DE2116507A1 - Chinolinderivate und Verfahren zu ihrer Herstellung - Google Patents
Chinolinderivate und Verfahren zu ihrer HerstellungInfo
- Publication number
- DE2116507A1 DE2116507A1 DE19712116507 DE2116507A DE2116507A1 DE 2116507 A1 DE2116507 A1 DE 2116507A1 DE 19712116507 DE19712116507 DE 19712116507 DE 2116507 A DE2116507 A DE 2116507A DE 2116507 A1 DE2116507 A1 DE 2116507A1
- Authority
- DE
- Germany
- Prior art keywords
- phenylquinoline
- chloro
- acetamido
- radical
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 6
- 238000002360 preparation method Methods 0.000 title claims description 6
- 229940027991 antiseptic and disinfectant quinoline derivative Drugs 0.000 title description 4
- 125000002943 quinolinyl group Chemical class N1=C(C=CC2=CC=CC=C12)* 0.000 title 1
- -1 substituted alkyl radical Chemical class 0.000 claims description 39
- 150000001875 compounds Chemical class 0.000 claims description 25
- FSEXLNMNADBYJU-UHFFFAOYSA-N alpha-Phenylquinoline Natural products C1=CC=CC=C1C1=CC=C(C=CC=C2)C2=N1 FSEXLNMNADBYJU-UHFFFAOYSA-N 0.000 claims description 11
- 239000003795 chemical substances by application Substances 0.000 claims description 10
- 125000003277 amino group Chemical group 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- 125000004442 acylamino group Chemical group 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- VBQVHWHWZOUENI-UHFFFAOYSA-N 1-phenyl-2H-quinoline Chemical compound C1C=CC2=CC=CC=C2N1C1=CC=CC=C1 VBQVHWHWZOUENI-UHFFFAOYSA-N 0.000 claims 1
- KPFVEIDKEQQBJG-UHFFFAOYSA-N C1=CC=CC=C1C1=CC=NC2=C1C=C(C=C2)N(=O)=O Chemical compound C1=CC=CC=C1C1=CC=NC2=C1C=C(C=C2)N(=O)=O KPFVEIDKEQQBJG-UHFFFAOYSA-N 0.000 claims 1
- MGJDSUCMJJJCFJ-UHFFFAOYSA-N N-(6-methyl-4-phenylquinolin-3-yl)acetamide Chemical compound C(C)(=O)NC=1C=NC2=CC=C(C=C2C1C1=CC=CC=C1)C MGJDSUCMJJJCFJ-UHFFFAOYSA-N 0.000 claims 1
- 238000002844 melting Methods 0.000 description 34
- 230000008018 melting Effects 0.000 description 34
- 239000000203 mixture Substances 0.000 description 15
- 239000013078 crystal Substances 0.000 description 14
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- 208000025865 Ulcer Diseases 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- 231100000397 ulcer Toxicity 0.000 description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 238000001953 recrystallisation Methods 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- YYSNEOZYIJSAOB-UHFFFAOYSA-N 6-chloro-4-phenylquinolin-3-amine Chemical compound NC1=CN=C2C=CC(Cl)=CC2=C1C1=CC=CC=C1 YYSNEOZYIJSAOB-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 229940121363 anti-inflammatory agent Drugs 0.000 description 5
- 239000002260 anti-inflammatory agent Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 241000224526 Trichomonas Species 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 150000003248 quinolines Chemical class 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000006722 reduction reaction Methods 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- KAITYFBNFIWDMF-UHFFFAOYSA-N N-(6-amino-4-phenylquinolin-3-yl)acetamide Chemical compound C(C)(=O)NC=1C=NC2=CC=C(C=C2C1C1=CC=CC=C1)N KAITYFBNFIWDMF-UHFFFAOYSA-N 0.000 description 2
- NCMOCBSQZRVKKA-UHFFFAOYSA-N N-(6-nitro-4-phenylquinolin-3-yl)acetamide Chemical compound C(C)(=O)NC=1C=NC2=CC=C(C=C2C1C1=CC=CC=C1)[N+](=O)[O-] NCMOCBSQZRVKKA-UHFFFAOYSA-N 0.000 description 2
- SALXRUZZOLTJNA-UHFFFAOYSA-N NC=1C=NC2=CC=C(C=C2C1C1=CC=CC=C1)N Chemical compound NC=1C=NC2=CC=C(C=C2C1C1=CC=CC=C1)N SALXRUZZOLTJNA-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 230000000397 acetylating effect Effects 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 239000003716 antitrichomonal agent Substances 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- FYFYCAVDUPOEOO-HNQUOIGGSA-N (ne)-n-(2-nitroethylidene)hydroxylamine Chemical compound O\N=C\C[N+]([O-])=O FYFYCAVDUPOEOO-HNQUOIGGSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N 1,1-Diethoxyethane Chemical compound CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- ISULZYQDGYXDFW-UHFFFAOYSA-N 3-methylbutanoyl chloride Chemical compound CC(C)CC(Cl)=O ISULZYQDGYXDFW-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- HEZLKMRHRAHOJJ-UHFFFAOYSA-N 4-(4-methoxyphenyl)quinoline Chemical compound C1=CC(OC)=CC=C1C1=CC=NC2=CC=CC=C12 HEZLKMRHRAHOJJ-UHFFFAOYSA-N 0.000 description 1
- ORYYQSTYNMOPOF-UHFFFAOYSA-N 6,7-dimethoxy-4-phenylquinolin-3-amine Chemical compound NC=1C=NC2=CC(=C(C=C2C1C1=CC=CC=C1)OC)OC ORYYQSTYNMOPOF-UHFFFAOYSA-N 0.000 description 1
- GSPUIRGSJNBASG-UHFFFAOYSA-N 6-bromo-4-phenylquinolin-3-amine Chemical compound NC1=CN=C2C=CC(Br)=CC2=C1C1=CC=CC=C1 GSPUIRGSJNBASG-UHFFFAOYSA-N 0.000 description 1
- UHEGAEFVIIDANZ-UHFFFAOYSA-N 6-iodo-4-phenylquinolin-3-amine Chemical compound NC=1C=NC2=CC=C(C=C2C1C1=CC=CC=C1)I UHEGAEFVIIDANZ-UHFFFAOYSA-N 0.000 description 1
- SLSOVEYDNOBEDB-UHFFFAOYSA-N 6-methoxy-4-phenylquinolin-3-amine Chemical compound C12=CC(OC)=CC=C2N=CC(N)=C1C1=CC=CC=C1 SLSOVEYDNOBEDB-UHFFFAOYSA-N 0.000 description 1
- UDDRLAGURIPKQM-UHFFFAOYSA-N 6-methyl-4-phenylquinolin-3-amine Chemical compound C12=CC(C)=CC=C2N=CC(N)=C1C1=CC=CC=C1 UDDRLAGURIPKQM-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- TXDNHGKXELTPPU-UHFFFAOYSA-N CCOC(C(C1=CC=CC=C1)N=CC(C=C(C=C1)[N+]([O-])=O)=C1N)OCC Chemical compound CCOC(C(C1=CC=CC=C1)N=CC(C=C(C=C1)[N+]([O-])=O)=C1N)OCC TXDNHGKXELTPPU-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 206010022714 Intestinal ulcer Diseases 0.000 description 1
- AQVFFAQGUBFKLF-UHFFFAOYSA-N N-(3-acetamido-4-phenylquinolin-6-yl)acetamide Chemical compound C(C)(=O)NC=1C=NC2=CC=C(C=C2C1C1=CC=CC=C1)NC(C)=O AQVFFAQGUBFKLF-UHFFFAOYSA-N 0.000 description 1
- FTNQQGHDUUMBIP-UHFFFAOYSA-N N-(6-bromo-4-phenylquinolin-3-yl)acetamide Chemical compound C(C)(=O)NC=1C=NC2=CC=C(C=C2C1C1=CC=CC=C1)Br FTNQQGHDUUMBIP-UHFFFAOYSA-N 0.000 description 1
- 208000007107 Stomach Ulcer Diseases 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 239000003699 antiulcer agent Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 208000000718 duodenal ulcer Diseases 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- CYWFCPPBTWOZSF-UHFFFAOYSA-N ibufenac Chemical compound CC(C)CC1=CC=C(CC(O)=O)C=C1 CYWFCPPBTWOZSF-UHFFFAOYSA-N 0.000 description 1
- 229950009183 ibufenac Drugs 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 125000002960 margaryl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940126601 medicinal product Drugs 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229960002895 phenylbutazone Drugs 0.000 description 1
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- AAZYNPCMLRQUHI-UHFFFAOYSA-N propan-2-one;2-propan-2-yloxypropane Chemical compound CC(C)=O.CC(C)OC(C)C AAZYNPCMLRQUHI-UHFFFAOYSA-N 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000036269 ulceration Effects 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000003 vaginal tablet Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/18—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
- C07D215/40—Nitrogen atoms attached in position 8
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Quinoline Compounds (AREA)
- Footwear And Its Accessory, Manufacturing Method And Apparatuses (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2885070 | 1970-04-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2116507A1 true DE2116507A1 (de) | 1971-12-02 |
Family
ID=12259838
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712116507 Pending DE2116507A1 (de) | 1970-04-04 | 1971-04-05 | Chinolinderivate und Verfahren zu ihrer Herstellung |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3798226A (enExample) |
| AT (1) | AT304555B (enExample) |
| BE (1) | BE765287A (enExample) |
| CA (1) | CA936535A (enExample) |
| CH (1) | CH559185A5 (enExample) |
| CS (1) | CS161127B2 (enExample) |
| DE (1) | DE2116507A1 (enExample) |
| DK (1) | DK127927B (enExample) |
| ES (1) | ES389890A1 (enExample) |
| FI (1) | FI49604C (enExample) |
| FR (1) | FR2092001B1 (enExample) |
| GB (1) | GB1290818A (enExample) |
| HU (1) | HU163639B (enExample) |
| NL (1) | NL7104487A (enExample) |
| NO (1) | NO133758C (enExample) |
| PH (1) | PH9881A (enExample) |
| SE (1) | SE360867B (enExample) |
| SU (1) | SU402213A3 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5523407A (en) * | 1989-12-11 | 1996-06-04 | Takeda Chemical Industries, Ltd. | Quinoline derivatives, their production and use as ACAT inhibitors |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0035868A1 (en) * | 1980-03-07 | 1981-09-16 | Takeda Chemical Industries, Ltd. | Bicyclic compounds, their production and use |
| IT1226045B (it) * | 1981-07-29 | 1990-12-10 | Simes | Derivati tetraidrochinolici |
| IE892088L (en) * | 1988-07-12 | 1990-01-12 | William Henry Deryk Morris | Quinoline derivatives, their production and use |
| TW205037B (enExample) * | 1989-10-06 | 1993-05-01 | Takeda Pharm Industry Co Ltd | |
| US5256782A (en) * | 1990-08-17 | 1993-10-26 | Takeda Chemical Industries, Ltd. | Thienopyridine derivatives which are intermediates |
| US5143919A (en) * | 1990-08-17 | 1992-09-01 | Takeda Chemical Industries, Ltd. | Thienopyridine derivatives and their pharmaceutical use |
| JPH059179A (ja) * | 1990-09-27 | 1993-01-19 | Takeda Chem Ind Ltd | 複素環化合物、その製造法及びacat阻害剤 |
| ATE124408T1 (de) * | 1990-10-16 | 1995-07-15 | Takeda Chemical Industries Ltd | Heterozyklische aminderivate, deren herstellung und deren verwendung. |
| DE69315920T2 (de) * | 1992-09-04 | 1998-06-10 | Takeda Chemical Industries Ltd | Kondensierte heterozyklische Verbindungen, deren Herstellung und Verwendung |
| JP4667384B2 (ja) * | 2003-10-07 | 2011-04-13 | レノビス, インコーポレイテッド | イオンチャネルリガンドとしてのアミド誘導体および薬学的組成物、ならびにこれらを使用する方法 |
| US7576099B2 (en) * | 2005-02-28 | 2009-08-18 | Renovis, Inc. | Amide derivatives as ion-channel ligands and pharmaceutical compositions and methods of using the same |
| US20080300243A1 (en) * | 2005-02-28 | 2008-12-04 | Kelly Michael G | Amide Derivatives as Ion-Channel Ligands and Pharmaceutical Compositions and Methods of Using the Same |
-
1971
- 1971-03-29 NO NO1173/71A patent/NO133758C/no unknown
- 1971-04-02 US US00130853A patent/US3798226A/en not_active Expired - Lifetime
- 1971-04-02 HU HUTA1113A patent/HU163639B/hu unknown
- 1971-04-02 CS CS2384A patent/CS161127B2/cs unknown
- 1971-04-02 DK DK158571AA patent/DK127927B/da unknown
- 1971-04-02 NL NL7104487A patent/NL7104487A/xx unknown
- 1971-04-02 AT AT283171A patent/AT304555B/de not_active IP Right Cessation
- 1971-04-02 SE SE04360/71A patent/SE360867B/xx unknown
- 1971-04-02 CH CH479371A patent/CH559185A5/xx not_active IP Right Cessation
- 1971-04-02 FR FR7111652A patent/FR2092001B1/fr not_active Expired
- 1971-04-02 CA CA109448A patent/CA936535A/en not_active Expired
- 1971-04-02 SU SU1641012A patent/SU402213A3/ru active
- 1971-04-03 ES ES389890A patent/ES389890A1/es not_active Expired
- 1971-04-05 FI FI710947A patent/FI49604C/fi active
- 1971-04-05 BE BE765287A patent/BE765287A/xx unknown
- 1971-04-05 DE DE19712116507 patent/DE2116507A1/de active Pending
- 1971-04-19 GB GB1290818D patent/GB1290818A/en not_active Expired
-
1976
- 1976-04-02 PH PH12342A patent/PH9881A/en unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5523407A (en) * | 1989-12-11 | 1996-06-04 | Takeda Chemical Industries, Ltd. | Quinoline derivatives, their production and use as ACAT inhibitors |
Also Published As
| Publication number | Publication date |
|---|---|
| CH559185A5 (enExample) | 1975-02-28 |
| NL7104487A (enExample) | 1971-10-06 |
| DK127927B (da) | 1974-02-04 |
| SU402213A3 (enExample) | 1973-10-12 |
| PH9881A (en) | 1976-05-18 |
| HU163639B (enExample) | 1973-09-27 |
| BE765287A (fr) | 1971-08-30 |
| NO133758B (enExample) | 1976-03-15 |
| GB1290818A (enExample) | 1972-09-27 |
| NO133758C (enExample) | 1976-06-23 |
| FR2092001B1 (enExample) | 1975-06-06 |
| FI49604C (fi) | 1975-08-11 |
| CA936535A (en) | 1973-11-06 |
| AT304555B (de) | 1973-01-10 |
| CS161127B2 (enExample) | 1975-05-04 |
| US3798226A (en) | 1974-03-19 |
| ES389890A1 (es) | 1973-06-01 |
| FI49604B (enExample) | 1975-04-30 |
| FR2092001A1 (enExample) | 1972-01-21 |
| SE360867B (enExample) | 1973-10-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0002482B1 (de) | 4-Hydroxy-2H-1,2-benzothiazin-3-carboxamid-1,1-dioxide, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE1967325B2 (de) | Isomere 3,4-Dihydro-2H-1,2-benzothiazin-1,1-dioxide | |
| DE2116507A1 (de) | Chinolinderivate und Verfahren zu ihrer Herstellung | |
| DE2519480A1 (de) | Aryl-oxo-heptensaeuren | |
| DE2356903A1 (de) | Verfahren zur herstellung substituierter chromon-3-carbonitrile, -carboxamide und -carbonsaeuren | |
| DE2141616C3 (de) | Oxazole- und Oxazine eckige Klammer auf 3,2-c eckige Klammer zu chinazolinone, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2059824A1 (de) | Heterocyclische Verbindungen | |
| DE2812353A1 (de) | Oxazol- und thiazol-alkansaeureverbindungen, verfahren zu ihrer herstellung und sie enthaltendes pharmazeutisches mittel | |
| DE1795150C3 (de) | 2-Alkyl-2,3-dihydrothieno eckige Klammer auf 3,2-c eckige Klammer zu chinoline, deren pharmazeutisch unbedenkliche nichttoxische Salze mit Säuren und Verfahren zu ihrer Herstellung | |
| EP0102318A2 (de) | Herstellung von beta-Amino-alpha,beta-ungesättigten Carbonsäureestern | |
| DE2503436A1 (de) | 2-substituierte 4,5-diphenylthiazole, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| EP0439766A2 (de) | Verfahren zur Herstellung von N-Acyl-4-phenyl-pyrrolidin-2-onen mit cerebroprotektiver Wirkung | |
| CH461489A (de) | Verfahren zur Herstellung von neuen Oxazolderivaten | |
| DE2752361A1 (de) | Neue indolderivate, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| AT268321B (de) | Verfahren zur Herstellung von neuen heterocyclischen Verbindungen und ihren Salzen | |
| DE3313599A1 (de) | Neue benzimidazolderivate | |
| DE69215040T2 (de) | Saishin N-Derivate, ihre Herstellungsverfahren und diese enthaltende Antitumormittel | |
| AT354432B (de) | Verfahren zur herstellung von 3-indolylessig- saeuren | |
| DE1770449C3 (de) | 26.09.67 Japan 61864-67 Verfahren zur Herstellung von 5,6-Dihydro-4H-1,3,4-thiadiazin-5-onderivaten | |
| AT240859B (de) | Verfahren zur Herstellung von neuen Chinazolin-Derivaten | |
| AT314537B (de) | Verfahren zur Herstellung von neuen 1,3,4,9b-Tetrahydro-2H-indeno[1,2-c]pyridinen und ihren Säureadditionssalzen | |
| AT251584B (de) | Verfahren zur Herstellung von neuen 4(3H)-Chinazolinon-Derivaten | |
| AT206899B (de) | Verfahren zur Herstellung von neuen, substituierten 3,5-Dioxo-tetrahydro-1,2,6-thiadiazin-1,1-dioxyden | |
| AT352747B (de) | Verfahren zur herstellung von neuen thieno- thiazinderivaten | |
| AT239794B (de) | Verfahren zur Herstellung von neuen Benzoxazepin-Derivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |