DE2064497C3 - Verfahren zur Kernhydroxylierung von aromatischen Verbindungen - Google Patents
Verfahren zur Kernhydroxylierung von aromatischen VerbindungenInfo
- Publication number
- DE2064497C3 DE2064497C3 DE2064497A DE2064497A DE2064497C3 DE 2064497 C3 DE2064497 C3 DE 2064497C3 DE 2064497 A DE2064497 A DE 2064497A DE 2064497 A DE2064497 A DE 2064497A DE 2064497 C3 DE2064497 C3 DE 2064497C3
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- hydrogen peroxide
- acid
- hydroxylation
- carried out
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 24
- 150000001491 aromatic compounds Chemical class 0.000 title claims description 18
- 230000033444 hydroxylation Effects 0.000 title claims description 12
- 238000005805 hydroxylation reaction Methods 0.000 title claims description 12
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 57
- 238000006243 chemical reaction Methods 0.000 claims description 31
- 239000002253 acid Substances 0.000 claims description 17
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- 229910021645 metal ion Inorganic materials 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 9
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 150000002500 ions Chemical class 0.000 claims description 2
- 229910052723 transition metal Inorganic materials 0.000 claims description 2
- 150000003624 transition metals Chemical class 0.000 claims description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 16
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 14
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 12
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 10
- 239000012429 reaction media Substances 0.000 description 9
- 150000007513 acids Chemical class 0.000 description 8
- 239000003446 ligand Substances 0.000 description 5
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 5
- 150000002989 phenols Chemical class 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- LHGVFZTZFXWLCP-UHFFFAOYSA-N guaiacol Chemical class COC1=CC=CC=C1O LHGVFZTZFXWLCP-UHFFFAOYSA-N 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- -1 phenolic ethers Chemical class 0.000 description 4
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000012736 aqueous medium Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- XYPISWUKQGWYGX-UHFFFAOYSA-N 2,2,2-trifluoroethaneperoxoic acid Chemical compound OOC(=O)C(F)(F)F XYPISWUKQGWYGX-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 239000008139 complexing agent Substances 0.000 description 2
- 150000001896 cresols Chemical class 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 238000010494 dissociation reaction Methods 0.000 description 2
- 230000005593 dissociations Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 2
- WRKCIHRWQZQBOL-UHFFFAOYSA-N octyl dihydrogen phosphate Chemical compound CCCCCCCCOP(O)(O)=O WRKCIHRWQZQBOL-UHFFFAOYSA-N 0.000 description 2
- 150000004967 organic peroxy acids Chemical class 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- 150000004053 quinones Chemical class 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 239000012028 Fenton's reagent Substances 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 150000008107 benzenesulfonic acids Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910001430 chromium ion Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229910001429 cobalt ion Inorganic materials 0.000 description 1
- 238000010668 complexation reaction Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229910001431 copper ion Inorganic materials 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 239000007857 degradation product Substances 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- AFAXGSQYZLGZPG-UHFFFAOYSA-N ethanedisulfonic acid Chemical compound OS(=O)(=O)CCS(O)(=O)=O AFAXGSQYZLGZPG-UHFFFAOYSA-N 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical compound CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- LRMHFDNWKCSEQU-UHFFFAOYSA-N ethoxyethane;phenol Chemical compound CCOCC.OC1=CC=CC=C1 LRMHFDNWKCSEQU-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000011790 ferrous sulphate Substances 0.000 description 1
- 235000003891 ferrous sulphate Nutrition 0.000 description 1
- 229960001867 guaiacol Drugs 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 229910001437 manganese ion Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-N methyl sulfate Chemical compound COS(O)(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- DLRJIFUOBPOJNS-UHFFFAOYSA-N phenetole Chemical compound CCOC1=CC=CC=C1 DLRJIFUOBPOJNS-UHFFFAOYSA-N 0.000 description 1
- 150000008379 phenol ethers Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- SNGARVZXPNQWEY-UHFFFAOYSA-N phenylmethanediol Chemical class OC(O)C1=CC=CC=C1 SNGARVZXPNQWEY-UHFFFAOYSA-N 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 229910001456 vanadium ion Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/60—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by oxidation reactions introducing directly hydroxy groups on a =CH-group belonging to a six-membered aromatic ring with the aid of other oxidants than molecular oxygen or their mixtures with molecular oxygen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C41/00—Preparation of ethers; Preparation of compounds having groups, groups or groups
- C07C41/01—Preparation of ethers
- C07C41/18—Preparation of ethers by reactions not forming ether-oxygen bonds
- C07C41/26—Preparation of ethers by reactions not forming ether-oxygen bonds by introduction of hydroxy or O-metal groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR6945467A FR2071464A5 (enExample) | 1969-12-30 | 1969-12-30 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2064497A1 DE2064497A1 (de) | 1971-07-08 |
| DE2064497B2 DE2064497B2 (de) | 1973-01-25 |
| DE2064497C3 true DE2064497C3 (de) | 1978-08-31 |
Family
ID=9045393
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2064497A Expired DE2064497C3 (de) | 1969-12-30 | 1970-12-30 | Verfahren zur Kernhydroxylierung von aromatischen Verbindungen |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3849502A (enExample) |
| JP (1) | JPS5213B1 (enExample) |
| AT (1) | AT305243B (enExample) |
| BE (1) | BE761017A (enExample) |
| BR (1) | BR7024945D0 (enExample) |
| CH (1) | CH515201A (enExample) |
| CS (1) | CS159783B2 (enExample) |
| DE (1) | DE2064497C3 (enExample) |
| FR (1) | FR2071464A5 (enExample) |
| GB (1) | GB1301709A (enExample) |
| LU (1) | LU62344A1 (enExample) |
| NL (1) | NL150094B (enExample) |
| PL (1) | PL84892B1 (enExample) |
| SE (1) | SE372515B (enExample) |
| SU (1) | SU505345A3 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3602180A1 (de) * | 1986-01-25 | 1987-07-30 | Degussa | Verfahren zur herstellung von brenzkatechin und hydrochinon |
Families Citing this family (53)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2167040C2 (de) * | 1971-07-17 | 1982-07-08 | Brichima S.p.A., Milano | Verfahren zur Herstellung von Brenzcatechin und Hydrochinon |
| FR2182668A1 (enExample) * | 1972-05-03 | 1973-12-14 | Rhone Poulenc Sa | |
| US3950437A (en) * | 1972-12-25 | 1976-04-13 | Oxirane Chemical Co. | Method for manufacture of dihydric phenols |
| US4174460A (en) * | 1974-03-06 | 1979-11-13 | Bayer Aktiengesellschaft | Process for the hydroxylation of phenols and phenol ethers in the nucleus |
| DE2410758C3 (de) * | 1974-03-06 | 1981-01-08 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von mehrwertigen substituierten Phenolen bzw. Monoäthern mehrwertiger Phenole durch Kernhydroxylierung von Phenolen oder Phenoläthern |
| DE2410742C3 (de) * | 1974-03-06 | 1981-01-08 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Brenzkatechin und Hydrochinon durch Kernhydroxylierung von Phenol |
| GB1448357A (en) * | 1974-04-04 | 1976-09-08 | Ube Industries | Process for preparing dihydric phenol derivatives |
| US4078006A (en) * | 1974-04-04 | 1978-03-07 | Ube Industries, Ltd. | Process for preparing dihydric phenol derivatives |
| GB1448358A (en) * | 1974-04-04 | 1976-09-08 | Ube Industries | Process for preparint dihydric phenol derivatives |
| US4013727A (en) * | 1974-11-07 | 1977-03-22 | Ube Industries, Ltd. | Process for preparing hydroxyphenyl ethers |
| FR2318851A1 (fr) * | 1975-07-25 | 1977-02-18 | Rhone Poulenc Ind | Procede d'hydroxylation de composes aromatiques |
| JPS5833207B2 (ja) * | 1975-08-28 | 1983-07-18 | 工業技術院長 | ニカフエノ−ルノセイゾウホウホウ |
| FR2336364A1 (fr) * | 1975-12-24 | 1977-07-22 | Rhone Poulenc Ind | Hydroxylation de composes aromatiques |
| JPS5278843A (en) * | 1975-12-26 | 1977-07-02 | Ube Ind Ltd | Preparation of diphenols |
| JPS5278842A (en) * | 1975-12-26 | 1977-07-02 | Ube Ind Ltd | Preparation of divalent phenols |
| JPS52118436A (en) * | 1976-03-30 | 1977-10-04 | Ube Ind Ltd | Synthesis of catechol and hydroquinone |
| JPS52142026A (en) * | 1976-05-21 | 1977-11-26 | Ube Ind Ltd | Production of catechol and hydroquinone |
| DE2658943C3 (de) * | 1976-12-24 | 1982-02-18 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Brenzkatechin und Hydrochinon |
| US4258219A (en) * | 1978-10-27 | 1981-03-24 | Mitsui Toatsu Chemicals, Inc. | Process for producing hydroquinone |
| DE2928743A1 (de) * | 1979-07-17 | 1981-02-05 | Bayer Ag | Verfahren zur herstellung mehrwertiger phenole |
| DE2942366A1 (de) * | 1979-10-19 | 1981-04-30 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung mehrwertiger phenole |
| DE3308726C2 (de) * | 1983-03-11 | 1991-01-24 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von Dihydroxybenzolen |
| US4588845A (en) * | 1983-07-18 | 1986-05-13 | Fmc Corporation | Oxidation of unsaturated organic compounds with hydrogen peroxide |
| DE3607923A1 (de) * | 1986-03-11 | 1987-09-17 | Degussa | Verfahren zur herstellung substituierter trihydroxybenzole |
| DE3643206C1 (de) * | 1986-12-18 | 1988-03-24 | Degussa | Verfahren zur Herstellung von substituierten Dihydroxybenzolen |
| FR2649695A1 (fr) * | 1989-07-11 | 1991-01-18 | Rhone Poulenc Chimie | Procede d'hydroxylation de phenols et d'ethers de phenols |
| FR2655332A1 (fr) * | 1989-12-05 | 1991-06-07 | Rhone Poulenc Chimie | Procede d'hydroxylation de phenols et d'ethers de phenols. |
| FR2667598B1 (fr) * | 1990-10-08 | 1994-05-20 | Rhone Poulenc Chimie | Procede d'hydroxylation de composes phenoliques. |
| US5120884A (en) * | 1991-02-14 | 1992-06-09 | The Dow Chemical Company | Preparation of hydroxy arylcyclobutenes |
| IT1251640B (it) * | 1991-10-28 | 1995-05-17 | Ausimont Spa | Processo per ossidare composti aromatici ed alifatici |
| FR2687662B1 (fr) * | 1992-02-26 | 1995-06-09 | Rhone Poulenc Chimie | Procede d'hydroxylation de composes phenoliques. |
| FR2687663B1 (fr) * | 1992-02-26 | 1994-05-20 | Rhone Poulenc Chimie | Procede d'hydroxylation de composes phenoliques. |
| DE69314365T2 (de) * | 1992-02-26 | 1998-04-02 | Rhone Poulenc Chimie | Verfahren zur Monohydroxylierung von Phenolverbindungen |
| FR2700332B1 (fr) * | 1993-01-08 | 1995-03-10 | Rhone Poulenc Chimie | Procédé d'hydroxylation de composés phénoliques. |
| FR2700333B1 (fr) * | 1993-01-08 | 1995-03-10 | Rhone Poulenc Chimie | Procédé de préparation de composés aromatiques dihydroxyles. |
| DE69417773T2 (de) * | 1993-01-08 | 1999-11-11 | Rhodia Chimie, Courbevoie | Verfahren zur Herstellung eines p-Fuchsons |
| JP3864558B2 (ja) | 1998-05-29 | 2007-01-10 | 宇部興産株式会社 | 二価フェノールの製法及びその製造装置 |
| JP2007015929A (ja) * | 2003-10-31 | 2007-01-25 | Ube Ind Ltd | ヒドロキシフェニルエーテルの製造方法 |
| FR2903100B1 (fr) * | 2006-06-29 | 2012-08-03 | Rhodia Recherches & Tech | Procede de preparation d'hydroquinone purifiee |
| FR2905374B1 (fr) | 2006-09-04 | 2008-11-14 | Rhodia Recherches & Tech | Procede de preparation d'hydroquinone de purete elevee. |
| FR2925489B1 (fr) | 2007-12-19 | 2010-02-05 | Rhodia Operations | Procede de preparation de pyrocatechol purifie |
| FR2932178B1 (fr) | 2008-06-09 | 2012-12-07 | Rhodia Operations | Procede d'hydroxylation de phenols et d'ethers de phenols |
| FR2944012B1 (fr) | 2009-04-06 | 2011-05-20 | Rhodia Operations | Procede d'hydroxylation de phenols et d'ethers de phenols. |
| FR2971783B1 (fr) | 2011-02-17 | 2013-02-15 | Rhodia Operations | Procede d'hydroxylation de phenols et d'ethers de phenols |
| FR2975393B1 (fr) | 2011-05-19 | 2013-05-10 | Rhodia Operations | Procede d'hydroxylation de phenols et d'ethers de phenols |
| FR2987046B1 (fr) | 2012-02-17 | 2014-03-21 | Rhodia Operations | Procede d'hydroxylation de composes aromatiques, catalyseur d'hydroxylation et son procede de preparation |
| US9540298B2 (en) | 2013-09-20 | 2017-01-10 | Mitsui Chemicals, Inc. | Process for producing aromatic dihydroxy compound |
| US9133088B1 (en) | 2014-04-30 | 2015-09-15 | Yuan-Zhang Han | Process for hydroxylating phenolic substrate |
| JP6700252B2 (ja) | 2014-08-19 | 2020-05-27 | ローディア オペレーションズ | フェノール基材をヒドロキシル化するための方法及びヒドロキシル化されたフェノール基材の製造方法 |
| FR3038897B1 (fr) | 2015-07-17 | 2019-01-25 | Rhodia Operations | Procede d'hydroxylation d'un substrat phenolique |
| FR3067348B1 (fr) | 2017-06-13 | 2019-06-28 | Rhodia Operations | Compositions comprenant de l'hydroquinone et du catechol, procede de preparation de ces compositions |
| FR3074177A1 (fr) | 2017-11-30 | 2019-05-31 | Rhodia Operations | Compositions comprenant du 4-alkoxyphenol et du 2-alkoxyphenol, et leur procede de preparation |
| FR3075198B1 (fr) | 2017-12-15 | 2020-04-03 | Rhodia Operations | Procede d'hydroxylation d'un compose aromatique |
-
1969
- 1969-12-30 FR FR6945467A patent/FR2071464A5/fr not_active Expired
-
1970
- 1970-12-18 SU SU1498234A patent/SU505345A3/ru active
- 1970-12-22 NL NL707018660A patent/NL150094B/xx not_active IP Right Cessation
- 1970-12-23 US US00101149A patent/US3849502A/en not_active Expired - Lifetime
- 1970-12-23 GB GB6122070A patent/GB1301709A/en not_active Expired
- 1970-12-23 JP JP45117328A patent/JPS5213B1/ja active Pending
- 1970-12-27 CS CS8793A patent/CS159783B2/cs unknown
- 1970-12-28 BR BR224945/70A patent/BR7024945D0/pt unknown
- 1970-12-29 PL PL1970145319A patent/PL84892B1/pl unknown
- 1970-12-29 LU LU62344D patent/LU62344A1/xx unknown
- 1970-12-29 SE SE7017691A patent/SE372515B/xx unknown
- 1970-12-29 CH CH1926270A patent/CH515201A/fr not_active IP Right Cessation
- 1970-12-29 BE BE761017A patent/BE761017A/xx not_active IP Right Cessation
- 1970-12-30 AT AT1173270A patent/AT305243B/de not_active IP Right Cessation
- 1970-12-30 DE DE2064497A patent/DE2064497C3/de not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3602180A1 (de) * | 1986-01-25 | 1987-07-30 | Degussa | Verfahren zur herstellung von brenzkatechin und hydrochinon |
Also Published As
| Publication number | Publication date |
|---|---|
| CS159783B2 (enExample) | 1975-01-31 |
| FR2071464A5 (enExample) | 1971-09-17 |
| GB1301709A (enExample) | 1973-01-04 |
| SE372515B (enExample) | 1974-12-23 |
| BE761017A (fr) | 1971-06-29 |
| CH515201A (fr) | 1971-11-15 |
| BR7024945D0 (pt) | 1973-01-09 |
| JPS5213B1 (enExample) | 1977-01-05 |
| NL7018660A (enExample) | 1971-07-02 |
| PL84892B1 (enExample) | 1976-04-30 |
| SU505345A3 (ru) | 1976-02-28 |
| LU62344A1 (enExample) | 1971-08-13 |
| US3849502A (en) | 1974-11-19 |
| AT305243B (de) | 1973-02-12 |
| DE2064497A1 (de) | 1971-07-08 |
| DE2064497B2 (de) | 1973-01-25 |
| NL150094B (nl) | 1976-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2064497C3 (de) | Verfahren zur Kernhydroxylierung von aromatischen Verbindungen | |
| DE2633302C2 (de) | Verfahren zur Herstellung von Phenolen durch Hydroxylierung von aromatischen Verbindungen | |
| DE2430130B2 (de) | Verfahren zur Herstellung von Polyphenylenäthern | |
| DE69314365T2 (de) | Verfahren zur Monohydroxylierung von Phenolverbindungen | |
| DE2410758C3 (de) | Verfahren zur Herstellung von mehrwertigen substituierten Phenolen bzw. Monoäthern mehrwertiger Phenole durch Kernhydroxylierung von Phenolen oder Phenoläthern | |
| DE2658545C3 (de) | Verfahren zur Kernhydroxylierung von aromatischen V erbindungen | |
| DE1593968C3 (de) | Verfahren zur Herstellung von Hydrochinon und Brenzcatechin | |
| DE2025662A1 (enExample) | ||
| EP0131243A1 (de) | Kontinuierliches Verfahren zur Entfernung des Katalysators aus Polyphenylenethern | |
| DE1262282B (de) | Verfahren zur Herstellung von Phenolen durch Oxydieren von aromatischen Kohlenwasserstoffen | |
| DE2658943C3 (de) | Verfahren zur Herstellung von Brenzkatechin und Hydrochinon | |
| DE2348957A1 (de) | Verfahren zur hydroxylierung aromatischer verbindungen | |
| DE2658866C3 (de) | Verfahren zur Herstellung von mehrwertigen substituierten Phenolen | |
| DE2548384C3 (de) | Verfahren zur Herstellung von Hydroxyphenyläthern | |
| DE69508864T2 (de) | Verfahren zur Herstellung von Pikrinsaüre | |
| DE2332747A1 (de) | Verfahren zur hydroxylierung aromatischer verbindungen | |
| DE1543548A1 (de) | Verfahren zur Herstellung von substituierten 4,6-Dinitrophenolen | |
| DE2033136B2 (de) | Verfahren zur herstellung von chinonen | |
| DE1643158C3 (enExample) | ||
| DE3016571A1 (de) | Verfahren zur herstellung von perfluoralkyl-alkanolen | |
| DE928230C (de) | Verfahren zur Herstellung von Hydroperoxyden alkylaromatischer Kohlenwasserstoffe | |
| EP0143416B1 (de) | Verfahren zur Isolierung von Alkalisulfat-armen Paraffinsulfonaten und Schwefelsäure aus Paraffin-Sulfoxidation-Reaktionsgemischen | |
| DE19633608A1 (de) | Verfahren zur Herstellung von p-Kresol | |
| DE3887859T2 (de) | Zersetzung von Dihydroperoxyd zu Resorcin. | |
| DE3102305A1 (de) | "raeumlich selektive (regioselektive) herstellung von(alpha) - und (beta)-naphthol" |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |