DE1960684A1 - Gedaempfter Ski und Verfahren zur Herstellung desselben - Google Patents
Gedaempfter Ski und Verfahren zur Herstellung desselbenInfo
- Publication number
- DE1960684A1 DE1960684A1 DE19691960684 DE1960684A DE1960684A1 DE 1960684 A1 DE1960684 A1 DE 1960684A1 DE 19691960684 DE19691960684 DE 19691960684 DE 1960684 A DE1960684 A DE 1960684A DE 1960684 A1 DE1960684 A1 DE 1960684A1
- Authority
- DE
- Germany
- Prior art keywords
- ski
- layer
- range
- skis
- viscoelastic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000004519 manufacturing process Methods 0.000 title description 4
- 238000013016 damping Methods 0.000 claims description 17
- 229910052782 aluminium Inorganic materials 0.000 claims description 11
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 11
- 239000000463 material Substances 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 5
- 230000009477 glass transition Effects 0.000 claims description 4
- 230000027455 binding Effects 0.000 claims 1
- 238000009739 binding Methods 0.000 claims 1
- 238000012360 testing method Methods 0.000 description 10
- 239000011248 coating agent Substances 0.000 description 9
- 238000000576 coating method Methods 0.000 description 9
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- 229920001577 copolymer Polymers 0.000 description 6
- 239000003190 viscoelastic substance Substances 0.000 description 6
- 238000010276 construction Methods 0.000 description 5
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 4
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 3
- 239000000853 adhesive Substances 0.000 description 3
- 230000001070 adhesive effect Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000006872 improvement Effects 0.000 description 3
- 229920006267 polyester film Polymers 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 2
- 229920000297 Rayon Polymers 0.000 description 2
- 125000005250 alkyl acrylate group Chemical group 0.000 description 2
- 238000013461 design Methods 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- 229910000853 7075 T6 aluminium alloy Inorganic materials 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- 229920002367 Polyisobutene Polymers 0.000 description 1
- 239000004820 Pressure-sensitive adhesive Substances 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 241001122767 Theaceae Species 0.000 description 1
- 101710205907 Urotensin-2 receptor Proteins 0.000 description 1
- ATMLPEJAVWINOF-UHFFFAOYSA-N acrylic acid acrylic acid Chemical compound OC(=O)C=C.OC(=O)C=C ATMLPEJAVWINOF-UHFFFAOYSA-N 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000002788 crimping Methods 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 239000002655 kraft paper Substances 0.000 description 1
- 238000003475 lamination Methods 0.000 description 1
- 230000000873 masking effect Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- RZSCFTDHFNHMOR-UHFFFAOYSA-N n-(2,4-difluorophenyl)-2-[3-(trifluoromethyl)phenoxy]pyridine-3-carboxamide;1,1-dimethyl-3-(4-propan-2-ylphenyl)urea Chemical compound CC(C)C1=CC=C(NC(=O)N(C)C)C=C1.FC1=CC(F)=CC=C1NC(=O)C1=CC=CN=C1OC1=CC=CC(C(F)(F)F)=C1 RZSCFTDHFNHMOR-UHFFFAOYSA-N 0.000 description 1
- 230000010355 oscillation Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- -1 polyethylene terephthalate Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 239000002990 reinforced plastic Substances 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 238000002255 vaccination Methods 0.000 description 1
- 229940006076 viscoelastic substance Drugs 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63C—SKATES; SKIS; ROLLER SKATES; DESIGN OR LAYOUT OF COURTS, RINKS OR THE LIKE
- A63C5/00—Skis or snowboards
- A63C5/12—Making thereof; Selection of particular materials
- A63C5/122—Selection of particular materials for damping purposes, e.g. rubber or the like
Landscapes
- Laminated Bodies (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US78008868A | 1968-11-29 | 1968-11-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1960684A1 true DE1960684A1 (de) | 1970-06-18 |
Family
ID=25118558
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691960684 Pending DE1960684A1 (de) | 1968-11-29 | 1969-11-28 | Gedaempfter Ski und Verfahren zur Herstellung desselben |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3537717A (enExample) |
| JP (1) | JPS4932377B1 (enExample) |
| CH (1) | CH525012A (enExample) |
| DE (1) | DE1960684A1 (enExample) |
| FR (1) | FR2024542A1 (enExample) |
Cited By (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2461889A1 (de) * | 1974-12-20 | 1976-07-08 | Fusaji Arai | Ski |
| US4154457A (en) * | 1977-03-04 | 1979-05-15 | Fritzmeier Ag | Ski with weight attachment |
| FR2534479A1 (fr) * | 1982-10-19 | 1984-04-20 | Caber Italia | Ski a surface superieure anti-vibrations et anti-glissante |
| FR2575393A1 (fr) * | 1984-12-27 | 1986-07-04 | Rossignol Sa | Ski de neige |
| DE3527996A1 (de) * | 1985-08-03 | 1987-04-09 | Mankau Dieter | Ski mit ausgleichselementen |
| DE3825188A1 (de) * | 1987-08-18 | 1989-03-02 | Blizzard Oesterreich Ges M B H | Ski |
| DE3919010A1 (de) * | 1988-07-18 | 1990-01-25 | Fischer Gmbh | Skipaar, insbesondere alpinskipaar |
| FR2638649A1 (fr) * | 1988-11-07 | 1990-05-11 | Salomon Sa | Ski muni de masses d'inertie laterales |
| DE3840553A1 (de) * | 1988-12-01 | 1990-06-07 | Blizzard Gmbh | Ski mit einem daempfungselement |
| EP0441971A4 (en) * | 1989-08-28 | 1992-09-30 | Toray Industries, Inc. | Sporting goods and shock absorbing material used by being fitted to the sporting goods |
| US5203583A (en) * | 1988-11-07 | 1993-04-20 | Salomon S.A. | Ski furnished with front masses of inertia |
| AT395946B (de) * | 1988-12-23 | 1993-04-26 | Tyrolia Freizeitgeraete | Skibindung |
| US5421574A (en) * | 1989-08-28 | 1995-06-06 | Toray Industries, Inc. | Sports instrument and impact-absorbing element to be attached to sports instrument |
| AT402157B (de) * | 1990-08-07 | 1997-02-25 | Varpat Patentverwertung | Plattenförmige dämpfungseinrichtung für eine schibindung |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3901522A (en) * | 1973-07-18 | 1975-08-26 | Olin Corp | Vibration damped ski |
| DE2434423C3 (de) * | 1973-07-18 | 1981-10-08 | Olin Corp., 06511 New Haven, Conn. | Schwingungsgedämpfter Ski |
| US3844576A (en) * | 1973-07-18 | 1974-10-29 | Olin Corp | Vibration damped ski |
| US4293142A (en) * | 1979-07-16 | 1981-10-06 | K-2 Corporation | Vibration damped ski |
| FR2476495A1 (fr) * | 1980-02-21 | 1981-08-28 | Rossignol Sa | Ski |
| FR2503569A1 (fr) * | 1981-04-09 | 1982-10-15 | Rossignol Sa | Ski |
| FR2527460B1 (fr) * | 1982-05-27 | 1986-07-04 | Dynamic | Perfectionnement aux skis du type a noyau en matiere synthetique cellulaire |
| DE3378022D1 (en) * | 1982-06-11 | 1988-10-27 | Dynastar Skis Sa | Ski provided with a vibration damping device |
| US4627635A (en) * | 1983-09-20 | 1986-12-09 | Koleda Michael T | Vibration damping units and vibration damped products |
| US4577886A (en) * | 1984-07-26 | 1986-03-25 | Chernega John O | Adjustable flex ski |
| US4696487A (en) * | 1985-10-07 | 1987-09-29 | Girard Donald A | Ski which is stiff in torsion and relatively weak in beam |
| US4639009A (en) * | 1985-12-30 | 1987-01-27 | Olin Corporation | Snow ski with elastomeric sidewalls |
| FR2611518B1 (fr) * | 1987-02-27 | 1989-11-17 | Salomon Sa | Ski a amortissement reparti |
| FR2620628B2 (fr) * | 1987-02-27 | 1994-08-19 | Salomon Sa | Procede pour realiser un ski et ski fait selon ce procede |
| US4895388A (en) * | 1988-05-17 | 1990-01-23 | Richmond William D | Pair of skis |
| FR2638651B1 (fr) * | 1988-11-04 | 1991-02-01 | Salomon Sa | Dispositif amortisseur de chocs et vibrations entre un ski et la fixation de la chaussure |
| FR2665081B1 (fr) * | 1990-07-30 | 1992-11-06 | Rossignol Sa | Surf de neige a caracteristiques asymetriques. |
| US5118562A (en) * | 1990-09-24 | 1992-06-02 | Minnesota Mining And Manufacturing Co. | Vibration damper having extended temperature range and low temperature shock resistance |
| FR2684011B1 (fr) * | 1991-11-25 | 1994-01-07 | Rossignol Sa Skis | Planche de glisse pourvue d'un dispositif d'amortissement des vibrations. |
| US5409229A (en) * | 1992-08-05 | 1995-04-25 | Callaway Golf Company | Golf club head with audible vibration attenuation |
| AT398381B (de) | 1993-02-23 | 1994-11-25 | Tyrolia Freizeitgeraete | Schwingungsdämpfungseinrichtung |
| US6113113A (en) * | 1994-04-08 | 2000-09-05 | Robert J. Harrington | Sliding apparatus having adjustable flexion and torsion characteristics |
| US6095547A (en) * | 1995-08-01 | 2000-08-01 | K-2 Corporation | Active piezoelectric damper for a snow ski or snowboard |
| US5775715A (en) * | 1995-08-01 | 1998-07-07 | K-2 Corporation | Piezoelectric damper for a board such as a snow ski or snowboard |
| WO1997011751A1 (en) * | 1995-09-26 | 1997-04-03 | Floreani, Richard | Sliding device dampener |
| FR2741814B1 (fr) * | 1995-12-04 | 1998-02-13 | Salomon Sa | Dispositif d'amortissement pour planche de glisse |
| US5984343A (en) * | 1997-04-08 | 1999-11-16 | Robert J. Harrington | Sliding apparatus having adjustable flexion and torsion characteristics |
| FR2834906B1 (fr) * | 2002-01-24 | 2004-04-02 | Rossignol Sa | Perfectionnement pour planche de glisse sur neige |
| FR2854333B1 (fr) * | 2003-04-30 | 2005-07-22 | Rossignol Sa | Perfectionnement pour planche de glisse sur neige |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB532059A (en) * | 1939-06-17 | 1941-01-16 | Hanns Klemm | Ski with metal facings on the running surface |
| US2995379A (en) * | 1958-12-30 | 1961-08-08 | Head Howard | Ski |
| AT242037B (de) * | 1960-12-07 | 1965-08-25 | Josef Fischer | Mehrschichtenski |
| US3300226A (en) * | 1964-09-28 | 1967-01-24 | Jr Charles L Reed | Ski construction and method for varying the flexibility thereof |
| US3475035A (en) * | 1967-02-17 | 1969-10-28 | Mobay Chemical Corp | Polycarbonate plastic skis |
-
1968
- 1968-11-29 US US780088A patent/US3537717A/en not_active Expired - Lifetime
-
1969
- 1969-11-28 FR FR6941091A patent/FR2024542A1/fr not_active Withdrawn
- 1969-11-28 DE DE19691960684 patent/DE1960684A1/de active Pending
- 1969-11-28 CH CH1780769A patent/CH525012A/de not_active IP Right Cessation
- 1969-11-28 JP JP44095139A patent/JPS4932377B1/ja active Pending
Cited By (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2461889A1 (de) * | 1974-12-20 | 1976-07-08 | Fusaji Arai | Ski |
| US4154457A (en) * | 1977-03-04 | 1979-05-15 | Fritzmeier Ag | Ski with weight attachment |
| FR2534479A1 (fr) * | 1982-10-19 | 1984-04-20 | Caber Italia | Ski a surface superieure anti-vibrations et anti-glissante |
| FR2575393A1 (fr) * | 1984-12-27 | 1986-07-04 | Rossignol Sa | Ski de neige |
| EP0188985A1 (fr) * | 1984-12-27 | 1986-07-30 | Skis Rossignol S.A. | Ski de neige |
| DE3527996A1 (de) * | 1985-08-03 | 1987-04-09 | Mankau Dieter | Ski mit ausgleichselementen |
| DE3825188A1 (de) * | 1987-08-18 | 1989-03-02 | Blizzard Oesterreich Ges M B H | Ski |
| DE3919010A1 (de) * | 1988-07-18 | 1990-01-25 | Fischer Gmbh | Skipaar, insbesondere alpinskipaar |
| FR2638649A1 (fr) * | 1988-11-07 | 1990-05-11 | Salomon Sa | Ski muni de masses d'inertie laterales |
| EP0370197A1 (fr) * | 1988-11-07 | 1990-05-30 | Salomon S.A. | Ski muni de masses d'inertie latérales |
| US5203583A (en) * | 1988-11-07 | 1993-04-20 | Salomon S.A. | Ski furnished with front masses of inertia |
| DE3840553A1 (de) * | 1988-12-01 | 1990-06-07 | Blizzard Gmbh | Ski mit einem daempfungselement |
| US5035442A (en) * | 1988-12-01 | 1991-07-30 | Blizzard Ges. M.B.H. | Ski with a damping element |
| AT397348B (de) * | 1988-12-01 | 1994-03-25 | Blizzard Gmbh | Ski |
| AT395946B (de) * | 1988-12-23 | 1993-04-26 | Tyrolia Freizeitgeraete | Skibindung |
| EP0441971A4 (en) * | 1989-08-28 | 1992-09-30 | Toray Industries, Inc. | Sporting goods and shock absorbing material used by being fitted to the sporting goods |
| US5421574A (en) * | 1989-08-28 | 1995-06-06 | Toray Industries, Inc. | Sports instrument and impact-absorbing element to be attached to sports instrument |
| AT402157B (de) * | 1990-08-07 | 1997-02-25 | Varpat Patentverwertung | Plattenförmige dämpfungseinrichtung für eine schibindung |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2024542A1 (enExample) | 1970-08-28 |
| CH525012A (de) | 1972-07-15 |
| US3537717A (en) | 1970-11-03 |
| JPS4932377B1 (enExample) | 1974-08-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1960684A1 (de) | Gedaempfter Ski und Verfahren zur Herstellung desselben | |
| AT397600B (de) | Sporthandschuh, insbesondere torwarthandschuh | |
| EP0161515B1 (de) | Griffbänder auf der Basis von mit Kunststoff beschichteten Trägermaterialien | |
| DE69417073T2 (de) | Hockeyschläger | |
| DE2264627A1 (de) | Gliederkante fuer einen ski, bei der die federkonstante laengs der gliederkante veraenderlich ist | |
| DE817713C (de) | Schneeschuh | |
| AT393458B (de) | Verfahren zum herstellen von laufflaechenbelaegen fuer skier, laufflaechenbauteil fuer alpinskier sowieski mit einem laufflaechenbelag | |
| DE69819664T2 (de) | Kern für Snowboard | |
| DE60304032T2 (de) | Möbelspanplatte | |
| DE8808330U1 (de) | Schlagblatt für Ballspiele | |
| DE2850550A1 (de) | Umlaufende trennscheibe sowie verfahren zur herabsetzung ihrer schwingungen | |
| DE3321343A1 (de) | Fangballspiel | |
| DE2135278A1 (de) | Leichtski | |
| AT366583B (de) | Kunststoffski in kassettenbauweise und verfahren zu seiner herstellung | |
| DE10134168A1 (de) | Griffband für Ballspielschläger | |
| DE2656587C2 (de) | Ski mit einem Holzkern | |
| AT208483B (de) | Verfahren zum Belegen fester Gegenstände mit fest haftender Kunststoff-Auflage | |
| DE2351285A1 (de) | Ski mit mehrteiligem kern | |
| DE2637228A1 (de) | Blattkonstruktion bei einem schlaeger fuer eishockey o.dgl. | |
| CH570811A5 (en) | Laminated material for covering skis - with base and running face layers of low-high pressure polyethylenes, respectively | |
| DE8913440U1 (de) | Ski | |
| DE1728175A1 (de) | Masshaltige Hartholzplatte | |
| DE2459162A1 (de) | Verwendung eines kunststoffes als schnee-ersatz | |
| AT276177B (de) | Ski | |
| DE3107681A1 (de) | "tischtennis-probeschlaeger-sammlung" |