DE2121184A1 - Triazinearbonsäuren und -ester - Google Patents
Triazinearbonsäuren und -esterInfo
- Publication number
- DE2121184A1 DE2121184A1 DE19712121184 DE2121184A DE2121184A1 DE 2121184 A1 DE2121184 A1 DE 2121184A1 DE 19712121184 DE19712121184 DE 19712121184 DE 2121184 A DE2121184 A DE 2121184A DE 2121184 A1 DE2121184 A1 DE 2121184A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- triazine
- compound according
- bis
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000002253 acid Substances 0.000 title claims description 5
- 150000002148 esters Chemical class 0.000 title description 5
- 150000007513 acids Chemical class 0.000 title 1
- -1 R 2 and R Chemical group 0.000 claims description 36
- 150000001875 compounds Chemical class 0.000 claims description 20
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 19
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 2
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 claims 4
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 claims 2
- 125000001989 1,3-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([H])C([*:2])=C1[H] 0.000 claims 2
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 claims 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 43
- 239000000047 product Substances 0.000 description 35
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- 239000000203 mixture Substances 0.000 description 30
- 239000000243 solution Substances 0.000 description 28
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 23
- 238000006243 chemical reaction Methods 0.000 description 19
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- 235000011121 sodium hydroxide Nutrition 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- 238000010992 reflux Methods 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 238000000034 method Methods 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- 239000000725 suspension Substances 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 150000001413 amino acids Chemical class 0.000 description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- ITRGRVVBODKGCW-UHFFFAOYSA-N 4,6-dichloro-n,n-dimethyl-1,3,5-triazin-2-amine Chemical compound CN(C)C1=NC(Cl)=NC(Cl)=N1 ITRGRVVBODKGCW-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000012153 distilled water Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- WSGJFUKUCZAZNP-UHFFFAOYSA-N 2-[[4-(carboxymethylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]acetic acid Chemical compound CN(C)C1=NC(=NC(=N1)NCC(=O)O)NCC(=O)O WSGJFUKUCZAZNP-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 3
- 230000000903 blocking effect Effects 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- CLUHWBURHNNGPK-UHFFFAOYSA-M sodium;6-aminohexanoate Chemical compound [Na+].NCCCCCC([O-])=O CLUHWBURHNNGPK-UHFFFAOYSA-M 0.000 description 3
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 2
- HYWCPNMPNFJCMD-UHFFFAOYSA-N 4,6-dichloro-n,n-diethyl-1,3,5-triazin-2-amine Chemical compound CCN(CC)C1=NC(Cl)=NC(Cl)=N1 HYWCPNMPNFJCMD-UHFFFAOYSA-N 0.000 description 2
- UIKAQTBBQJSDQE-UHFFFAOYSA-N 4,6-dichloro-n,n-diphenyl-1,3,5-triazin-2-amine Chemical compound ClC1=NC(Cl)=NC(N(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 UIKAQTBBQJSDQE-UHFFFAOYSA-N 0.000 description 2
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 2
- FRGKKJTWAMJSSG-UHFFFAOYSA-N 6-[[4-(5-carboxypentylamino)-6-chloro-1,3,5-triazin-2-yl]amino]hexanoic acid Chemical compound OC(=O)CCCCCNC1=NC(Cl)=NC(NCCCCCC(O)=O)=N1 FRGKKJTWAMJSSG-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- UCMIRNVEIXFBKS-UHFFFAOYSA-N beta-alanine Chemical compound NCCC(O)=O UCMIRNVEIXFBKS-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- VAMXMNNIEUEQDV-UHFFFAOYSA-N methyl anthranilate Chemical compound COC(=O)C1=CC=CC=C1N VAMXMNNIEUEQDV-UHFFFAOYSA-N 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- UCAJPHQTEWYXEA-UHFFFAOYSA-N triazine-4-carboxylic acid Chemical class OC(=O)C1=CC=NN=N1 UCAJPHQTEWYXEA-UHFFFAOYSA-N 0.000 description 2
- CCVYCJAZARDILT-UHFFFAOYSA-N 1,1-dimethyl-2,2-diphenylhydrazine Chemical compound C=1C=CC=CC=1N(N(C)C)C1=CC=CC=C1 CCVYCJAZARDILT-UHFFFAOYSA-N 0.000 description 1
- BINQYVWLAWZYPX-UHFFFAOYSA-N 1,3,5-triazine-2-carboxylic acid Chemical class OC(=O)C1=NC=NC=N1 BINQYVWLAWZYPX-UHFFFAOYSA-N 0.000 description 1
- CMEPUAROFJSGJN-UHFFFAOYSA-N 1,4-dioxan-2-ylmethanol Chemical compound OCC1COCCO1 CMEPUAROFJSGJN-UHFFFAOYSA-N 0.000 description 1
- PBLZLIFKVPJDCO-UHFFFAOYSA-N 12-aminododecanoic acid Chemical compound NCCCCCCCCCCCC(O)=O PBLZLIFKVPJDCO-UHFFFAOYSA-N 0.000 description 1
- MCLXKFUCPVGZEN-UHFFFAOYSA-N 4,6-dichloro-1,3,5-triazin-2-amine Chemical compound NC1=NC(Cl)=NC(Cl)=N1 MCLXKFUCPVGZEN-UHFFFAOYSA-N 0.000 description 1
- XCENPWBBAXQVCG-UHFFFAOYSA-N 4-phenylpiperidine-4-carbaldehyde Chemical compound C=1C=CC=CC=1C1(C=O)CCNCC1 XCENPWBBAXQVCG-UHFFFAOYSA-N 0.000 description 1
- JKVDEDJXZDILBN-UHFFFAOYSA-N 6-[[4-(5-carboxypentylamino)-6-(N-phenylanilino)-1,3,5-triazin-2-yl]amino]hexanoic acid Chemical compound OC(=O)CCCCCNC1=NC(NCCCCCC(O)=O)=NC(N(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 JKVDEDJXZDILBN-UHFFFAOYSA-N 0.000 description 1
- YRNBQXCHGUJRKY-UHFFFAOYSA-N 6-[[4-(5-carboxypentylamino)-6-(diethylamino)-1,3,5-triazin-2-yl]amino]hexanoic acid Chemical compound CCN(CC)C1=NC(NCCCCCC(O)=O)=NC(NCCCCCC(O)=O)=N1 YRNBQXCHGUJRKY-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical compound OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 101100190858 Bacillus subtilis (strain 168) pnbA gene Proteins 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 206010035148 Plague Diseases 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical class [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- BLFLLBZGZJTVJG-UHFFFAOYSA-N benzocaine Chemical compound CCOC(=O)C1=CC=C(N)C=C1 BLFLLBZGZJTVJG-UHFFFAOYSA-N 0.000 description 1
- 229940000635 beta-alanine Drugs 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- SMEDVXJKKOXLCP-UHFFFAOYSA-N cyamelide Chemical compound N=C1OC(=N)OC(=N)O1 SMEDVXJKKOXLCP-UHFFFAOYSA-N 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- YSBGCHXLMBAKPV-UHFFFAOYSA-L disodium;2-(carboxylatomethylamino)acetate;hydrate Chemical compound O.[Na+].[Na+].[O-]C(=O)CNCC([O-])=O YSBGCHXLMBAKPV-UHFFFAOYSA-L 0.000 description 1
- 101150070550 estB gene Proteins 0.000 description 1
- 229960003692 gamma aminobutyric acid Drugs 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- VZDNXXPBYLGWOS-UHFFFAOYSA-N methyl 3-aminobenzoate Chemical compound COC(=O)C1=CC=CC(N)=C1 VZDNXXPBYLGWOS-UHFFFAOYSA-N 0.000 description 1
- CZRBJACESSICCS-UHFFFAOYSA-N methyl 4-[[4-(diethylamino)-6-(4-methoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]benzoate Chemical compound N=1C(NC=2C=CC(=CC=2)C(=O)OC)=NC(N(CC)CC)=NC=1NC1=CC=C(C(=O)OC)C=C1 CZRBJACESSICCS-UHFFFAOYSA-N 0.000 description 1
- 229940102398 methyl anthranilate Drugs 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- YCWSUKQGVSGXJO-NTUHNPAUSA-N nifuroxazide Chemical group C1=CC(O)=CC=C1C(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 YCWSUKQGVSGXJO-NTUHNPAUSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920002480 polybenzimidazole Polymers 0.000 description 1
- 229920002577 polybenzoxazole Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 235000011118 potassium hydroxide Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000013014 purified material Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/54—Three nitrogen atoms
- C07D251/70—Other substituted melamines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US3352770A | 1970-04-30 | 1970-04-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2121184A1 true DE2121184A1 (de) | 1971-11-11 |
Family
ID=21870920
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712121184 Pending DE2121184A1 (de) | 1970-04-30 | 1971-04-29 | Triazinearbonsäuren und -ester |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3697520A (enExample) |
| CA (1) | CA949970A (enExample) |
| DE (1) | DE2121184A1 (enExample) |
| FR (1) | FR2090955A5 (enExample) |
| GB (1) | GB1326887A (enExample) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2840960A1 (de) * | 1977-09-23 | 1979-04-12 | Ciba Geigy Ag | Triazinringe enthaltende dicarbonsaeuren und polyester aus diesen dicarbonsaeuren |
| EP0024254A1 (de) * | 1979-07-25 | 1981-02-25 | Ciba-Geigy Ag | Aminotriazinpolycarbonsäuren und deren Teilester, deren Herstellung und deren Verwendung als Härter für Epoxidharze |
| EP0087098A3 (en) * | 1982-02-23 | 1984-12-05 | Basf Aktiengesellschaft | S-triazine derivatives and their use as sunscreen agents |
| EP1655303A2 (en) | 2000-05-19 | 2006-05-10 | Ciba SC Holding AG | Hydroxylamine esters as polimerization initiators |
| EP2009041A1 (en) | 2003-12-19 | 2008-12-31 | Ciba Holding Inc. | Fluorocarbon terminated oligo- and poly-carbonates as surface modifiers |
| DE102008061137A1 (de) | 2008-12-09 | 2010-06-10 | Borealis Agrolinz Melamine Gmbh | Neue Triazinpolymere, Verfahren zu deren Herstellung und deren Verwendung |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4132850A (en) * | 1977-06-29 | 1979-01-02 | American Cyanamid Company | Tri-substituted triazines |
| US4183929A (en) * | 1977-06-29 | 1980-01-15 | American Cyanamid Company | Tri-substituted triazines |
| CH635814A5 (de) * | 1978-09-29 | 1983-04-29 | Ciba Geigy Ag | Umesterungsverfahren. |
| US4402907A (en) * | 1980-08-13 | 1983-09-06 | Ciba-Geigy Corporation | Triazine carboxylic acids as corrosion inhibitors for aqueous systems |
| US4386177A (en) * | 1981-07-20 | 1983-05-31 | American Cyanamid Company | Light stabilizers for polymers containing hindered piperidinyl-substituted 1,3,5 triazine groups |
| DE3333457A1 (de) * | 1983-09-16 | 1985-04-04 | Hoechst Ag, 6230 Frankfurt | Perfluoralkyl-anthranilsaeureester, verfahren zu deren herstellung und ihre verwendung als schmutzabweisendes mittel |
| GB8911569D0 (en) * | 1989-05-19 | 1989-07-05 | Ciba Geigy Ag | Antifreeze compositions |
| DE59203008D1 (de) * | 1991-04-24 | 1995-08-31 | Ciba Geigy Ag | Fliessfähige wässrige Dispersionen von Polycarbonsäure-Korrosionsinhibitoren. |
| IT1283295B1 (it) * | 1996-03-22 | 1998-04-16 | 3V Sigma Spa | Filtri solari |
| JP3793222B2 (ja) * | 2004-07-02 | 2006-07-05 | キヤノン株式会社 | インクジェット用インク、インクセット、インクジェット記録方法、インクカートリッジ、記録ユニット、及びインクジェット記録装置 |
| CN102250029B (zh) * | 2011-05-16 | 2015-02-11 | 烟台恒迪克能源科技有限公司 | 一种三嗪羟乙基乙二胺基多元羧酸的制备方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1670525A1 (enExample) * | 1966-05-21 | 1971-12-09 |
-
1970
- 1970-04-30 US US33527A patent/US3697520A/en not_active Expired - Lifetime
-
1971
- 1971-04-19 CA CA110,654A patent/CA949970A/en not_active Expired
- 1971-04-29 FR FR7115415A patent/FR2090955A5/fr not_active Expired
- 1971-04-29 DE DE19712121184 patent/DE2121184A1/de active Pending
- 1971-04-29 GB GB1213971*[A patent/GB1326887A/en not_active Expired
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2840960A1 (de) * | 1977-09-23 | 1979-04-12 | Ciba Geigy Ag | Triazinringe enthaltende dicarbonsaeuren und polyester aus diesen dicarbonsaeuren |
| FR2404019A1 (fr) * | 1977-09-23 | 1979-04-20 | Ciba Geigy Ag | Acides dicarboxyliques contenant des noyaux triaziniques et polyesters obtenus a partir de ces acides dicarboxyliques |
| DE2858749C2 (enExample) * | 1977-09-23 | 1991-02-21 | Ciba-Geigy Ag, Basel, Ch | |
| EP0024254A1 (de) * | 1979-07-25 | 1981-02-25 | Ciba-Geigy Ag | Aminotriazinpolycarbonsäuren und deren Teilester, deren Herstellung und deren Verwendung als Härter für Epoxidharze |
| EP0087098A3 (en) * | 1982-02-23 | 1984-12-05 | Basf Aktiengesellschaft | S-triazine derivatives and their use as sunscreen agents |
| EP1655303A2 (en) | 2000-05-19 | 2006-05-10 | Ciba SC Holding AG | Hydroxylamine esters as polimerization initiators |
| EP2009041A1 (en) | 2003-12-19 | 2008-12-31 | Ciba Holding Inc. | Fluorocarbon terminated oligo- and poly-carbonates as surface modifiers |
| DE102008061137A1 (de) | 2008-12-09 | 2010-06-10 | Borealis Agrolinz Melamine Gmbh | Neue Triazinpolymere, Verfahren zu deren Herstellung und deren Verwendung |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1326887A (en) | 1973-08-15 |
| FR2090955A5 (enExample) | 1972-01-14 |
| CA949970A (en) | 1974-06-25 |
| US3697520A (en) | 1972-10-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2121184A1 (de) | Triazinearbonsäuren und -ester | |
| DE69428300T2 (de) | Verfahren zur Herstellung von 1,3,5-Triazinecarbamate, 1,3,5-Triazine welche mindestens zur functionelle Carbamatgruppe enthalten | |
| DE1118789B (de) | Verfahren zur Herstellung von 1, 3, 5-Triazinderivaten | |
| DE2237632C3 (de) | H4-Hydro3qr-6-methyl-2-pvrimidinyD-3-methyl-pyrazolin-5-on, ein Verfahren zu dessen Herstellung und dessen Verwendung zur Herstellung von l-(4-Methoxy-6methyl-2-pyrimidinyl)-3-methyl-5-methoxypyrazol | |
| DE1668805A1 (de) | Verfahren zur Herstellung von Isocyanatophenolen | |
| DE3531912A1 (de) | Hydroxyoxaalkylmelamine, verfahren zu ihrer herstellung und deren verwendung | |
| US20080251758A1 (en) | Triazine Compounds Comprising Substituents Containing Amino Groups and Carboxyl Groups | |
| DE2126148A1 (en) | Prepn of uracil derivs - useful as plant - protection agents and their inters | |
| DD210055A5 (de) | Verfahren zur herstellung von n-phosphonomethylglycin | |
| EP0179408B1 (de) | Neue Amidoalkylmelamine und Aminoalkylmelamine und Verfahren zu ihrer Herstellung | |
| US2725379A (en) | Triazeve pharmaceuticals | |
| DE2131330A1 (de) | Imidazo-[1,2-a]-benzimidazolderivate und Verfahren zur Herstellung derselben | |
| US2658893A (en) | Preparation of halodiaminotriazines | |
| DE2038182C3 (de) | 2-Substituierte 4,6-Diamino-stri azine | |
| DE2025860C3 (de) | Verfahren zur Herstellung von Tris-(3,5-dialkyl-4-hydroxy-benzyl)-isocyanuraten | |
| DE2053414A1 (de) | Diamino s triazine | |
| DE3411202C2 (de) | Verfahren zur Herstellung von 2-Amino-s-triazinen | |
| DE3829957A1 (de) | Verfahren zur herstellung von oxyguanidinen | |
| DE2233862B2 (de) | Verfahren zur herstellung von dimethylmaleinsaeureanhydrid | |
| DE2164618A1 (de) | Verbindung mit antihypertensiver Wir kung und Verfahren zu ihrer Herstellung | |
| DE2307174A1 (de) | Verfahren zur herstellung von 5-substituierten 5h-dibenzo eckige klammer auf b,f eckige klammer zu azepinen | |
| DE2153513A1 (de) | 2,2'-bis-(5,6-dihydro-4h-l,3-oxazine) | |
| DE1470053C (de) | S^-Diamino-ö-chlor-pyrazinoylguanidine, deren Salze und Verfahren zu ihrer Herstellung | |
| AT204564B (de) | Verfahren zur Herstellung von neuen stickstoffhaltigen organischen Phosphorverbindungen | |
| DE1470052C (de) | (3 -Amino-6-chlor-pyrazinamido)-guanidine, deren Salze und Verfahren zu deren Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| OHW | Rejection |