DE2107699A1 - 4-Isopropyl-phenylharnstoffe, ihre Herstellung und ihre Verwendung zur Schädlingsbekämpfung - Google Patents
4-Isopropyl-phenylharnstoffe, ihre Herstellung und ihre Verwendung zur SchädlingsbekämpfungInfo
- Publication number
- DE2107699A1 DE2107699A1 DE19712107699 DE2107699A DE2107699A1 DE 2107699 A1 DE2107699 A1 DE 2107699A1 DE 19712107699 DE19712107699 DE 19712107699 DE 2107699 A DE2107699 A DE 2107699A DE 2107699 A1 DE2107699 A1 DE 2107699A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- weeds
- alkyl
- compound
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 241000607479 Yersinia pestis Species 0.000 title claims description 5
- 238000004519 manufacturing process Methods 0.000 title description 5
- 241000196324 Embryophyta Species 0.000 claims description 19
- 150000001875 compounds Chemical class 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 8
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000000304 alkynyl group Chemical group 0.000 claims description 7
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 239000000969 carrier Substances 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 240000008042 Zea mays Species 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 claims description 3
- 229920000742 Cotton Polymers 0.000 claims description 2
- 241001465754 Metazoa Species 0.000 claims description 2
- 235000007164 Oryza sativa Nutrition 0.000 claims description 2
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 claims description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 claims description 2
- 235000013339 cereals Nutrition 0.000 claims description 2
- 235000009973 maize Nutrition 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 235000009566 rice Nutrition 0.000 claims description 2
- 244000045561 useful plants Species 0.000 claims description 2
- 235000013311 vegetables Nutrition 0.000 claims description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims 1
- 240000007594 Oryza sativa Species 0.000 claims 1
- 239000000654 additive Substances 0.000 claims 1
- 239000000575 pesticide Substances 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 description 26
- 150000003839 salts Chemical class 0.000 description 24
- 239000002253 acid Substances 0.000 description 17
- -1 C - C Chemical group 0.000 description 13
- 239000000243 solution Substances 0.000 description 11
- 150000002148 esters Chemical class 0.000 description 10
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 8
- 239000004202 carbamide Substances 0.000 description 8
- 235000013877 carbamide Nutrition 0.000 description 8
- 239000002904 solvent Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 239000000839 emulsion Substances 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 229910052736 halogen Inorganic materials 0.000 description 5
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 4
- 150000003672 ureas Chemical class 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 239000005995 Aluminium silicate Substances 0.000 description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 241000209094 Oryza Species 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 235000012211 aluminium silicate Nutrition 0.000 description 3
- 230000003115 biocidal effect Effects 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 239000012990 dithiocarbamate Substances 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical compound C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 2
- ZMNXXNHBWQGPCK-UHFFFAOYSA-N 2-bromo-4-isocyanato-1-propan-2-ylbenzene Chemical compound CC(C)C1=CC=C(N=C=O)C=C1Br ZMNXXNHBWQGPCK-UHFFFAOYSA-N 0.000 description 2
- AJBZENLMTKDAEK-UHFFFAOYSA-N 3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-4,9-diol Chemical compound CC12CCC(O)C(C)(C)C1CCC(C1(C)CC3O)(C)C2CCC1C1C3(C)CCC1C(=C)C AJBZENLMTKDAEK-UHFFFAOYSA-N 0.000 description 2
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 2
- 241000743985 Alopecurus Species 0.000 description 2
- 241000219318 Amaranthus Species 0.000 description 2
- DJHGAFSJWGLOIV-UHFFFAOYSA-K Arsenate3- Chemical class [O-][As]([O-])([O-])=O DJHGAFSJWGLOIV-UHFFFAOYSA-K 0.000 description 2
- 235000005781 Avena Nutrition 0.000 description 2
- 244000075850 Avena orientalis Species 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 235000003880 Calendula Nutrition 0.000 description 2
- 240000001432 Calendula officinalis Species 0.000 description 2
- 235000007516 Chrysanthemum Nutrition 0.000 description 2
- 240000005250 Chrysanthemum indicum Species 0.000 description 2
- 235000017896 Digitaria Nutrition 0.000 description 2
- 241001303487 Digitaria <clam> Species 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Natural products CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 241001101998 Galium Species 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 241000219146 Gossypium Species 0.000 description 2
- 241000209219 Hordeum Species 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 235000021506 Ipomoea Nutrition 0.000 description 2
- 241000207783 Ipomoea Species 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 241000209117 Panicum Species 0.000 description 2
- 235000006443 Panicum miliaceum subsp. miliaceum Nutrition 0.000 description 2
- 235000009037 Panicum miliaceum subsp. ruderale Nutrition 0.000 description 2
- 241000209048 Poa Species 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- 241000220261 Sinapis Species 0.000 description 2
- 240000006394 Sorghum bicolor Species 0.000 description 2
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 2
- 240000006694 Stellaria media Species 0.000 description 2
- 101150052863 THY1 gene Proteins 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- 229960000892 attapulgite Drugs 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 2
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical compound NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 239000000428 dust Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 230000002363 herbicidal effect Effects 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Natural products OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 229910052625 palygorskite Inorganic materials 0.000 description 2
- IZUPBVBPLAPZRR-UHFFFAOYSA-N pentachlorophenol Chemical compound OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl IZUPBVBPLAPZRR-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 230000002028 premature Effects 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 238000009331 sowing Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 150000003918 triazines Chemical class 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- IZRWZLBCZMYWIG-UHFFFAOYSA-N 1,2-dinitro-3-phenylbenzene Chemical group [O-][N+](=O)C1=CC=CC(C=2C=CC=CC=2)=C1[N+]([O-])=O IZRWZLBCZMYWIG-UHFFFAOYSA-N 0.000 description 1
- XTFIVUDBNACUBN-UHFFFAOYSA-N 1,3,5-trinitro-1,3,5-triazinane Chemical compound [O-][N+](=O)N1CN([N+]([O-])=O)CN([N+]([O-])=O)C1 XTFIVUDBNACUBN-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- LUBJCRLGQSPQNN-UHFFFAOYSA-N 1-Phenylurea Chemical compound NC(=O)NC1=CC=CC=C1 LUBJCRLGQSPQNN-UHFFFAOYSA-N 0.000 description 1
- NDUPDOJHUQKPAG-UHFFFAOYSA-M 2,2-Dichloropropanoate Chemical compound CC(Cl)(Cl)C([O-])=O NDUPDOJHUQKPAG-UHFFFAOYSA-M 0.000 description 1
- NEBPTMCRLHKPOB-UHFFFAOYSA-N 2,2-diphenylacetonitrile Chemical compound C=1C=CC=CC=1C(C#N)C1=CC=CC=C1 NEBPTMCRLHKPOB-UHFFFAOYSA-N 0.000 description 1
- HOSPDZPUWYEZHH-UHFFFAOYSA-N 2,3,4,5-tetrachloro-6-methoxycarbonylbenzoic acid Chemical compound COC(=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1C(O)=O HOSPDZPUWYEZHH-UHFFFAOYSA-N 0.000 description 1
- FUXMTEKFGUWSNC-UHFFFAOYSA-N 2,3,4,5-tetrachlorobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=C(Cl)C(Cl)=C1Cl FUXMTEKFGUWSNC-UHFFFAOYSA-N 0.000 description 1
- VYPKFHFVKFKHMK-UHFFFAOYSA-N 2-(1h-indol-2-yl)butanoic acid Chemical compound C1=CC=C2NC(C(C(O)=O)CC)=CC2=C1 VYPKFHFVKFKHMK-UHFFFAOYSA-N 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical group CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- KTOQRRDVVIDEAA-UHFFFAOYSA-N 2-methylpropane Chemical compound [CH2]C(C)C KTOQRRDVVIDEAA-UHFFFAOYSA-N 0.000 description 1
- MQBITTBZTXUIPN-UHFFFAOYSA-N 2-methylpropylurea Chemical compound CC(C)CNC(N)=O MQBITTBZTXUIPN-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- LQLQRFGHAALLLE-UHFFFAOYSA-N 5-bromouracil Chemical compound BrC1=CNC(=O)NC1=O LQLQRFGHAALLLE-UHFFFAOYSA-N 0.000 description 1
- CFGDUDUEDQSSKF-UHFFFAOYSA-N 5-butyl-1h-pyrimidine-2,4-dione Chemical compound CCCCC1=CNC(=O)NC1=O CFGDUDUEDQSSKF-UHFFFAOYSA-N 0.000 description 1
- SHVCSCWHWMSGTE-UHFFFAOYSA-N 6-methyluracil Chemical compound CC1=CC(=O)NC(=O)N1 SHVCSCWHWMSGTE-UHFFFAOYSA-N 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- 235000011331 Brassica Nutrition 0.000 description 1
- 241000219198 Brassica Species 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical class [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 1
- FVIGODVHAVLZOO-UHFFFAOYSA-N Dixanthogen Chemical compound CCOC(=S)SSC(=S)OCC FVIGODVHAVLZOO-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 235000009438 Gossypium Nutrition 0.000 description 1
- 206010019133 Hangover Diseases 0.000 description 1
- 240000001812 Hyssopus officinalis Species 0.000 description 1
- 235000010650 Hyssopus officinalis Nutrition 0.000 description 1
- 239000005982 Indolylbutyric acid Substances 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 240000004658 Medicago sativa Species 0.000 description 1
- 235000017587 Medicago sativa ssp. sativa Nutrition 0.000 description 1
- MGJKQDOBUOMPEZ-UHFFFAOYSA-N N,N'-dimethylurea Chemical compound CNC(=O)NC MGJKQDOBUOMPEZ-UHFFFAOYSA-N 0.000 description 1
- GUMJKHKTSWLXGK-UHFFFAOYSA-N N-(3-methoxypropyl)-1,3,5-triazin-2-amine Chemical compound COCCCNC1=NC=NC=N1 GUMJKHKTSWLXGK-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 240000000111 Saccharum officinarum Species 0.000 description 1
- 235000007201 Saccharum officinarum Nutrition 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 241000209149 Zea Species 0.000 description 1
- 235000007244 Zea mays Nutrition 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 229960001413 acetanilide Drugs 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- GCPXMJHSNVMWNM-UHFFFAOYSA-N arsenous acid Chemical class O[As](O)O GCPXMJHSNVMWNM-UHFFFAOYSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- 230000027455 binding Effects 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- RSKPLCGMBWEANE-UHFFFAOYSA-N cacodyl Chemical group C[As](C)[As](C)C RSKPLCGMBWEANE-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- OOCMUZJPDXYRFD-UHFFFAOYSA-L calcium;2-dodecylbenzenesulfonate Chemical compound [Ca+2].CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O.CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O OOCMUZJPDXYRFD-UHFFFAOYSA-L 0.000 description 1
- GTCAXTIRRLKXRU-UHFFFAOYSA-N carbamic acid methyl ester Natural products COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 239000002837 defoliant Substances 0.000 description 1
- 230000035613 defoliation Effects 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- PWWSSIYVTQUJQQ-UHFFFAOYSA-N distearyl thiodipropionate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)CCSCCC(=O)OCCCCCCCCCCCCCCCCCC PWWSSIYVTQUJQQ-UHFFFAOYSA-N 0.000 description 1
- 150000004659 dithiocarbamates Chemical class 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000008029 eradication Effects 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 230000004720 fertilization Effects 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000005094 fruit set Effects 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 239000003324 growth hormone secretagogue Substances 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- SEOVTRFCIGRIMH-UHFFFAOYSA-N indole-3-acetic acid Chemical compound C1=CC=C2C(CC(=O)O)=CNC2=C1 SEOVTRFCIGRIMH-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- FZERHIULMFGESH-UHFFFAOYSA-N methylenecarboxanilide Natural products CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical group C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002903 organophosphorus compounds Chemical class 0.000 description 1
- AICOOMRHRUFYCM-ZRRPKQBOSA-N oxazine, 1 Chemical compound C([C@@H]1[C@H](C(C[C@]2(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@]21C)=O)CC1=CC2)C[C@H]1[C@@]1(C)[C@H]2N=C(C(C)C)OC1 AICOOMRHRUFYCM-ZRRPKQBOSA-N 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000005070 ripening Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid group Chemical class S(N)(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 101150068774 thyX gene Proteins 0.000 description 1
- 229940055764 triaz Drugs 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 229940035893 uracil Drugs 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH294470A CH537148A (de) | 1970-02-27 | 1970-02-27 | Verwendung von Phenylharnstoffen als selektive Herbizide |
| CH1392370A CH558141A (de) | 1970-09-21 | 1970-09-21 | Verwendung von phenylharnstoffen zur unkrautbekaempfung in getreidekulturen. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2107699A1 true DE2107699A1 (de) | 1971-09-16 |
Family
ID=25691782
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712107774 Expired DE2107774C2 (de) | 1970-02-27 | 1971-02-18 | Verfahren zur selektiven Unkrautbekämpfung in Getreidekulturen |
| DE19712107699 Pending DE2107699A1 (de) | 1970-02-27 | 1971-02-18 | 4-Isopropyl-phenylharnstoffe, ihre Herstellung und ihre Verwendung zur Schädlingsbekämpfung |
| DE19712107698 Pending DE2107698A1 (de) | 1970-02-27 | 1971-02-18 | Verwendung eines Phenylharnstoffes zur Bekämpfung von Unkrautern in Weizen, Hafer, Roggen, Gersten, Reis und Baum wolle |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712107774 Expired DE2107774C2 (de) | 1970-02-27 | 1971-02-18 | Verfahren zur selektiven Unkrautbekämpfung in Getreidekulturen |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712107698 Pending DE2107698A1 (de) | 1970-02-27 | 1971-02-18 | Verwendung eines Phenylharnstoffes zur Bekämpfung von Unkrautern in Weizen, Hafer, Roggen, Gersten, Reis und Baum wolle |
Country Status (11)
| Country | Link |
|---|---|
| AU (1) | AU2590371A (enExample) |
| BE (3) | BE763516A (enExample) |
| CA (1) | CA1028867A (enExample) |
| CY (1) | CY979A (enExample) |
| DE (3) | DE2107774C2 (enExample) |
| FR (3) | FR2080809B1 (enExample) |
| GB (3) | GB1293500A (enExample) |
| IL (2) | IL36220A0 (enExample) |
| KE (1) | KE2909A (enExample) |
| NL (3) | NL7102616A (enExample) |
| RO (2) | RO57207A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2435747A1 (de) * | 1973-08-10 | 1975-02-13 | Lilly Industries Ltd | Stabile fluessige zubereitung mit herbicider wirkung und verfahren zu ihrer herstellung |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2039041A1 (de) * | 1970-08-06 | 1972-02-17 | Hoechst Ag | Herbizide Mittel |
| FR2180619B1 (enExample) * | 1972-04-21 | 1975-06-13 | Pepro | |
| FR2183625A1 (en) * | 1972-05-09 | 1973-12-21 | Pepro | N-4-isopropylphenyl-N',N'-dimethylurea herbicide - having synergistic action with mixts of neburon or linuron, esp for cereals |
| FR2215898B1 (enExample) * | 1973-02-02 | 1977-04-22 | Philagro Sa | |
| CH575208A5 (enExample) * | 1973-07-30 | 1976-05-14 | Ciba Geigy Ag | |
| DE2638402A1 (de) | 1975-09-05 | 1977-03-17 | Sandoz Ag | Organische verbindungen, ihre herstellung und verwendung |
| IT1123643B (it) | 1976-12-14 | 1986-04-30 | Montedison Spa | Uree ad azione insetticida e nematocida |
| CA1160072A (en) * | 1980-03-11 | 1984-01-10 | Shell Canada Limited | Herbicidal composition and method of combating undesired plant growth |
| MA19170A1 (fr) * | 1980-06-19 | 1981-12-31 | May & Baker Ltd | Procede pour la lutte contre les adventices a l'aide de (isopropyl-4-phenyl)-3 dimethyl-i,i-uree en combinaison avec le "s"(trichloro 2,3,3,alkyl thiocarbamate d'osopropyle . |
| CH652391A5 (de) * | 1982-01-15 | 1985-11-15 | Sandoz Ag | Harnstoff-derivate. |
| DE3222622A1 (de) * | 1982-06-11 | 1983-12-15 | Schering AG, 1000 Berlin und 4709 Bergkamen | Mittel zur entblaetterung von pflanzen mit synergistischer wirkung |
| US4749812A (en) * | 1985-05-27 | 1988-06-07 | Mitsui Toatsu Chemicals, Inc. | N-(3-chloro-4-isopropylphenyl) carboxamide derivative and selective herbicide |
| EP2052609A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| DE102008037621A1 (de) | 2008-08-14 | 2010-02-18 | Bayer Cropscience Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
| CN105532697B (zh) * | 2015-12-28 | 2018-04-27 | 江苏傲伦达科技实业股份有限公司 | 一种含有苄草丹和异丙隆的稻田除草组合物 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH242359A (fr) * | 1942-06-06 | 1946-05-15 | Bourdereau Alphonse Jacques | Film à réseau lenticulaire microscopique, procédé pour sa réalisation et mécanisme pour la mise en oeuvre dudit procédé. |
| US2655445A (en) * | 1949-12-06 | 1953-10-13 | Du Pont | 3-(halophenyl)-1-methyl-1-(methyl or ethyl) ureas and herbicidal compositions and methods employing same |
| US2655447A (en) * | 1952-02-14 | 1953-10-13 | Du Pont | Composition and method |
| NL236579A (enExample) * | 1958-02-01 | |||
| FR1251281A (fr) * | 1959-11-06 | 1961-01-20 | Du Pont | Composés complexes d'acides chlorobenzoïques et d'urées |
| US3228762A (en) * | 1960-10-03 | 1966-01-11 | Du Pont | Method of killing weeds |
| US3297425A (en) * | 1962-08-28 | 1967-01-10 | Du Pont | Herbicidal composition |
| CH424359A (de) * | 1963-01-29 | 1966-11-15 | Ciba Geigy | Schädlingsbekämpfungsmittel |
| FR1497868A (fr) * | 1965-10-28 | 1967-10-13 | Sandoz Sa | Procédé de lutte sélective contre les plantes adventices dans les cultures de céréales |
| IL31574A0 (en) * | 1968-02-13 | 1969-04-30 | Ciba Ltd | Use of certain ureas for combating weeds |
| FR2263590B1 (enExample) * | 1974-03-08 | 1976-12-10 | Alsthom Cgee |
-
1971
- 1971-02-17 IL IL36220A patent/IL36220A0/xx unknown
- 1971-02-17 IL IL36218A patent/IL36218A0/xx unknown
- 1971-02-18 DE DE19712107774 patent/DE2107774C2/de not_active Expired
- 1971-02-18 DE DE19712107699 patent/DE2107699A1/de active Pending
- 1971-02-18 DE DE19712107698 patent/DE2107698A1/de active Pending
- 1971-02-19 CA CA105,751A patent/CA1028867A/en not_active Expired
- 1971-02-25 FR FR7106517A patent/FR2080809B1/fr not_active Expired
- 1971-02-25 FR FR7106518A patent/FR2079082A5/fr not_active Expired
- 1971-02-25 FR FR7106519A patent/FR2080810B1/fr not_active Expired
- 1971-02-25 RO RO6606571A patent/RO57207A/ro unknown
- 1971-02-26 AU AU25903/71A patent/AU2590371A/en not_active Expired
- 1971-02-26 NL NL7102616A patent/NL7102616A/xx unknown
- 1971-02-26 NL NL7102617A patent/NL7102617A/xx unknown
- 1971-02-26 BE BE763516A patent/BE763516A/xx unknown
- 1971-02-26 RO RO6608371A patent/RO57592A/ro unknown
- 1971-02-26 BE BE763515A patent/BE763515A/xx not_active IP Right Cessation
- 1971-02-26 BE BE763514A patent/BE763514A/xx unknown
- 1971-02-26 NL NL7102615A patent/NL7102615A/xx unknown
- 1971-04-19 GB GB22623/71A patent/GB1293500A/en not_active Expired
- 1971-04-19 GB GB5974873A patent/GB1407587A/en not_active Expired
- 1971-04-19 CY CY97971A patent/CY979A/xx unknown
- 1971-04-19 GB GB2262471A patent/GB1407586A/en not_active Expired
-
1978
- 1978-12-07 KE KE290978A patent/KE2909A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2435747A1 (de) * | 1973-08-10 | 1975-02-13 | Lilly Industries Ltd | Stabile fluessige zubereitung mit herbicider wirkung und verfahren zu ihrer herstellung |
Also Published As
| Publication number | Publication date |
|---|---|
| IL36218A0 (en) | 1971-04-28 |
| RO57207A (enExample) | 1975-01-15 |
| NL7102615A (enExample) | 1971-08-31 |
| AU2590371A (en) | 1972-08-31 |
| NL7102616A (enExample) | 1971-08-31 |
| NL7102617A (enExample) | 1971-08-31 |
| GB1407587A (en) | 1975-09-24 |
| CY979A (en) | 1979-03-23 |
| FR2080810A1 (enExample) | 1971-11-19 |
| DE2107698A1 (de) | 1971-09-16 |
| DE2107774A1 (de) | 1971-09-16 |
| GB1293500A (en) | 1972-10-18 |
| FR2080810B1 (enExample) | 1974-03-01 |
| KE2909A (en) | 1979-01-19 |
| FR2079082A5 (enExample) | 1971-11-05 |
| FR2080809B1 (enExample) | 1974-03-01 |
| DE2107774C2 (de) | 1990-03-29 |
| IL36220A0 (en) | 1971-04-28 |
| GB1407586A (en) | 1975-09-24 |
| BE763514A (fr) | 1971-08-26 |
| RO57592A (enExample) | 1975-02-15 |
| BE763515A (fr) | 1971-08-26 |
| FR2080809A1 (enExample) | 1971-11-19 |
| BE763516A (fr) | 1971-08-26 |
| CA1028867A (en) | 1978-04-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE68906668T2 (de) | Guanidin-derivate, ihre herstellung und insektizide. | |
| DE2107699A1 (de) | 4-Isopropyl-phenylharnstoffe, ihre Herstellung und ihre Verwendung zur Schädlingsbekämpfung | |
| DE1518815C3 (de) | m-(UreidophenyI)-carbaminsäureester, deren Herstellung und diese enthaltende herbizide Mittel | |
| DE69126836T2 (de) | Herbizide | |
| DE1918114A1 (de) | Phenylharnstoffe,ihre Herstellung und Verwendung als Herbizide | |
| EP0056969B1 (de) | Substituierte Phenylsulfonylharnstoff-Derivate, Verfahren und neue Zwischenprodukte zu deren Herstellung sowie diese Derivate als Wirkstoffe enthaltende herbizide Mittel | |
| EP0036390B1 (de) | Diphenyläther-Harnstoffe mit herbizider Wirkung | |
| EP0129764A2 (de) | Substituierte Phenylsulfonylguanidin-Derivate | |
| EP0136455A1 (de) | Substituierte Phenylsulfonylguanidin-Derivate | |
| EP0296120A2 (de) | Aryloxyphenyl-thioharnstoffe, -isothioharnstoffe und -carbodiimide, ihre Herstellung und Verwendung bei der Kontrolle von Schädlingen | |
| DE2044735C3 (de) | Phenylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende Schädlingsbekämpfungsmittel | |
| DE2436108A1 (de) | Substituierte phenylharnstoffe, verfahren zu ihrer herstellung und herbizide mittel | |
| DE2114774C3 (de) | m-(Halogenalkenyloxy)-phenyIharnstoffe, Verfahren zu ihrer Herstellung und sie enthaltende herbizide Mittel | |
| EP0148498A1 (de) | Neue Sulfonylguanidin-Derivate | |
| DE2048660A1 (de) | N o Fluorphenylharnstoffe zur Schad hngsbekampfung | |
| CH617571A5 (enExample) | ||
| DE2036968C3 (de) | 3-Chlor-4-n und i-Propoxyphenylharnstoffe, ihre Herstellung und diese enthaltende Schädlingsbekämpfungsmittel | |
| DE2103388A1 (de) | p Fluor m Trifluormethylphenylharn stoffe zur Schädlingsbekämpfung | |
| DE68913686T2 (de) | Benzamidverbindungen, deren Herstellung und deren Verwendung als Pestizide. | |
| DE2005162A1 (de) | Acylierte Harnstoffe | |
| DE2125353A1 (de) | Neue Pheny !harnstoffderivate und Verfahren zu ihrer Herstellung | |
| EP0298915B1 (de) | Pyridylthio-, Pyridylsulfinyl- und Pyridylsulfonyl-phenyl-thioharnstoffe, -isothioharnstoffe und -carbodiimide, ihre Herstellung und Verwendung bei der Kontrolle von Schädlingen | |
| DE2546916A1 (de) | Neue aryl-iso-thio-cyanate zur beeinflussung des pflanzenwachstums | |
| AT305688B (de) | Herbizides und fungizides Mittel | |
| DE1809838C3 (de) | N-(3-Brom-4-chlorphenyl)-N'methoxy-N'-methylharnstoff und seine Verwendung als Herbizid |