DE2116433A1 - Elektronische Digitaluhr - Google Patents
Elektronische DigitaluhrInfo
- Publication number
- DE2116433A1 DE2116433A1 DE19712116433 DE2116433A DE2116433A1 DE 2116433 A1 DE2116433 A1 DE 2116433A1 DE 19712116433 DE19712116433 DE 19712116433 DE 2116433 A DE2116433 A DE 2116433A DE 2116433 A1 DE2116433 A1 DE 2116433A1
- Authority
- DE
- Germany
- Prior art keywords
- frequency
- line
- counter
- signal
- gate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000005669 field effect Effects 0.000 claims description 29
- 101100484930 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) VPS41 gene Proteins 0.000 claims 4
- 101150073536 FET3 gene Proteins 0.000 claims 3
- 101150079361 fet5 gene Proteins 0.000 claims 3
- 101150015217 FET4 gene Proteins 0.000 claims 2
- -1 PET3 Proteins 0.000 claims 1
- 239000011159 matrix material Substances 0.000 description 18
- 238000011156 evaluation Methods 0.000 description 15
- 238000010586 diagram Methods 0.000 description 10
- 238000004804 winding Methods 0.000 description 10
- 230000006870 function Effects 0.000 description 9
- 238000010438 heat treatment Methods 0.000 description 5
- 239000008186 active pharmaceutical agent Substances 0.000 description 3
- 238000013459 approach Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000010354 integration Effects 0.000 description 2
- BVGDAZBTIVRTGO-UONOGXRCSA-N 3-[(1r)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[4-methoxy-6-[(2s)-2-methylpiperazin-1-yl]pyridin-3-yl]pyridin-2-amine Chemical compound C1([C@@H](C)OC=2C(N)=NC=C(C=2)C2=CN=C(C=C2OC)N2[C@H](CNCC2)C)=C(Cl)C=CC(F)=C1Cl BVGDAZBTIVRTGO-UONOGXRCSA-N 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000007689 inspection Methods 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000001208 nuclear magnetic resonance pulse sequence Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G04—HOROLOGY
- G04G—ELECTRONIC TIME-PIECES
- G04G9/00—Visual time or date indication means
- G04G9/08—Visual time or date indication means by building-up characters using a combination of indicating elements, e.g. by using multiplexing techniques
- G04G9/10—Visual time or date indication means by building-up characters using a combination of indicating elements, e.g. by using multiplexing techniques by controlling light sources, e.g. electroluminescent diodes
- G04G9/107—Visual time or date indication means by building-up characters using a combination of indicating elements, e.g. by using multiplexing techniques by controlling light sources, e.g. electroluminescent diodes provided with means for displaying at will a time indication or a date or a part thereof
-
- G—PHYSICS
- G04—HOROLOGY
- G04G—ELECTRONIC TIME-PIECES
- G04G13/00—Producing acoustic time signals
- G04G13/02—Producing acoustic time signals at preselected times, e.g. alarm clocks
- G04G13/025—Producing acoustic time signals at preselected times, e.g. alarm clocks acting only at one preselected time
-
- G—PHYSICS
- G04—HOROLOGY
- G04G—ELECTRONIC TIME-PIECES
- G04G19/00—Electric power supply circuits specially adapted for use in electronic time-pieces
- G04G19/02—Conversion or regulation of current or voltage
- G04G19/06—Regulation
-
- G—PHYSICS
- G04—HOROLOGY
- G04G—ELECTRONIC TIME-PIECES
- G04G5/00—Setting, i.e. correcting or changing, the time-indication
- G04G5/02—Setting, i.e. correcting or changing, the time-indication by temporarily changing the number of pulses per unit time, e.g. quick-feed method
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Engineering & Computer Science (AREA)
- Power Engineering (AREA)
- Electric Clocks (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US2593070A | 1970-04-06 | 1970-04-06 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2116433A1 true DE2116433A1 (de) | 1971-11-04 |
Family
ID=21828841
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712116433 Pending DE2116433A1 (de) | 1970-04-06 | 1971-04-03 | Elektronische Digitaluhr |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3664116A (enExample) |
| CA (1) | CA930033A (enExample) |
| CH (2) | CH534386A (enExample) |
| DE (1) | DE2116433A1 (enExample) |
| GB (1) | GB1341252A (enExample) |
Families Citing this family (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1285012A (en) * | 1970-07-30 | 1972-08-09 | Seiko Instr & Electronics | Digital electronic timepiece |
| US3744235A (en) * | 1970-12-09 | 1973-07-10 | S Kratomi | Timepiece indicating time by generated images in sets |
| GB1339403A (en) * | 1971-02-03 | 1973-12-05 | Suwa Seikosha Kk | Timepiece |
| IT952097B (it) * | 1971-03-08 | 1973-07-20 | Suwa Seikosha Kk | Perfezionamento nei sistemi di misura del tempo a indicazione numerica |
| US3986333A (en) * | 1971-03-22 | 1976-10-19 | Sharp Kabushiki Kaisha | Electronic digital clock |
| GB1391995A (en) * | 1971-04-27 | 1975-04-23 | Seikosha Kk | Electric timepieces |
| US3823551A (en) * | 1971-05-03 | 1974-07-16 | Riehl Electronics Corp | Solid state electronic timepiece |
| US3817020A (en) * | 1971-05-04 | 1974-06-18 | Nippon Denso Co | Electronic digital clock |
| US3754392A (en) * | 1971-05-17 | 1973-08-28 | Motorola Inc | Apparatus for driving a light emitting diode of horologic display |
| US3969886A (en) * | 1971-06-30 | 1976-07-20 | Kabushiki Kaisha Daini Seikosha | Digital electronic watch for displaying both time and the time remaining within a preselected time period |
| JPS4847861A (enExample) * | 1971-10-19 | 1973-07-06 | ||
| GB1366794A (en) * | 1971-12-02 | 1974-09-11 | Seiko Instr & Electronics | Electronic timepiece |
| GB1391235A (en) * | 1972-01-22 | 1975-04-16 | Suwa Seikosha Kk | Digital wrist watch |
| US3813533A (en) * | 1972-06-02 | 1974-05-28 | Garrett Comtronics Corp | Clock calculator |
| JPS4969361A (enExample) * | 1972-11-06 | 1974-07-04 | ||
| JPS5548273B2 (enExample) * | 1973-01-22 | 1980-12-04 | ||
| US3803827A (en) * | 1973-02-01 | 1974-04-16 | Time Computer | Solid state electronic wristwatch |
| US3869854A (en) * | 1973-05-10 | 1975-03-11 | James A Church | Solid state electronic control |
| DE2425254C3 (de) * | 1973-05-28 | 1980-11-20 | Citizen Watch Co., Ltd., Tokio | Tragbare elektronische Uhr |
| US4065915A (en) * | 1973-06-11 | 1978-01-03 | Farnbach John S | Binary counting system |
| US3918250A (en) * | 1973-10-10 | 1975-11-11 | David N Torresdal | Multi-channel digital clock |
| US3943288A (en) * | 1973-10-23 | 1976-03-09 | Edgar D. Young | Telephone incorporating binary coded decimal time display |
| US3946549A (en) * | 1973-12-26 | 1976-03-30 | Uranus Electronics, Inc. | Electronic alarm watch |
| GB1498700A (en) * | 1974-11-21 | 1978-01-25 | Tokyo Shibaura Electric Co | Time correction circuits for electronic timepieces |
| GB1523128A (en) * | 1974-12-27 | 1978-08-31 | Kienzle Uhrenfabriken Gmbh | Electronic digital clocks |
| JPS51102455A (ja) * | 1975-03-05 | 1976-09-09 | Funai Electric Co | Denshitaimasochi |
| US3961473A (en) * | 1975-03-06 | 1976-06-08 | George Hung | Electronic chess timer |
| JPS51114580A (en) * | 1975-03-31 | 1976-10-08 | Funai Denki Kk | Electronic timer apparatus |
| US4027470A (en) * | 1975-04-04 | 1977-06-07 | Friedman Eliot I | Digital timer circuit |
| JPS522563A (en) * | 1975-06-24 | 1977-01-10 | Seiko Instr & Electronics Ltd | Electronic clock with alarm |
| US4320478A (en) * | 1975-07-02 | 1982-03-16 | Motorola, Inc. | Digital watch |
| US4095182A (en) * | 1975-10-08 | 1978-06-13 | Cybernet Electronic Corporation | Display device for transceiver and like |
| JPS5246860A (en) * | 1975-10-13 | 1977-04-14 | Seiko Instr & Electronics Ltd | Alarm electronic clock |
| JPS5258972A (en) * | 1975-11-11 | 1977-05-14 | Seiko Instr & Electronics Ltd | Electronic stopwatch |
| US4047375A (en) * | 1975-11-17 | 1977-09-13 | Allan Wulff | Darkroom timer |
| JPS52109974A (en) * | 1976-03-11 | 1977-09-14 | Seiko Instr & Electronics Ltd | Digital alarm watch |
| DE2645744A1 (de) * | 1976-10-09 | 1978-04-13 | Quarz Zeit Ag | Elektronische uhr, insbesondere quarzuhr |
| US4185283A (en) * | 1978-01-09 | 1980-01-22 | Clark Lloyd D | Multiple character word indication system employing sequential sensible indicia |
| US4201038A (en) * | 1978-04-25 | 1980-05-06 | Kabushiki Kaisha Daini Seikosha | Alarm electronic watch |
| FR2492551B1 (fr) * | 1980-10-21 | 1985-06-07 | Suisse Horlogerie | Procede pour comparer un etat horaire et le contenu d'un registre dans une piece d'horlogerie a rappel, circuit pour sa mise en oeuvre et utilisation de ce circuit |
| US4444512A (en) * | 1981-10-21 | 1984-04-24 | Societe Suisse Pour L'industrie Horlogere Management Services S.A. | Method and circuit for comparing the timekeeping state and contents of a register in an electronic reminder giving timepiece |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA791946A (en) * | 1968-08-13 | Dome Peter | Electronic watches |
-
1970
- 1970-04-06 US US25930A patent/US3664116A/en not_active Expired - Lifetime
-
1971
- 1971-03-09 CA CA107210A patent/CA930033A/en not_active Expired
- 1971-04-02 CH CH478971A patent/CH534386A/de unknown
- 1971-04-02 CH CH478971D patent/CH478971A4/xx unknown
- 1971-04-03 DE DE19712116433 patent/DE2116433A1/de active Pending
- 1971-04-19 GB GB2633371*A patent/GB1341252A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA930033A (en) | 1973-07-10 |
| US3664116A (en) | 1972-05-23 |
| CH534386A (de) | 1972-08-31 |
| GB1341252A (en) | 1973-12-19 |
| CH478971A4 (enExample) | 1972-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2116433A1 (de) | Elektronische Digitaluhr | |
| DE1952203B2 (de) | Elektronisch regulierter zeitmesser mit niedrigem energieverbrauch | |
| DE2643359A1 (de) | Signalgenerator und verfahren zur erzeugung eines einer tastenfeldvorwahl entsprechenden ausgangssignals | |
| DE2528812B2 (de) | Antiprellschaltkreis | |
| DE2365143C3 (de) | Elektronische Zeitmeßschaltung | |
| DE2328992B2 (de) | Tongenerator zum erzeugen ausgewaehlter frequenzen | |
| DE2545823A1 (de) | Verfahren zur automatischen nachstellung einer elektronischen uhr sowie uhr zur durchfuehrung des verfahrens | |
| DE3108342C2 (de) | Dynamische Schieberegisterschaltung | |
| DE4333358A1 (de) | Schaltungsanordnung zur Informationsübertragung auf einer Zweidrahtleitung | |
| DE3018509A1 (de) | Schieberegister mit latch-schaltung | |
| DE2605919A1 (de) | Verfahren und einrichtung zur bildung eines bipolaren signals mit dem tastverhaeltnis einhalb | |
| DE1130849B (de) | Elektronische Kodierungs- und Dekodierungseinrichtung fuer radioelektrische oder telefonische Verbindungen | |
| DE2257689A1 (de) | Geraet zur suche von je ein gleiches geraet tragenden verschuetteten personen | |
| DE2746520A1 (de) | Impulsgenerator | |
| DE2619319A1 (de) | Abstimmvorrichtung fuer normalfrequenzgenerator | |
| DE2657025C3 (de) | Elektronische Uhr | |
| DE1924688A1 (de) | Impulszaehlvorrichtung | |
| DE2305931A1 (de) | Fernsteuer-signalgenerator | |
| DE2429477A1 (de) | Zeitspeicher | |
| DE2650367B2 (de) | Steuerschaltung eines für die Zeitmessung benutzten Schrittmotors | |
| DE1762173B2 (de) | Kodegenerator | |
| DE3106654A1 (de) | Elektronisches miniaturgeraet, insbesondere elektronische armbanduhr | |
| DE2240428A1 (de) | Elektronisches signaluebermittlungstor | |
| DE2920240A1 (de) | Energiequellen-steuereinrichtung fuer eine kamera | |
| DE2552359B2 (de) | Belichtungswertanzeigeeinrichtung mit einer Digitalanzeige für einen gemessenen oder eingestellten Belichtungswert |