DE2007844A1 - Azomethin Metallkomplexfarbstoffe - Google Patents
Azomethin MetallkomplexfarbstoffeInfo
- Publication number
- DE2007844A1 DE2007844A1 DE19702007844 DE2007844A DE2007844A1 DE 2007844 A1 DE2007844 A1 DE 2007844A1 DE 19702007844 DE19702007844 DE 19702007844 DE 2007844 A DE2007844 A DE 2007844A DE 2007844 A1 DE2007844 A1 DE 2007844A1
- Authority
- DE
- Germany
- Prior art keywords
- parts
- radical
- formulas
- denotes
- metal complex
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000434 metal complex dye Substances 0.000 title claims description 4
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 5
- 229910052725 zinc Inorganic materials 0.000 claims description 5
- 239000011701 zinc Substances 0.000 claims description 5
- NTCCNERMXRIPTR-UHFFFAOYSA-N 2-hydroxy-1-naphthaldehyde Chemical compound C1=CC=CC2=C(C=O)C(O)=CC=C21 NTCCNERMXRIPTR-UHFFFAOYSA-N 0.000 claims description 4
- 239000000976 ink Substances 0.000 claims description 4
- 150000002815 nickel Chemical group 0.000 claims description 4
- 229910052759 nickel Inorganic materials 0.000 claims description 4
- 238000007639 printing Methods 0.000 claims description 4
- 238000004040 coloring Methods 0.000 claims description 3
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical class NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 claims description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 229910052793 cadmium Inorganic materials 0.000 claims description 2
- 125000005521 carbonamide group Chemical group 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 229910017052 cobalt Inorganic materials 0.000 claims description 2
- 239000010941 cobalt Substances 0.000 claims description 2
- 229910052802 copper Inorganic materials 0.000 claims description 2
- 239000010949 copper Substances 0.000 claims description 2
- 239000000975 dye Substances 0.000 claims description 2
- 229910052736 halogen Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 239000004033 plastic Substances 0.000 claims description 2
- 229920003023 plastic Polymers 0.000 claims description 2
- 229940124530 sulfonamide Drugs 0.000 claims description 2
- 150000003456 sulfonamides Chemical group 0.000 claims description 2
- PBHRBFFOJOXGPU-UHFFFAOYSA-N cadmium Chemical compound [Cd].[Cd] PBHRBFFOJOXGPU-UHFFFAOYSA-N 0.000 claims 1
- SFJBWZNTPHYOEH-UHFFFAOYSA-N cobalt Chemical compound [Co].[Co].[Co] SFJBWZNTPHYOEH-UHFFFAOYSA-N 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 239000003973 paint Substances 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 20
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 229960000583 acetic acid Drugs 0.000 description 10
- 239000012362 glacial acetic acid Substances 0.000 description 10
- 239000000049 pigment Substances 0.000 description 9
- -1 ethylphenyl Chemical group 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- MQRWBMAEBQOWAF-UHFFFAOYSA-N acetic acid;nickel Chemical compound [Ni].CC(O)=O.CC(O)=O MQRWBMAEBQOWAF-UHFFFAOYSA-N 0.000 description 5
- 229940078494 nickel acetate Drugs 0.000 description 5
- 239000004925 Acrylic resin Substances 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- 239000007868 Raney catalyst Substances 0.000 description 3
- 229910000564 Raney nickel Inorganic materials 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 239000004922 lacquer Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000001054 red pigment Substances 0.000 description 3
- 239000002966 varnish Substances 0.000 description 3
- IGTULARHZSSSOB-UHFFFAOYSA-N (2-nitrophenyl)sulfamic acid Chemical compound OS(=O)(=O)NC1=C(C=CC=C1)[N+]([O-])=O IGTULARHZSSSOB-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- XDDFMQJPLRZESJ-UHFFFAOYSA-N (2-nitrophenyl)carbamic acid Chemical compound OC(=O)NC1=CC=CC=C1[N+]([O-])=O XDDFMQJPLRZESJ-UHFFFAOYSA-N 0.000 description 1
- NBEFEBNDQFWRGM-UHFFFAOYSA-N (4-amino-3-nitrophenyl)sulfonylurea Chemical compound [N+](=O)([O-])C=1C=C(C=CC1N)S(=O)(=O)NC(=O)N NBEFEBNDQFWRGM-UHFFFAOYSA-N 0.000 description 1
- 239000004640 Melamine resin Substances 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 1
- 229910010413 TiO 2 Inorganic materials 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000004799 bromophenyl group Chemical group 0.000 description 1
- 239000001058 brown pigment Substances 0.000 description 1
- RDVQTQJAUFDLFA-UHFFFAOYSA-N cadmium Chemical compound [Cd][Cd][Cd][Cd][Cd][Cd][Cd][Cd][Cd] RDVQTQJAUFDLFA-UHFFFAOYSA-N 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- GSOLWAFGMNOBSY-UHFFFAOYSA-N cobalt Chemical compound [Co][Co][Co][Co][Co][Co][Co][Co] GSOLWAFGMNOBSY-UHFFFAOYSA-N 0.000 description 1
- 125000005805 dimethoxy phenyl group Chemical group 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000007644 letterpress printing Methods 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000004987 o-phenylenediamines Chemical class 0.000 description 1
- 238000007645 offset printing Methods 0.000 description 1
- 239000001053 orange pigment Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 239000001052 yellow pigment Substances 0.000 description 1
- 239000004246 zinc acetate Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B55/00—Azomethine dyes
- C09B55/005—Disazomethine dyes
- C09B55/007—Disazomethine dyes containing only carbocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inks, Pencil-Leads, Or Crayons (AREA)
Priority Applications (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702007844 DE2007844A1 (de) | 1970-02-20 | 1970-02-20 | Azomethin Metallkomplexfarbstoffe |
| CH125471A CH532643A (de) | 1970-02-20 | 1971-01-28 | Verfahren zur Herstellung von Azomethin-Metallkomplexfarbstoffen |
| US115829A US3687991A (en) | 1970-02-20 | 1971-02-16 | Azomethine metal complex dyes |
| FR7105524A FR2078761A5 (cg-RX-API-DMAC7.html) | 1970-02-20 | 1971-02-18 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702007844 DE2007844A1 (de) | 1970-02-20 | 1970-02-20 | Azomethin Metallkomplexfarbstoffe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2007844A1 true DE2007844A1 (de) | 1971-08-26 |
Family
ID=5762835
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702007844 Pending DE2007844A1 (de) | 1970-02-20 | 1970-02-20 | Azomethin Metallkomplexfarbstoffe |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3687991A (cg-RX-API-DMAC7.html) |
| CH (1) | CH532643A (cg-RX-API-DMAC7.html) |
| DE (1) | DE2007844A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2078761A5 (cg-RX-API-DMAC7.html) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH562301A5 (cg-RX-API-DMAC7.html) * | 1971-12-13 | 1975-05-30 | Ciba Geigy Ag | |
| US4038241A (en) * | 1972-02-24 | 1977-07-26 | Ciba-Geigy Corporation | Polymer compositions containing a bisazomethine pigment |
| BE795836A (fr) * | 1972-02-24 | 1973-08-23 | Ciba Geigy | Pigment bis-azomethinique et sa preparation |
| GB1413511A (en) * | 1972-03-20 | 1975-11-12 | Ciba Geigy Ag | Metallised bisazomethine pigments |
| US3939194A (en) * | 1972-06-19 | 1976-02-17 | Ciba-Geigy Corporation | Bis-2-azomethine pigments, process for their manufacture and their use |
| CH568368A5 (cg-RX-API-DMAC7.html) * | 1972-06-19 | 1975-10-31 | Ciba Geigy Ag | |
| US3903118A (en) * | 1972-12-08 | 1975-09-02 | Du Pont | Schiff bases derived from phenanthrene-9,10-diamines and orthohydroxy aldehydes |
| US3928328A (en) * | 1972-12-08 | 1975-12-23 | Du Pont | Schiff base and metal bisazomethine metal chelate |
| CH596276A5 (cg-RX-API-DMAC7.html) * | 1974-07-31 | 1978-03-15 | Ciba Geigy Ag | |
| US3980640A (en) * | 1974-12-20 | 1976-09-14 | E. I. Du Pont De Nemours And Company | Schiff bases derived from phenanthrene-9,10-diamines and ortho-hydroxy aldehydes |
| DE2460490A1 (de) * | 1974-12-20 | 1976-07-01 | Hoechst Ag | Wasserunloesliche disazomethinverbindungen, verfahren zu ihrer herstellung und ihre verwendung |
| US4113759A (en) * | 1975-07-30 | 1978-09-12 | Hoechst Aktiengesellschaft | Metal-containing disazomethine compounds, process for preparing them and their use as colorants |
| GB1564231A (en) * | 1977-05-31 | 1980-04-02 | Ciba Geigy Ag | Process for the production of a bisazomethine pigment |
| DE3302498A1 (de) * | 1983-01-26 | 1984-07-26 | Basf Ag, 6700 Ludwigshafen | Verbessertes verfahren zur herstellung von salcomin sowie die herstellung von trimethyl-p-benzochinon aus trimethylphenol unter verwendung des so hergestellten salcomins |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2405886A (en) * | 1942-05-02 | 1946-08-13 | Wingfoot Corp | New products |
| US2993065A (en) * | 1956-10-24 | 1961-07-18 | Interchem Corp | Pigment and method of preparing same |
| FR1469573A (fr) * | 1966-01-04 | 1967-02-17 | Kuhlmann Ets | Pigments azométhiniques métallifères |
| US3441578A (en) * | 1967-05-02 | 1969-04-29 | Basf Ag | Pigments comprising metal derivatives of complex schiff's bases |
-
1970
- 1970-02-20 DE DE19702007844 patent/DE2007844A1/de active Pending
-
1971
- 1971-01-28 CH CH125471A patent/CH532643A/de not_active IP Right Cessation
- 1971-02-16 US US115829A patent/US3687991A/en not_active Expired - Lifetime
- 1971-02-18 FR FR7105524A patent/FR2078761A5/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3687991A (en) | 1972-08-29 |
| FR2078761A5 (cg-RX-API-DMAC7.html) | 1971-11-05 |
| CH532643A (de) | 1973-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2007844A1 (de) | Azomethin Metallkomplexfarbstoffe | |
| DE2515523C3 (de) | Wasserunlösliche Disazomethinverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbmittel | |
| US3923774A (en) | Quinazolone containing phenyl-azo-pyridine compounds | |
| DE2025111A1 (de) | Substituierte Azomethinverbindungen | |
| DE1227585B (de) | Verfahren zur Herstellung von wasserunloeslichen Monoazofarbstoffen | |
| DE2008938A1 (en) | Azomethine-metal complex pigment dyes | |
| DE2239445C3 (de) | Kationische Pyrazolfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2401597A1 (de) | Azoarylamide enthaltende pigmentzusammensetzungen | |
| DE2111734B2 (de) | Azofarbstoffe und ihre Verwendung | |
| DE2025429A1 (en) | Bis-azomethine pigment dyes - giving yellow to red shades of good - fastness esp to light and solvents | |
| DE2010492C3 (de) | Verfahren zur Färbung von Fasern auf Acrylnitrilpolymerisat- oder -mischpolymerisatbasis | |
| DE1279257B (de) | Verfahren zur Herstellung von Pigmentfarbstoffen | |
| DE2544568C3 (de) | Sulfonsäuregruppenfreie Azofarbstoffe, Verfahren zu ihrer Herstellung und deren Verwendung als Pigmente in Lacken, Druckfarben oder Kunststoffen | |
| DE2212755A1 (de) | Wasserunloesliche monoazofarbstoffe und verfahren zu ihrer herstellung | |
| DE3230768C2 (cg-RX-API-DMAC7.html) | ||
| DE2119745C3 (de) | Monoazofarbstoffe, ein Verfahren zu ihrer Herstellung sowie ihre Verwendung zum Färben von Fasern | |
| DE3642856A1 (de) | Isoindolin-metallkomplexe | |
| DE2435921A1 (de) | Azopyrazoliumfarbstoffe, verfahren zu ihrer herstellung und ihre verwendung | |
| DE1801328B2 (de) | Mono- und Disazoverbindungen, Verfahren zu ihrer Herstellung und sie enthaltende Farbstoffpräparate | |
| DE3229953A1 (de) | Pigmentfarbstoffe der pyrazolonreihe | |
| DE2631669A1 (de) | Azo-benzothiazoliumfarbstoffe, verfahren zu ihrer herstellung und deren verwendung | |
| DE2025428A1 (en) | Metal complex pigment dyes - from 1,2,4,5- tetramino - benzene deriv and 2-hydroxy 3-formyl 4-methyl pyridone-(6) derivs | |
| DE977257C (de) | Verfahren zur Herstellung von wasserunloeslichen Disazofarbstoffen | |
| DE2643639A1 (de) | Kationische farbstoffe, verfahren zu ihrer herstellung und ihre verwendung | |
| DE1544404C (de) | Pigmentfarbstoffe und ihre Herstel lung |