Ltd. | Intermediates for the preparation of 7-acylamino-3-oxyiminomethyl-3-cephem-4-carboxylic acids |
| JPS49109391A (OSRAM) * | 1973-02-28 | 1974-10-17 | ||
| US4132790A (en) * | 1974-04-23 | 1979-01-02 | Eli Lilly And Company | Antibiotic A16886II |
| US4145538A (en) * | 1976-05-06 | 1979-03-20 | Eli Lilly And Company | 3-Carbamyloxymethyl-cephalosporins |
| US4363807A (en) * | 1978-04-06 | 1982-12-14 | Fujisawa Pharmaceutical Company, Limited | Cepham compounds |
| FR2457297A1 (fr) * | 1979-05-23 | 1980-12-19 | Rhone Poulenc Ind | Nouvelles vinyl-3 cephalosporines, et leur preparation |
| ZM884A1 (en) * | 1983-01-28 | 1984-10-22 | Bristol Myers Co | Substituted vinyl cephalosporins |
| US4520022A (en) * | 1983-01-28 | 1985-05-28 | Bristol-Myers Company | Substituted vinyl cephalosporins |
| US5856474A (en) * | 1994-04-25 | 1999-01-05 | Biochemie Gesellschaft, M.B.H. | Cephalosporin synthesis |
-
1970
- 1970-07-27 US US58678A patent/US3674784A/en not_active Expired - Lifetime
-
1971
- 1971-07-05 ZA ZA714387A patent/ZA714387B/xx unknown
- 1971-07-06 IE IE861/71A patent/IE35438B1/xx unknown
- 1971-07-09 IL IL37279A patent/IL37279A/xx unknown
- 1971-07-22 CA CA118,854A patent/CA995208A/en not_active Expired
- 1971-07-26 JP JP5589571A patent/JPS558991B1/ja active Pending
- 1971-07-26 GB GB3493171A patent/GB1341712A/en not_active Expired
- 1971-07-26 CH CH1099471A patent/CH572937A5/xx not_active IP Right Cessation
- 1971-07-27 ES ES393681A patent/ES393681A1/es not_active Expired
- 1971-07-27 FR FR7127495A patent/FR2103742A5/fr not_active Expired
- 1971-07-27 NL NL7110368A patent/NL7110368A/xx active Search and Examination
- 1971-07-27 AT AT655571A patent/AT306238B/de not_active IP Right Cessation
- 1971-07-27 RO RO67817A patent/RO57337A/ro unknown
- 1971-07-27 BE BE770531A patent/BE770531A/xx not_active IP Right Cessation
- 1971-07-27 DE DE19712137592 patent/DE2137592A1/de not_active Ceased
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0010667A1 (en) * | 1978-10-17 | 1980-05-14 | Fujisawa Pharmaceutical Co., Ltd. | Cepham compounds, pharmaceutical compositions containing them and processes for the preparation thereof and of known cephem compounds |
Also Published As
| Publication number | Publication date |
|---|---|
| AT306238B (de) | 1973-03-26 |
| NL7110368A (OSRAM) | 1972-01-31 |
| GB1341712A (en) | 1973-12-25 |
| US3674784A (en) | 1972-07-04 |
| RO57337A (OSRAM) | 1975-02-15 |
| FR2103742A5 (OSRAM) | 1972-04-14 |
| IE35438L (en) | 1972-01-27 |
| CH572937A5 (OSRAM) | 1976-02-27 |
| IE35438B1 (en) | 1976-02-18 |
| ZA714387B (en) | 1973-02-28 |
| BE770531A (fr) | 1972-01-27 |
| IL37279A0 (en) | 1971-10-20 |
| JPS558991B1 (OSRAM) | 1980-03-07 |
| CA995208A (en) | 1976-08-17 |
| ES393681A1 (es) | 1974-07-16 |
| IL37279A (en) | 1975-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2137592A1 (de) | 3-Formylcephalosporinsulfoxide und Verfahren zu ihrer Herstellung | |
| DE2824535A1 (de) | Penicillansaeure-1,1-dioxide, verfahren zu ihrer herstellung und diese enthaltende arzneimittel | |
| CH628901A5 (de) | Verfahren zur herstellung von cephalosporinantibiotika. | |
| DE4307422A1 (de) | Verfahren zur Herstellung von Clavulansäuresalzen | |
| DE2331179C2 (de) | Verfahren zur Herstellung von 2-Alkoxycephalosporinen | |
| DE1925230C3 (de) | Verfahren zur Herstellung des Antibiotikums Streptozotocin | |
| DE1950390A1 (de) | Neue 2-Acyloxycephalosporinverbindungen mit antibiotischer Aktivitaet,zu ihrer Herstellung geeignete Zwischenprodukte und Verfahren zur Herstellung der Verbindungen und Zwischenprodukte | |
| DE3008257C2 (de) | Verfahren zur Herstellung von Penicillansäure-1,1-dioxid und dessen Estern | |
| DE2534926C2 (de) | Verfahren zur Herstellung von Estern der 7-Oxo- und 7β-Hydroxy-cephalosporansäure und deren 3-substituierten Derivaten | |
| DE2140119A1 (de) | Verfahren zur Herstellung von Penicillinsulf oxiden | |
| DE2360620C2 (de) | Verfahren zur Herstellung von lactolartigen Cephalosporinen | |
| CH623825A5 (OSRAM) | ||
| DE2720088C2 (OSRAM) | ||
| DE3343198C2 (OSRAM) | ||
| DD149668A5 (de) | Verfahren zur herstellung von penicillinsulfoxiden | |
| DE2408686A1 (de) | 3-halogencephalosporine und verfahren zu deren herstellung | |
| DE3002659A1 (de) | Neue organische verbindungen, verfahren zu ihrer herstellung und ihre verwendung | |
| DE3217073C2 (de) | Verfahren zur Herstellung von 7α-Methoxycephemverbindungen | |
| DE3534857A1 (de) | Cephalosporinsulfoxide, verfahren zu deren herstellung und deren verwendung bei der herstellung von cephalosporinen | |
| DE2065708C3 (de) | 3-Halogenmethyl-Ä3-cephalosporinsulfoxidester und Verfahren zu ihrer Herstellung | |
| DE3212613C2 (OSRAM) | ||
| DE1937016C3 (de) | Verfahren zur Herstellung von Cephalosporjnsulfoxiden | |
| DE2740526A1 (de) | Clavulansaeureabkoemmlinge und deren herstellung | |
| DE1937015A1 (de) | Cephalospronsulfoxide | |
| DE1906194C3 (de) | 3-Brommethyl-A2 -cephalosporine und Verfahren zu ihrer Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8131 | Rejection |