DE2031724C3 - N-substituierte Trijodbenz- bzw. Jodmethansulfon-am'ide, Verfahren zu deren Herstellung und radiologische Zusammensetzungen - Google Patents
N-substituierte Trijodbenz- bzw. Jodmethansulfon-am'ide, Verfahren zu deren Herstellung und radiologische ZusammensetzungenInfo
- Publication number
- DE2031724C3 DE2031724C3 DE2031724A DE2031724A DE2031724C3 DE 2031724 C3 DE2031724 C3 DE 2031724C3 DE 2031724 A DE2031724 A DE 2031724A DE 2031724 A DE2031724 A DE 2031724A DE 2031724 C3 DE2031724 C3 DE 2031724C3
- Authority
- DE
- Germany
- Prior art keywords
- triiodobenzoyl
- water
- acid
- groups
- dissolved
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 17
- 238000002360 preparation method Methods 0.000 title claims description 11
- FDGDRDDFTVNCGU-UHFFFAOYSA-N iodomethanesulfonamide Chemical class NS(=O)(=O)CI FDGDRDDFTVNCGU-UHFFFAOYSA-N 0.000 title claims 2
- -1 N-substituted triiodobenzamides Chemical class 0.000 title description 30
- 239000000203 mixture Substances 0.000 title description 12
- 150000001875 compounds Chemical class 0.000 claims description 54
- 239000002253 acid Substances 0.000 claims description 33
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 66
- 239000000243 solution Substances 0.000 description 38
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 32
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 30
- 229910052757 nitrogen Inorganic materials 0.000 description 27
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 24
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 229910052739 hydrogen Inorganic materials 0.000 description 21
- 239000000047 product Substances 0.000 description 20
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 18
- 238000004458 analytical method Methods 0.000 description 18
- 239000003610 charcoal Substances 0.000 description 18
- 238000003756 stirring Methods 0.000 description 18
- 241001465754 Metazoa Species 0.000 description 17
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 17
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 15
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 14
- 239000007858 starting material Substances 0.000 description 14
- 239000007864 aqueous solution Substances 0.000 description 13
- 239000002872 contrast media Substances 0.000 description 13
- 238000004519 manufacturing process Methods 0.000 description 13
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 11
- 150000001408 amides Chemical class 0.000 description 11
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 150000001412 amines Chemical class 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 125000002252 acyl group Chemical group 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 229960002442 glucosamine Drugs 0.000 description 9
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 9
- 238000006317 isomerization reaction Methods 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 235000000346 sugar Nutrition 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- 125000000217 alkyl group Chemical group 0.000 description 8
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 150000004820 halides Chemical class 0.000 description 8
- 229910052740 iodine Inorganic materials 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 231100000419 toxicity Toxicity 0.000 description 7
- 230000001988 toxicity Effects 0.000 description 7
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000000605 extraction Methods 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- 238000012800 visualization Methods 0.000 description 6
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 5
- MSWZFWKMSRAUBD-UHFFFAOYSA-N beta-D-galactosamine Natural products NC1C(O)OC(CO)C(O)C1O MSWZFWKMSRAUBD-UHFFFAOYSA-N 0.000 description 5
- 229940039231 contrast media Drugs 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 238000009608 myelography Methods 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- 235000012239 silicon dioxide Nutrition 0.000 description 5
- 238000004809 thin layer chromatography Methods 0.000 description 5
- MSWZFWKMSRAUBD-IVMDWMLBSA-N 2-amino-2-deoxy-D-glucopyranose Chemical compound N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O MSWZFWKMSRAUBD-IVMDWMLBSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 4
- 210000000748 cardiovascular system Anatomy 0.000 description 4
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 4
- 230000002526 effect on cardiovascular system Effects 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 239000002609 medium Substances 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 241000894007 species Species 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- RSCMSACQRPYYRN-UHFFFAOYSA-N 3,5-diaminobenzamide Chemical compound NC(=O)C1=CC(N)=CC(N)=C1 RSCMSACQRPYYRN-UHFFFAOYSA-N 0.000 description 3
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 241000699666 Mus <mouse, genus> Species 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 125000004442 acylamino group Chemical group 0.000 description 3
- 125000004423 acyloxy group Chemical group 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000006345 epimerization reaction Methods 0.000 description 3
- 150000002337 glycosamines Chemical class 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- 238000006192 iodination reaction Methods 0.000 description 3
- 150000008040 ionic compounds Chemical class 0.000 description 3
- RDFJFVXMRYVOAC-UHFFFAOYSA-N methiodal Chemical compound OS(=O)(=O)CI RDFJFVXMRYVOAC-UHFFFAOYSA-N 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 125000003156 secondary amide group Chemical group 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 125000003142 tertiary amide group Chemical group 0.000 description 3
- 231100000331 toxic Toxicity 0.000 description 3
- 230000002588 toxic effect Effects 0.000 description 3
- CBOJBBMQJBVCMW-BTVCFUMJSA-N (2r,3r,4s,5r)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride Chemical compound Cl.O=C[C@H](N)[C@@H](O)[C@H](O)[C@H](O)CO CBOJBBMQJBVCMW-BTVCFUMJSA-N 0.000 description 2
- SPYXCBRPFJVOTD-XKAARJIMSA-N 2,4,6-triiodo-n-methyl-n-[(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl]benzamide Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CN(C)C(=O)C1=C(I)C=C(I)C=C1I SPYXCBRPFJVOTD-XKAARJIMSA-N 0.000 description 2
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 2
- GNOGSFBXBWBTIG-UHFFFAOYSA-N Acetrizoic acid Chemical compound CC(=O)NC1=C(I)C=C(I)C(C(O)=O)=C1I GNOGSFBXBWBTIG-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- BAQCROVBDNBEEB-UBYUBLNFSA-N Metrizamide Chemical compound CC(=O)N(C)C1=C(I)C(NC(C)=O)=C(I)C(C(=O)N[C@@H]2[C@H]([C@H](O)[C@@H](CO)OC2O)O)=C1I BAQCROVBDNBEEB-UBYUBLNFSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 2
- 125000003172 aldehyde group Chemical group 0.000 description 2
- 230000002152 alkylating effect Effects 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 230000001588 bifunctional effect Effects 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 210000001175 cerebrospinal fluid Anatomy 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 150000004292 cyclic ethers Chemical class 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 229960001911 glucosamine hydrochloride Drugs 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 230000026045 iodination Effects 0.000 description 2
- 229960003695 methiodal Drugs 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 150000005846 sugar alcohols Chemical group 0.000 description 2
- 150000003461 sulfonyl halides Chemical class 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- 125000004665 trialkylsilyl group Chemical group 0.000 description 2
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 230000002792 vascular Effects 0.000 description 2
- CRVYPNHLIAWRNV-UHFFFAOYSA-N 2,4,6-triiodobenzoic acid Chemical compound OC(=O)C1=C(I)C=C(I)C=C1I CRVYPNHLIAWRNV-UHFFFAOYSA-N 0.000 description 1
- HRMQJJGGCUYILB-UHFFFAOYSA-N 2,4,6-triiodobenzoyl chloride Chemical compound ClC(=O)C1=C(I)C=C(I)C=C1I HRMQJJGGCUYILB-UHFFFAOYSA-N 0.000 description 1
- FLJZNTXMADMDLH-POVIXMMNSA-N 3,5-diacetamido-2,4,6-triiodo-n-[(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl]benzamide Chemical compound CC(=O)NC1=C(I)C(NC(C)=O)=C(I)C(C(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)=C1I FLJZNTXMADMDLH-POVIXMMNSA-N 0.000 description 1
- SLYNWYFWQKOVNQ-RFMXWLSYSA-N 3,5-diacetamido-2,4,6-triiodo-n-methyl-n-[(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl]benzamide Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CN(C)C(=O)C1=C(I)C(NC(C)=O)=C(I)C(NC(C)=O)=C1I SLYNWYFWQKOVNQ-RFMXWLSYSA-N 0.000 description 1
- SEJCXXXEYJMYKT-NCCMUGIUSA-N 3,5-diamino-2,4,6-triiodo-n-methyl-n-[(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl]benzamide Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CN(C)C(=O)C1=C(I)C(N)=C(I)C(N)=C1I SEJCXXXEYJMYKT-NCCMUGIUSA-N 0.000 description 1
- NNOHXABAQAGKRZ-UHFFFAOYSA-N 3,5-dinitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC(C(Cl)=O)=CC([N+]([O-])=O)=C1 NNOHXABAQAGKRZ-UHFFFAOYSA-N 0.000 description 1
- QEKXGWMRPSGUEC-UHFFFAOYSA-N 3-(butanoylamino)-2,4,6-triiodobenzoic acid Chemical compound CCCC(=O)NC1=C(I)C=C(I)C(C(O)=O)=C1I QEKXGWMRPSGUEC-UHFFFAOYSA-N 0.000 description 1
- NHBQPUIWRKEEJE-RFMXWLSYSA-N 3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodo-n-[(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl]benzamide Chemical compound CC(=O)N(C)C1=C(I)C(NC(C)=O)=C(I)C(C(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)=C1I NHBQPUIWRKEEJE-RFMXWLSYSA-N 0.000 description 1
- NRDMTSNDCORLDB-UHFFFAOYSA-N 3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodobenzoyl chloride Chemical compound CC(=O)N(C)C1=C(I)C(NC(C)=O)=C(I)C(C(Cl)=O)=C1I NRDMTSNDCORLDB-UHFFFAOYSA-N 0.000 description 1
- CPRGSOYWINBLDR-UHFFFAOYSA-N 3-amino-5-nitrobenzamide Chemical compound NC(=O)C1=CC(N)=CC([N+]([O-])=O)=C1 CPRGSOYWINBLDR-UHFFFAOYSA-N 0.000 description 1
- KQIGMPWTAHJUMN-UHFFFAOYSA-N 3-aminopropane-1,2-diol Chemical compound NCC(O)CO KQIGMPWTAHJUMN-UHFFFAOYSA-N 0.000 description 1
- WOMTYMDHLQTCHY-UHFFFAOYSA-N 3-methylamino-1,2-propanediol Chemical compound CNCC(O)CO WOMTYMDHLQTCHY-UHFFFAOYSA-N 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- VTNFMKLOPJUZEM-UHFFFAOYSA-N CN(C(C)=O)C1=C(C(=C(C=C1I)I)NC(C)=O)I Chemical compound CN(C(C)=O)C1=C(C(=C(C=C1I)I)NC(C)=O)I VTNFMKLOPJUZEM-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- QZRGKCOWNLSUDK-UHFFFAOYSA-N Iodochlorine Chemical compound ICl QZRGKCOWNLSUDK-UHFFFAOYSA-N 0.000 description 1
- YMQOAXDTWNKYAY-UHFFFAOYSA-N N,N'-bis[3-[bis(2-hydroxyethyl)carbamoyl]-2,4,6-triiodophenyl]hexanediamide Chemical compound OCCN(CCO)C(=O)C1=C(I)C=C(I)C(NC(=O)CCCCC(=O)NC=2C(=C(C(=O)N(CCO)CCO)C(I)=CC=2I)I)=C1I YMQOAXDTWNKYAY-UHFFFAOYSA-N 0.000 description 1
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical compound CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- SPXSEZMVRJLHQG-XMMPIXPASA-N [(2R)-1-[[4-[(3-phenylmethoxyphenoxy)methyl]phenyl]methyl]pyrrolidin-2-yl]methanol Chemical compound C(C1=CC=CC=C1)OC=1C=C(OCC2=CC=C(CN3[C@H](CCC3)CO)C=C2)C=CC=1 SPXSEZMVRJLHQG-XMMPIXPASA-N 0.000 description 1
- XWFMOWRKOWOJJN-UHFFFAOYSA-N [Na].ClICl Chemical compound [Na].ClICl XWFMOWRKOWOJJN-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 230000000397 acetylating effect Effects 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 238000010640 amide synthesis reaction Methods 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000003957 anion exchange resin Substances 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- MSWZFWKMSRAUBD-QZABAPFNSA-N beta-D-glucosamine Chemical compound N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O MSWZFWKMSRAUBD-QZABAPFNSA-N 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 210000001124 body fluid Anatomy 0.000 description 1
- 239000010839 body fluid Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 229940023913 cation exchange resins Drugs 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000011208 chromatographic data Methods 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 238000007697 cis-trans-isomerization reaction Methods 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 229940127271 compound 49 Drugs 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- LRMHFDNWKCSEQU-UHFFFAOYSA-N ethoxyethane;phenol Chemical compound CCOCC.OC1=CC=CC=C1 LRMHFDNWKCSEQU-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000002373 hemiacetals Chemical class 0.000 description 1
- UQEAIHBTYFGYIE-UHFFFAOYSA-N hexamethyldisiloxane Chemical compound C[Si](C)(C)O[Si](C)(C)C UQEAIHBTYFGYIE-UHFFFAOYSA-N 0.000 description 1
- 150000008273 hexosamines Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- FTQWRYSLUYAIRQ-UHFFFAOYSA-N n-[(octadecanoylamino)methyl]octadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NCNC(=O)CCCCCCCCCCCCCCCCC FTQWRYSLUYAIRQ-UHFFFAOYSA-N 0.000 description 1
- ZEIPVGFKLCGLRR-UMSGYPCISA-N n-methyl-3,5-dinitro-n-[(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl]benzamide Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CN(C)C(=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 ZEIPVGFKLCGLRR-UMSGYPCISA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical compound [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 150000008278 pentosamines Chemical class 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- DGXZDQFYFRCMJB-UHFFFAOYSA-N prop-1-yne-1,3-diol Chemical compound OCC#CO DGXZDQFYFRCMJB-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000012066 reaction slurry Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000009938 salting Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000003334 secondary amides Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 210000002330 subarachnoid space Anatomy 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 230000006103 sulfonylation Effects 0.000 description 1
- 238000005694 sulfonylation reaction Methods 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- 210000000115 thoracic cavity Anatomy 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K49/00—Preparations for testing in vivo
- A61K49/04—X-ray contrast preparations
- A61K49/0433—X-ray contrast preparations containing an organic halogenated X-ray contrast-enhancing agent
Landscapes
- Health & Medical Sciences (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3269969 | 1969-06-27 | ||
| GB613070 | 1970-02-09 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2031724A1 DE2031724A1 (de) | 1971-01-07 |
| DE2031724B2 DE2031724B2 (de) | 1978-11-02 |
| DE2031724C3 true DE2031724C3 (de) | 1979-06-28 |
Family
ID=26240463
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2031724A Expired DE2031724C3 (de) | 1969-06-27 | 1970-06-26 | N-substituierte Trijodbenz- bzw. Jodmethansulfon-am'ide, Verfahren zu deren Herstellung und radiologische Zusammensetzungen |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3701771A (enExample) |
| JP (1) | JPS5147702B1 (enExample) |
| AT (1) | AT318134B (enExample) |
| BE (1) | BE752574A (enExample) |
| BR (1) | BR7020080D0 (enExample) |
| CA (1) | CA935153A (enExample) |
| CH (1) | CH544551A (enExample) |
| DE (1) | DE2031724C3 (enExample) |
| DK (1) | DK130709B (enExample) |
| ES (1) | ES381202A1 (enExample) |
| FI (1) | FI53066C (enExample) |
| FR (1) | FR2053037B1 (enExample) |
| HK (1) | HK65978A (enExample) |
| IE (1) | IE34927B1 (enExample) |
| IL (1) | IL34803A (enExample) |
| IT (1) | IT1047908B (enExample) |
| NL (1) | NL153083B (enExample) |
| NO (1) | NO129093B (enExample) |
| SE (1) | SE392100B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2726196A1 (de) * | 1976-06-11 | 1977-12-22 | Nyegaard & Co As | Jodhaltige isophthalamidderivate, deren herstellung und radiologische mittel |
| US7780875B2 (en) | 2005-01-13 | 2010-08-24 | Cinvention Ag | Composite materials containing carbon nanoparticles |
Families Citing this family (73)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE795555A (fr) * | 1972-02-16 | 1973-08-16 | Schering Ag | Amides de triiodo-isophtaloyl-monoamino-acide, leur procede de preparation et leur utilisation |
| US3914294A (en) * | 1972-06-01 | 1975-10-21 | Squibb & Sons Inc | 3,5-Disubstituted-2,4,6-triiodobenzoic acids |
| US4138589A (en) * | 1974-06-17 | 1979-02-06 | Mallinckrodt, Inc. | Substituted isophthalamic acids |
| GB1495679A (en) * | 1974-06-17 | 1977-12-21 | Mallinckrodt Inc | Substituted isophthalamic acids |
| US4125709A (en) * | 1974-10-04 | 1978-11-14 | Mallinckrodt, Inc. | Polyhydroxy-alkyl-3,5-disubstituted-2,4,6-triiodocarbanilates |
| CH608189A5 (enExample) * | 1974-12-13 | 1978-12-29 | Savac Ag | |
| GB1491129A (en) * | 1975-06-04 | 1977-11-09 | Guerbet Sa | Iodo-benzene derivatives and an x-ray contrast medium containing them |
| US4314055A (en) * | 1975-09-29 | 1982-02-02 | Mallinckrodt, Inc. | 3,5-Disubstituted-2,4,6-triiodoanilides of polyhydroxy-monobasic acids |
| US4307072A (en) * | 1976-03-12 | 1981-12-22 | Mallinckrodt, Inc. | N-Triiodobenzoylaminoacyl polyhydroxic amines |
| DE2628517C2 (de) * | 1976-06-23 | 1985-02-21 | Schering AG, 1000 Berlin und 4709 Bergkamen | Dicarbonsäure-bis(3,5-dicarbamoyl-2,4,6-trijodanilid)-Verbindungen, Verfahren zu ihrer Herstellung und Röntgenkontrastmittel |
| US4125599A (en) * | 1976-08-19 | 1978-11-14 | Mallinckrodt, Inc. | X-ray contrast agents |
| JPS53137793A (en) * | 1977-05-07 | 1978-12-01 | Nihon Seikan Kk | Method of attaching container lid indicating plate |
| JPS54128855U (enExample) * | 1978-02-16 | 1979-09-07 | ||
| DE2909439A1 (de) * | 1979-03-08 | 1980-09-18 | Schering Ag | Neue nichtionische roentgenkontrastmittel |
| US4284620A (en) | 1979-03-23 | 1981-08-18 | Mallinckrodt, Inc. | N-(2-Hydroxyethyl)-2,4,6-triiodo-3,5-bis-(2-keto-L-gulonamido)benzamide and radiological compositions containing same |
| US4256729A (en) * | 1979-03-23 | 1981-03-17 | Mallinckrodt, Inc. | N,N'-Bis-(2,3-dihydroxypropyl)-2,4,6-triiodo-5-(2-keto-L-gulonamido)isophthalamide and radiological compositions containing same |
| US4243653A (en) * | 1979-04-27 | 1981-01-06 | The Regents Of The University Of California | Non-ionic polyiodo sugar substituted anilines |
| DE2928417A1 (de) * | 1979-07-12 | 1981-01-29 | Schering Ag | Trijodierte basen |
| IT1193211B (it) * | 1979-08-09 | 1988-06-15 | Bracco Ind Chimica Spa | Derivati dell'acido 2,4,6-triiodo-isoftalico,metodo per la loro preparazione e mezzi di contrasto che li contengono |
| DE3001293A1 (de) * | 1980-01-11 | 1981-07-16 | Schering Ag Berlin Und Bergkamen, 1000 Berlin | Ionische 5-c-substitiuerte 2,4,6-trijod-isophtalsaeure-derivete |
| DE3001292A1 (de) * | 1980-01-11 | 1981-07-16 | Schering Ag Berlin Und Bergkamen, 1000 Berlin | Nichtionische 5-c-substituierte 2,4,6-trijod-isophthalsaeure-derivate |
| US4341756A (en) * | 1980-01-31 | 1982-07-27 | The Regents Of The University Of California | Novel amino-dioxepane intermediates for the synthesis of new non-ionic contrast media |
| DE3038853A1 (de) | 1980-10-10 | 1982-05-27 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Neue n-hydroxy-alkylierte dicarbonsaeure-bis-(3,5-dicarbamoyl-2,4,6-trijodanilide), deren herstellung und diese enthaltende roentgenkonstrastmittel (ii) |
| DE3150916A1 (de) * | 1981-12-18 | 1983-06-30 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | N-hydroxyaethylierte 2,4,6-trijodaminoisiophthalsaeure-bis- trihydroxybutylamide, deren herstellung und diese enthaltende roentgenkontrastmittel" |
| DE3150917A1 (de) * | 1981-12-18 | 1983-06-30 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | "2-amino-1-(1,3-dioxolan-4-yl)-ethanol-verbindungen, deren herstellung und verwendung zur weiterverarbeitung" |
| EP0108638B1 (en) * | 1982-11-08 | 1986-07-16 | NYEGAARD & CO. A/S | X-ray contrast agents |
| US5191119A (en) * | 1983-10-20 | 1993-03-02 | Cook Imaging Corp. | Process for producing non-ionic radiographic contrast media utilizing N-allylation |
| US4584401A (en) * | 1983-10-20 | 1986-04-22 | Biophysica Foundation | Methods and compositions involving polyhydroxylated polyiodo non-ionic contrast media |
| DE3447970C1 (en) * | 1984-02-29 | 1988-06-30 | Dr. Franz Koehler Chemie Gmbh, 6146 Alsbach, De | N-(3,5-Diacetamido-2,4,6-triiodobenzoyl)amino acid esters, process for their preparation and their use |
| WO1987000757A1 (en) * | 1985-08-09 | 1987-02-12 | Cook Imaging, Inc. | Non-ionic polyol contrast media from ionic contrast media |
| US5035877A (en) * | 1985-08-09 | 1991-07-30 | Cook Imaging Corporation | Non-ionic contrast media from ionic contrast media |
| US4954348A (en) * | 1985-08-09 | 1990-09-04 | Cook Imaging Corporation | Non-ionic polyol contrast media from ionic contrast media |
| JPS63166908U (enExample) * | 1987-04-17 | 1988-10-31 | ||
| FR2614299B1 (fr) * | 1987-04-23 | 1989-08-18 | Guerbet Sa | Composes diamino benzeniques iodes, leur procede de preparation et produits de contraste les contenant. |
| AU618535B2 (en) * | 1987-05-22 | 1992-01-02 | Bracco International B.V. | Preparation of 5-acylamino-2,4,6-triiodo-or tribromo-benzoic acid derivatives |
| US5043152A (en) * | 1988-06-02 | 1991-08-27 | Guerbet S.A. | Novel iodinated non-ionic triiodobenzene compounds and contrast media containing them |
| US5698739A (en) * | 1989-07-05 | 1997-12-16 | Schering Aktiengesellschaft | Carboxamide non-ionic contrast media |
| FR2649698B1 (fr) * | 1989-07-17 | 1991-10-25 | Guerbet Sa | Nouveaux derives non ioniques polyiodes a structure arylsulfonamide et produit de contraste les contenant |
| GB8919929D0 (en) | 1989-09-04 | 1989-10-18 | Nycomed As | Compositions |
| US5614638A (en) * | 1989-11-29 | 1997-03-25 | Bracco International B.V. | Nonionic radiographic contrast agents |
| US5869024A (en) * | 1989-11-29 | 1999-02-09 | Bracco International B.V. | Methods and compositions for using non-ionic contrast agents to reduce the risk of clot formation in diagnostic procedures |
| US4997983A (en) * | 1990-01-31 | 1991-03-05 | Mallinckrodt, Inc. | Process for production of ioversol |
| US5527926A (en) * | 1990-11-26 | 1996-06-18 | Bracco International B.V. | Methods and compositions for using non-ionic contrast agents to reduce the risk of clot formation in diagnostic procedures |
| US5278311A (en) * | 1992-06-05 | 1994-01-11 | E. R. Squibb & Sons, Inc. | Nonionic radiographic contrast agents |
| US5668196A (en) * | 1995-08-10 | 1997-09-16 | Nanosystems Llc | 3-amido-triiodophenyl esters as x-ray contrast agents |
| US5925683A (en) * | 1996-10-17 | 1999-07-20 | Target Therapeutics, Inc. | Liquid embolic agents |
| US6051210A (en) | 1997-05-15 | 2000-04-18 | Bracco Research Usa | N,N-dimethyldiatrizoic acid and its conjugates as hepatobiliary agents for X-ray CT imaging |
| DE19731591C2 (de) * | 1997-07-17 | 1999-09-16 | Schering Ag | Pharmazeutische Mittel enthaltend perfluoralkylgruppenhaltige Trijodaromaten und ihre Verwendung in der Tumortherapie und interventionellen Radiologie |
| US6309420B1 (en) | 1997-10-14 | 2001-10-30 | Parallax Medical, Inc. | Enhanced visibility materials for implantation in hard tissue |
| US7572263B2 (en) | 1998-04-01 | 2009-08-11 | Arthrocare Corporation | High pressure applicator |
| AU3203599A (en) * | 1998-04-01 | 1999-10-18 | Parallax Medical, Inc. | Pressure applicator for hard tissue implant placement |
| US6723746B2 (en) * | 1998-09-08 | 2004-04-20 | Veritas Pharmaceuticals, Inc. | Functional radiographic imaging methods and agents |
| US6226352B1 (en) | 1998-09-08 | 2001-05-01 | Veritas Pharmaceuticals, Inc. | System and method for radiographic imaging of tissue |
| US20040170561A1 (en) * | 1998-09-08 | 2004-09-02 | Jesse Salb | Functional radiographic imaging methods and agents |
| US6751290B2 (en) | 1998-09-08 | 2004-06-15 | Veritas Pharmaceuticals, Inc. | Radiographic assessment of tissue after exposure to a compound |
| WO2000056254A1 (en) | 1999-03-24 | 2000-09-28 | Parallax Medical, Inc. | Non-compliant system for delivery of implant material |
| WO2001003666A2 (en) * | 1999-07-12 | 2001-01-18 | Scimed Life Systems, Inc. | Liquid based vaso-occlusive compositions |
| US6783515B1 (en) | 1999-09-30 | 2004-08-31 | Arthrocare Corporation | High pressure delivery system |
| ATE450201T1 (de) | 2000-03-16 | 2009-12-15 | Veritas Pharmaceuticals | Radiographische bewertung von gewebereaktionen auf chemische verbindungen |
| WO2002051301A2 (en) | 2000-11-10 | 2002-07-04 | Wm. Marsh Rice University | Fullerene (c60)-based x-ray contrast agent for diagnostic imaging |
| US20070191964A1 (en) * | 2001-04-04 | 2007-08-16 | Arthrocare Corporation | Enhanced visibility materials for implantation in hard tissue |
| US7341716B2 (en) * | 2002-04-12 | 2008-03-11 | Boston Scientific Scimed, Inc. | Occlusive composition |
| US7632291B2 (en) * | 2003-06-13 | 2009-12-15 | Trivascular2, Inc. | Inflatable implant |
| US20050283182A1 (en) * | 2004-06-21 | 2005-12-22 | Concentric Medical, Inc. | Systems and methods for intraluminal delivery of occlusive elements |
| CA2675121A1 (en) * | 2007-01-19 | 2008-07-24 | Cinvention Ag | Porous, non-degradable implant made by powder molding |
| CN101646764A (zh) * | 2007-02-28 | 2010-02-10 | 金文申有限公司 | 高表面积培养系统 |
| WO2008104599A1 (en) * | 2007-02-28 | 2008-09-04 | Cinvention Ag | High surface cultivation system bag |
| CN104473704B (zh) | 2007-03-15 | 2017-06-16 | 矫正-空位有限公司 | 假体装置及其使用方法 |
| CN102336681B (zh) * | 2011-07-21 | 2013-11-13 | 浙江司太立制药股份有限公司 | 一种三碘苯类化合物造影剂 |
| WO2013057566A2 (en) | 2011-10-18 | 2013-04-25 | Ortho-Space Ltd. | Prosthetic devices and methods for using same |
| CN102516116B (zh) * | 2011-11-22 | 2013-11-13 | 浙江司太立制药股份有限公司 | 一种低渗透压三碘苯类化合物造影剂 |
| US10959761B2 (en) | 2015-09-18 | 2021-03-30 | Ortho-Space Ltd. | Intramedullary fixated subacromial spacers |
| US11045981B2 (en) | 2017-01-30 | 2021-06-29 | Ortho-Space Ltd. | Processing machine and methods for processing dip-molded articles |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR6777M (enExample) * | 1967-07-10 | 1969-03-10 |
-
1970
- 1970-06-26 CH CH973270A patent/CH544551A/de not_active IP Right Cessation
- 1970-06-26 FI FI1802/70A patent/FI53066C/fi active
- 1970-06-26 US US50075A patent/US3701771A/en not_active Expired - Lifetime
- 1970-06-26 BE BE752574D patent/BE752574A/xx not_active IP Right Cessation
- 1970-06-26 SE SE7008921A patent/SE392100B/xx unknown
- 1970-06-26 AT AT577970A patent/AT318134B/de not_active IP Right Cessation
- 1970-06-26 DE DE2031724A patent/DE2031724C3/de not_active Expired
- 1970-06-26 IT IT51731/70A patent/IT1047908B/it active
- 1970-06-26 JP JP45055344A patent/JPS5147702B1/ja active Pending
- 1970-06-26 NO NO02518/70A patent/NO129093B/no unknown
- 1970-06-26 FR FR7023704A patent/FR2053037B1/fr not_active Expired
- 1970-06-26 IL IL34803A patent/IL34803A/xx unknown
- 1970-06-26 DK DK332470AA patent/DK130709B/da not_active IP Right Cessation
- 1970-06-26 NL NL707009493A patent/NL153083B/xx not_active IP Right Cessation
- 1970-06-26 IE IE834/70A patent/IE34927B1/xx unknown
- 1970-06-26 ES ES381202A patent/ES381202A1/es not_active Expired
- 1970-06-26 BR BR220080/70A patent/BR7020080D0/pt unknown
- 1970-06-26 CA CA086599A patent/CA935153A/en not_active Expired
-
1978
- 1978-11-16 HK HK659/78A patent/HK65978A/xx unknown
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2726196A1 (de) * | 1976-06-11 | 1977-12-22 | Nyegaard & Co As | Jodhaltige isophthalamidderivate, deren herstellung und radiologische mittel |
| US7780875B2 (en) | 2005-01-13 | 2010-08-24 | Cinvention Ag | Composite materials containing carbon nanoparticles |
Also Published As
| Publication number | Publication date |
|---|---|
| US3701771A (en) | 1972-10-31 |
| HK65978A (en) | 1978-11-24 |
| NL153083B (nl) | 1977-05-16 |
| DK130709B (da) | 1975-04-01 |
| ES381202A1 (es) | 1973-04-16 |
| DK130709C (enExample) | 1975-09-01 |
| IL34803A0 (en) | 1970-08-19 |
| SE392100B (sv) | 1977-03-14 |
| CA935153A (en) | 1973-10-09 |
| FI53066C (enExample) | 1978-02-10 |
| NO129093B (enExample) | 1974-02-25 |
| FR2053037B1 (enExample) | 1974-08-09 |
| IE34927B1 (en) | 1975-10-01 |
| DE2031724B2 (de) | 1978-11-02 |
| BE752574A (fr) | 1970-12-28 |
| JPS5147702B1 (enExample) | 1976-12-16 |
| BR7020080D0 (pt) | 1973-03-13 |
| IL34803A (en) | 1975-03-13 |
| IT1047908B (it) | 1980-10-20 |
| FI53066B (enExample) | 1977-10-31 |
| AT318134B (de) | 1974-09-25 |
| CH544551A (de) | 1973-11-30 |
| IE34927L (en) | 1970-12-27 |
| FR2053037A1 (enExample) | 1971-04-16 |
| NL7009493A (enExample) | 1970-12-29 |
| DE2031724A1 (de) | 1971-01-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2031724C3 (de) | N-substituierte Trijodbenz- bzw. Jodmethansulfon-am'ide, Verfahren zu deren Herstellung und radiologische Zusammensetzungen | |
| DE3873766T2 (de) | Herstellung von 5-acylamino-2,4,6-trijodo- oder tribromo-benzoesaeure-derivate. | |
| DE2523567C2 (de) | 2,4,6-Trijodbenzoesäure-Derivate und deren Verwendung als Röntgenkontrastmittel | |
| EP0022056B1 (de) | Dimere trijodierte Isophthalsäurediamide, deren Herstellung, diese enthaltendes Röntgenkontrastmittel, und dimere trijodierte Isophthalsäure-chloride | |
| DE2624153C2 (de) | N,N'-acylamido-trijod-benzoylierte Alkylendiamine, Verfahren zu ihrer Herstellung und ihre Verwendung als Kontrastmittel für Röntgenaufnahmen | |
| DE2628517A1 (de) | Neue dicarbonsaeure-bis(3,5-dicarbamoyl-2,4,6-trijodanilide) | |
| EP0022744B1 (de) | Trijodierte Basen, deren Herstellung und diese enthaltendes Röntgenkontrastmittel | |
| DE2600668C2 (de) | N-(1-Adamantylmethyl)-N'-cinnamylpiperazin, Verfahren zu dessen Herstellung und dieses enthaltende Arzneimittel | |
| DE1793841B1 (de) | trans-4-Aminomethylcyclohexan-1-carbonsaeure und Verfahren zur Herstellung | |
| DE1287081B (de) | Verfahren zur Herstellung von N, N'-Bis-(3-amino-5-carboxy-2, 4, 6-trijodphenyl)-alkandicarbonsaeureamiden oder der entsprechenden Kohlensaeurediamide | |
| DE2065312C3 (de) | Aminoäthansulfonylderivate und Verfahren zu ihrer Herstellung | |
| DE69213768T2 (de) | 5,5'-[(1,3-propandiyl)bis-[imino(2-oxo-2,1-ethandiyl)acetylimino]]bis(2,4,6-triiodo-1,3-benzenedicarboxyamide), und diese verbindungen enthaltendes kontrastmittel | |
| DE3689330T2 (de) | Nichtionische polyolkontrastmittel aus ionischen kontrastmitteln. | |
| DE69604642T2 (de) | Verfahren zur herstellung von iodierten kontrastmitteln | |
| DD238970A5 (de) | Verfahren zur herstellung von iodierten triaminobenzen-verbindungen | |
| DE69401327T2 (de) | Nicht-ionische iod-dimere als röntgenkontrastmittel, verfahren zu ihrer herstellung und galenische zusammensetzungen die diese enthalten | |
| DD205892A5 (de) | Verfahren zur herstellung von in kontrastmitteln verwendbaren brom-verbindungen | |
| DE69414129T2 (de) | Biphenyl jodierte derivate und ihre verwendung als diagnostikum | |
| DE1593222C3 (de) | Oberflächenaktive Verbindungen, Verfahren zu deren Herstellung sowie Haarpflegemittel, die diese Verbindungen enthalten | |
| DE2643841A1 (de) | 3,5-disubst.-2,4,6-trijodanilide von einbasischen polyhydroxysaeuren | |
| DE2902292A1 (de) | Verfahren zur herstellung von 4-aminobuttersaeure und deren derivaten | |
| DE2744657A1 (de) | N-substituierte aniline und deren verwendung | |
| DE2547789C3 (de) | 5-Hydroxypropionylamino-2,4,6-trijodisophthalsäure-bis-(dihydroxypropylamide), Verfahren zu ihrer Herstellung und diese enthaltende Röntgenkontrastmittel | |
| AT288393B (de) | Verfahren zur Herstellung von neuen Zimtsäureamiden | |
| DE2132614A1 (de) | Jodierte N-Acyl-Derivate von aromatischen Amino-Carbonsaeuren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |