DE2128672A1 - - Google Patents
Info
- Publication number
- DE2128672A1 DE2128672A1 DE19712128672 DE2128672A DE2128672A1 DE 2128672 A1 DE2128672 A1 DE 2128672A1 DE 19712128672 DE19712128672 DE 19712128672 DE 2128672 A DE2128672 A DE 2128672A DE 2128672 A1 DE2128672 A1 DE 2128672A1
- Authority
- DE
- Germany
- Prior art keywords
- carbon atoms
- chlorine
- substituted
- radical
- atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- -1 alkyl radical Chemical group 0.000 claims description 64
- 229910052801 chlorine Inorganic materials 0.000 claims description 45
- 125000004432 carbon atom Chemical group C* 0.000 claims description 42
- 239000000460 chlorine Substances 0.000 claims description 42
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 24
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 claims description 23
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 22
- 125000001246 bromo group Chemical group Br* 0.000 claims description 20
- 150000001875 compounds Chemical class 0.000 claims description 19
- 150000001805 chlorine compounds Chemical class 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 239000012948 isocyanate Substances 0.000 claims description 6
- 150000002513 isocyanates Chemical class 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- 239000012433 hydrogen halide Substances 0.000 claims description 4
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 150000001408 amides Chemical class 0.000 claims description 3
- 238000007363 ring formation reaction Methods 0.000 claims description 3
- 150000003951 lactams Chemical class 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 3
- 229910052794 bromium Inorganic materials 0.000 claims 3
- WPWHSFAFEBZWBB-UHFFFAOYSA-N 1-butyl radical Chemical compound [CH2]CCC WPWHSFAFEBZWBB-UHFFFAOYSA-N 0.000 claims 1
- WBLIXGSTEMXDSM-UHFFFAOYSA-N chloromethane Chemical compound Cl[CH2] WBLIXGSTEMXDSM-UHFFFAOYSA-N 0.000 claims 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 claims 1
- 210000002700 urine Anatomy 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 57
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 20
- 239000000047 product Substances 0.000 description 14
- 239000003054 catalyst Substances 0.000 description 13
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- 239000002904 solvent Substances 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 238000009835 boiling Methods 0.000 description 8
- 238000004458 analytical method Methods 0.000 description 7
- 125000005843 halogen group Chemical group 0.000 description 7
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- VYDQQISAMFZBDX-UHFFFAOYSA-N n-chloro-n-methylcarbamothioyl chloride Chemical compound CN(Cl)C(Cl)=S VYDQQISAMFZBDX-UHFFFAOYSA-N 0.000 description 5
- YMBCJWGVCUEGHA-UHFFFAOYSA-M tetraethylammonium chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC YMBCJWGVCUEGHA-UHFFFAOYSA-M 0.000 description 5
- STCOOQWBFONSKY-UHFFFAOYSA-N tributyl phosphate Chemical compound CCCCOP(=O)(OCCCC)OCCCC STCOOQWBFONSKY-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 125000000753 cycloalkyl group Chemical class 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- FJSKXQVRKZTKSI-UHFFFAOYSA-N 2,3-dimethylfuran Chemical compound CC=1C=COC=1C FJSKXQVRKZTKSI-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 2
- PHVFLGITSDWMKI-UHFFFAOYSA-N [formyl(methyl)amino] thiohypochlorite Chemical compound ClSN(C)C=O PHVFLGITSDWMKI-UHFFFAOYSA-N 0.000 description 2
- 239000012975 dibutyltin dilaurate Substances 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 239000012263 liquid product Substances 0.000 description 2
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 2
- 230000000361 pesticidal effect Effects 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- NTZPCBGVBWXEOC-UHFFFAOYSA-N (3-butan-2-ylphenyl) n-methylcarbamate Chemical compound CCC(C)C1=CC=CC(OC(=O)NC)=C1 NTZPCBGVBWXEOC-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 125000005999 2-bromoethyl group Chemical group 0.000 description 1
- HOZLOOPIXHWKCI-UHFFFAOYSA-N 2-chloro-n-methylacetamide Chemical compound CNC(=O)CCl HOZLOOPIXHWKCI-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- BKOOMYPCSUNDGP-UHFFFAOYSA-N 2-methylbut-2-ene Chemical group CC=C(C)C BKOOMYPCSUNDGP-UHFFFAOYSA-N 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 229920004449 Halon® Polymers 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 102000002423 Octamer Transcription Factor-6 Human genes 0.000 description 1
- 108010068113 Octamer Transcription Factor-6 Proteins 0.000 description 1
- 101150082690 Pou3f1 gene Proteins 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- GDVQUWOEJXJPNJ-UHFFFAOYSA-N [acetyl(methyl)amino] thiohypochlorite Chemical compound ClSN(C)C(C)=O GDVQUWOEJXJPNJ-UHFFFAOYSA-N 0.000 description 1
- SUCZVUATYUNKHF-UHFFFAOYSA-N [cyclohexyl(formyl)amino] thiohypochlorite Chemical compound ClSN(C=O)C1CCCCC1 SUCZVUATYUNKHF-UHFFFAOYSA-N 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 1
- 150000003585 thioureas Chemical class 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- DQWPFSLDHJDLRL-UHFFFAOYSA-N triethyl phosphate Chemical compound CCOP(=O)(OCC)OCC DQWPFSLDHJDLRL-UHFFFAOYSA-N 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US4590270A | 1970-06-12 | 1970-06-12 | |
US4590170A | 1970-06-12 | 1970-06-12 |
Publications (1)
Publication Number | Publication Date |
---|---|
DE2128672A1 true DE2128672A1 (enrdf_load_html_response) | 1971-12-16 |
Family
ID=26723322
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DE19712128672 Withdrawn DE2128672A1 (enrdf_load_html_response) | 1970-06-12 | 1971-06-09 |
Country Status (6)
Country | Link |
---|---|
JP (1) | JPS5636189B1 (enrdf_load_html_response) |
CA (1) | CA925512A (enrdf_load_html_response) |
CH (2) | CH568961A5 (enrdf_load_html_response) |
DE (1) | DE2128672A1 (enrdf_load_html_response) |
FR (1) | FR2095948A5 (enrdf_load_html_response) |
GB (1) | GB1311634A (enrdf_load_html_response) |
-
1971
- 1971-05-20 CA CA113534A patent/CA925512A/en not_active Expired
- 1971-06-04 FR FR7120365A patent/FR2095948A5/fr not_active Expired
- 1971-06-09 DE DE19712128672 patent/DE2128672A1/de not_active Withdrawn
- 1971-06-09 GB GB1978771A patent/GB1311634A/en not_active Expired
- 1971-06-10 JP JP4067771A patent/JPS5636189B1/ja active Pending
- 1971-06-11 CH CH884175A patent/CH568961A5/xx not_active IP Right Cessation
- 1971-06-11 CH CH857271A patent/CH566970A5/xx not_active IP Right Cessation
Also Published As
Publication number | Publication date |
---|---|
CA925512A (en) | 1973-05-01 |
GB1311634A (en) | 1973-03-28 |
FR2095948A5 (enrdf_load_html_response) | 1972-02-11 |
JPS5636189B1 (enrdf_load_html_response) | 1981-08-22 |
CH566970A5 (enrdf_load_html_response) | 1975-09-30 |
CH568961A5 (enrdf_load_html_response) | 1975-11-14 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE2206366C3 (de) | Verfahren zur Herstellung von substituierten Diaminocarbonylderivaten | |
DE2756638A1 (de) | Imidazoline, verfahren zu ihrer herstellung und ihre verwendung in schaedlingsbekaempfungsmitteln | |
DE1695594A1 (de) | In 2-Stellung substituierte delta1-Pyrrolinverbindungen und Verfahren zu ihrer Herstellung | |
DE2227919A1 (de) | Verfahren zur herstellung von benzimidazol-2-yl-carbaminsaeure-alkylestern | |
DE69604513T2 (de) | Verfahren zur Herstellung substituierter Carbodiimide | |
DE69427827T2 (de) | Verfahren zur Herstellung von Sulfonylharnstoffderivaten und Zwischenprodukte für dieses Verfahren | |
DE1964619A1 (de) | Adiabatisches Verfahren zur Herstellung von 2,4-Dichlor-6-amino-s-triazinen | |
DE1123662B (de) | Verfahren zur Herstellung von Alkylbenzoldiisocyanaten | |
DE2128672A1 (enrdf_load_html_response) | ||
DE1161905B (de) | Verfahren zur Herstellung von neuen Kondensationsprodukten tetramerer Halogencyane | |
DE2045440B2 (de) | Verfahren zur Herstellung von trisubstituierten Chlorsulfenylharnstoffen | |
CH616430A5 (en) | Process for preparing organic esters of phosphorus | |
DE2742158A1 (de) | Herstellung substituierter harnstoffe | |
DE1932297A1 (de) | Verfahren zur Herstellung von Benzimidazol-2-carbaminsaeureestern | |
DE2040502C3 (de) | Verfahren zur Herstellung von cyclischen Formamidinen | |
DE1261855B (de) | Verfahren zur Herstellung von reinem 2-N,N-Dimethylcarbamyl-3-methyl-pyrazolyl-(5)-N,N-dimethylcarbamat | |
DE2901334A1 (de) | Neue harnstoffderivate | |
DE929192C (de) | Verfahren zur Herstellung von am Stickstoffatom acylierten oder sulfonylierten aliphatischen Aminocarbonsaeureamiden | |
DE1445659C (de) | Pyndylphosphorverbindungen und Verfahren zu ihrer Herstellung | |
DE2063919A1 (de) | Verfahren zur Herstellung von Dial kylsulfiden | |
DE1793412C3 (de) | Verfahren zur Herstellung von N hoch 1 Acyl N hochl aryl N hoch 2, N hoch 2 dialkylharnstoffen | |
DE2062120C3 (de) | 2-Chloräthylphosphonsäurediamide und diese enthaltende Mittel | |
DE2053840A1 (en) | Carbamide acid chlorides/bromides prodn - by reaction of substd formamides with phosphorus-trihalides then with thionyl hal | |
DE3221874A1 (de) | Verfahren zur herstellung von n-carbamoyl-benzoesaeure-sulfimid-derivaten | |
DE2137649B2 (enrdf_load_html_response) |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
OD | Request for examination | ||
8128 | New person/name/address of the agent |
Representative=s name: DEUFEL, P., DIPL.-WIRTSCH.-ING. DR.RER.NAT. SCHOEN |
|
8130 | Withdrawal |