GB1290818A - - Google Patents
Info
- Publication number
- GB1290818A GB1290818A GB1290818DA GB1290818A GB 1290818 A GB1290818 A GB 1290818A GB 1290818D A GB1290818D A GB 1290818DA GB 1290818 A GB1290818 A GB 1290818A
- Authority
- GB
- United Kingdom
- Prior art keywords
- april
- optionally substituted
- agents
- alkyl
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 abstract 2
- 101100440696 Caenorhabditis elegans cor-1 gene Proteins 0.000 abstract 1
- 208000025865 Ulcer Diseases 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 229940121363 anti-inflammatory agent Drugs 0.000 abstract 1
- 239000002260 anti-inflammatory agent Substances 0.000 abstract 1
- 230000000767 anti-ulcer Effects 0.000 abstract 1
- 230000000026 anti-ulcerogenic effect Effects 0.000 abstract 1
- 239000003716 antitrichomonal agent Substances 0.000 abstract 1
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 229940079593 drug Drugs 0.000 abstract 1
- 239000003814 drug Substances 0.000 abstract 1
- 230000000694 effects Effects 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- CYWFCPPBTWOZSF-UHFFFAOYSA-N ibufenac Chemical compound CC(C)CC1=CC=C(CC(O)=O)C=C1 CYWFCPPBTWOZSF-UHFFFAOYSA-N 0.000 abstract 1
- 229950009183 ibufenac Drugs 0.000 abstract 1
- 229960000905 indomethacin Drugs 0.000 abstract 1
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- 229960002895 phenylbutazone Drugs 0.000 abstract 1
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 abstract 1
- 125000000547 substituted alkyl group Chemical group 0.000 abstract 1
- 230000001225 therapeutic effect Effects 0.000 abstract 1
- 230000000699 topical effect Effects 0.000 abstract 1
- 231100000397 ulcer Toxicity 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/18—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
- C07D215/40—Nitrogen atoms attached in position 8
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Quinoline Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Footwear And Its Accessory, Manufacturing Method And Apparatuses (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2885070 | 1970-04-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1290818A true GB1290818A (enExample) | 1972-09-27 |
Family
ID=12259838
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB1290818D Expired GB1290818A (enExample) | 1970-04-04 | 1971-04-19 |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3798226A (enExample) |
| AT (1) | AT304555B (enExample) |
| BE (1) | BE765287A (enExample) |
| CA (1) | CA936535A (enExample) |
| CH (1) | CH559185A5 (enExample) |
| CS (1) | CS161127B2 (enExample) |
| DE (1) | DE2116507A1 (enExample) |
| DK (1) | DK127927B (enExample) |
| ES (1) | ES389890A1 (enExample) |
| FI (1) | FI49604C (enExample) |
| FR (1) | FR2092001B1 (enExample) |
| GB (1) | GB1290818A (enExample) |
| HU (1) | HU163639B (enExample) |
| NL (1) | NL7104487A (enExample) |
| NO (1) | NO133758C (enExample) |
| PH (1) | PH9881A (enExample) |
| SE (1) | SE360867B (enExample) |
| SU (1) | SU402213A3 (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5143919A (en) * | 1990-08-17 | 1992-09-01 | Takeda Chemical Industries, Ltd. | Thienopyridine derivatives and their pharmaceutical use |
| US5256782A (en) * | 1990-08-17 | 1993-10-26 | Takeda Chemical Industries, Ltd. | Thienopyridine derivatives which are intermediates |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0035868A1 (en) * | 1980-03-07 | 1981-09-16 | Takeda Chemical Industries, Ltd. | Bicyclic compounds, their production and use |
| IT1226045B (it) * | 1981-07-29 | 1990-12-10 | Simes | Derivati tetraidrochinolici |
| IE892088L (en) * | 1988-07-12 | 1990-01-12 | William Henry Deryk Morris | Quinoline derivatives, their production and use |
| TW205037B (enExample) * | 1989-10-06 | 1993-05-01 | Takeda Pharm Industry Co Ltd | |
| JPH03181465A (ja) * | 1989-12-11 | 1991-08-07 | Takeda Chem Ind Ltd | キノリン誘導体 |
| JPH059179A (ja) * | 1990-09-27 | 1993-01-19 | Takeda Chem Ind Ltd | 複素環化合物、その製造法及びacat阻害剤 |
| EP0481383B1 (en) * | 1990-10-16 | 1995-06-28 | Takeda Chemical Industries, Ltd. | Heterocyclic amine derivatives, their production and use |
| ATE161530T1 (de) * | 1992-09-04 | 1998-01-15 | Takeda Chemical Industries Ltd | Kondensierte heterozyklische verbindungen, deren herstellung und verwendung |
| WO2005046683A1 (en) * | 2003-10-07 | 2005-05-26 | Renovis, Inc. | Amide derivatives as ion-channel ligands and pharmaceutical compositions and methods of using the same |
| US7576099B2 (en) * | 2005-02-28 | 2009-08-18 | Renovis, Inc. | Amide derivatives as ion-channel ligands and pharmaceutical compositions and methods of using the same |
| US20080300243A1 (en) * | 2005-02-28 | 2008-12-04 | Kelly Michael G | Amide Derivatives as Ion-Channel Ligands and Pharmaceutical Compositions and Methods of Using the Same |
-
1971
- 1971-03-29 NO NO1173/71A patent/NO133758C/no unknown
- 1971-04-02 US US00130853A patent/US3798226A/en not_active Expired - Lifetime
- 1971-04-02 DK DK158571AA patent/DK127927B/da unknown
- 1971-04-02 CH CH479371A patent/CH559185A5/xx not_active IP Right Cessation
- 1971-04-02 NL NL7104487A patent/NL7104487A/xx unknown
- 1971-04-02 FR FR7111652A patent/FR2092001B1/fr not_active Expired
- 1971-04-02 HU HUTA1113A patent/HU163639B/hu unknown
- 1971-04-02 SE SE04360/71A patent/SE360867B/xx unknown
- 1971-04-02 AT AT283171A patent/AT304555B/de not_active IP Right Cessation
- 1971-04-02 CA CA109448A patent/CA936535A/en not_active Expired
- 1971-04-02 SU SU1641012A patent/SU402213A3/ru active
- 1971-04-02 CS CS2384A patent/CS161127B2/cs unknown
- 1971-04-03 ES ES389890A patent/ES389890A1/es not_active Expired
- 1971-04-05 FI FI710947A patent/FI49604C/fi active
- 1971-04-05 DE DE19712116507 patent/DE2116507A1/de active Pending
- 1971-04-05 BE BE765287A patent/BE765287A/xx unknown
- 1971-04-19 GB GB1290818D patent/GB1290818A/en not_active Expired
-
1976
- 1976-04-02 PH PH12342A patent/PH9881A/en unknown
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5143919A (en) * | 1990-08-17 | 1992-09-01 | Takeda Chemical Industries, Ltd. | Thienopyridine derivatives and their pharmaceutical use |
| US5256782A (en) * | 1990-08-17 | 1993-10-26 | Takeda Chemical Industries, Ltd. | Thienopyridine derivatives which are intermediates |
Also Published As
| Publication number | Publication date |
|---|---|
| HU163639B (enExample) | 1973-09-27 |
| DK127927B (da) | 1974-02-04 |
| CH559185A5 (enExample) | 1975-02-28 |
| ES389890A1 (es) | 1973-06-01 |
| FI49604C (fi) | 1975-08-11 |
| CA936535A (en) | 1973-11-06 |
| SE360867B (enExample) | 1973-10-08 |
| BE765287A (fr) | 1971-08-30 |
| DE2116507A1 (de) | 1971-12-02 |
| NO133758C (enExample) | 1976-06-23 |
| CS161127B2 (enExample) | 1975-05-04 |
| SU402213A3 (enExample) | 1973-10-12 |
| PH9881A (en) | 1976-05-18 |
| FI49604B (enExample) | 1975-04-30 |
| US3798226A (en) | 1974-03-19 |
| NL7104487A (enExample) | 1971-10-06 |
| NO133758B (enExample) | 1976-03-15 |
| FR2092001B1 (enExample) | 1975-06-06 |
| FR2092001A1 (enExample) | 1972-01-21 |
| AT304555B (de) | 1973-01-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1454778A (en) | Therapeutic compositions comprising dioxamates | |
| GB1290818A (enExample) | ||
| GB1147379A (en) | 4-alkyl-dialkoxy-ª‡-methylphenethylamines and pharmacologically acceptable salts | |
| GB1287659A (en) | Pyrimidinylpyrazole derivatives | |
| GB1367785A (en) | 2-substituted adenosine derivatives and the production thereof | |
| ES431497A1 (es) | Procedimiento para preparar un derivado de s-triazol (1,5- a) piridina. | |
| GB1169945A (en) | Pharmaceutical Compositions containing Diphenylalkyl-amine Derivatives | |
| GB1434805A (en) | 5-phenoxy-4-amino pyrimidines | |
| GB1256723A (enExample) | ||
| GB1325770A (en) | Pyrimidopyridazine derivatives | |
| GB1518042A (en) | Oxadiazolinone derivatives | |
| GB1291442A (en) | Adamantylamino-5,8-dihydronaphthyloxy-propanols and related compounds | |
| GB1246117A (en) | Pharmaceutical preparations containing glucose compounds, glucose derivatives and process for their manufacture | |
| GB1290841A (enExample) | ||
| GB1359044A (en) | Quinoline derivatives | |
| GB1160064A (en) | Indole Derivatives | |
| GB1195319A (en) | Alkyl Sulfate Salts of 1-(p-Chlorobenzhydryl)-4-Methylhomopiperazines | |
| GB1191039A (en) | Benzimidazole Methanesulphonates | |
| GB1264128A (enExample) | ||
| GB1228080A (enExample) | ||
| GB1457254A (en) | 1-phenoxy-2-hydroxy-3-chromonyloxy-propane derivatives | |
| GB1357733A (en) | 1,2,4-oxadiazole derivatives | |
| SE7612236L (sv) | Nya indol-derivat. | |
| GB1406307A (en) | Production of benzylpyrimidines | |
| GB1132397A (en) | Improvements in or relating to fluorene derivatives and the manufacture thereof |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PLNP | Patent lapsed through nonpayment of renewal fees |