DE2018253A1 - Disazofarbstoffe - Google Patents
DisazofarbstoffeInfo
- Publication number
- DE2018253A1 DE2018253A1 DE19702018253 DE2018253A DE2018253A1 DE 2018253 A1 DE2018253 A1 DE 2018253A1 DE 19702018253 DE19702018253 DE 19702018253 DE 2018253 A DE2018253 A DE 2018253A DE 2018253 A1 DE2018253 A1 DE 2018253A1
- Authority
- DE
- Germany
- Prior art keywords
- radical
- groups
- alkyl
- coor
- cor
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000975 dye Substances 0.000 title claims description 16
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 title claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000005041 acyloxyalkyl group Chemical group 0.000 claims description 4
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 125000005160 aryl oxy alkyl group Chemical group 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 4
- 125000004966 cyanoalkyl group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 125000005842 heteroatom Chemical group 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- YRGYYQCOWUULNF-UHFFFAOYSA-N 2-hydroxy-4-methyl-6-oxo-1h-pyridine-3-carbonitrile Chemical compound CC1=CC(=O)NC(O)=C1C#N YRGYYQCOWUULNF-UHFFFAOYSA-N 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 238000004043 dyeing Methods 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 239000004753 textile Substances 0.000 claims description 3
- 125000004442 acylamino group Chemical group 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 150000001989 diazonium salts Chemical class 0.000 claims description 2
- 125000005113 hydroxyalkoxy group Chemical group 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 229920003002 synthetic resin Polymers 0.000 claims description 2
- 239000000057 synthetic resin Substances 0.000 claims description 2
- 239000000463 material Substances 0.000 claims 3
- 238000000034 method Methods 0.000 claims 3
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims 1
- 101150052863 THY1 gene Proteins 0.000 claims 1
- 229910052731 fluorine Inorganic materials 0.000 claims 1
- 239000011737 fluorine Substances 0.000 claims 1
- 125000001188 haloalkyl group Chemical group 0.000 claims 1
- 108010093488 His-His-His-His-His-His Proteins 0.000 description 11
- 239000000049 pigment Substances 0.000 description 11
- 239000000460 chlorine Substances 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 125000001309 chloro group Chemical group Cl* 0.000 description 6
- 239000004744 fabric Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 5
- 230000008878 coupling Effects 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- 206010039587 Scarlet Fever Diseases 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- MBHRHUJRKGNOKX-UHFFFAOYSA-N [(4,6-diamino-1,3,5-triazin-2-yl)amino]methanol Chemical compound NC1=NC(N)=NC(NCO)=N1 MBHRHUJRKGNOKX-UHFFFAOYSA-N 0.000 description 2
- -1 aliphatic alcohols Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- GTRGJJDVSJFNTE-UHFFFAOYSA-N chembl2009633 Chemical compound OC1=CC=C2C=C(S(O)(=O)=O)C=CC2=C1N=NC1=CC=CC=C1 GTRGJJDVSJFNTE-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000004815 dispersion polymer Substances 0.000 description 2
- 238000005108 dry cleaning Methods 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000004576 sand Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 1
- QPQKUYVSJWQSDY-CCEZHUSRSA-N 4-(phenylazo)aniline Chemical compound C1=CC(N)=CC=C1\N=N\C1=CC=CC=C1 QPQKUYVSJWQSDY-CCEZHUSRSA-N 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N 4-nonylphenol Polymers CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- CNCOEDDPFOAUMB-UHFFFAOYSA-N N-Methylolacrylamide Chemical compound OCNC(=O)C=C CNCOEDDPFOAUMB-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Polymers CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B31/00—Disazo and polyazo dyes of the type A->B->C, A->B->C->D, or the like, prepared by diazotising and coupling
- C09B31/02—Disazo dyes
- C09B31/12—Disazo dyes from other coupling components "C"
- C09B31/14—Heterocyclic components
- C09B31/153—Heterocyclic components containing a six-membered ring with one nitrogen atom as the only ring hetero-atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Inks, Pencil-Leads, Or Crayons (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702018253 DE2018253A1 (de) | 1970-04-16 | 1970-04-16 | Disazofarbstoffe |
| NL7104391A NL7104391A (Direct) | 1970-04-16 | 1971-04-01 | |
| SU1643457A SU383306A1 (ru) | 1971-04-08 | Способ получения водонерастворимого дисазокрасителя | |
| BE765685A BE765685A (fr) | 1970-04-16 | 1971-04-13 | Colorants disazoiques et leur preparation |
| AT319271A AT301717B (de) | 1970-04-16 | 1971-04-15 | Verfahren zur Herstellung von neuen Disazofarbstoffen |
| ES390241A ES390241A1 (es) | 1970-04-16 | 1971-04-15 | Procedimiento para la obtencion de colorantes disazoicos. |
| DD15444871A DD96246A5 (Direct) | 1970-04-16 | 1971-04-15 | |
| FR7113254A FR2086112B1 (Direct) | 1970-04-16 | 1971-04-15 | |
| CH547271A CH544798A (de) | 1970-04-16 | 1971-04-15 | Verfahren zur Herstellung von Disazofarbstoffen |
| GB2714171A GB1293706A (en) | 1970-04-16 | 1971-04-19 | Disazo dyes and a process for their manufacture |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702018253 DE2018253A1 (de) | 1970-04-16 | 1970-04-16 | Disazofarbstoffe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2018253A1 true DE2018253A1 (de) | 1971-10-28 |
Family
ID=5768255
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702018253 Pending DE2018253A1 (de) | 1970-04-16 | 1970-04-16 | Disazofarbstoffe |
Country Status (9)
| Country | Link |
|---|---|
| AT (1) | AT301717B (Direct) |
| BE (1) | BE765685A (Direct) |
| CH (1) | CH544798A (Direct) |
| DD (1) | DD96246A5 (Direct) |
| DE (1) | DE2018253A1 (Direct) |
| ES (1) | ES390241A1 (Direct) |
| FR (1) | FR2086112B1 (Direct) |
| GB (1) | GB1293706A (Direct) |
| NL (1) | NL7104391A (Direct) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3634393A1 (de) * | 1986-10-09 | 1988-04-14 | Basf Ag | Solventfarbstoffe mit carbonsaeurefunktionen |
-
1970
- 1970-04-16 DE DE19702018253 patent/DE2018253A1/de active Pending
-
1971
- 1971-04-01 NL NL7104391A patent/NL7104391A/xx unknown
- 1971-04-13 BE BE765685A patent/BE765685A/xx unknown
- 1971-04-15 FR FR7113254A patent/FR2086112B1/fr not_active Expired
- 1971-04-15 AT AT319271A patent/AT301717B/de not_active IP Right Cessation
- 1971-04-15 CH CH547271A patent/CH544798A/de not_active IP Right Cessation
- 1971-04-15 DD DD15444871A patent/DD96246A5/xx unknown
- 1971-04-15 ES ES390241A patent/ES390241A1/es not_active Expired
- 1971-04-19 GB GB2714171A patent/GB1293706A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1293706A (en) | 1972-10-25 |
| BE765685A (fr) | 1971-10-13 |
| CH544798A (de) | 1973-11-30 |
| FR2086112A1 (Direct) | 1971-12-31 |
| FR2086112B1 (Direct) | 1975-10-10 |
| SU383306A3 (Direct) | 1973-05-25 |
| DD96246A5 (Direct) | 1973-03-12 |
| NL7104391A (Direct) | 1971-10-19 |
| ES390241A1 (es) | 1974-03-16 |
| AT301717B (de) | 1972-09-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1295115B (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| EP2113011A2 (de) | Dispersionsfarbstoffe, ihre herstellung und ihre verwendung | |
| DE2833854C2 (de) | Neue marineblaue Dispersionsfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung zum Färben oder Bedrucken von synthetischen Fasermaterialien | |
| DE2925542A1 (de) | Azoverbindungen, verfahren zu ihrer herstellung und verwendung | |
| DE1644343B2 (de) | Dispersions-Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2433260C3 (de) | In Wasser schwer lösliche Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken | |
| DE2347532B1 (de) | Monoazopigmente,Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2018253A1 (de) | Disazofarbstoffe | |
| DE2935974A1 (de) | Disazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2434207C2 (de) | In Wasser schwer lösliche Monoazoverbindungen, ihre Herstellung und Verwendung | |
| DE2623251A1 (de) | Disperse monoazofarbstoffe | |
| DE2702627A1 (de) | Monoazofarbstoffe | |
| DE3201268A1 (de) | Benzisothiazolazofarbstoffe | |
| DE1153840B (de) | Verfahren zur Herstellung wasserunloeslicher Azofarbstoffe | |
| DE1197562B (de) | Verfahren zur Herstellung von Diazapolymethin-farbstoffen | |
| DE1644327A1 (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE2116315B2 (de) | Monoazofarbstoffe, Verfahren zu ihrer Herstellung und Verwendung | |
| DE1644166C3 (de) | Wasserunlösliche Monoazofarbstoffe und Verfahren zu ihrer Herstellung | |
| DE2212755A1 (de) | Wasserunloesliche monoazofarbstoffe und verfahren zu ihrer herstellung | |
| AT237152B (de) | Verfahren zur Herstellung von neuen wasserunlöslichen Monoazofarbstoffen | |
| AT232623B (de) | Verfahren zur Herstellung von neuen Diazapolymethinfarbstoffen | |
| AT249212B (de) | Verfahren zur Herstellung von neuen wasserunlöslichen 4-Nitro-4'-dialkylamino-1,1'-azobenzolen | |
| AT277411B (de) | Herstellung von neuen, in wasser schwerloeslichen azofarbstoffen | |
| DE645423C (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE1644167C3 (Direct) |