DE2031724C3 - N-substituierte Trijodbenz- bzw. Jodmethansulfon-am'ide, Verfahren zu deren Herstellung und radiologische Zusammensetzungen - Google Patents
N-substituierte Trijodbenz- bzw. Jodmethansulfon-am'ide, Verfahren zu deren Herstellung und radiologische ZusammensetzungenInfo
- Publication number
- DE2031724C3 DE2031724C3 DE2031724A DE2031724A DE2031724C3 DE 2031724 C3 DE2031724 C3 DE 2031724C3 DE 2031724 A DE2031724 A DE 2031724A DE 2031724 A DE2031724 A DE 2031724A DE 2031724 C3 DE2031724 C3 DE 2031724C3
- Authority
- DE
- Germany
- Prior art keywords
- triiodobenzoyl
- water
- acid
- groups
- dissolved
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 17
- 238000002360 preparation method Methods 0.000 title claims description 11
- FDGDRDDFTVNCGU-UHFFFAOYSA-N iodomethanesulfonamide Chemical class NS(=O)(=O)CI FDGDRDDFTVNCGU-UHFFFAOYSA-N 0.000 title claims 2
- -1 N-substituted triiodobenzamides Chemical class 0.000 title description 30
- 239000000203 mixture Substances 0.000 title description 12
- 150000001875 compounds Chemical class 0.000 claims description 54
- 239000002253 acid Substances 0.000 claims description 33
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 66
- 239000000243 solution Substances 0.000 description 38
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 32
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 30
- 229910052757 nitrogen Inorganic materials 0.000 description 27
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 24
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 229910052739 hydrogen Inorganic materials 0.000 description 21
- 239000000047 product Substances 0.000 description 20
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 18
- 238000004458 analytical method Methods 0.000 description 18
- 239000003610 charcoal Substances 0.000 description 18
- 238000003756 stirring Methods 0.000 description 18
- 241001465754 Metazoa Species 0.000 description 17
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 17
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 15
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 14
- 239000007858 starting material Substances 0.000 description 14
- 239000007864 aqueous solution Substances 0.000 description 13
- 239000002872 contrast media Substances 0.000 description 13
- 238000004519 manufacturing process Methods 0.000 description 13
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 11
- 150000001408 amides Chemical class 0.000 description 11
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 150000001412 amines Chemical class 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 125000002252 acyl group Chemical group 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 229960002442 glucosamine Drugs 0.000 description 9
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 9
- 238000006317 isomerization reaction Methods 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 235000000346 sugar Nutrition 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- 125000000217 alkyl group Chemical group 0.000 description 8
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 150000004820 halides Chemical class 0.000 description 8
- 229910052740 iodine Inorganic materials 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 231100000419 toxicity Toxicity 0.000 description 7
- 230000001988 toxicity Effects 0.000 description 7
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000000605 extraction Methods 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- 238000012800 visualization Methods 0.000 description 6
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 5
- MSWZFWKMSRAUBD-UHFFFAOYSA-N beta-D-galactosamine Natural products NC1C(O)OC(CO)C(O)C1O MSWZFWKMSRAUBD-UHFFFAOYSA-N 0.000 description 5
- 229940039231 contrast media Drugs 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 238000009608 myelography Methods 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- 235000012239 silicon dioxide Nutrition 0.000 description 5
- 238000004809 thin layer chromatography Methods 0.000 description 5
- MSWZFWKMSRAUBD-IVMDWMLBSA-N 2-amino-2-deoxy-D-glucopyranose Chemical compound N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O MSWZFWKMSRAUBD-IVMDWMLBSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 4
- 210000000748 cardiovascular system Anatomy 0.000 description 4
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 4
- 230000002526 effect on cardiovascular system Effects 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 239000002609 medium Substances 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 241000894007 species Species 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- RSCMSACQRPYYRN-UHFFFAOYSA-N 3,5-diaminobenzamide Chemical compound NC(=O)C1=CC(N)=CC(N)=C1 RSCMSACQRPYYRN-UHFFFAOYSA-N 0.000 description 3
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 241000699666 Mus <mouse, genus> Species 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 125000004442 acylamino group Chemical group 0.000 description 3
- 125000004423 acyloxy group Chemical group 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000006345 epimerization reaction Methods 0.000 description 3
- 150000002337 glycosamines Chemical class 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- 238000006192 iodination reaction Methods 0.000 description 3
- 150000008040 ionic compounds Chemical class 0.000 description 3
- RDFJFVXMRYVOAC-UHFFFAOYSA-N methiodal Chemical compound OS(=O)(=O)CI RDFJFVXMRYVOAC-UHFFFAOYSA-N 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 125000003156 secondary amide group Chemical group 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 125000003142 tertiary amide group Chemical group 0.000 description 3
- 231100000331 toxic Toxicity 0.000 description 3
- 230000002588 toxic effect Effects 0.000 description 3
- CBOJBBMQJBVCMW-BTVCFUMJSA-N (2r,3r,4s,5r)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride Chemical compound Cl.O=C[C@H](N)[C@@H](O)[C@H](O)[C@H](O)CO CBOJBBMQJBVCMW-BTVCFUMJSA-N 0.000 description 2
- SPYXCBRPFJVOTD-XKAARJIMSA-N 2,4,6-triiodo-n-methyl-n-[(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl]benzamide Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CN(C)C(=O)C1=C(I)C=C(I)C=C1I SPYXCBRPFJVOTD-XKAARJIMSA-N 0.000 description 2
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 2
- GNOGSFBXBWBTIG-UHFFFAOYSA-N Acetrizoic acid Chemical compound CC(=O)NC1=C(I)C=C(I)C(C(O)=O)=C1I GNOGSFBXBWBTIG-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- BAQCROVBDNBEEB-UBYUBLNFSA-N Metrizamide Chemical compound CC(=O)N(C)C1=C(I)C(NC(C)=O)=C(I)C(C(=O)N[C@@H]2[C@H]([C@H](O)[C@@H](CO)OC2O)O)=C1I BAQCROVBDNBEEB-UBYUBLNFSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 2
- 125000003172 aldehyde group Chemical group 0.000 description 2
- 230000002152 alkylating effect Effects 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 230000001588 bifunctional effect Effects 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 210000001175 cerebrospinal fluid Anatomy 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 150000004292 cyclic ethers Chemical class 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 229960001911 glucosamine hydrochloride Drugs 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 230000026045 iodination Effects 0.000 description 2
- 229960003695 methiodal Drugs 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 150000005846 sugar alcohols Chemical group 0.000 description 2
- 150000003461 sulfonyl halides Chemical class 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- 125000004665 trialkylsilyl group Chemical group 0.000 description 2
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 230000002792 vascular Effects 0.000 description 2
- CRVYPNHLIAWRNV-UHFFFAOYSA-N 2,4,6-triiodobenzoic acid Chemical compound OC(=O)C1=C(I)C=C(I)C=C1I CRVYPNHLIAWRNV-UHFFFAOYSA-N 0.000 description 1
- HRMQJJGGCUYILB-UHFFFAOYSA-N 2,4,6-triiodobenzoyl chloride Chemical compound ClC(=O)C1=C(I)C=C(I)C=C1I HRMQJJGGCUYILB-UHFFFAOYSA-N 0.000 description 1
- FLJZNTXMADMDLH-POVIXMMNSA-N 3,5-diacetamido-2,4,6-triiodo-n-[(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl]benzamide Chemical compound CC(=O)NC1=C(I)C(NC(C)=O)=C(I)C(C(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)=C1I FLJZNTXMADMDLH-POVIXMMNSA-N 0.000 description 1
- SLYNWYFWQKOVNQ-RFMXWLSYSA-N 3,5-diacetamido-2,4,6-triiodo-n-methyl-n-[(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl]benzamide Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CN(C)C(=O)C1=C(I)C(NC(C)=O)=C(I)C(NC(C)=O)=C1I SLYNWYFWQKOVNQ-RFMXWLSYSA-N 0.000 description 1
- SEJCXXXEYJMYKT-NCCMUGIUSA-N 3,5-diamino-2,4,6-triiodo-n-methyl-n-[(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl]benzamide Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CN(C)C(=O)C1=C(I)C(N)=C(I)C(N)=C1I SEJCXXXEYJMYKT-NCCMUGIUSA-N 0.000 description 1
- NNOHXABAQAGKRZ-UHFFFAOYSA-N 3,5-dinitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC(C(Cl)=O)=CC([N+]([O-])=O)=C1 NNOHXABAQAGKRZ-UHFFFAOYSA-N 0.000 description 1
- QEKXGWMRPSGUEC-UHFFFAOYSA-N 3-(butanoylamino)-2,4,6-triiodobenzoic acid Chemical compound CCCC(=O)NC1=C(I)C=C(I)C(C(O)=O)=C1I QEKXGWMRPSGUEC-UHFFFAOYSA-N 0.000 description 1
- NHBQPUIWRKEEJE-RFMXWLSYSA-N 3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodo-n-[(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl]benzamide Chemical compound CC(=O)N(C)C1=C(I)C(NC(C)=O)=C(I)C(C(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)=C1I NHBQPUIWRKEEJE-RFMXWLSYSA-N 0.000 description 1
- NRDMTSNDCORLDB-UHFFFAOYSA-N 3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodobenzoyl chloride Chemical compound CC(=O)N(C)C1=C(I)C(NC(C)=O)=C(I)C(C(Cl)=O)=C1I NRDMTSNDCORLDB-UHFFFAOYSA-N 0.000 description 1
- CPRGSOYWINBLDR-UHFFFAOYSA-N 3-amino-5-nitrobenzamide Chemical compound NC(=O)C1=CC(N)=CC([N+]([O-])=O)=C1 CPRGSOYWINBLDR-UHFFFAOYSA-N 0.000 description 1
- KQIGMPWTAHJUMN-UHFFFAOYSA-N 3-aminopropane-1,2-diol Chemical compound NCC(O)CO KQIGMPWTAHJUMN-UHFFFAOYSA-N 0.000 description 1
- WOMTYMDHLQTCHY-UHFFFAOYSA-N 3-methylamino-1,2-propanediol Chemical compound CNCC(O)CO WOMTYMDHLQTCHY-UHFFFAOYSA-N 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- VTNFMKLOPJUZEM-UHFFFAOYSA-N CN(C(C)=O)C1=C(C(=C(C=C1I)I)NC(C)=O)I Chemical compound CN(C(C)=O)C1=C(C(=C(C=C1I)I)NC(C)=O)I VTNFMKLOPJUZEM-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- QZRGKCOWNLSUDK-UHFFFAOYSA-N Iodochlorine Chemical compound ICl QZRGKCOWNLSUDK-UHFFFAOYSA-N 0.000 description 1
- YMQOAXDTWNKYAY-UHFFFAOYSA-N N,N'-bis[3-[bis(2-hydroxyethyl)carbamoyl]-2,4,6-triiodophenyl]hexanediamide Chemical compound OCCN(CCO)C(=O)C1=C(I)C=C(I)C(NC(=O)CCCCC(=O)NC=2C(=C(C(=O)N(CCO)CCO)C(I)=CC=2I)I)=C1I YMQOAXDTWNKYAY-UHFFFAOYSA-N 0.000 description 1
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical compound CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- SPXSEZMVRJLHQG-XMMPIXPASA-N [(2R)-1-[[4-[(3-phenylmethoxyphenoxy)methyl]phenyl]methyl]pyrrolidin-2-yl]methanol Chemical compound C(C1=CC=CC=C1)OC=1C=C(OCC2=CC=C(CN3[C@H](CCC3)CO)C=C2)C=CC=1 SPXSEZMVRJLHQG-XMMPIXPASA-N 0.000 description 1
- XWFMOWRKOWOJJN-UHFFFAOYSA-N [Na].ClICl Chemical compound [Na].ClICl XWFMOWRKOWOJJN-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 230000000397 acetylating effect Effects 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 238000010640 amide synthesis reaction Methods 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000003957 anion exchange resin Substances 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- MSWZFWKMSRAUBD-QZABAPFNSA-N beta-D-glucosamine Chemical compound N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O MSWZFWKMSRAUBD-QZABAPFNSA-N 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 210000001124 body fluid Anatomy 0.000 description 1
- 239000010839 body fluid Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 229940023913 cation exchange resins Drugs 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000011208 chromatographic data Methods 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 238000007697 cis-trans-isomerization reaction Methods 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 229940127271 compound 49 Drugs 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- LRMHFDNWKCSEQU-UHFFFAOYSA-N ethoxyethane;phenol Chemical compound CCOCC.OC1=CC=CC=C1 LRMHFDNWKCSEQU-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000002373 hemiacetals Chemical class 0.000 description 1
- UQEAIHBTYFGYIE-UHFFFAOYSA-N hexamethyldisiloxane Chemical compound C[Si](C)(C)O[Si](C)(C)C UQEAIHBTYFGYIE-UHFFFAOYSA-N 0.000 description 1
- 150000008273 hexosamines Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- FTQWRYSLUYAIRQ-UHFFFAOYSA-N n-[(octadecanoylamino)methyl]octadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NCNC(=O)CCCCCCCCCCCCCCCCC FTQWRYSLUYAIRQ-UHFFFAOYSA-N 0.000 description 1
- ZEIPVGFKLCGLRR-UMSGYPCISA-N n-methyl-3,5-dinitro-n-[(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl]benzamide Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CN(C)C(=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 ZEIPVGFKLCGLRR-UMSGYPCISA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical compound [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 150000008278 pentosamines Chemical class 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- DGXZDQFYFRCMJB-UHFFFAOYSA-N prop-1-yne-1,3-diol Chemical compound OCC#CO DGXZDQFYFRCMJB-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000012066 reaction slurry Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000009938 salting Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000003334 secondary amides Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 210000002330 subarachnoid space Anatomy 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 230000006103 sulfonylation Effects 0.000 description 1
- 238000005694 sulfonylation reaction Methods 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- 210000000115 thoracic cavity Anatomy 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K49/00—Preparations for testing in vivo
- A61K49/04—X-ray contrast preparations
- A61K49/0433—X-ray contrast preparations containing an organic halogenated X-ray contrast-enhancing agent
Landscapes
- Health & Medical Sciences (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3269969 | 1969-06-27 | ||
| GB613070 | 1970-02-09 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2031724A1 DE2031724A1 (de) | 1971-01-07 |
| DE2031724B2 DE2031724B2 (de) | 1978-11-02 |
| DE2031724C3 true DE2031724C3 (de) | 1979-06-28 |
Family
ID=26240463
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2031724A Expired DE2031724C3 (de) | 1969-06-27 | 1970-06-26 | N-substituierte Trijodbenz- bzw. Jodmethansulfon-am'ide, Verfahren zu deren Herstellung und radiologische Zusammensetzungen |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3701771A (enExample) |
| JP (1) | JPS5147702B1 (enExample) |
| AT (1) | AT318134B (enExample) |
| BE (1) | BE752574A (enExample) |
| BR (1) | BR7020080D0 (enExample) |
| CA (1) | CA935153A (enExample) |
| CH (1) | CH544551A (enExample) |
| DE (1) | DE2031724C3 (enExample) |
| DK (1) | DK130709B (enExample) |
| ES (1) | ES381202A1 (enExample) |
| FI (1) | FI53066C (enExample) |
| FR (1) | FR2053037B1 (enExample) |
| HK (1) | HK65978A (enExample) |
| IE (1) | IE34927B1 (enExample) |
| IL (1) | IL34803A (enExample) |
| IT (1) | IT1047908B (enExample) |
| NL (1) | NL153083B (enExample) |
| NO (1) | NO129093B (enExample) |
| SE (1) | SE392100B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2726196A1 (de) * | 1976-06-11 | 1977-12-22 | Nyegaard & Co As | Jodhaltige isophthalamidderivate, deren herstellung und radiologische mittel |
| US7780875B2 (en) | 2005-01-13 | 2010-08-24 | Cinvention Ag | Composite materials containing carbon nanoparticles |
Families Citing this family (73)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE795555A (fr) * | 1972-02-16 | 1973-08-16 | Schering Ag | Amides de triiodo-isophtaloyl-monoamino-acide, leur procede de preparation et leur utilisation |
| US3914294A (en) * | 1972-06-01 | 1975-10-21 | Squibb & Sons Inc | 3,5-Disubstituted-2,4,6-triiodobenzoic acids |
| GB1495679A (en) * | 1974-06-17 | 1977-12-21 | Mallinckrodt Inc | Substituted isophthalamic acids |
| US4138589A (en) * | 1974-06-17 | 1979-02-06 | Mallinckrodt, Inc. | Substituted isophthalamic acids |
| US4125709A (en) * | 1974-10-04 | 1978-11-14 | Mallinckrodt, Inc. | Polyhydroxy-alkyl-3,5-disubstituted-2,4,6-triiodocarbanilates |
| CH608189A5 (enExample) * | 1974-12-13 | 1978-12-29 | Savac Ag | |
| GB1491129A (en) * | 1975-06-04 | 1977-11-09 | Guerbet Sa | Iodo-benzene derivatives and an x-ray contrast medium containing them |
| US4314055A (en) * | 1975-09-29 | 1982-02-02 | Mallinckrodt, Inc. | 3,5-Disubstituted-2,4,6-triiodoanilides of polyhydroxy-monobasic acids |
| US4307072A (en) * | 1976-03-12 | 1981-12-22 | Mallinckrodt, Inc. | N-Triiodobenzoylaminoacyl polyhydroxic amines |
| DE2628517C2 (de) * | 1976-06-23 | 1985-02-21 | Schering AG, 1000 Berlin und 4709 Bergkamen | Dicarbonsäure-bis(3,5-dicarbamoyl-2,4,6-trijodanilid)-Verbindungen, Verfahren zu ihrer Herstellung und Röntgenkontrastmittel |
| US4125599A (en) * | 1976-08-19 | 1978-11-14 | Mallinckrodt, Inc. | X-ray contrast agents |
| JPS53137793A (en) * | 1977-05-07 | 1978-12-01 | Nihon Seikan Kk | Method of attaching container lid indicating plate |
| JPS54128855U (enExample) * | 1978-02-16 | 1979-09-07 | ||
| DE2909439A1 (de) * | 1979-03-08 | 1980-09-18 | Schering Ag | Neue nichtionische roentgenkontrastmittel |
| US4256729A (en) * | 1979-03-23 | 1981-03-17 | Mallinckrodt, Inc. | N,N'-Bis-(2,3-dihydroxypropyl)-2,4,6-triiodo-5-(2-keto-L-gulonamido)isophthalamide and radiological compositions containing same |
| US4284620A (en) * | 1979-03-23 | 1981-08-18 | Mallinckrodt, Inc. | N-(2-Hydroxyethyl)-2,4,6-triiodo-3,5-bis-(2-keto-L-gulonamido)benzamide and radiological compositions containing same |
| US4243653A (en) * | 1979-04-27 | 1981-01-06 | The Regents Of The University Of California | Non-ionic polyiodo sugar substituted anilines |
| DE2928417A1 (de) * | 1979-07-12 | 1981-01-29 | Schering Ag | Trijodierte basen |
| IT1193211B (it) * | 1979-08-09 | 1988-06-15 | Bracco Ind Chimica Spa | Derivati dell'acido 2,4,6-triiodo-isoftalico,metodo per la loro preparazione e mezzi di contrasto che li contengono |
| DE3001293A1 (de) * | 1980-01-11 | 1981-07-16 | Schering Ag Berlin Und Bergkamen, 1000 Berlin | Ionische 5-c-substitiuerte 2,4,6-trijod-isophtalsaeure-derivete |
| DE3001292A1 (de) * | 1980-01-11 | 1981-07-16 | Schering Ag Berlin Und Bergkamen, 1000 Berlin | Nichtionische 5-c-substituierte 2,4,6-trijod-isophthalsaeure-derivate |
| US4341756A (en) * | 1980-01-31 | 1982-07-27 | The Regents Of The University Of California | Novel amino-dioxepane intermediates for the synthesis of new non-ionic contrast media |
| DE3038853A1 (de) | 1980-10-10 | 1982-05-27 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Neue n-hydroxy-alkylierte dicarbonsaeure-bis-(3,5-dicarbamoyl-2,4,6-trijodanilide), deren herstellung und diese enthaltende roentgenkonstrastmittel (ii) |
| DE3150917A1 (de) * | 1981-12-18 | 1983-06-30 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | "2-amino-1-(1,3-dioxolan-4-yl)-ethanol-verbindungen, deren herstellung und verwendung zur weiterverarbeitung" |
| DE3150916A1 (de) * | 1981-12-18 | 1983-06-30 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | N-hydroxyaethylierte 2,4,6-trijodaminoisiophthalsaeure-bis- trihydroxybutylamide, deren herstellung und diese enthaltende roentgenkontrastmittel" |
| DE3364536D1 (en) * | 1982-11-08 | 1986-08-21 | Nyegaard & Co As | X-ray contrast agents |
| US4584401A (en) * | 1983-10-20 | 1986-04-22 | Biophysica Foundation | Methods and compositions involving polyhydroxylated polyiodo non-ionic contrast media |
| US5191119A (en) * | 1983-10-20 | 1993-03-02 | Cook Imaging Corp. | Process for producing non-ionic radiographic contrast media utilizing N-allylation |
| DE3447970C1 (en) * | 1984-02-29 | 1988-06-30 | Dr. Franz Koehler Chemie Gmbh, 6146 Alsbach, De | N-(3,5-Diacetamido-2,4,6-triiodobenzoyl)amino acid esters, process for their preparation and their use |
| DE3689330T2 (de) * | 1985-08-09 | 1994-05-19 | Cook Imaging Corp | Nichtionische polyolkontrastmittel aus ionischen kontrastmitteln. |
| US5035877A (en) * | 1985-08-09 | 1991-07-30 | Cook Imaging Corporation | Non-ionic contrast media from ionic contrast media |
| US4954348A (en) * | 1985-08-09 | 1990-09-04 | Cook Imaging Corporation | Non-ionic polyol contrast media from ionic contrast media |
| JPS63166908U (enExample) * | 1987-04-17 | 1988-10-31 | ||
| FR2614299B1 (fr) * | 1987-04-23 | 1989-08-18 | Guerbet Sa | Composes diamino benzeniques iodes, leur procede de preparation et produits de contraste les contenant. |
| JP2585087B2 (ja) * | 1987-05-22 | 1997-02-26 | ブラッコ インターナショナル ベ ヴェ | 5‐アシルアミノ‐2,4,6‐トリヨード‐または‐トリブロモ‐ベンゾイックアシッド誘導体の製造方法およびその製造方法によって得られる新規の5‐アシルアミノ‐2,4,6‐トリヨードまたは‐トリブロモ‐ベンゾイックアシッド誘導体 |
| US5043152A (en) * | 1988-06-02 | 1991-08-27 | Guerbet S.A. | Novel iodinated non-ionic triiodobenzene compounds and contrast media containing them |
| US5698739A (en) * | 1989-07-05 | 1997-12-16 | Schering Aktiengesellschaft | Carboxamide non-ionic contrast media |
| FR2649698B1 (fr) * | 1989-07-17 | 1991-10-25 | Guerbet Sa | Nouveaux derives non ioniques polyiodes a structure arylsulfonamide et produit de contraste les contenant |
| GB8919929D0 (en) | 1989-09-04 | 1989-10-18 | Nycomed As | Compositions |
| US5614638A (en) * | 1989-11-29 | 1997-03-25 | Bracco International B.V. | Nonionic radiographic contrast agents |
| US5869024A (en) * | 1989-11-29 | 1999-02-09 | Bracco International B.V. | Methods and compositions for using non-ionic contrast agents to reduce the risk of clot formation in diagnostic procedures |
| US4997983A (en) * | 1990-01-31 | 1991-03-05 | Mallinckrodt, Inc. | Process for production of ioversol |
| US5527926A (en) * | 1990-11-26 | 1996-06-18 | Bracco International B.V. | Methods and compositions for using non-ionic contrast agents to reduce the risk of clot formation in diagnostic procedures |
| US5278311A (en) * | 1992-06-05 | 1994-01-11 | E. R. Squibb & Sons, Inc. | Nonionic radiographic contrast agents |
| US5668196A (en) * | 1995-08-10 | 1997-09-16 | Nanosystems Llc | 3-amido-triiodophenyl esters as x-ray contrast agents |
| US5925683A (en) * | 1996-10-17 | 1999-07-20 | Target Therapeutics, Inc. | Liquid embolic agents |
| US6051210A (en) | 1997-05-15 | 2000-04-18 | Bracco Research Usa | N,N-dimethyldiatrizoic acid and its conjugates as hepatobiliary agents for X-ray CT imaging |
| DE19731591C2 (de) * | 1997-07-17 | 1999-09-16 | Schering Ag | Pharmazeutische Mittel enthaltend perfluoralkylgruppenhaltige Trijodaromaten und ihre Verwendung in der Tumortherapie und interventionellen Radiologie |
| US6309420B1 (en) * | 1997-10-14 | 2001-10-30 | Parallax Medical, Inc. | Enhanced visibility materials for implantation in hard tissue |
| WO1999049819A1 (en) | 1998-04-01 | 1999-10-07 | Parallax Medical, Inc. | Pressure applicator for hard tissue implant placement |
| US7572263B2 (en) | 1998-04-01 | 2009-08-11 | Arthrocare Corporation | High pressure applicator |
| US6723746B2 (en) * | 1998-09-08 | 2004-04-20 | Veritas Pharmaceuticals, Inc. | Functional radiographic imaging methods and agents |
| US6226352B1 (en) | 1998-09-08 | 2001-05-01 | Veritas Pharmaceuticals, Inc. | System and method for radiographic imaging of tissue |
| US20040170561A1 (en) * | 1998-09-08 | 2004-09-02 | Jesse Salb | Functional radiographic imaging methods and agents |
| US6751290B2 (en) | 1998-09-08 | 2004-06-15 | Veritas Pharmaceuticals, Inc. | Radiographic assessment of tissue after exposure to a compound |
| AU6168699A (en) | 1999-03-24 | 2000-10-09 | Parallax Medical, Inc. | Non-compliant system for delivery of implant material |
| AU6058000A (en) * | 1999-07-12 | 2001-01-30 | Scimed Life Systems, Inc. | Liquid based vaso-occlusive compositions |
| US6783515B1 (en) | 1999-09-30 | 2004-08-31 | Arthrocare Corporation | High pressure delivery system |
| ATE450201T1 (de) | 2000-03-16 | 2009-12-15 | Veritas Pharmaceuticals | Radiographische bewertung von gewebereaktionen auf chemische verbindungen |
| US6660248B2 (en) | 2000-11-10 | 2003-12-09 | William Marsh Rice University | Fullerene (C60)-based X-ray contrast agent for diagnostic imaging |
| US20070191964A1 (en) * | 2001-04-04 | 2007-08-16 | Arthrocare Corporation | Enhanced visibility materials for implantation in hard tissue |
| US7341716B2 (en) * | 2002-04-12 | 2008-03-11 | Boston Scientific Scimed, Inc. | Occlusive composition |
| US7632291B2 (en) | 2003-06-13 | 2009-12-15 | Trivascular2, Inc. | Inflatable implant |
| US20050283182A1 (en) * | 2004-06-21 | 2005-12-22 | Concentric Medical, Inc. | Systems and methods for intraluminal delivery of occlusive elements |
| CN101646402A (zh) * | 2007-01-19 | 2010-02-10 | 金文申有限公司 | 用粉末模塑法制成的多孔、不可降解植入物 |
| CA2677699A1 (en) * | 2007-02-28 | 2008-09-04 | Cinvention Ag | High surface cultivation system |
| US20080206862A1 (en) * | 2007-02-28 | 2008-08-28 | Cinvention Ag | High surface cultivation system bag |
| PL2124831T3 (pl) | 2007-03-15 | 2017-03-31 | Ortho-Space Ltd. | Urządzenia protetyczne |
| CN102336681B (zh) * | 2011-07-21 | 2013-11-13 | 浙江司太立制药股份有限公司 | 一种三碘苯类化合物造影剂 |
| WO2013057566A2 (en) | 2011-10-18 | 2013-04-25 | Ortho-Space Ltd. | Prosthetic devices and methods for using same |
| CN102516116B (zh) * | 2011-11-22 | 2013-11-13 | 浙江司太立制药股份有限公司 | 一种低渗透压三碘苯类化合物造影剂 |
| WO2017046647A1 (en) | 2015-09-18 | 2017-03-23 | Ortho-Space Ltd. | Intramedullary fixated subacromial spacers |
| EP3573806A4 (en) | 2017-01-30 | 2019-12-11 | Ortho-Space Ltd. | MACHINING MACHINE AND METHOD FOR PROCESSING DIVING MADE ARTICLES |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR6777M (enExample) * | 1967-07-10 | 1969-03-10 |
-
1970
- 1970-06-26 BR BR220080/70A patent/BR7020080D0/pt unknown
- 1970-06-26 NO NO02518/70A patent/NO129093B/no unknown
- 1970-06-26 FI FI1802/70A patent/FI53066C/fi active
- 1970-06-26 IL IL34803A patent/IL34803A/xx unknown
- 1970-06-26 BE BE752574D patent/BE752574A/xx not_active IP Right Cessation
- 1970-06-26 SE SE7008921A patent/SE392100B/xx unknown
- 1970-06-26 JP JP45055344A patent/JPS5147702B1/ja active Pending
- 1970-06-26 ES ES381202A patent/ES381202A1/es not_active Expired
- 1970-06-26 DE DE2031724A patent/DE2031724C3/de not_active Expired
- 1970-06-26 US US50075A patent/US3701771A/en not_active Expired - Lifetime
- 1970-06-26 CH CH973270A patent/CH544551A/de not_active IP Right Cessation
- 1970-06-26 AT AT577970A patent/AT318134B/de not_active IP Right Cessation
- 1970-06-26 FR FR7023704A patent/FR2053037B1/fr not_active Expired
- 1970-06-26 NL NL707009493A patent/NL153083B/xx not_active IP Right Cessation
- 1970-06-26 IE IE834/70A patent/IE34927B1/xx unknown
- 1970-06-26 CA CA086599A patent/CA935153A/en not_active Expired
- 1970-06-26 IT IT51731/70A patent/IT1047908B/it active
- 1970-06-26 DK DK332470AA patent/DK130709B/da not_active IP Right Cessation
-
1978
- 1978-11-16 HK HK659/78A patent/HK65978A/xx unknown
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2726196A1 (de) * | 1976-06-11 | 1977-12-22 | Nyegaard & Co As | Jodhaltige isophthalamidderivate, deren herstellung und radiologische mittel |
| US7780875B2 (en) | 2005-01-13 | 2010-08-24 | Cinvention Ag | Composite materials containing carbon nanoparticles |
Also Published As
| Publication number | Publication date |
|---|---|
| NL7009493A (enExample) | 1970-12-29 |
| FI53066C (enExample) | 1978-02-10 |
| IE34927B1 (en) | 1975-10-01 |
| SE392100B (sv) | 1977-03-14 |
| HK65978A (en) | 1978-11-24 |
| ES381202A1 (es) | 1973-04-16 |
| IL34803A0 (en) | 1970-08-19 |
| IE34927L (en) | 1970-12-27 |
| BE752574A (fr) | 1970-12-28 |
| FR2053037A1 (enExample) | 1971-04-16 |
| BR7020080D0 (pt) | 1973-03-13 |
| AT318134B (de) | 1974-09-25 |
| FR2053037B1 (enExample) | 1974-08-09 |
| NO129093B (enExample) | 1974-02-25 |
| DE2031724B2 (de) | 1978-11-02 |
| DE2031724A1 (de) | 1971-01-07 |
| US3701771A (en) | 1972-10-31 |
| DK130709C (enExample) | 1975-09-01 |
| IL34803A (en) | 1975-03-13 |
| JPS5147702B1 (enExample) | 1976-12-16 |
| IT1047908B (it) | 1980-10-20 |
| CH544551A (de) | 1973-11-30 |
| CA935153A (en) | 1973-10-09 |
| FI53066B (enExample) | 1977-10-31 |
| DK130709B (da) | 1975-04-01 |
| NL153083B (nl) | 1977-05-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2031724C3 (de) | N-substituierte Trijodbenz- bzw. Jodmethansulfon-am'ide, Verfahren zu deren Herstellung und radiologische Zusammensetzungen | |
| DE3873766T2 (de) | Herstellung von 5-acylamino-2,4,6-trijodo- oder tribromo-benzoesaeure-derivate. | |
| DE2523567C2 (de) | 2,4,6-Trijodbenzoesäure-Derivate und deren Verwendung als Röntgenkontrastmittel | |
| EP0022056B1 (de) | Dimere trijodierte Isophthalsäurediamide, deren Herstellung, diese enthaltendes Röntgenkontrastmittel, und dimere trijodierte Isophthalsäure-chloride | |
| DE2624153C2 (de) | N,N'-acylamido-trijod-benzoylierte Alkylendiamine, Verfahren zu ihrer Herstellung und ihre Verwendung als Kontrastmittel für Röntgenaufnahmen | |
| DE2628517A1 (de) | Neue dicarbonsaeure-bis(3,5-dicarbamoyl-2,4,6-trijodanilide) | |
| EP0022744B1 (de) | Trijodierte Basen, deren Herstellung und diese enthaltendes Röntgenkontrastmittel | |
| DE2600668C2 (de) | N-(1-Adamantylmethyl)-N'-cinnamylpiperazin, Verfahren zu dessen Herstellung und dieses enthaltende Arzneimittel | |
| DE1793841B1 (de) | trans-4-Aminomethylcyclohexan-1-carbonsaeure und Verfahren zur Herstellung | |
| DE1287081B (de) | Verfahren zur Herstellung von N, N'-Bis-(3-amino-5-carboxy-2, 4, 6-trijodphenyl)-alkandicarbonsaeureamiden oder der entsprechenden Kohlensaeurediamide | |
| DE2065312C3 (de) | Aminoäthansulfonylderivate und Verfahren zu ihrer Herstellung | |
| DE69213768T2 (de) | 5,5'-[(1,3-propandiyl)bis-[imino(2-oxo-2,1-ethandiyl)acetylimino]]bis(2,4,6-triiodo-1,3-benzenedicarboxyamide), und diese verbindungen enthaltendes kontrastmittel | |
| DE3689330T2 (de) | Nichtionische polyolkontrastmittel aus ionischen kontrastmitteln. | |
| DE69604642T2 (de) | Verfahren zur herstellung von iodierten kontrastmitteln | |
| DD238970A5 (de) | Verfahren zur herstellung von iodierten triaminobenzen-verbindungen | |
| DE69401327T2 (de) | Nicht-ionische iod-dimere als röntgenkontrastmittel, verfahren zu ihrer herstellung und galenische zusammensetzungen die diese enthalten | |
| DD205892A5 (de) | Verfahren zur herstellung von in kontrastmitteln verwendbaren brom-verbindungen | |
| DE69414129T2 (de) | Biphenyl jodierte derivate und ihre verwendung als diagnostikum | |
| DE1593222C3 (de) | Oberflächenaktive Verbindungen, Verfahren zu deren Herstellung sowie Haarpflegemittel, die diese Verbindungen enthalten | |
| DE2643841A1 (de) | 3,5-disubst.-2,4,6-trijodanilide von einbasischen polyhydroxysaeuren | |
| DE2628042B2 (de) | 3-Amino-tricyclo [53.1.0.3A1 -undecan, dessen Säureadditionssalze und Verfahren zur Herstellung dieser Verbindungen | |
| DE2902292A1 (de) | Verfahren zur herstellung von 4-aminobuttersaeure und deren derivaten | |
| DE2744657A1 (de) | N-substituierte aniline und deren verwendung | |
| DE2547789C3 (de) | 5-Hydroxypropionylamino-2,4,6-trijodisophthalsäure-bis-(dihydroxypropylamide), Verfahren zu ihrer Herstellung und diese enthaltende Röntgenkontrastmittel | |
| AT288393B (de) | Verfahren zur Herstellung von neuen Zimtsäureamiden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |